
Subversion Repositories hdlc

Compare Revisions

  • This comparison shows the changes necessary to convert path
    from Rev 19 to Rev 18
    Reverse comparison

Rev 19 → Rev 18

/hdlc/web_uploads/hdlc_project.pdf Cannot display: file marked as a binary type. svn:mime-type = application/octet-stream
hdlc/web_uploads/hdlc_project.pdf Property changes : Deleted: svn:mime-type ## -1 +0,0 ## -application/octet-stream \ No newline at end of property Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (revision 19) +++ hdlc/web_uploads/ (nonexistent) @@ -1,5701 +0,0 @@ -%!PS-Adobe-2.0 -%%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software -%%Title: hdlc_project.dvi -%%Pages: 15 -%%PageOrder: Ascend -%%BoundingBox: 0 0 612 792 -%%EndComments -%DVIPSWebPage: ( -%DVIPSCommandLine: dvips hdlc_project.dvi -%DVIPSParameters: dpi=600, compressed -%DVIPSSource: TeX output 2001.04.09:2357 -%%BeginProcSet: -%! -/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S -N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 -mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 -0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ -landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize -mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ -matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round -exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ -statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] -N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin -/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array -/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 -array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N -df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A -definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get -}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} -B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr -1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 -1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx -0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx -sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ -rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp -gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B -/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ -/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ -A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy -get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} -ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp -fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 -{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add -chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ -1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} -forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn -/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put -}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ -bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A -mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ -SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ -userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X -1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 -index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N -/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ -/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) -(LaserWriter 16/600)]{A length product length le{A length product exch 0 -exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse -end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask -grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} -imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round -exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto -fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p -delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} -B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ -p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S -rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end - -%%EndProcSet -%%BeginProcSet: -%! -TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N -/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N -/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N -/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ -/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho -X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B -/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ -/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known -{userdict/md get type/dicttype eq{userdict begin md length 10 add md -maxlength ge{/md md dup length 20 add dict copy def}if end md begin -/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S -atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ -itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll -transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll -curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf -pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} -if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 --1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 -get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip -yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub -neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ -noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop -90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get -neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr -1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr -2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 --1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S -TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ -Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale -}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState -save N userdict maxlength dict begin/magscale true def normalscale -currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts -/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x -psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx -psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub -TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ -psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 -roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath -moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict -begin/SpecialSave save N gsave normalscale currentpoint TR -@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ -CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto -closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx -sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR -}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse -CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury -lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N -/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} -repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N -/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX -currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY -moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X -/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 -1 startangle endangle arc savematrix setmatrix}N end - -%%EndProcSet -TeXDict begin 40258431 52099146 1000 600 600 (hdlc_project.dvi) -@start -%DVIPSBitmapFont: Fa cmsy10 10.95 2 -/Fa 2 16 df<0060166000F816F06C1501007E15036CED07E06C6CEC0FC06C6CEC1F806C -6CEC3F006C6C147E6C6C5C6C6C495A017E495A6D495A6D6C485A6D6C485A6D6C48C7FC90 -3803F07E6D6C5A903800FDF8EC7FF06E5A6E5AA24A7E4A7EECFDF8903801F8FC903803F0 -7E49487E49486C7E49486C7E49486C7E017E6D7E496D7E48486D7E4848147E4848804848 -EC1F804848EC0FC048C8EA07E0007EED03F0481501481500006016602C2C73AC47>2 -D15 -D E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Fb cmbx12 12 48 -/Fb 48 123 df12 D44 D46 D49 -DII<163FA25E5E5D5DA25D5D5D5D -A25D92B5FCEC01F7EC03E7140715C7EC0F87EC1F07143E147E147C14F8EB01F0EB03E013 -0714C0EB0F80EB1F00133E5BA25B485A485A485A120F5B48C7FC123E5A12FCB91280A5C8 -000F90C7FCAC027FB61280A531417DC038>I<0007150301E0143F01FFEB07FF91B6FC5E -5E5E5E5E16804BC7FC5D15E092C8FC01C0C9FCAAEC3FF001C1B5FC01C714C001DF14F090 -39FFE03FFC9138000FFE01FC6D7E01F06D13804915C0497F6C4815E0C8FC6F13F0A317F8 -A4EA0F80EA3FE0487E12FF7FA317F05B5D6C4815E05B007EC74813C0123E003F4A1380D8 -1FC0491300D80FF0495AD807FEEBFFFC6CB612F0C65D013F1480010F01FCC7FC010113C0 -2D427BC038>I<4AB47E021F13F0027F13FC49B6FC01079038807F8090390FFC001FD93F -F014C04948137F4948EBFFE048495A5A1400485A120FA248486D13C0EE7F80EE1E00003F -92C7FCA25B127FA2EC07FC91381FFF8000FF017F13E091B512F89039F9F01FFC9039FBC0 -07FE9039FF8003FF17804A6C13C05B6F13E0A24915F0A317F85BA4127FA5123FA217F07F -121FA2000F4A13E0A26C6C15C06D4913806C018014006C6D485A6C9038E01FFC6DB55A01 -1F5C010714C0010191C7FC9038003FF02D427BC038>I<121E121F13FC90B712FEA45A17 -FC17F817F017E017C0A2481680007EC8EA3F00007C157E5E00785D15014B5A00F84A5A48 -4A5A5E151FC848C7FC157E5DA24A5A14035D14074A5AA2141F5D143FA2147F5D14FFA25B -A35B92C8FCA35BA55BAA6D5A6D5A6D5A2F447AC238>I -II67 DIII73 D77 -D<923807FFC092B512FE0207ECFFC0021F15F091267FFE0013FC902601FFF0EB1FFF0107 -0180010313C04990C76C7FD91FFC6E6C7E49486F7E49486F7E01FF8348496F7E48496F13 -80A248496F13C0A24890C96C13E0A24819F04982003F19F8A3007F19FC49177FA400FF19 -FEAD007F19FC6D17FFA3003F19F8A26D5E6C19F0A26E5D6C19E0A26C6D4B13C06C19806E -5D6C6D4B13006C6D4B5A6D6C4B5A6D6C4B5A6D6C4A5B6D01C001075B6D01F0011F5B0101 -01FE90B5C7FC6D90B65A023F15F8020715C002004AC8FC030713C047467AC454>79 -D82 -DI<003FBA12E0A59026FE000FEB -8003D87FE09338003FF049171F90C71607A2007E1803007C1801A300781800A400F819F8 -481978A5C81700B3B3A20107B8FCA545437CC24E>I86 -D<903801FFE0011F13FE017F6D7E48B612E03A03FE007FF84848EB1FFC6D6D7E486C6D7E -A26F7FA36F7F6C5A6C5AEA00F090C7FCA40203B5FC91B6FC1307013F13F19038FFFC0100 -0313E0000F1380381FFE00485A5B127F5B12FF5BA35DA26D5B6C6C5B4B13F0D83FFE013E -EBFFC03A1FFF80FC7F0007EBFFF86CECE01FC66CEB8007D90FFCC9FC322F7DAD36>97 -DIIIIIII<137C48 -B4FC4813804813C0A24813E0A56C13C0A26C13806C1300EA007C90C7FCAAEB7FC0EA7FFF -A512037EB3AFB6FCA518467CC520>IIII<90277F -8007FEEC0FFCB590263FFFC090387FFF8092B5D8F001B512E002816E4880913D87F01FFC -0FE03FF8913D8FC00FFE1F801FFC0003D99F009026FF3E007F6C019E6D013C130F02BC5D -02F86D496D7EA24A5D4A5DA34A5DB3A7B60081B60003B512FEA5572D7CAC5E>I<90397F -8007FEB590383FFF8092B512E0028114F8913987F03FFC91388F801F000390399F000FFE -6C139E14BC02F86D7E5CA25CA35CB3A7B60083B512FEA5372D7CAC3E>II<90397FC00FF8B590B57E02C314E002CF14 -F89139DFC03FFC9139FF001FFE000301FCEB07FF6C496D13804A15C04A6D13E05C7013F0 -A2EF7FF8A4EF3FFCACEF7FF8A318F017FFA24C13E06E15C06E5B6E4913806E4913006E49 -5A9139DFC07FFC02CFB512F002C314C002C091C7FCED1FF092C9FCADB67EA536407DAC3E ->II<90387F807F -B53881FFE0028313F0028F13F8ED8FFC91389F1FFE000313BE6C13BC14F8A214F0ED0FFC -9138E007F8ED01E092C7FCA35CB3A5B612E0A5272D7DAC2E>I<90391FFC038090B51287 -000314FF120F381FF003383FC00049133F48C7121F127E00FE140FA215077EA27F01E090 -C7FC13FE387FFFF014FF6C14C015F06C14FC6C800003806C15806C7E010F14C0EB003F02 -0313E0140000F0143FA26C141F150FA27EA26C15C06C141FA26DEB3F8001E0EB7F009038 -F803FE90B55A00FC5CD8F03F13E026E007FEC7FC232F7CAD2C>IIII120 -DI<001FB71280A49026FC001F130001E0 -495A5B49495A90C7485A48495B123E4A5B4A5B003C495BA24A90C7FC4A5A4A5AC7FC4A5A -495B495BA2495B499038800780491300A2495A4948130F49481400A2485B48495B485BA2 -48495B4890C75A48485C15034848EB1FFEB7FCA4292C7DAB32>I -E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Fc cmbx12 14.4 37 -/Fc 37 120 df12 D<157815FC14031407141F14FF130F0007B5FCB6FCA2147F13 -F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>49 DI<91380FFFC091B512FC0107ECFF80011F15E090263FF8077F9026FF800113FC4848 -C76C7ED803F86E7E491680D807FC8048B416C080486D15E0A4805CA36C17C06C5B6C90C7 -5AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B5BDBFFFEC7FC91B512F816E016 -FCEEFF80DA000713E0030113F89238007FFE707E7013807013C018E07013F0A218F8A270 -13FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FCA25E18F891C7FC6C17F0495C6C -4816E001F04A13C06C484A1380D80FF84A13006CB44A5A6CD9F0075BC690B612F06D5D01 -1F1580010302FCC7FCD9001F1380374F7ACD43>I<177C17FEA2160116031607160FA216 -1F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C15FCEC01F815F0EC03E01407EC -0FC01580EC1F005C147E147C5C1301495A495A5C495A131F49C7FC133E5B13FC485A5B48 -5A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7FCAF020FB712C0A53A4F7CCE43 ->III<121F7F7FEBFF8091B81280A45A1900606060 -A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F4C5A160F4C5A484B5A4C5A94C8 -FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FFA24A90C9FCA25C5D1407A2140F -A25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC06E5A395279D043>I<913807FF -C0027F13FC0103B67E010F15E090261FFC0113F8903A3FE0003FFCD97F80EB0FFE49C76C -7E48488048486E1380000717C04980120F18E0177FA2121F7FA27F7F6E14FF02E015C014 -F802FE4913806C7FDBC00313009238F007FE6C02F85B9238FE1FF86C9138FFBFF06CEDFF -E017806C4BC7FC6D806D81010F15E06D81010115FC010781011F81491680EBFFE7480181 -15C048D9007F14E04848011F14F048487F48481303030014F8484880161F4848020713FC -1601824848157F173FA2171FA2170FA218F8A27F007F17F06D151FA26C6CED3FE0001F17 -C06D157F6C6CEDFF806C6C6C010313006C01E0EB0FFE6C01FCEBFFFC6C6CB612F06D5D01 -0F1580010102FCC7FCD9000F13C0364F7ACD43>I<932601FFFCEC01C0047FD9FFC01303 -0307B600F81307033F03FE131F92B8EA803F0203DAE003EBC07F020F01FCC7383FF0FF02 -3F01E0EC0FF94A01800203B5FC494848C9FC4901F8824949824949824949824949824990 -CA7E494883A2484983485B1B7F485B481A3FA24849181FA3485B1B0FA25AA298C7FC5CA2 -B5FCAE7EA280A2F307C07EA36C7FA21B0F6C6D1980A26C1A1F6C7F1C006C6D606C6D187E -A26D6C606D6D4C5A6D6D16036D6D4C5A6D6D4C5A6D01FC4C5A6D6DEE7F806D6C6C6C4BC7 -FC6E01E0EC07FE020F01FEEC1FF80203903AFFE001FFF0020091B612C0033F93C8FC0307 -15FCDB007F14E0040101FCC9FC525479D261>67 DI73 D76 -D80 -D82 D<91260FFF80130791B5 -00F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5 -FC4848C87E48488149150F001F824981123F4981007F82A28412FF84A27FA26D82A27F7F -6D93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C83 -6C836D826D82010F821303010082021F16801400030F15C0ED007F040714E01600173F05 -0F13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D -5D01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7 -FC48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC1280A59126C0003F -9038C0007F49C71607D87FF8060113C001E08449197F49193F90C8171FA2007E1A0FA300 -7C1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD05E>I97 D<913801FFF8021FEBFF80 -91B612F0010315FC010F9038C00FFE903A1FFE0001FFD97FFC491380D9FFF05B4817C048 -495B5C5A485BA2486F138091C7FC486F1300705A4892C8FC5BA312FFAD127F7FA27EA2EF -03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC3F006C6D147ED97FFE5C6D6CEB03F8 -010F9038E01FF0010390B55A01001580023F49C7FC020113E033387CB63C>99 -D<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13FC91B6FC010315C7010F9038 -E03FE74990380007F7D97FFC0101B5FC49487F4849143F484980485B83485B5A91C8FC5A -A3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C6D49B5FC6D6C4914E0D9 -3FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9003F13F8020301C049C7 -FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C04901817F903A3FFC007FF849 -486D7E49486D7E4849130F48496D7E48178048497F18C0488191C7FC4817E0A248815B18 -F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01F06E14037E6C6DEC07E0 -A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE903A0FFFC03FF8010390 -B55A010015C0021F49C7FC020113F034387CB63D>II< -DA3FFF14FF0103B5D8F00713C0010FDAFC1F13E0013FECFF7F90267FFC0F9038FF9FF090 -26FFE001EBF83F48496C13E0484990387FF01F4890C7D83FF813E0489338FC0FC0F00780 -48486E6CC7FCA2003F82A9001F5EA26C6C4A5AA26C5E6C6D495A6C6D495A6C6D485BDAFC -0F5B4890B6C8FCD803EF14FC01C314F02607C03F90C9FC91CBFCA2120FA37FA213F813FE -90B7FC6C16F817FF18C06C836C836C836D828448B9FC12074848C700031480D81FF8EC00 -3F4848150748486F13C083485A83A56D5D007F18806D5D003F18006C6C4B5AD80FFEED1F -FC6C6C6CEC7FF86C01E049485A6C01FE011F5B6C6CB71280010F03FCC7FC010115E0D900 -0F01FCC8FC3C4F7CB543>II<137F497E000313E0487FA2487FA7 -6C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3A6B612E0A51B547BD325 ->I<157FEDFF80020313E04A13F0A24A13F8A76E13F0A26E13E002001380ED7F0092C7FC -ADED1FF891B5FCA51401EC007FB3B3B1EA0780EA1FE0487E487E486C13FF16F0A216E05C -16C04A13806C4848130049485A003F495A000FB512F06C5C0001148026001FFCC7FC256C -87D329>I108 -DII<913801FFE0021F13FE91B6 -12C0010315F0010F9038807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F4849 -6D7F4A147F48834890C86C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3 -003F18006D5DA26C5FA26C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE -011F90C7FC903A0FFF807FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I< -903A3FF001FFE0B5010F13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9 -FFE0EB1FFFC602806D7F92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A -0060A36118FFA2615F616E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FB -FE075B02F8B612E06F1480031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I< -90397FE003FEB590380FFF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013 -FEC6ECC07FECE78014EF150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612 -FCA52F367CB537>114 D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307 -D81FE0130148487F4980127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15 -F86C14FF16C06C15F06C816C816C81C681013F1580010F15C01300020714E0EC003F0307 -13F015010078EC007F00F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC -7F0001FEEB01FE9039FFC00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB6 -35>I<143EA6147EA414FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FC -A426003FFEC8FCB3A9EE07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEB -FFF86D6C5B021F5B020313802A4D7ECB34>IIII E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Fd cmbx10 10.95 50 -/Fd 50 121 df11 DI45 DI48 D<140F143F5C495A130F48B5 -FCB6FCA313F7EAFE071200B3B3A8007FB612F0A5243C78BB34>I<903803FF80013F13F8 -90B512FE00036E7E4881260FF80F7F261FC0037F4848C67F486C6D7E6D6D7E487E6D6D7E -A26F1380A46C5A6C5A6C5A0007C7FCC8FC4B1300A25E153F5E4B5AA24B5A5E4A5B4A5B4A -48C7FC5D4A5AEC1FE04A5A4A5A9139FF000F80EB01FC495A4948EB1F00495AEB1F8049C7 -FC017E5C5B48B7FC485D5A5A5A5A5AB7FC5EA4293C7BBB34>I<903801FFE0010F13FE01 -3F6D7E90B612E04801817F3A03FC007FF8D807F06D7E82D80FFC131F6D80121F7FA56C5A -5E6C48133FD801F05CC8FC4B5A5E4B5A4A5B020F5B902607FFFEC7FC15F815FEEDFFC0D9 -000113F06E6C7E6F7E6F7E6F7E1780A26F13C0A217E0EA0FC0487E487E487E487EA317C0 -A25D491580127F49491300D83FC0495A6C6C495A3A0FFE01FFF86CB65A6C5DC61580013F -49C7FC010313E02B3D7CBB34>II<00071538D80FE0EB01F801FE133F90B6FC5E5E5E5E93C7FC5D15F85D15C04AC8 -FC0180C9FCA9ECFFC0018713FC019F13FF90B67E020113E09039F8007FF0496D7E01C06D -7E5B6CC77FC8120F82A31780A21207EA1FC0487E487E12FF7FA21700A25B4B5A6C5A0180 -5C6CC7123F6D495AD81FE0495A260FFC075B6CB65A6C92C7FCC614FC013F13F0010790C8 -FC293D7BBB34>II<121F7F13 -F890B712F0A45A17E017C0178017005E5E5A007EC7EA01F84B5A007C4A5A4B5A4B5A93C7 -FC485C157E5DC7485A4A5AA24A5A140F5D141F143F5D147FA214FF92C8FC5BA25BA3495A -A3130FA5131FAA6D5A6D5A6D5A2C3F7ABD34>II58 D66 D<922607FFC0130E92B500FC -131E020702FF133E023FEDC07E91B7EAE1FE01039138803FFB499039F80003FF4901C013 -00013F90C8127F4948151FD9FFF8150F48491507485B4A1503481701485B18004890CAFC -197E5A5B193E127FA349170012FFAC127F7F193EA2123FA27F6C187E197C6C7F19FC6C6D -16F86C6D150119F06C6D15036C6DED07E0D97FFEED0FC06D6CED3F80010F01C0ECFF006D -01F8EB03FE6D9039FF801FFC010091B55A023F15E002071580020002FCC7FC030713C03F -407ABE4C>II70 D73 D76 -D79 DI82 D<903A03FFC001C0011FEBF803017FEBFE0748B6128F4815DF48010013FFD80F -F8130F48481303497F4848EB007F127F49143F161F12FF160FA27F1607A27F7F01FC91C7 -FCEBFF806C13F8ECFFC06C14FCEDFF806C15E016F86C816C816C816C16806C6C15C07F01 -0715E0EB007F020714F0EC003F1503030013F8167F163F127800F8151FA2160FA27EA217 -F07E161F6C16E06D143F01E015C001F8EC7F8001FEEB01FF9026FFE00713004890B55A48 -6C14F8D8F81F5CD8F00314C027E0003FFEC7FC2D407ABE3A>I<003FB912FCA5903BFE00 -3FFE003FD87FF0EE0FFE01C0160349160190C71500197E127EA2007C183EA400FC183F48 -181FA5C81600B3AF010FB712F8A5403D7CBC49>II87 D<903807FFC0013F13F848B6FC48812607FE03 -7F260FF8007F6DEB3FF0486C806F7EA36F7EA26C5A6C5AEA01E0C8FC153F91B5FC130F13 -7F3901FFFE0F4813E0000F1380381FFE00485A5B485A12FF5BA4151F7F007F143F6D9038 -7BFF806C6C01FB13FE391FFF07F36CEBFFE100031480C6EC003FD91FF890C7FC2F2B7DA9 -33>97 D<13FFB5FCA512077EAFEDFFE0020713FC021FEBFF80027F80DAFF8113F09139FC -003FF802F06D7E4A6D7E4A13074A80701380A218C082A318E0AA18C0A25E1880A218005E -6E5C6E495A6E495A02FCEB7FF0903AFCFF01FFE0496CB55AD9F01F91C7FCD9E00713FCC7 -000113C033407DBE3A>IIIII<903A03FF -8007F0013F9038F83FF8499038FCFFFC48B712FE48018313F93A07FC007FC34848EB3FE1 -001FEDF1FC4990381FF0F81700003F81A7001F5DA26D133F000F5D6C6C495A3A03FF83FF -8091B5C7FC4814FC01BF5BD80F03138090CAFCA2487EA27F13F06CB6FC16F016FC6C15FF -17806C16C06C16E01207001F16F0393FE000034848EB003F49EC1FF800FF150F90C81207 -A56C6CEC0FF06D141F003F16E001F0147FD81FFC903801FFC02707FF800F13006C90B55A -C615F8013F14E0010101FCC7FC2F3D7DA834>I<13FFB5FCA512077EAFED1FF8EDFFFE02 -036D7E4A80DA0FE07F91381F007F023C805C4A6D7E5CA25CA35CB3A4B5D8FE0FB512E0A5 -333F7CBE3A>III<13FFB5FCA512077EB092380FFFFEA5DB01FEC7FC4B5AED07F0ED1FE04B5A -4B5A4BC8FCEC03FC4A5A4A5A141F4A7EECFFFCA2818102E77F02C37F148102007F826F7E -6F7E151F6F7E826F7F6F7F816F7FB5D8FC07EBFFC0A5323F7DBE37>I<13FFB5FCA51207 -7EB3B3AFB512FCA5163F7CBE1D>I<01FFD91FF8ECFFC0B590B5010713F80203DAC01F13 -FE4A6E487FDA0FE09026F07F077F91261F003FEBF8010007013EDAF9F0806C0178ECFBC0 -4A6DB4486C7FA24A92C7FC4A5CA34A5CB3A4B5D8FE07B5D8F03FEBFF80A551297CA858> -I<01FFEB1FF8B5EBFFFE02036D7E4A80DA0FE07F91381F007F0007013C806C5B4A6D7E5C -A25CA35CB3A4B5D8FE0FB512E0A533297CA83A>II<01FFEBFFE0B5000713FC021FEBFF80027F80DAFF8113F09139FC007FF8 -000701F06D7E6C496D7E4A130F4A6D7E1880A27013C0A38218E0AA4C13C0A318805E1800 -5E6E5C6E495A6E495A02FCEBFFF0DAFF035B92B55A029F91C7FC028713FC028113C00280 -C9FCACB512FEA5333B7DA83A>I<3901FE01FE00FF903807FF804A13E04A13F0EC3F1F91 -387C3FF8000713F8000313F0EBFFE0A29138C01FF0ED0FE091388007C092C7FCA391C8FC -B3A2B6FCA525297DA82B>114 D<90383FFC1E48B512BE000714FE5A381FF00F383F8001 -48C7FC007E147EA200FE143EA27E7F6D90C7FC13F8EBFFE06C13FF15C06C14F06C806C80 -6C806C80C61580131F1300020713C014000078147F00F8143F151F7EA27E16806C143F6D -140001E013FF9038F803FE90B55A15F0D8F87F13C026E00FFEC7FC222B7DA929>IIIIII -E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Fe cmbxti10 10.95 11 -/Fe 11 120 df46 D67 -D79 D101 -D<4AB4FC020F13C0023FEBE3E091B5EAF7F049EBC3FF49010013F8D907FC137F4948133F -011F15F0495A4948137FA201FF15E05C4815FFA2484914C0A25D5A02001480A25D5A4915 -00A25DA25E5B0007140FA25E6C6C131F157F6C6C13FF6C01835B6DB5FC7F6D13BF903903 -FE3FF090C7FC157FA25EA2D80F8013FF487E486C5C486C5A5E48485A4A90C7FC4A5A4948 -5A397F807FF86CB512E06C14806C49C8FC000113E02D3C7BA830>103 -D110 -D<913803FF80023F13F091B512FC010380010FEB03FF90261FF80013804948EB7FC0D97F -C0EB3FE0495A4816F04890C7FC4848141F000F16F849143F121FA2485AA2167F007F16F0 -5BA216FF00FF16E05BA24B13C0A21780495B007F16006D495A4B5A003F5D4B5A6C6CEB7F -E06C6C495A2607FE075B6CB548C7FC6C14F86C6C13E0D90FFEC8FC2D2A77A836>II114 DI<017FEE03E0D9FFC0903907C007F8000301F090380FE0 -0F486D90391FF01FFCD80FE7143FD987FCED3FFED81F07147F003F16E0003E171FD87C0F -160F04FFEB07FCD8FC1FEDC00300F8491501A2013F49140000F001F04A13F81200137F4A -48140119F001FF150014C04B14034818E002805BA2F007C048140F02005BF00F80A2181F -6C1800606E486C133E606C6D486C13FCD97FF0B5EA83F890263FFFFCEBFFF06D496C5B01 -07D9E01F1380010090268003FEC7FC3F2A78A846>119 D E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Ff cmr10 10.95 77 -/Ff 77 123 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907 -F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7 -FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11 -DII<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3 -12011380120313005A120E5A1218123812300B1C79BE19>39 D<1430147014E0EB01C0EB -03801307EB0F00131E133E133C5B13F85B12015B1203A2485AA2120F5BA2121F90C7FCA2 -5AA3123E127EA6127C12FCB2127C127EA6123E123FA37EA27F120FA27F1207A26C7EA212 -017F12007F13787F133E131E7FEB07801303EB01C0EB00E014701430145A77C323>I<12 -C07E12707E7E121E7E6C7E7F12036C7E7F12007F1378137CA27FA2133F7FA21480130FA2 -14C0A3130714E0A6130314F0B214E01307A614C0130FA31480A2131F1400A25B133EA25B -A2137813F85B12015B485A12075B48C7FC121E121C5A5A5A5A145A7BC323>I<121EEA7F -8012FF13C0A213E0A3127FEA1E601200A413E013C0A312011380120313005A120E5A1218 -123812300B1C798919>44 DI<121EEA7F80A2EAFFC0A4EA7F80 -A2EA1E000A0A798919>IIIIII<150E151E153EA2157EA215 -FE1401A21403EC077E1406140E141CA214381470A214E0EB01C0A2EB0380EB0700A2130E -5BA25B5BA25B5B1201485A90C7FC5A120E120C121C5AA25A5AB8FCA3C8EAFE00AC4A7E49 -B6FCA3283E7EBD2D>I<00061403D80780131F01F813FE90B5FC5D5D5D15C092C7FC14FC -EB3FE090C9FCACEB01FE90380FFF8090383E03E090387001F8496C7E49137E497F90C713 -800006141FC813C0A216E0150FA316F0A3120C127F7F12FFA416E090C7121F12FC007015 -C012780038EC3F80123C6CEC7F00001F14FE6C6C485A6C6C485A3903F80FE0C6B55A013F -90C7FCEB07F8243F7CBC2D>II<12 -38123C123F90B612FCA316F85A16F016E00078C712010070EC03C0ED078016005D48141E -151C153C5DC8127015F04A5A5D14034A5A92C7FC5C141EA25CA2147C147814F8A213015C -1303A31307A3130F5CA2131FA6133FAA6D5A0107C8FC26407BBD2D>III<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121EEA7F80A2EAFFC0A4 -EA7F80A2EA1E000A2779A619>I<007FB912E0BA12F0A26C18E0CDFCAE007FB912E0BA12 -F0A26C18E03C167BA147>61 D64 D<15074B7EA34B7EA34B7EA34B7EA34B7E15E7A2913801 -C7FC15C3A291380381FEA34AC67EA3020E6D7EA34A6D7EA34A6D7EA34A6D7EA34A6D7EA3 -49486D7E91B6FCA249819138800001A249C87EA24982010E157FA2011E82011C153FA201 -3C820138151FA2017882170F13FC00034C7ED80FFF4B7EB500F0010FB512F8A33D417DC0 -44>IIIIII -III<011FB512FCA3D9000713006E5A1401B3B3A6123F -EA7F80EAFFC0A44A5A1380D87F005B007C130700385C003C495A6C495A6C495A2603E07E -C7FC3800FFF8EB3FC026407CBD2F>IIIIIIIIII<003FB91280A3903AF0007FE001018090393FC000 -3F48C7ED1FC0007E1707127C00781703A300701701A548EF00E0A5C81600B3B14B7E4B7E -0107B612FEA33B3D7DBC42>IIII<007FB5D8C003B512E0A3C649C7 -EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E6D6C141C6D6C143C5F6D6C14706D6D -13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC020F5BEDF81E913807FC1C163C6E6C -5A913801FF7016F06E5B6F5AA26F7E6F7EA28282153FED3BFEED71FF15F103E07F913801 -C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C6D7E02386D7E14784A6D7E4A6D7F13 -0149486E7E4A6E7E130749C86C7E496F7E497ED9FFC04A7E00076DEC7FFFB500FC0103B5 -12FEA33F3E7EBD44>II<003FB712 -F8A391C7EA1FF013F801E0EC3FE00180EC7FC090C8FC003EEDFF80A2003C4A1300007C4A -5A12784B5A4B5AA200704A5AA24B5A4B5AA2C8485A4A90C7FCA24A5A4A5AA24A5AA24A5A -4A5AA24A5A4A5AA24990C8FCA2495A4948141CA2495A495AA2495A495A173C495AA24890 -C8FC485A1778485A484815F8A24848140116034848140F4848143FED01FFB8FCA32E3E7B -BD38>II93 D97 -DI<49B4FC010F13E090383F00F8017C131E4848131F -4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290C9FC5AAB6C7EA3 -003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C6C137890383F01 -F090380FFFC0D901FEC7FC222A7DA828>II -II<167C903903F801 -FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC0600000F6EC7FC -49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E03903FE0FC026071F -FFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15E06C810003813A -0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E157E6C5D6C6C49 -5A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D7EA82D>III<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC147FEB7FFFA313 -017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03F0381E07C0380F -FF803801FC00185185BD1C>II -I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B7803F03C01F80007 -903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91C75B13FF4992C7FC -A2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>I<3901F801FE00FF -903807FFC091381E07E091387803F000079038E001F82603F9C07F0001138001FB6D7E91 -C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14FF010713E090381F -81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F15F04848EB01F8A2 -003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F86C6CEB03F0A26C6C -EB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFFF0010090C7FC282A -7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F03A07FFC001FC6C49 -6C7E6C90C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0A4EE1FE0A2EE3F -C06D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA3FFFC7FCEC07F8 -91C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F80F090397F0038 -7C01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485AA448C7FCAA6C7E -A36C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E137990383F81F190380FFF -C1903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E000FFEB1FF8EC78 -7CECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35BB3A5487EB512FE -A31F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E1307003C1303127C -0078130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F6C1480000114C0 -D8003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F07E14016C14E06C -EB03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<131CA6133CA4137C -A213FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912009038FE01C0A2 -EB7F03013F138090381F8700EB07FEEB01F81B397EB723>IIIIII<001FB61280A2EBE0000180140049485A001E495A121C4A5A003C -495A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90393FC00380A2EB -7F80EBFF005A5B484813071207491400485A48485BA248485B4848137F00FF495A90B6FC -A221277EA628>I E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Fg cmr12 12 17 -/Fg 17 117 df<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113 -80120313005A1206120E5A5A5A12600B1D78891B>44 D<14FF010713E090381F81F89038 -3E007C01FC133F4848EB1F8049130F4848EB07C04848EB03E0A2000F15F0491301001F15 -F8A2003F15FCA390C8FC4815FEA54815FFB3A46C15FEA56D1301003F15FCA3001F15F8A2 -6C6CEB03F0A36C6CEB07E0000315C06D130F6C6CEB1F806C6CEB3F00013E137C90381F81 -F8903807FFE0010090C7FC28447CC131>48 D<143014F013011303131F13FFB5FC13E713 -071200B3B3B0497E497E007FB6FCA3204278C131>II<14FF010713E0011F13F890387F80FC9038FC007E48487F4848EB1F8048 -48EB0FC0000FEC07E0485AED03F0485A16F8007F140190C713FCA25AA216FE1500A516FF -A46C5CA36C7E5D121F7F000F5C6C6C130E150C6C6C131C6C6C5BD8007C5B90383F01E090 -390FFF80FE903801FE0090C8FC150116FCA4ED03F8A216F0D80F801307486C14E0486C13 -0F16C0ED1F80A249EB3F0049137E001EC75A001C495A000F495A3907E01FE06CB51280C6 -49C7FCEB1FF028447CC131>57 D<16C04B7EA34B7EA34B7EA34B7EA3ED19FEA3ED30FFA2 -03707FED607FA203E07FEDC03FA2020180ED801FA2DA03007F160FA20206801607A24A6D -7EA34A6D7EA34A6D7EA20270810260147FA202E08191B7FCA249820280C7121FA249C87F -170FA20106821707A2496F7EA3496F7EA3496F7EA201788313F8486C83D80FFF03037FB5 -00E0027FEBFFC0A342477DC649>65 D<010FB512FEA3D9000313806E130080B3B3AB123F -487E487EA44A5A13801300006C495A00705C6C13076C5C6C495A6CEB1F802603E07FC7FC -3800FFFCEB1FE027467BC332>74 D -I97 -DI104 -DI108 DI<3901FC03FC00FF90380FFF8091383C07E091387001F83A07FDE000FE00030180 -137FD801FFEC3F8091C7EA1FC04915E049140F17F0160717F8160317FCA3EE01FEABEE03 -FCA3EE07F8A217F0160F6D15E0EE1FC06D143F17806EEB7E00D9FDC05B9039FCF003F891 -383C0FE091381FFF80DA03FCC7FC91C9FCAE487EB512F8A32F3F7DAB36>112 -D<3903F803F000FFEB1FFCEC3C3EEC707F0007EBE0FF3803F9C000015B13FBEC007E153C -01FF13005BA45BB3A748B4FCB512FEA3202C7DAB26>114 D<1306A5130EA4131EA3133E -137EA213FE12011207001FB512F0B6FCA2C648C7FCB3A4150CAA017E131C017F1318A26D -133890381F8030ECC070903807E0E0903801FFC09038007F001E3E7EBC26>116 -D E -%EndDVIPSBitmapFont -%DVIPSBitmapFont: Fh cmr17 17.28 11 -/Fh 11 117 df67 DI72 D76 D<4AB47E020F13F8023F13FE9139FF007F80D903 -FCEB07E0D907F0EB01F0D91FE0EB007849488049488049C87E48485D4915FF00034B1380 -48485CA2485AA2485AA2003F6F130049EC007C94C7FC127FA35B12FFAD127F7FA4123F7F -A2001FEE01C07F000F16036D168012076C6C15076D160000015E6C6C151E6D6C5C6D6C5C -6D6C5CD90FF8495AD903FCEB07C0903A00FF803F8091263FFFFEC7FC020F13F802011380 -32417CBF3A>99 D101 D108 D110 -DI<90 -39078003F8D807FFEB0FFFB5013F13C092387C0FE0913881F01F9238E03FF00001EB8380 -39007F8700148FEB3F8E029CEB1FE0EE0FC00298EB030002B890C7FCA214B014F0A25CA5 -5CB3B0497EEBFFF8B612FCA42C3F7CBE33>114 D<1438A71478A414F8A31301A31303A2 -1307130F131FA2137F13FF1203000F90B6FCB8FCA3260007F8C8FCB3AE17E0AE6D6CEB01 -C0A316036D6C148016076D6C14006E6C5A91383FC01E91381FF07C6EB45A020313E09138 -007F802B597FD733>116 D E -%EndDVIPSBitmapFont -end -%%EndProlog -%%BeginSetup -%%Feature: *Resolution 600dpi -TeXDict begin - -%%EndSetup -%%Page: 1 1 -1 0 bop 1256 912 a Fh(HDLC)43 b(con)l(troller)j(core)1594 -1165 y Fg(Jamil)30 b(Khatib)1599 1369 y(April)h(9,)h(2001)1198 -1718 y Ff(\(C\))e(Cop)m(yrigh)m(t)g(2001)i(Jamil)d(Khatib.)p -eop -%%Page: 2 2 -2 1 bop 382 228 a Ff(CONTENTS)1172 b Fe(www.Op)-5 b(enCor)g(es.or)g(g) -46 b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a Fc(Con)l(ten)l(ts)382 -752 y Fd(1)84 b(List)35 b(of)g(authors)g(and)g(c)m(hanges)1540 -b(4)382 956 y(2)84 b(Pro)6 b(ject)36 b(De\014nition)1972 -b(5)518 1068 y Ff(2.1)94 b(In)m(tro)s(duction)27 b(.)46 -b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g -(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)138 b(5)518 1181 -y(2.2)94 b(Ob)5 b(jectiv)m(es)38 b(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h -(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.) -g(.)f(.)h(.)138 b(5)382 1385 y Fd(3)84 b(Sp)s(eci\014cations)2182 -b(5)518 1498 y Ff(3.1)94 b(System)31 b(F)-8 b(eatures)31 -b(Sp)s(eci\014cation)47 b(.)f(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h -(.)g(.)f(.)h(.)g(.)f(.)h(.)138 b(5)518 1611 y(3.2)94 -b(External)30 b(In)m(terfaces)55 b(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g -(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)138 -b(6)727 1724 y(3.2.1)106 b(Receiv)m(e)32 b(Channel)70 -b(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.) -h(.)g(.)f(.)h(.)138 b(6)727 1837 y(3.2.2)106 b(Bac)m(k-end)32 -b(in)m(terface)f(mapping)e(to)i(Wish)m(b)s(one)e(SoC)h(bus)69 -b(.)46 b(.)138 b(6)727 1950 y(3.2.3)106 b(T)-8 b(ransmit)29 -b(Channel)79 b(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h -(.)g(.)f(.)h(.)g(.)f(.)h(.)138 b(8)727 2063 y(3.2.4)106 -b(Bac)m(k-end)32 b(in)m(terface)f(mapping)e(to)i(Wish)m(b)s(one)e(SoC)h -(bus)69 b(.)46 b(.)138 b(8)727 2176 y(3.2.5)106 b(CPU)30 -b(in)m(terface)25 b(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h -(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)138 b(9)382 -2379 y Fd(4)84 b(Design)36 b(description)1901 b(10)518 -2492 y Ff(4.1)94 b(Receiv)m(e)32 b(Channel)78 b(.)46 -b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h -(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(10)727 2605 y(4.1.1)106 -b(Design)30 b(notes)85 b(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f -(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(10)727 -2718 y(4.1.2)106 b(Timing)87 b(.)45 b(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g -(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 -b(10)518 2831 y(4.2)h(T)-8 b(ransmit)30 b(Channel)86 -b(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.) -h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(10)727 2944 y(4.2.1)106 -b(Design)30 b(notes)85 b(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f -(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(11)727 -3057 y(4.2.2)106 b(Timing)87 b(.)45 b(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g -(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 -b(11)518 3170 y(4.3)h(External)30 b(FIF)m(O)h(and)f(registers)i(.)46 -b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h -(.)93 b(11)518 3283 y(4.4)h(Registers)24 b(.)45 b(.)h(.)g(.)g(.)f(.)h -(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.) -g(.)f(.)h(.)g(.)f(.)h(.)93 b(11)727 3396 y(4.4.1)106 -b(T)-8 b(ransmit)84 b(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.) -g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 -b(11)727 3509 y(4.4.2)106 b(Receiv)m(e)79 b(.)45 b(.)h(.)g(.)f(.)h(.)g -(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.) -f(.)h(.)93 b(12)518 3621 y(4.5)h(T)-8 b(ransmit)30 b(F)-8 -b(rame)27 b(.)45 b(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f -(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(12)518 -3734 y(4.6)h(Receiv)m(e)32 b(F)-8 b(rame)90 b(.)45 b(.)h(.)g(.)f(.)h(.) -g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g -(.)f(.)h(.)93 b(13)518 3847 y(4.7)h(Connection)30 b(to)h(TDM)g(con)m -(troller)87 b(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.) -g(.)f(.)h(.)93 b(13)518 3960 y(4.8)h(Clo)s(c)m(ks)30 -b(Sync)m(hronization)92 b(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.) -g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(13)518 4073 -y(4.9)h(Diagrams)77 b(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.) -g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 -b(14)382 4277 y Fd(5)84 b(T)-9 b(esting)35 b(and)g(v)m(eri\014cations) -1630 b(14)518 4390 y Ff(5.1)94 b(Sim)m(ulation)28 b(and)i(T)-8 -b(est)31 b(b)s(enc)m(hes)90 b(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.) -f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 b(15)518 4503 y(5.2)h(V)-8 -b(eri\014cation)30 b(tec)m(hniques)g(and)g(algorithms)59 -b(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)93 -b(15)518 4616 y(5.3)h(T)-8 b(est)31 b(plans)46 b(.)g(.)g(.)g(.)f(.)h(.) -g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g -(.)f(.)h(.)g(.)f(.)h(.)93 b(15)382 4819 y Fd(6)84 b(Implemen)m(tations) -1981 b(15)518 4932 y Ff(6.1)94 b(Scripts,)29 b(\014les)h(and)f(an)m(y)i -(other)g(information)25 b(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.) -f(.)h(.)93 b(15)518 5045 y(6.2)h(Design)31 b(con)m(v)m(en)m(tions)g -(and)f(co)s(ding)f(st)m(yles)43 b(.)j(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f -(.)h(.)g(.)f(.)h(.)93 b(15)382 5249 y Fd(7)84 b(Reviews)35 -b(and)g(commen)m(ts)1677 b(15)p 382 5539 V 382 5652 a -Ff(HDLC)30 b(con)m(troller)2021 b(2)61 b(of)31 b(15)p -eop -%%Page: 3 3 -3 2 bop 382 228 a Ff(CONTENTS)1172 b Fe(www.Op)-5 b(enCor)g(es.or)g(g) -46 b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a(8)84 -b(References)2258 b(15)p 382 5539 V 382 5652 a Ff(HDLC)30 -b(con)m(troller)2021 b(3)61 b(of)31 b(15)p eop -%%Page: 4 4 -4 3 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a Fc(1)135 -b(List)45 b(of)g(authors)g(and)g(c)l(hanges)p 382 673 -3352 4 v 380 786 4 113 v 432 752 a Ff(Name)p 1006 786 -V 397 w(Changes)p 2513 786 V 1173 w(Date)p 2991 786 V -289 w(Con)m(tact)32 b(address)p 3731 786 V 382 789 3352 -4 v 382 806 V 380 919 4 113 v 432 885 a(Jamil)c(Khatib)p -1006 919 V 99 w(Initial)g(release)p 2513 919 V 974 w(9-1-2001)p -2991 919 V 148 w( 3731 919 V 382 922 -3352 4 v 380 1035 4 113 v 432 1001 a(Jamil)g(Khatib)p -1006 1035 V 99 w(TX)i(in)m(terface)h(added,)f(Sp)s(ec)g(impro)m(v)m(ed) -p 2513 1035 V 99 w(27-1-2001)p 2991 1035 V 103 w( -3731 1035 V 382 1038 3352 4 v 380 1151 4 113 v 432 1117 -a(Jamil)e(Khatib)p 1006 1151 V 99 w(External)i(FIF)m(O)h(bu\013er)e -(added)p 2513 1151 V 386 w(3-2-2001)p 2991 1151 V 148 -w( 3731 1151 V 382 1154 3352 4 v 380 -1267 4 113 v 432 1233 a(Jamil)f(Khatib)p 1006 1267 V -99 w(Registers)i(and)g(CPU)g(in)m(terface)h(added)p 2513 -1267 V 106 w(8-2-2001)p 2991 1267 V 148 w( -3731 1267 V 382 1271 3352 4 v 380 1384 4 113 v 432 1350 -a(Jamil)d(Khatib)p 1006 1384 V 99 w(Drop)i(bit,)g(TDM)h(in)m(terface)g -(are)f(added)p 2513 1384 V 102 w(9-2-2001)p 2991 1384 -V 148 w( 3731 1384 V 382 1387 3352 4 -v 380 1500 4 113 v 432 1466 a(Jamil)e(Khatib)p 1006 1500 -V 99 w(More)j(design)e(descriptions)g(added)p 2513 1500 -V 254 w(2-4-2001)p 2991 1500 V 148 w( -3731 1500 V 382 1503 3352 4 v 380 1616 4 113 v 432 1582 -a(Jamil)f(Khatib)p 1006 1616 V 99 w(FIF)m(O)j(bu\013ers)e(calculations) -h(added)p 2513 1616 V 227 w(9-4-2001)p 2991 1616 V 148 -w( 3731 1616 V 382 1619 3352 4 v 382 -5539 2989 4 v 382 5652 a(HDLC)g(con)m(troller)2021 b(4)61 -b(of)31 b(15)p eop -%%Page: 5 5 -5 4 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a Fc(2)135 -b(Pro)7 b(ject)46 b(De\014nition)382 754 y Fb(2.1)112 -b(In)m(tro)s(duction)382 926 y Ff(HDLC)27 b(proto)s(col)h(is)f(used)f -(as)i(a)g(data)g(link)e(of)h(most)h(of)g(the)g(curren)m(t)f(comm)m -(unication)382 1039 y(systems)37 b(lik)m(e)g(ISDN,)g(F)-8 -b(rame)38 b(Rela)m(y)g(etc.)62 b(HDLC)37 b(is)f(a)i(family)e(of)h -(proto)s(cols)g(that)382 1152 y(v)-5 b(aries)30 b(in)f(address)g(size,) -i(con)m(trol)g(\014eld,)e(F)m(CS)h(and)g(no.)40 b(of)31 -b(data)g(bits.)382 1394 y Fb(2.2)112 b(Ob)6 b(jectiv)m(es)382 -1566 y Ff(The)32 b(aim)h(of)g(this)f(pro)5 b(ject)33 -b(is)g(to)g(dev)m(elop)g(the)g(basic)g(HDLC)g(functionalities)d(to)k(b) -s(e)382 1679 y(used)29 b(b)m(y)i(man)m(y)f(comm)m(unication)g(systems.) -382 1965 y Fc(3)135 b(Sp)t(eci\014cations)382 2171 y -Fb(3.1)112 b(System)37 b(F)-9 b(eatures)38 b(Sp)s(eci\014cation)493 -2343 y Ff(1.)46 b(Sync)m(hronous)29 b(op)s(eration)493 -2529 y(2.)46 b(8)31 b(bit)e(parallel)g(bac)m(k-end)i(in)m(terface)493 -2715 y(3.)46 b(Use)31 b(external)f(RX)h(and)e(TX)h(clo)s(c)m(ks)493 -2902 y(4.)46 b(Start)31 b(and)f(end)f(of)i(frame)f(pattern)h -(generation)493 3088 y(5.)46 b(Start)31 b(and)f(end)f(of)i(frame)f -(pattern)h(c)m(hec)m(king)493 3274 y(6.)46 b(Idle)29 -b(pattern)i(generation)g(and)e(detection)i(\(all)f(ones\))493 -3461 y(7.)46 b(Zero)30 b(insertion)f(and)h(remo)m(v)-5 -b(al)30 b(for)h(transparen)m(t)f(transmission.)493 3647 -y(8.)46 b(Ab)s(ort)30 b(pattern)h(generation)f(and)g(c)m(hec)m(king)h -(\(7)g(ones\))493 3833 y(9.)46 b(Address)29 b(insertion)g(and)h -(detection)h(b)m(y)f(soft)m(w)m(are)448 4020 y(10.)46 -b(CR)m(C)28 b(generation)h(and)e(c)m(hec)m(king)i(\(CR)m(C-16)h(or)e -(CR)m(C-32)h(can)g(b)s(e)e(used)h(whic)m(h)609 4133 y(is)i -(con\014gurale)f(at)j(the)e(co)s(de)h(top)f(lev)m(el\))448 -4319 y(11.)46 b(FIF)m(O)31 b(bu\013ers)e(and)h(sync)m(hronization)f -(\(External\))448 4505 y(12.)46 b(Byte)38 b(aligned)e(data)i(\(if)f -(data)g(is)g(not)g(aligned)f(to)i(8-bits)f(error)f(signal)g(is)g(re-) -609 4618 y(p)s(orted)30 b(to)h(the)g(bac)m(k)m(end)g(in)m(terface\))448 -4805 y(13.)46 b(Q.921,)32 b(LAPD)f(and)e(LAPB)i(complian)m(t.)448 -4991 y(14.)46 b(The)31 b(core)h(should)d(not)j(ha)m(v)m(e)g(in)m -(ternal)e(con\014guration)h(registers)g(or)g(coun)m(ters,)609 -5104 y(instead)f(it)g(pro)m(vides)f(all)g(the)i(signals)e(to)i -(implemen)m(t)e(external)h(registers.)448 5290 y(15.)46 -b(There)31 b(is)e(No)j(limit)d(on)h(the)h(Maxim)m(um)g(frame)g(size)f -(as)h(long)g(as)g(the)g(bac)m(k)m(end)609 5403 y(can)g(read)f(and)g -(write)f(data)j(\(dep)s(ends)c(on)j(the)f(external)g(FIF)m(O)h(size\))p -382 5539 V 382 5652 a(HDLC)f(con)m(troller)2021 b(5)61 -b(of)31 b(15)p eop -%%Page: 6 6 -6 5 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 448 548 a Ff(16.)46 -b(Bus)33 b(connection)g(is)e(not)i(supp)s(orted)e(directly)h(\(TxEN)h -(and)f(RxEN)g(pins)f(can)609 661 y(b)s(e)f(used)f(for)i(that)g -(reason\))448 848 y(17.)46 b(Retransmission)41 b(is)h(not)g(supp)s -(orted)f(when)h(there)h(is)e(collision)g(in)g(the)i(Bus)609 -961 y(connection)31 b(mo)s(de.)448 1149 y(18.)46 b(This)31 -b(con)m(troller)i(is)f(used)g(for)h(lo)m(w)g(sp)s(eed)f(application)f -(only)h(\(relativ)m(e)i(to)f(the)609 1262 y(bac)m(k)m(end)e(bus\).)448 -1450 y(19.)46 b(Supp)s(orts)28 b(connection)i(to)g(TDM)h(core)f(via)g -(bac)m(k)m(end)g(in)m(terface)h(and)e(soft)m(w)m(are)609 -1562 y(con)m(trol)h(for)e(time)h(slot)g(selection)g(and)f(con)m(trol)i -(\(signaling)d(,etc.\))42 b(generation.)448 1750 y(20.)k(Bac)m(k)m(end) -32 b(in)m(terface)g(uses)e(the)h(Wish)m(b)s(one)e(bus)h(in)m(terface)h -(whic)m(h)e(can)i(b)s(e)f(con-)609 1863 y(nected)h(directly)e(to)i(the) -g(system)f(or)h(via)f(FIF)m(O)h(bu\013er.)448 2051 y(21.)46 -b(Optional)29 b(External)h(FIF)m(O)h(bu\013ers,)e(con\014guration)h -(and)g(status)g(registers.)448 2238 y(22.)46 b(The)30 -b(core)i(will)c(b)s(e)i(made)h(of)g(t)m(w)m(o)h(lev)m(els)e(of)h -(hierarc)m(hies,)f(the)h(basic)f(function-)609 2351 y(alit)m(y)g(and)g -(the)h(Optional)d(in)m(terfaces)j(and)f(bu\013ers.)382 -2595 y Fb(3.2)112 b(External)37 b(In)m(terfaces)382 2766 -y Fd(3.2.1)105 b(Receiv)m(e)36 b(Channel)p 382 2837 3566 -4 v 380 2949 4 113 v 432 2916 a Ff(Signal)28 b(name)p -1224 2949 V 359 w(Direction)p 1691 2949 V 100 w(Description)p -3946 2949 V 382 2953 3566 4 v 382 2969 V 380 3082 4 113 -v 432 3048 a(Con)m(trol)i(in)m(terface)p 1224 3082 V -1691 3082 V 3946 3082 V 382 3086 3566 4 v 382 3102 V -380 3215 4 113 v 432 3181 a(Rst)p 1224 3215 V 705 w(Input)p -1691 3215 V 247 w(System)g(async)m(hronous)g(reset\(activ)m(e)i(lo)m -(w\))p 3946 3215 V 382 3218 3566 4 v 382 3235 V 380 3348 -4 113 v 432 3314 a(Serial)c(In)m(terface)p 1224 3348 -V 1691 3348 V 3946 3348 V 382 3351 3566 4 v 382 3368 -V 380 3481 4 113 v 432 3447 a(RxClk)p 1224 3481 V 588 -w(Input)p 1691 3481 V 247 w(Receiv)m(e)j(Clo)s(c)m(k)p -3946 3481 V 380 3594 V 432 3560 a(Rx)p 1224 3594 V 728 -w(Input)p 1691 3594 V 247 w(Receiv)m(e)g(Data)p 3946 -3594 V 380 3707 V 432 3673 a(RxEn)p 1224 3707 V 615 w(Input)p -1691 3707 V 247 w(RX)f(enable)g(\(activ)m(e)i(high\))p -3946 3707 V 382 3710 3566 4 v 382 3727 V 380 3839 4 113 -v 432 3806 a(Bac)m(k-end)f(In)m(terface)p 1224 3839 V -1691 3839 V 3946 3839 V 382 3843 3566 4 v 382 3859 V -380 3972 4 113 v 432 3938 a(RxD[7:0])p 1224 3972 V 494 -w(Output)p 1691 3972 V 174 w(Receiv)m(e)g(data)g(bus)p -3946 3972 V 380 4085 V 432 4051 a(V)-8 b(alidF)g(rame)p -1224 4085 V 387 w(Output)p 1691 4085 V 174 w(V)g(alid)29 -b(F)-8 b(rame)31 b(indication)d(during)h(all)g(frame)h(b)m(ytes)h -(transfer)p 3946 4085 V 380 4198 V 432 4164 a(F)-8 b(rameErr)p -1224 4198 V 461 w(Output)p 1691 4198 V 174 w(Error)29 -b(in)g(the)i(receiv)m(ed)f(data)h(\(lost)g(bits\))p 3946 -4198 V 380 4311 V 432 4277 a(Ab)s(orted)p 1224 4311 V -514 w(Output)p 1691 4311 V 174 w(Ab)s(orted)e(F)-8 b(rame)p -3946 4311 V 380 4424 V 432 4390 a(Read)p 1224 4424 V -640 w(Input)p 1691 4424 V 247 w(Read)30 b(b)m(yte)p 3946 -4424 V 380 4537 V 432 4503 a(Ready)p 1224 4537 V 592 -w(Output)p 1691 4537 V 174 w(V)-8 b(alid)29 b(data)i(exists)p -3946 4537 V 382 4540 3566 4 v 382 4739 a Fd(3.2.2)105 -b(Bac)m(k-end)36 b(in)m(terface)f(mapping)f(to)h(Wish)m(b)s(one)h(SoC)e -(bus)382 4910 y Ff(The)d(HDLC)h(receiv)m(e)g(bac)m(k)m(end)g(in)m -(terface)g(can)g(b)s(e)f(used)g(as)h(a)g(sla)m(v)m(e)g(core)h(or)e -(master)382 5023 y(according)g(to)g(the)g(b)s(elo)m(w)f(mapping.)41 -b(The)30 b(core)i(supp)s(orts)d(SINGLE)h(READ)h(Cycle)382 -5136 y(only)c(using)g(8-bit)h(data)h(bus)e(without)g(address)g(lines.) -39 b(The)27 b(c)m(hoice)i(b)s(et)m(w)m(een)g(master)382 -5249 y(and)c(sla)m(v)m(e)i(is)d(left)i(for)f(the)h(system)g(in)m -(tegrator)h(and)e(m)m(ust)h(do)f(the)h(con\014guration)f(and)382 -5362 y(glue)30 b(logic)g(as)h(de\014ned)e(in)g(the)h(tables.)p -382 5539 2989 4 v 382 5652 a(HDLC)g(con)m(troller)2021 -b(6)61 b(of)31 b(15)p eop -%%Page: 7 7 -7 6 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 2039 a - currentpoint currentpoint translate 0.88127 0.88127 scale neg exch -neg exch translate - 382 2039 -a 382 2039 a - currentpoint currentpoint translate .5 .5 scale neg exch neg exch -translate - 382 2039 a 382 2039 a - gsave currentpoint currentpoint translate 0 neg rotate neg exch neg -exch translate - 382 2039 a @beginspecial -14 @llx 14 @lly 828 @urx 445 @ury 8140 @rwi @setspecial -%%BeginDocument: -%!PS-Adobe-3.0 -%%Creator: GIMP PostScript file plugin V 1.06 by Peter Kirchgessner -%%Title: /home/jamil/Projects_org/hdlc/ -%%CreationDate: Mon Apr 9 23:02:34 2001 -%%DocumentData: Clean7Bit -%%Pages: 1 -%%BoundingBox: 14 14 828 445 -%%EndComments -%%BeginProlog -% Use own dictionary to avoid conflicts -5 dict begin -%%EndProlog -%%Page: 1 1 -% Translate for offset -14.173228 14.173228 translate -% Translate to begin of first scanline -0.000000 429.921260 translate -813.543307 -429.921260 scale -% Variable to keep one line of raster data -/scanline 246 3 mul string def -% Image geometry -246 130 8 -% Transformation matrix -[ 246 0 0 130 0 0 ] -{ currentfile scanline readhexstring pop } false 3 -colorimage -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff8fffffcfffffffafd -fff2faffedfbffecffffe8ffffe6ffffdaccffe5d7ffeee0ffecdeffe5d7ffe3d5ffeddffff2e4 -fff3f4fff3f4fff5f4fff6f4fff7f4fff8f4fff8f4fff9f4fff1f4fff1f4ffedf0ffe5e8ffe1e4 -ffe2e5ffe6e9ffe9ecdcffffe3fffceefdf8fffdfffffafffffbfffefffff8ffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffcfefdfdfdfdfffeff -fffcfffffafffff9fffff7fffff6fffffbf4fffbf4fffbf4fffbf4fffbf4fffbf4fffbf4fffbf4 -d0ffe9ccffe4caffdecdfcdcd8ffe2eaffeef0fff1f2fff1fbfff1fbfff1fbfff1fbfff1fbfff1 -fbfff1fbfff1fbfff1ebfffff1fffff9fffffffefffffcfffffdfffffffffcffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffafefffdffffffff -f9fffff2ffffedffffe9ffffe6ffffe3f8fde2f7fce1f6fbe2f7fce3f8fde3f8fde2f7fce1f6fb -a9ffe8afffe8b1ffdfb9ffdacdffdfe4ffe8f0ffe8f5ffe8daebcbdaebcbdbecccdcedcddeefcf -e0f1d1e2f3d3e3f4d4fffbfffffcfffffefffefffffefffffffffffffefffffcffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffafffffcfffeffff -f4ffffe2fff8cefeeebbf9e4b1f5dec6e6f3c0e0edbfdfecccecf9e0ffffe7ffffe7ffffe7ffff -d8ffdfdfffdfedffdfffffdffffbdfffeddaffddd1ffd4ccffe8dfffe8dfffe8dfffe8dfffe8df -ffe8dfffe8dfffe8dfffe8ffffeffffff9fff9fffff2fffdf6fffcfffcfffff7ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffdf7f9fffefffeffff -f9fffff4ffffeefffdddfbf1d4f4e9fffcfffffcfffffcfffffcfffffcfffffcfffffcfffff9ff -ffbbadffc1b6ffc3bdffb8b8ff979eff6573ff3447e8142ad40012db0119e50b23ed132bee142c -e80e26df051dd90017ffb5e1ffdbf9fff4fff4ffffe8fffee9fcf6fffafffff1ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffdbeae5ecf5f2fffeff -fff9fffff4ffffefffffecffffeaffffe4ecffe4ecffc2caffb8c0ffc0c8ffb6bee79098c26b73 -ff162eff2139ff2f46ff2f46ff1b31e7000bbc0000a50000f6000ffe0017ff0722ff0d28ff0823 -fc0015ea0003de0000ff64a2ffa7d3ffeffff0ffffdfffffe2fdf4fff5fbffecffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffd3f9ece8fdf6fffcff -ffefffffe1ffffc4f0ffa3d9ff8ec9ff8480ff5a56e4322ee2302cf64440f4423ecc1a16a20000 -e60000e90000e90000df0004d5120ecc2417c8331fc63b24d81d16e1261feb3029ee332ce22720 -cb1009b10000a00000f71561ff73a9ffeafdebffffd6ffffddfef3ffeaf2ffe8ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffdcffffebfffffffbff -ffd6edff9dc9ff5c9aff206cf50050ff1e11e50000ca0000df0000ff2215ff372aff1d10e40000 -ff020eed0006d10600c1200cc85632e59f6cffe4a6ffffbdffebbdffebbdffebbdffebbdffebbd -ffd3a5ffb486f4a072dc0037ff548fffe0f5eaffffd2ffffdafff3fde3ecffddf6ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffecffffeffffff4fffffbfff8ffffeaffffd6fff5caffeef0ffe4edffe4eaffe4e0ffe0 -d5ffdaceffd9cdffdccfffdfffe9f1ffe9eeffedecfff6edf4fff1e7fff4dafff3d3fff2fde1ff -fde3ffffe7ffffebfffff2fffff7fffff8fffff8ffffecdaffeedafff3dafff9daffffdaffffda -f9ffdaf5ffdaffcbf4ffd3f4ffd1e1ebd3cfc0ebd0adffe59dfff48cfff4f10006ff1d34ff1e35 -f10006ef0004ff162dff1229e40000e40014f50025ff0032fb002cec0026fc0f3dff4772ff76a0 -7fffcc9dffdeb6ffe1d4ffe1f2ffe1fffde1ffdecdffc3b895f879fddd92ffd6b9ffeccfddffe3 -b3ffdedaabbbff55a1ff0a2bf33f4ba5d49dc0ffe6fffff1ffd8eaf4e4efcaffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffdeeeffe3f0ffecf5fff8fbf9ffffeeffffe6ffffe0ffffffefebffeee9ffeee8fff2ea -fffbf2fffff4fffff4fffff4eedcd2fff6ebfffef1fffff1f4ffede4fae3ebffefeafff1e6ffff -e7ffffebfffff1fffff5fffff4faf8efefefebe9ead0f9c1ebffd7f8ffdaffffdafffddafff0d3 -ffd9c1ffceb9dbf1dad8ccc0d88c96e24369f90246f10031e90029e800286c00009e0400c01f15 -b60f07c41510e93330dd2120ab0000ffc2a2ffceaeffd2b2ffc7a7fbbc9bffcaa9fff0cffff0cf -fff3c7ffecc4ffdcbbffbca4ff8c7ee4534ec52122b20308a2410cf23726ff545effaca6eaffe1 -b0ffefd3fff2fccdddff001de52b39a6b78ad1ffe6fffff1ffe0eff0e4eed2ffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffff1fcffeff8feedf3f3edefedf3f1ecfdf7edfffeeafffffff0ffffefffffefffffe5ff -ffdcf7ffd8f3ffd8f4ffd9f5d4f4cfeeffe8f4ffe8fbffe8ffffe8fff8e1fffae6fffce8bafbbb -c3fbbed4fbc4eafcccfffdd5fffcdafff6dafff3daf6dfbdffeacdffdfccffaba5f05f66db2438 -e6112ffa1438cb1136d20e36e00837f20138ff003bff003fff0443ff0645d0c88afff7bcfffbc6 -fff4c6ffecc6ffe5c6ffd4baff9e8770ffba8bffbabdffbad4e18fde7f51f8362aff1a22ff1f27 -fc0108fe030aff060eff0a12ff0d15ff0f17ff0f17ff0f17d60000da0000f80011ff4b5eead5b6 -bcffe8b0ffefc8fff3f0000ed10e1fa9866adff9d4fffff1ffeff7ede6eed7ffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffbfffffcfffffdfffaf8f9eef0efeaf0eeecf5f2eef9f5eaffffedffffe9faffe7efff -e9e9fff0e7fff9eafffdedffe4ffdfeaffdff7ffdfffffdffffadffff2dfffcec2ffb3a9ffffbc -fffcbcffe1a8fca879dd6b46c03317aa08009d0000ff3e68ff3f6aff2a56f60022c80000c80000 -ff0028ff315ffc002aff1142ff4d6bff9499ffd8c2ebffdfc6ffdfb0ffdfffffc6ffffc6fffac6 -ffeac0ffc3a3ff9a82f66958db4135e30000e40000e30000db0000d20000d20000dd1600e6270d -ff342fff2722ff130efd0000f10000e10000dd0000da0500ff3253ff0d31f40017ea0b28df6768 -dcc7a8dbffd2daffe0f30011c6000cb34a46ebc6b6fffcf1fffbfbecebf1e2f1f6ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffff8fffff9fffffbfffffefffffffefffffdfffffcfffffbff8bf9e093fbe4a4ffedbffffe -d8ffffe2ffffeaffffeeffffffffd3e9dcafcdad86e6af90ffc8b1ffbaabed746bb22e29a90000 -b40100c60400dd0800f70d02ff120dff1a15ff1e19d40000f4001dff1641ff3c56f26168fa9990 -ffe7d0fff7dafcffd3ffffd3ffffd3ffffd3ffffd3ffffd3fff0c5f7e2b7ffa28cff8471f35f51 -e53c35d11514bc0000b50000bb0000ff1e29ff121dff020df60001f00000eb0000e30000dd0000 -c70000c70000cc1507dd412afd7e5dffc399ffedbcfff1bcffd2ddff97a1da3f4dc4001adf001d -ff4558ffa9a3ffeccffd182fcf000dc61328f68d94fff8f1f4fffbeef6f9f7e6f6ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffc9e9ded7f1e8eefff9fbfffffffdfffff9fffff6fffff4ffc7ffecceffecd9ffece1ffe4 -e8f5dbf5e8d7ffe3d8ffe1d9ffa28cdc6753ad3220b73223e25247ef554dc4221d900000fc090d -fb080cf7070af30407ee0204eb0001e80000e70000f4656bff9392ffdecefffedae7ffdac1ffda -a4ffda8dffd3fffccafff6caffeac9ffc2b0ff8c8bff5360ff2039ff0621ff4e60ff2436fe0b1d -ff1325ff1021f10313ff1626ff3e4ef4001dfa0023ff0e3cff5771ffbcb1ffffdacdffdab2ffda -ffeddafff0daffe5caf1dab8d9dab0cce2b1c9eeb8c9f9bffffff3ebf7e1bea191c12634e00003 -ff0c27ff828cffdcbfff5f65ea011fe00013fe5773ffe6e1e3fffbf4ffffffe3fdffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffb7e6d6cdf3e6ecfffdf9fffffffcffffeff8f7d1deebbcccfff3c6ffe5bcffbd9cff8e76 -f75f52ee3835eb1e23e9121aff1d27fe171fec0b11d60002ca0000cd0a06dd221bea332bd10f1a -d62128e54243f56f66ff9e8cffcbb0ffeccafff5cffff9dafff9dafff1d2fff9dafff9daffdebf -b49374745334ff2031ff2132ff2132ff1d2eff1526ff0c1bf50510eb0009eb0000c80000ca0000 -f1151ff93839dd3930ec5a4bff9582f7fdfbe6eceadde3e1eaf0eefcfffffcfffff9fdfce2e6e5 -e4f3eee2f5efe3faf2e5fffae4ffffe0ffffdcffffdbfffffaeff3eafffae5f1dbed6b75ed000d -f10003ff7362fffeb3ffa69fff1839dd0008ff2d59fbd3d1d6fffbf1ffffffe6ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffd8fffce0ffffeafffff8fffffaeff3d4b4bfa67787875063d60e00db0400e50000eb0000 -ed0000f40000fc0000ff0400e30000ff121eff2f3bff101cd40000ce0000ff4e47ffa79dffdee1 -ffe3e1ffefe1fffde1eeffe1d2ffe1bcffe1b0ffe1ffe7d4e084799f1218ae0000fa0023ff1846 -ff0d3bf4001dda0000dd0000e30000eb0000f50001fc000bff0b13ff1018ff2f45ff1d2dff4c51 -ffb0a7ffdfc6ffdcb4fff4c1ffffc6ddffffe0ffffdeffffedfffff5fffffcfcfffff9fff4e6ff -e7ffffe7ffffe9ffffebffffeeffffeeffffebfbffeaf9ffffbbdffffbfffffff3ffa4affe001c -d70000c4632eadff91ffd2c4ff2a4cd90004ff164bf2c9c7cffffbf0ffffffe2ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -f0ffe4edffe4eaffe4e4ffe4dfffe4d9ffe4d5ffe4d4ffe4ffe8ffffebfffff1fffff7fff3feff -e5ffffdbffffd5fffffde1fffde3fffee6ffffe9ffffeffffff5fffff8fffff8ffffe6edffeaf0 -ffeff4fff4f7fff5f7fff3f3f9efeef5edebc6ffffc9ffffc2fceed5f8f2f8fffffffafffff3ff -fff0ffff2309ff1a03ff0c00fc0100f30000ed0000ea0000e90000ff2e5cff2452ff1240ff002c -f00019e1000ad80001d400006c9c6aabd1a2f5ffe1ffffe1fff9e1fff2e1ffebe1ffe8e1ffffbd -ffe4a6e59f6cc85632c1200cd10600ed0006ff020eff1e17ff150eff0600f70000f20000f50000 -fc0000ff0500842b49a42d55c0265ac21650b31c4fb05372c6acb5dff2eccaffeed6fff5eaffff -f8fffffffbfffff4ffffefffffecffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff4ebe2dffff1d5ffe8fddfc5ee3a45 -d90000ff3634ffcdaaffd7dac70510fa070bb20800ffffbcb9fabae6ffffffe8ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -f2dad6f5e0dbfdeae4fff8f0fffdf4fffff4fffff4fffff4ead4e1fae8f4fff7fff3f2f8d8e2e4 -cbddddd6f0ede8ffffe6ffffe7ffffebfffff1fffff5fffffafffef0f0f0e8e6e7a9ffe2aaffd9 -aeffcebef6c9dbf0cffff6e0fff7e8fff2e8ffdbb5ffac88f86f4dd23e20c3250aba1400b00100 -a40000ff2127ff1218fc0003ea0000e30000e30000e70000ea0b069e0000b60002ec4755ffb1ac -fff4dafeffdae2ffdad2ffdaffbeb0ffd6c9ffdacfffc8c1ff8c88ee504fd22c2ecb2124c63b24 -c8331fcc2417d5120edf0004e90000e90000e60000b70000c60000de1116f72a2fff3c41ff454a -ff474cff464bfdbfd4ffcae7ffd1f8ffc8f4ffc3e9ffd9effffdffeaffffe0ffffe6ffffeeffff -f9fffffff8fbffecf5ffe3f0ffdeeeffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff5efe2fff1d2ffe8fce9cbff565d -ea000af62a29ff9f7fffdddbcd181ffa070bbc0900fffcbcc2fabde9ffffffeaffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fff0ffffefffffefffffecffffe6ffffe0fbffdbf7ffd9f5c4e0d2e3fdf0f4fffbfbfffbf3f2ee -ede1e1ffedeffff8fbb4f5b5c7ffc2e6ffd6f8ffdaffffdafffcdafff6dafff3dad9ffcae7ffca -d8e1a2bc9164b45237bf2c22d61c1fe61822ff3a00ff1d00f30000ef0000ff1200ff2e00ff3e00 -ff4100d20000cb0003c50011cc2b31e56c64ffb8a3fff3d4fff8d4ffc6caffdad8ffe5dafff2da -ffffdae2fac8ade0a58cce8eff0008ff131bff262eff272fff1820ff0f14ff1316ff1d1ea50000 -bc0000e7000bff1b31ff2f46ff2f46ff2139ff162eb24856cf6573fb919fffbac8ffd1dfffd3e1 -ffc7d5ffbccafff9fffff3ffffecffffe9ffffedfffff8fff4ffffe3ffffeaffffedfffeecfdf7 -edf3f1f3edeffeedf3ffeff8fff1fcffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff4f4e6fff1ceffe8fbf8d5ff8082 -ff1127ea1517e9593fffebdddd3a3bf7070acd0b00ffe6add3fac3ebffffffefffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -e7ffffe9ffffebfcffeff7fff2f2fff6edfff8e9fff8e8ffe4fff1eafff1f7fff1fffef1fff6f1 -ffeef1ffe8f1ffd7e3ffffbcfffcbcfff5bcffca9bff8d68d6492daf0d00960000ec0000e80000 -e10000dd0000e30000f20000ff060aff1317ff1800ff0900f50000f70200f51a00ec2700d52100 -bf1600ffffeaffffeaf9f4dee8e6cfd9dbc3ced4bac7d1b6c5cfb4ffe4daffbdb9ff7b84fd3b53 -ff0f37ff0634ff1240ff1f4dff0b06ff0a05ff0601f90000e10000ce0000c70800c71200e8142a -ff3447ff6573ff979effb8b8ffc3bdffc1b6ffbbadf3e6f7fff4fffff9fffff9fffff9fffff9ff -fff9fffdf0ffedfcf7f9fffffefffffffefff5f7f6dde9e5c8e3dabde1d5eef9f5ecf5f2eaf0ee -eef0effaf8f9fffdfffffcfffffbffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffecf4edfff1c4ffe5f5ffdfffa9a3 -ff2f41e10207bf1806fffbdfef6960f50609e30e00ffab7ceafcccf1fffffff3ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -85f3da92fae3a9fff2c7ffffd8ffffe2ffffeaffffeeffffffffe6fdedd6dfbbabf8bdb5ffdddd -ffd9e1ff9eace76071a50000b80500d51300f5200eff2419ff211cff1e19ff1a15ff060aff0e12 -ff191dff1e22ff191dff0e0dda0600c4000094162ea63046cd6b7affb9c0fff0effff8effffeef -ffffefe9ffeaf7ffeafffae9ffd2d3ff9badff587cf31e4ee50032dc273ad10923c70002c20000 -c30000da0003fc0025ff0e3c9900009b0000a90a00c84123f3865fffcb9cfff1bcfff4bcffd4cc -ffddd1ffeddafffbdfffffdfedffdfdfffdfd8ffdfe3ffffe3ffffe3ffffdaffffd0f6ffcbf1fc -c9effac9effaf0ffffebffffe6ffffdffffae3fffbeefffff7fffffefffffffbfffffcfffffdff -fffefffefffffbfffff9fffff8ffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffe4f4f2ffefbcffe4e4ffdfffc3b4 -ff3d4cdd0000b50000f0ffe1ff9a88f20608fb1106dd6b46fffcd4f5fffffff6ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -c7ffecceffecd9ffece9ffeceffce2f4e7d6f6d8cdf9d1c9ffa6a6e06869ac2e31b42b32e14e58 -f55765d32e3ea4000dfd0a0efb080cf50508f00104eb0001e90000e80000e80000a90000ca0002 -fb4b4bffa899ffeacafff9caffffcafcffcafff2fffff3fffff6fffff9fffefdffe5eefd9aaab7 -637782950000b7000ced0825ff143bff1c43ff163dff082fff0024fc0025ff0935ff294cff435a -e34c55b2413d822c1f641d0bfff6dafff7dafff8d9ffecc9f6edc6eae8bfd3daaec2cb9ef5ffe8 -f0ffe8e4ffe8cdffdfb9ffdab1ffdfafffe8a9ffe8e3ffffe3ffffe0ffffd7fffed7fffee1ffff -e3ffffe3fffff9ffffeeffffe0ffffd7fffbe3fffff8fffffff6ffffedfffff4fffff6fffff9ff -fffdfffbffffeefff9d7f1e8c9e9deffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffdcf4f7ffedbaffe8d5ffdfffc9b2 -ff3b47e50000cc0000d2ffe1ffc8adf10507ff140fbd3014fffcdaf9fffdfff7ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fff3c6ffecc3ffc7a6ff9880fc6457eb3532dd1015d40005ff1a3af90e2dde0016c10000b20000 -b90005cd0e1edf2533d81621d11c23cf2c2dd34d44e77c6affb499ffe7c5fff5cfe9f8d9f4ffe1 -ffffe8fffee8fff6e5ffdfd2f6c7bdeab8afb9423ab0352eab2a25b52928c22c2ebd1e23a60007 -900000ff1a20ff1117ff040af70000f10000f10000f50000f90000d90825f1374cff8187ffcbbe -fffbdaf0ffdac7ffcda7ffbdf1fffff4fffff0fbf7fffffffffbfffff9fffff6fffff4fff2fff1 -f0fff1eaffeed8ffe2cdfcdccaffdeccffe4d0ffe9f8fff4f8fff4f8fff4f8fff4f8fff4f8fff4 -f8fff4f8fff4fff9fffafefdd9fdf1d7fff9eafffffffaffffd4edffabd1ebbcccf7d1deffeff8 -fffcfff9ffffecfffdcdf3e6b7e6d6ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffd5f3fafdecb5ffe8caffdfffc1a5 -fc3039ef0005f40b0fbcffe1ffebc9ef0506ff1b16a50300fff6daf4f6f5fff8ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -dc1400e40d00f00200f70000f30000ef0000ec0000ea0000f0000eff1435ff2647ff001ebe0000 -b70000ff3645ff929dffdee1ffdfddffd2c4e2d1b5c6e5b9c1ffd0bcffe1b0ffe1b0fffbc6fffb -e3fff3e7b9c4f06f96fa2d6eff0052f90043ff4a17ff2c00ff0a00f40000ff0900ff1800ff1b00 -ff1800ff1401ff0a00ee0a00d12c00cf7129e9ca6dffffa3eeffa3ffebdaffebdaffecdaffecda -ffeddaffeddaffeddaffeddadef3ffd4e0f8dbd4f3ffe3ffffeaffffe2ffffdbffffc7fffff9f4 -fff8f4fff8f4fff7f4fff6f4fff5f4fff3f4fff3f4ecdec4fceed4fffee4fffee4fffee4fffde3 -f1e3c9ded0b6fff1fffff9fdeeffffe3fffff1fffffff3ffffadd0ff6a9d875063a67787d4b4bf -faeff3f8ffffeaffffe0ffffd8fffcffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffc6e7fcfaebb2ffe8c3ffdfefba9a -ef262ef7000aff1d25b0ffe1fff5cfef0506ff1f1a970000fff3daf2f0f1fff8ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffff8fffffcfffffffcfffff7fffff1ffffecffffe8ffffe6ffffdacc -ffe5d7ffeee0ffecdeffe5d7ffe3d5ffeddffff2e4ffecf4ffecf4ffedf4ffeef4ffeff4fff1f4 -fff1f4ffedf0aeffffbcffffd5fffff5fffffff3ffffe7ffffdeffffd9ffc6ffe3cbffe3c7ffd2 -e7ffe3f8ffe3ffffe3fffbe3ffeedaf8ffc6ffffc6ffd1a5ef6c58d6070ddd0000f8000dff1c33 -e70000e40000e00000de0000e20000ea0000f40000fa0100ff5e9cff99d2ffcdfbffdbfbffeafb -fff1f5fcfffbf1fffbe3e59afff9b1ffffbdfff7bdffeebdffb086df6a47bb3e1eff1710ff130c -ff0b04fe0100f30000e90000e10000dd0000c7000cd1111cd12026bd2220ab251cb94838eb8873 -ffbda5c8ffffcdffffcdffffcdffffcdffffcdffffcdffffcdffffd9ffffdbffffddffffd1fdfe -dfffffe6fff8e9fff1eaffecffc3f7ffd0feffe1ffffe9ffffedffffebffffe0ffffd1f4a8ffff -a9ffffc3ffffe8edffffcffbffe1fffffeffd1fffb41fffbe3fffffffaf3b4ffdadbffcfffd9bf -ffb68cdcffaccaffdacad6a8d3605dff0a33ff0230ff0b39ff0937ff002dc00000ff545dffdac7 -ecffe5d5fff1e7fffbfff5ffffd3f7ffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff9e4f3efe4e4f7fdf7ffffffe4ff -f45e7bfd0013ff0300d7001fffffda43441aff4f7de5000eff9b9ff0ffdaf6f7cdffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffd3d5d4dbdbdbe9e5e6f8eff2fff7fcfff9fffff7fffff6fffffbf4 -fffbf4fffbf4fffbf4fffbf4fffbf4fffbf4fffbf4b0d7babce0c4d2f0d6ecffecf7fff1fbfff1 -fffff1fffff1ffe7ffffecfffff5fffcffffdcfff8b5ffe797ffdc8afed7ffecddffeaddffe8dd -ffe5ddffdcd8ff9897bc4547860b0eeb0000ec0001e70000db0000d40000dd0000f40918ff2834 -e5001cf0002aef1545f0506cf9949cffd9ceffffe8f4ffe8c7d0b3c9cdb2d5d1b8eadec8ffeedc -fff7e8fff4e8ffeee3ce432cd64832e24d39ea4a3ae93f32dd2b21d1160fc70702cf0000d40000 -da0000e00004e70914ed1c22f22a2df43233ff8f93ffaaacffc6c4ffcfc7ffcabcffd3bfffecd4 -ffeed4f7f1fffbf5fffffafffffafffffafffffafffffafffef8ffdbffffddffffe0ffffdafefe -e0fef2eefff1eeffe6e4f5d5b9f3e5d7ffffe0ffffebfffffcfffffff1ffffecffffe6ffcbffff -d6fffff5ffffffedffffdefaffdfefffd4cdc6bb9fa0fff1ffe7faffa7c2d6b8a0ffd1b2ff4952 -cc0000865711ff002ced0016db0004e2000bf80021ec082bb40f1d840a09ff0e2fff455cffa49f -f4f3d7e4fff1ebfffbfff8ffffebffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff9e4f8f1e7e5f8fef4ffffffe9ff -fa6e88ff0d1fff0400de0726fffedaa2926eff4470e4000dde444effffdaffffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffcf1f5fcf6f8fcfcfcf9fffff2ffffedffffe9ffffe6ffffe3f8fd -e2f7fce1f6fbe2f7fce3f8fde3f8fde2f7fce1f6fbb9ffe8bfffe8c8ffe8d6ffe8e1ffe3e1f6d5 -e0e6cae1ddc4ffc4b9ffc7b7ffd0b7f4e4c0eeffd3dfffdaceffdac4ffdaf30023e70019ce0005 -b00000a10000b10000da1529fc3b4eeb0311e40008e10004ec000cfc0719ff061af4000ce70000 -ffcfffffd4ffffdcffffd2ffd3ccf6aecbe994cee288d1e0f7ffcaeeefb3bf9d6dbf6f4ee35e4f -f84445e70d1bca0000e60000dc0000cf0000c40000c60000d60004ed101ffb2330d63556de4160 -e95672f8728aff90a3ffacbbffc1cdffcdd7ffcac1ffe7dcffeadcffeedcfff2dcfff5dcfff8dc -fffadcffe9ffffe9ffffe9ffffe9ffffe9ffffe9ffffe9ffffe9ffddffffe0ffffe7fffff0ffff -f9fff6ffffecffffe4fffedf92fffb9efffbb5fffbcffffbeafffbfbfaf6fff7fbfff3fbe9efe3 -fbd3d3ffbcc5ffb5bfffacacff877ada4f3ab4270cfff4f3ffa8d2ff2355ca2335ff4b5ae70000 -b20000b41d08ff1a48ff002ae3000fcc0019cf4d4fdab396deffd2c4ffdaff5374ff1c43ed535f -ffd4c9fcfff1e4f5ebf7f2f9fff5ffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff7e4fdf4ebe6f9fff0fffffff1ff -ff8ca0ff2833ff0600ee1736ffe1cbffe5caff2e4ff4001d9d0000fff7daffffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffafffffcfffefffff4ffffe6fffcd8fff8cefff7cafff7c6e6f3 -c0e0edbfdfecccecf9e0ffffe7ffffe7ffffe7ffffc4eebccdedbee1ecc4feedcffff2deffeadf -ffe4dfffdfdfffffbcffedadf6b781dd7c51d0492bcf2613d51309dc0b06cd0000ff0b29ff5472 -ff738aff5c6bf4353ccd1f20bf1b19f9000ef50011ee2d2eff8770ffebbaf5ffc6d2ffc6abffb2 -e6f4f4e5e0e6e2bbcde691b2ed6799f94687ff307dff2578d70000ca0000c90000d90000fb0000 -ff1317ff1115ff0408ff2f54ff284aff213df6273bf43e4aff6569ff8e8bffa7a2ffdbfeffdfff -ffe7ffffeffffff4fffff8fffffcfffffdffdec8b3eed9c4ffefd9fffae3fff9e0f4eed4e7e3c8 -dfdec2fff8fffff8fffff8fffff6fffff3fffff3fffff5fffff7ffd8ffffdafefef0fffffefff8 -fffcecfff7e1fff3dafff1d6f7fff1fffff1fff7efffeeeafff7f1fffef1f4fff1e7fff1ffe4c5 -f2736cdd111cd80808c62509b41f00cb0000e60000ffe3e3ffa8bcbd00129e0000fa2f45fe1f3a -fc3947ffd6cddeffd1ddfec9e2efc1f0ebc3fff5d1fffcdafffddafffedaff5475ef0012cc1229 -ffc7cafff8f1e9eee8dee6e9fefeffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff4e4fff8f0e7fcffeafffffff9ff -ffb2beff4d4eff0902ff2b4aff9491ffe8dac41526ff1341ac0000ffded3ffffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffdfffffcfdf0f2f1e1eae7d9eae4d8efe7dbf9efdffff4fffcff -fffcfffffcfffffcfffffcfffffcfffffcfffff9ffffd9d3ffd6d3ffc1c3ff858dff4c5bf11d33 -e10019d9000cb01200b10400b70000c50000d20000db0000e60000ee0000fa2225f02222d2150f -9e00007a00008e1800d36f4bffb890bfffc6c4ffb8d2eca3ffd3a2ffbaa3ff8384ff3043f6000b -f1552ff34425f82713ff0500f30000ea0000e60000e50000ff080cff2428ff3c40ff3135ff0b0f -df0000c30000bd0000ffbabfffbebfffc4bfffd0c4ffe1ccfff4d7ffffdfffffdffff7fffff8ff -fffbfff5fdffe7feffdcfeffd3ffffceffffe5fde5e2f8e1e2f5dfebfae5f8fff0fcfff1fffff1 -fffff1dbfffad9fff8cfffeec7ffe6c6fee5ccffebd5fff4dbfffae3ffffddfbf1f9fff6fffcec -fff4e1ffbca6ffb7a0ffe3caff7fb8ff4580ff1d56ff4471ffa8bdfff3e6e2ffe6a7ffd3fff1c9 -ff5551ee0000ff1411e5622eca5913fa1500ff0b00ffeccfffd4b3a7503dac2021ff8a8fffc6b5 -ffebd1fff8e3a2dc9fd8ffc9feffdafff6daffdbd5ff6675cb000dae0000ff2c4dc70000bf1426 -ffd4d9fff3f1f9f5f2d7e2e4f2ffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff1e4fffaf4e9feffe3fffffcfeff -ffdce0ff756bf31805ff3555f24153ffcecd961819ff405efd0029ffb5bfffffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffff5fffff7fffdf5f3f4fcebf1ffeef9ffefffffecffffeaffffe4ec -ffe4ecffc2caffb8c0ffc0c8ffb6bee79098c26b73ff0c27ff021df6000fec0005ec0005f6000f -ff031eff0d28ff0b13ff0e16ff121aff171fff1b23ff2826fa3127f03627d64c28ff7b56ffbb94 -ffe1b6ffe4b6ffe7b6ffeab6ffebb6ff061cfe0116fa0115ff1022ff2334ff2a3aff2130fc1422 -ff1b00ff1500ff0c00fc0500f90200fb0400f21000ec1900a80000e32f30ff9286ffcdb1ffe0b3 -f0f4b7ebffcaddffcaf4ffe4f7ffe8f1ffe8eaffe8e4ffe8ddffe8d8ffe8d2ffe4f8e7f9f5eafa -f1effcebf5fee4fcffdfffffd9ffffd7ffffe4fffbe5fff9defaecebfcf2fcfffbfffdfbfffafb -fff9fbe2ffefe2ffefe2ffefe2ffefe2ffefe2ffefe2ffefe2ffefe7fff8e9ffecffffecfff7e1 -ffc4aeb64c36b6321dfd6a56ff1344e4000fc20000eb0016ff5578ffd2caeeffdcb4ffd6dcd0a6 -df363dff041fff7d7efff5b5e1c16cf01f00dd0000b9683bf3fdb6e3d8a0ed746cffc7c1dfffe8 -b4ffe7ebfff3ff0c3aff113fff113df2082ddf0019ec0016fd0026ff0b39ea4a4abd2f2ed96967 -ffe9e6fff3f1fffcfbe6f0f2f0ffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffefe4fff8f4e8ffffd7fffff1ffff -fff1ecff9986e12508ff2848fa1337ffafbaa85648ea4452ff3260ff6885ffffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffe6fffff1fffff7eef1fdcedeffb9d7ffb1ddffb5ebffbaf5ff8480 -ff5a56e4322ee2302cf64440f4423ecc1a16a20000ff2132ff1223fe000ee50000cf0000c50500 -c71b0fca2a1ae40002fb001fff3b51ff7d87ffb7b5ffddcfffe6cfffebcfffdbadffb185fd683e -cf3009c21800cb1600d61a00db1c00ff2632ff1d2cff061ae90000d00000ce0000e20000f7000c -df0000ed0006f51424f9514eff9982ffe1b6ffffcafcffcaf3ffe2f7ffe8f2ffe8ebffe8e4ffe8 -dfffe8d9ffe8d8ffe8dbfff1ddfff1dfffeee4ffece9ffeaeeffeaf4fdeaf7fbeafff1f4fff3f4 -fff6f4fffbf4fffff4fbfff4f5fff4f1fff4defffed8f7f2dbededf5f6fbfff9fffff3ffffd2e7 -e5afc7ffd3d3ffcacaffc0c0ffbebeffc9c9ffe0e0ffe8e8ffe8e8e9fff1e3f7dbffffe4fff3da -ffbba4af2b16b21000ff5844cb564ddf3e44f91f38ff1638ff3951ff8a85ffe9c2eaffd4c0f0ca -c33b4fff0035ffa6b2f4ffcab9f498ca280fcc0000ae0300ffffb8fffbc3f43944ff6678d9ffef -a7fff1c9c9c9ff0533fb0024df00089f0000950008e3585dffced7ffccdad2b589edcba6ffeace -fff6e6fff8f1fffcfbfbfffff4ffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffede4fff7f4e9ffffcdffffe9ffff -fff7ecffb69bd3310be30828ff1947ffbbd0ecbea4a11c1fff3d6bff022effffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffdcffffcfede3beb2b6b36f86b83662c9114fdf0049ef004aff1e11 -e50000ca0000df0000ff2215ff372aff1d10e40000f30000f50001eb090be83024f46a4effaf84 -ffecb6fff9bde6ffe1f0ffe1fdffdefbddc5e4a095bc5556900e18720000e83612cf1200c00000 -da0000ff0d02ff1c11ff0a00ec0000f8000dff061dff0f26e7181eb5321eb17448ded698f8ffc6 -d6ffffd6ffffd4ffffc5ffffbaf6feb4f3fab3f2f9b4f3fac4fffbcffffbc6efddecede8fff1fb -ffe3fbffd9fbffd3fbe4fff4ebfff4effdecf3eae1ffe3e2ffe7eeffe7f4ffe4f4ffeae4ffede4 -ffefe4fff4e4fff6e2fff2daf7f0d4f2eed1e1ffffe3fbfdf6fffffffafffff3ffffecffeba5c7 -b86b8fd91135d1092dc80024c80024d81034f42c50ff4c70ff6084e6ffe8d4e5c5fffedffff1d6 -ffddc4e5523ef74430ff9b8a85ffacd6ffcafff4cdff9a93f7484de2534dffbba0fffbcfc3fffb -ef829fff1256ffa7bacdffdc9dffb8dd604cff1227ec0000ffebb3ffe7bfbe0000b90000d5e6d3 -caffffffe3ffc92f39e67d77ffe2c3f0ffdaddffdad0ffc6d7e7b8e9ddb7dfffceeaffd4f9ffdc -ffffe6eddfd4fffbfafefffff8ffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffebe4fff6f4eaffffc7feffe4ffff -fffaecffc6a6cb360cc9000dff3563ffc0dafffada630000ff2e5cc20000ffffdaffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffecffffeffffff4fffffbfff8ffff -eaffffd6fff5caffeedef8d1e6ffd9f1ffe4f1ffe4f1ffe4f1ffe4f1ffe4f1ffe4ffc9eaffd6f4 -ffdcf4ffe4f4ffecf4fff4f4fff7f1f7eee5ededfffcfcfffcfcfffcfcfffcfcfffcfcfffcfcff -fcfcffbebf95e0e1b7ffffdaffffdaffffdaffffdaffffdaffffdaffffc6ffffc6ffcba2fb7461 -ea1f23eb0000ea0000f5000aff2537ff182cff041bf6000bee0003ef0004f6000bfb0010cb0000 -f90029ff1e55ff2158ff1442f02044ff5470ff889fc7ffe1d2ffe1cff6c7fffddcfff2e1ffe3e1 -ff929bcc3b4aff1710ff130cff0b04fe0100f30000e90000e10000dd0000e00000ef0000ff0801 -ff1811ff1a13ff0d06f70000ea0000f8d8e3fff1fcfff4fffff4fffff4ffffecf7fff4fffff4ff -f0ffffebf8fefefefffff9fffff3ffffeeffffe0feffe6ffffdcffffebffffe7ffffd5ffffdaff -fff3fff9f3ffe5bbd3fbfefffffbfffff7fffff1ffffebffffe4ffffe1ffffdfffa4ecdeffc9eb -ffbdffffdcffc0ffff6dffff85ffffb5fffafff8ffdafff3beffe3f0ffe3ffd6c0ff252ad50000 -ea00008e674ae52b40ff0e3cff1947e04952bd4745e6001dd10000a61b00ffb3bdffd9efafffff -b1fffaf9557aff3235ffda81ffd6ffc4fff293fffbfefff1ff8cc9ff0637ed112bbbc38aa2ffda -c7b793dc2136f31234ff9a9efff7daf0e0bc906449dc0000afffc1caffcafd001fff0035f1efd6 -abfff1e8ffeeffd6977f5410906f28ffdd9bffdaacffa595ff3e42b20000bc040cff797affdfd5 -fff7e5fbfeedf8fffbfffefffff3ffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffdbffffcdfcecd1f1e6f8fffffffbff -fff4ffd7a8b8976073f60000fe0809fff5d4b1c9a9d9103cff1138de0000afff98ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffdeeeffe3f0ffecf5fff8fbf9ffff -eeffffe6ffffe0fffffff5f4fff5f4fff5f4fff5f4fff5f4fff1f0ffe7e6ffe2e1efeddeeef1e0 -ecf5e2e8fbe5e2ffe6dcffe7d8ffe7d5ffe7f7fffff7fffff7fffff7fffff7fffff7fffff7ffff -f4fffcf0ffdaffffdafff7daffbfb4ff656fe61431de000dd70000ff0016f7000ceb0000e80000 -f00005ff0014ff0b22ff132ac90000d30000e00d14e82728e43932d43c2fc03725b3321df58675 -ffaf9cffd6beffd6b9f7c19de7c298ffe9bbffffcfffebcfffa991c65847b73128d53132f2343e -f52233e80a1fcf0000d40000da0000e00004e70914ed1c22f22a2df43233de7055f18368ffa186 -ffbda2ffcdb2ffd0b5ffc9aeffc3a8fffbfffffbfffffbfffffbfffffbfffffbfffffbfffffbff -fbfffff6f9fef5f6fbfffbfffffbfffff9fffff8fffff8ffddefefe4ffffeafffef3e7f1fceff9 -f5fffff1fffffcfffffdfcf8f7fcf6effff6eafffbdffffbd5fffbcefffbcafffb86ffffe7ffff -ffdcffffd5faeefefecdfffff8ffffffdbfef7ffffe7f9ede2e3d1f5baacf1635fe11013f90d0d -ff3d37d9ebbbffc1b9ffa5bdffb8c3ffdbc0d3cea6e8837bff395a922e00ff586aff81afd1efed -caffffff94a4e9181ee95f30ffb7f9e2ecee99fffbbdfff1ffd2d7ff3d67ee0b27be2d28e6ffda -fcb0a0ec2f45e22b3fffada2fffadaffcfbac84849e20000cbffc1d2ffcaff0b31ff0033f2ddca -aefff1efffeeffd2cafe3b41e50002ff0520fa0013ff1530ff3e48b40b08ff1f37ff5a6affb2b4 -ffefe6fffdf1fbfffbf9fefffbf8ffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffe0ffffd8fef1d5efe6f5fefbfffcff -fff6ffe7c1ceb58696ff0400ff1516fff1d4b0c8a8c40e34fd0020e90000d2ffa3ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff1fcffeff8feedf3f3edefedf3f1 -ecfdf7edfffeeaffffffe8ffffe8ffffe8ffffe8ffffe5ffffddffffd7f9ffd3f5b2ffe8b5ffe8 -b5ffe3b6ffdebdffdec9ffe3d2ffe8d5ffe8fff9dafff9dae4c3a4e4c3a4ffe8c9fff1d2e4c3a4 -ae8d6eae262ac42a34d92437e50a2aeb0017e80011f6001fff0230ff1229f9000ee50000f10006 -f31d25da3e32aa3b20822907bc0000eb0000ff3a4affa092ffedbff1ffc6c3ffc3a0ffb884ffba -9dffbac8ffbae6ed9dd77f4fdb2a18fc070cff0f17e90000f20000ff020aff0a12ff050df00000 -d60000c40000d63556de4160e95672f8728aff90a3ffacbbffc1cdffcdd7b5e1bdc5f1cddeffe6 -e4ffece4ffece4ffece4ffece4ffecf7fffff7fffff7fffff7fffff7fffff7fffff6fffee8f4f0 -fffbfbfffcfbfaf6f3ebf0eaebfbf1f0fffbebfffbe9fffbadfff9b4ffe9b2fee0b2ffe7ccfff1 -f9fffbfffbfbfefffbfffcddffeed0e6cbaeeacbafffe4cafff7ddffeed6ffddc5d8fffbffe2ec -ffa2ccffa7cfffe3effbfffbfff9fbffe7fbcdffe7fffbefffb0bff93853cd0417e23d39ff9a7f -ffcfa6f0ffdafff6daffe4dafff2dae9ffdacdffdae0ffccffd9bda7793dff1935f8002df490a8 -dbfff6ffe9d8db0f1aed0000ffafebfff4ffbafffba0fff1d2ffe3ffcfc1ff4b5ed40000ffdad2 -ff8997fb3951d15354edd3b2fffedaffb5b5ff1840ea0000dee89fe0ffcaff3652ff002ff2b9b2 -b2fff1fffaf0ffc5ccba082acd0004f6002dfd0034ff7092fffde8c3ffe8ff3f60ff1f42ff6677 -ffe4e6fff7f1fdfffadee8eaf8ffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffeaffffe8fff9ddeee8f2f8f6fffdff -fff9ffffe6efe0c0cbfd0200ff2123ffebd4c3dbbbbb2842e20005f10000faffa1ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffbfffffcfffffdfffaf8f9eef0ef -eaf0eeecf5f2eef9f5fff7fffff7fffff7fffff7fffff7fffff7fffff7fffff7ffc3ffdfcaffdf -d5ffdfe4ffdff5ffdfffffdffff5d7ffead0ffbeaaff8975f44f3be23d29ed4834e94430c41f0b -9c0000f4001df80021f4001de6000fbb0004a90311b42f32c55450f2141fcf070abc1910db6c51 -ffdaadffffc6f1ffc6d8ffbbddffc6f1ffc6ffffc6ffe8c6ffbeb6ff6a7aff253cff0014d70000 -ed0000ff0400fc0500e00000d10400db1d03ea3719ff1914ff100bf40000ce0000bd0000e51d06 -ff8165ffcdafffdbfeffdfffffe7ffffeffffff4fffff8fffffcfffffdffcaffffcdffffcdffff -cdffffcdffffcdffffc4ffffbcfff9eeffffe7fff8d4eee5d7f1e8eafffbeeffffe9fffad8f2e9 -ffefe9fff9f1fffdf1fbffeef2fff1e9fff1e2fff1ddfff1c0fff1f3f6e5f1efe0cdfff1e6fff1 -ffa6bbff87aeffc1d2ffbda8ff7b6bda332de91c23ff2d42ff3851ff1c35f8000fed0443fd0045 -ff195eff6a9bffd6e2eefff1c0fff1acfff1bfffdeffeee1ff6d97ff002af81533ffbbaefffed1 -ffffcfffb8a7ffc1b6ffccc1ffceb8d6d3aac6e4b0e5ffcefcffdae9e3afff3d5cd90005ff466f -f9ffe3f0ffddda1e2deb0009fff8fffff8fffefffbabd2b5bdeec1ffffdcffd1cbff253aff607e -ff4065fc324cce766ae7fbcaffffdaffa4b0ff0735e60104f79973f2ffcaff7c7cfc002af18992 -b7fff1fff2f1c6fffbcae6d8ffdce9ffddfbffb9d2dcd4d2c0fffb84ffefff4263ea000ddd1d36 -ffdce3fff4f1f5f6f1d2dddff5ffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff8fffff9ffffe9efedf1f3f2fffeff -fffdfffffcfffff7fbe90000ff2225ffd3c6f1ffe9d36d78d80000ee0000ffc673ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff8fffff9fffffbfffffefffffffeff -fffdfffffcfffffbffe0ffffe0ffffe0ffffddffffe0ffffe0ffffe0ffffe0fffffdc8a8ffcfb3 -ffd7c0ffd1c2ffb9b3ff9294ff6a71ff505bff0a05ff0a05ff0601f60000e80000e20000e70000 -ee0000ff3765ff3d69ff4566fb4c5dd95b5cd48274eabca2ffe8c7ffedc6ffe7c0ffb791ffb38e -ffc3a0ffb391d27554973818ff0e25ff132aff1e33ff2c39ff393ced3e39da4034cf4030ff1823 -ff1e29ff1d28ff0f1af90004ea0000ea0000ef0000970000e64a33ffbb9dffe3bcffedbcffe7ac -fcdf9df8e5a0fff7fffff8fffffbfff5fdffe7feffdcfeffd3ffffcefffffefcfffefcfffefcff -fefcfffefcfffefcfffefcfffdfbfff7ffffecf8f4dfebe7e1ede9f1fdf9f7fffff7fffff7ffff -ffe0cefff9e6fffbe6fffde6ffffe6ffffe6ffffe6d1d8b9fce1ceff6f91ff8da8ffffe6fff7e6 -ff2b68fe0033ff305fff0a23dc0000b50000c10000ee0717ff303af0252bca070bff0038f80037 -e8133fee395aff7588ffc4bce4ffe6afffe6b9ffc4ffb1a1ff2148f30018ff6a83fff9ddf4ffe1 -bec4a2e40023e6263ddd434dc73a40bc2b32d65154ffb1a7fff0daffffe3ff9db0fe0021ff0425 -ffd7b1bae8a8cd2c3cfe0030b5fffff2ffffffd1ecc83859d05361ffe9dcfff3d4ffd2adf40a2f -ff0732f31e3cd87c71eeffd4fcffdaffafb5ff0d3be21912ff4444ffffc4ffcbabf70025f05871 -bdfff1ffeaf397f7d25dbd98b5ffead5fffbf1fffbfff4fbffe2fbffd5f8ff2d4ec70000b60f20 -ffcfd0fff7f1f3f4efdce4e7fbffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffbfffffcfff8f2f4f5f3f4feffff -fbfffff9fffff8ffffd20000ff1d21ffa29ff2ffeafbc9c2e10004eb0000f8612cffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffc9e9ded7f1e8eefff9fbfffffffdff -fff9fffff6fffff4ffffffecffffececeed8d4d6c0c5c7b1c2c4aec5c7b1caccb6ee252dfa2e37 -ff3844ff3948ff2d3fff1228ed000ddf0000ca0000ef0000ff1820ff2830ff252dff2a32ff4149 -ff5a62d0d1a7e1d1adf4c8adffb2a4ffa2a1ffaab5ffc5daffc0daef6352de4236dc2321ff212c -ff3249ff3e55ff2b42ff1128ff1930ff0b20ed0008d20000c20000be0000c20000c60000dd0006 -f1001aff103eff546cffa69dfdf1cbdfffdac6ffdaffedcefffcdaffffdaeffccec9eeb8c4fec1 -d2ffdacdffdaf8e7f9f5eafaf1effcebf5fee4fcffdfffffd9ffffd7ffffffd6f8ffd9fbffdeff -ffe5ffffe8ffffe8ffffe8ffffe8fffff7fffff7fffff7fffff7ffffe9f1fff0f8fff7fffff7ff -fbe7c6fffadcfff7dcffd2bcfcb9a8ffd2c5ffb4abca6962d6585be50010ff1344fff7d6ffe9d0 -ff0030c80000ff0e39ff0032fd0029e61334dc6466e1ccadd5ffdda7ffdd89ffd9ffebdcffe6c8 -c7ae8fb44b47d3001eff133eff8899ffe9dcb7fe9ee95b47dd0000fe0021ffc1bbe4ffe8e7ecd8 -9f384dc70000e00021d93945d62134e50012fd0026ff627fffd2d4fff6f6ffeae6ff4950cc0000 -d55a38b2c082c84a58fa003f97dbcef8ffffffb3d0d40033d40009ff6281fff1d4d6ffcfcd2b38 -ef1837f71336e2575cecdeb9f7ffdaffdac8ff5568dd2d1eff0718fff1bfeeffd3f20020ef2851 -c3fff1ffe1f4ffe6e8ffd4cef6cec2f9c4bcb23e4bc70019ed0024c30000ff414dc02428bd5c55 -ffdecffffff1f5faf4f8f3fafff9ffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff4fffff6fffff7fdfff9fbfafffe -f4ffffeeffffeaffffd50f00ff2125fa5b60f2ffeaffffead70013f60000fa0e00ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffb7e6d6cdf3e6ecfffdf9fffffffcff -ffeff8f7d1deebbcccff9f95ff8b81ff6d63f25147e24137df3e34e6453bec4b41f10004ea0000 -dd0000d40000d70000e10c0eee2221f92f2ddd5f53ec6e62ff8b7fffaca0ffc3b7ffc2b6ffafa3 -ff9c90ffffdafffedaffe8d2ff9895f34254ec0529f4001df90022ff4753ff2f3eff0b1fee0003 -da0000cf0000ca0000c80000ff0118ff041bff0d24fe3639eb735be4b685e5eeabe8ffc3c6fbe9 -c5f4e4ccece1dcebe6f1edeeffecf3ffe4f0ffddebd6f0e7ebffffe7ffffe3ffffddffffd9ffff -c0ffeab0f1dbfff1f4fff3f4fff6f4fffbf4fffff4fbfff4f5fff4f1fff4fed6d7fed6d7fed6d7 -ffd9daffe0e1ffe9eafff2f3fff3f4ffe2f9ffe8ffffe8ffffe2f9e9a5bcda96adffc5dcffe8ff -ffffd2fffdd4ffedcec66b59bd3935ff5d66ff4e61dc041cd2534dc30000f60019d2ffc9d9ffce -ff0026d70000f46665ffadcdffbfdaffdef1fff4fbfefffbe7fffbd6fffbcdfffbffffd4e2ffd4 -d8ffd4e2ad8eef0926ec000fff455dffc8b8d6f494dd331cd50000ff3c51f7ffe0b9ffefc1929c -e80040ee0018f66069ffc1aeff9c9cff2351ff002aff2c52ff8d8effc4e6eeffecd7be86970000 -ef3214ffebb9f1969fee0043dd4180ffcae4fff5f7e2617dd5000af50020ff8b8ae6ffcfe6b89e -ff6f79ff173fe31933da9381f4ffdaf9ffdaf2cdb0d93e28e60000ffe6bbc3ffd3ee001cee0439 -c7fff1ffdaf4ffbdb4d42826d0040dfe1226e50000ff0520ff4e69ff425dde8a70e6af91f1e3c0 -f3ffe4eefff1f8fffbfff8fffff1ffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffebfbfff2fffff6fffffcfff6fffc -e6fff7e0fff9defffdff592bff3135be0a16f2ffeaedffeac60a19ff1115f50000ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffd8fffce0ffffeafffff8fffffaeff3 -d4b4bfa67787875063ff2019ff110af90000e80000e60000f30000ff0902ff160fff2129f70e12 -cf0000b70000be1705e6563cff9b7bffc8a5f1ffe1edffdde2fdd2f1ffe1f1ffe1f1ffe1c4dfb4 -789368d4001cde0726e20b2ad8001ec8000dc5000ad5001ae80b2cd20003d30208ca0809b90703 -ac0e03b92c1bdc5b46fb816af7ffc6fdffc3fff9beffe9b8ffdab5ffcfb4ffc6b4ffc3b5b9ffff -c1ffffd1ffffe6fffffcfcfffff2ffffe9ffffe5ffedffffedffffdef0ffcfdff6d9e5fdf1fbff -f7fefff8feffffeae4ffede4ffefe4fff4e4fff6e2fff2daf7f0d4f2eed1f8ffe4f8ffe4f8ffe4 -f8ffe4f8ffe4f4ffe0f3ffdff4ffe0ffbcddffdeffffdeffffbadbbb5a7b983758d06f90ffb8d9 -ffffcfffffcfffc4a2881405800000ea051cff0f30d90000fead92f1000fff122ea0ffcf99ffcf -f12131f70015dec89996ffffb0ffffe2ffffffe9ffff8fd8ff228cf70055dd003be64646ffd8b2 -f5ffcffff3cfff6b78f9172db8644a8dda8affffa3f13b23f70005ff8b8ac7ffe383ffd5c26786 -ff0568eb3a4cffceb6edffdafff5daff7594ff0836df0d2aa95648ffaadfc4ffefbfffb48b0000 -ff4b32ffebc3ffe5ebd2004bfd0054ffaddfd2fffbf7f5e6fa073dcd0000ff314dffecc0ebffda -ffc1bcff234de00013c75652e0fbc8d2ffdad9ffdad7472dd40000ffe1b9acffd3ec001aee002c -cafff1ffd6f4ffd196b82806ec0000ff2b2fff282cff8264fffcaeb5ff9ad2cb97fcffd4e9ffdc -dcffe6d9ffeaf5fffbfff5ffffebffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffdef1ffeffffff4fffffbfff4fffb -d9f9eecbfaeac9ffedff9763ff4044930000dbf3d3e0ffeaba1019ff262afc0100ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -e7f2eee0e2e1efe4e8fffafffffdfff5ffffe3fffcdcffffbfffffdaeaffffa6a4ff836cff5537 -ff1201e80000eb0015ec0000f30000fb0400ff0d00ff1000ff0f00ff0c00fb0800a8c398cde8bd -f1ffe1f1ffe1f1ffe1f1ffe1e8ffd8e6ffd6f0ffcfeff4bcd4a881c75c4ad22328f50721ff0b2c -ff1637ea0000ec0000ef0000f30000f70000f00200e40d00dc1400bc456de8789effb7d7ffd8f2 -ffdef1ffe3eefff7fdfffbffffedfffff0fffff2fffff5fffff8fffef3fffdfafffffdffaeffff -b3ffffb8ffffc5ffffd8ffffe7fffff1fffff7ffffedffffccffffc3ffffd6fffffefefffff4ff -fffdffe6ffff75ffadbfffdae9ffdaf2e6c0ddc0a0e2ddb5edffdad8ffdadfcac5f1fff1d1fff4 -b9fff4aaffdebbe9cdfff2ecffeaf4cf0000fd4023a90000b80000ff3c73ff1331ce0000ffaf6c -e4fff4ff9bbcfffff4fff7f4ff0250ff004bd6ffeafffef4fefbff9c0000ff1000ff573d60ffd0 -fff5ffff2766ffa356aef1ceb9ffd8c8c8aeee475bff0228ff0c27ff0718a90e00cc0820ff425c -ffc2d4ffdcdae0a8914113008c2e24ffbac2ffffdaab0000ff1f45c9e7b3bcffdaffdbdac20000 -ff0836ffe4e4ffe1e2d6f2f5d8fffff8ffffffb8c6ff2c3bdf0000fff7d8f5ffdafb968eb77662 -f72542ff939dd1ffdae6000fdb0000f5ffca68eea7ffe5fbae001c910319d83933f90000c7ffcf -ffffd4ffa0a4e40635e90b46ffa5cdfffeffc1ffffff1d4bff0836fa807ffbffdaffc7beff103e -e72c41adf4b2ffae8fff6b51ec331fff4b38ffa387ffe2b6fff3b6ffe79fd50000db0000ff031e -e90019cd102cffc2d0fff1f1a9a59affffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffbcdfa9ff586bc60000ffeadaffffda9e0007ff0d3bff0e3cffd8e7fff7ff -fbffffc4dbd3f5fffffff9ffffe1f4ffe2ffffffffffffffffffffffffffffffffffffff -f3f7f6ecececf3edeffffcfffffefff9ffffe5faf3d8f6ecfb89cfe9487eff1634ff1c1aff1508 -f10000f00017ff034be90026f1083dfe4066ff8497ffc9c7fffce8f0ffe8e0ffe8ffbfb3ffcfc3 -ffd5c9ffbfb3ff9185e06256c5473bbc3e32ff3951fc263ee00a22cb000dc50007d20014e61028 -f51f37d40005dd1015eb3532fc6457ff9880ffc7a6ffecc3fff3c6f59fbcffc4deffe9ffffefff -fff4fffff4f9fffefffbffffeedae6f7e5f1fff4fefffbfffffdfffffefffcfffffbfffffff8ff -fff6fffff2ffffecffffe6ffffe0ffffdcffffdafffffbfff3ffffd9f9f4dcf6f3ebf0f4edeaf1 -e5f7f7e1ffffb5ffd2dfffdafffbdaffe0daffb7c2ff6576e53d4cd83c47ee3765fd5880ff94b0 -ffd6e4fff1f1fffdf1f7fff1dbf7dee70000ff3b2dcd2427de3c54ff9abbff5062de0200ff6843 -d5fff1ffc2cdeefff1fffcf1ff003fed0037d9e8d3fffbf1e9ffffbb281eff1500ff3d2892ffed -fff1ffff0140ff8344a2fff4a4fff19bdaab9d2429c80000eb0004ff1728fc352ec70000c91629 -ffa79fffeadaffb7aeb53b3acf5c59ffe1d7fffcdab30000ff1d41d2d8accbffdaffe0dad80001 -ff0634ffe1e4fff0f3ecffffd9fffff7ffffffc1ccff3340df0000ffdfc9f8ffdaffbfb2cf9981 -f81d3dff6c7bcfffdae70010eb0000ffffca8dffbfffeafbca0644af1932f54d4aff2529c0b683 -fff1d4ffdadcdf3c57b82446ffc1d8fcffffbffbf1fd0026f2001bf36b6fffffdaffc5b9ff1240 -f8384fd6ffcaffffcae7b288b83b29ca070dff182fff3550ff2b46ff102bef2e25e91d1cfe2834 -c9000fa3000dffb4c1ffeef1fffbf4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffc8e3b0ff4f64cc0000ffeadaffffdaae0e1aff0c3aff0d3be7b2c4fff5ff -feffffc9ded7f4fffffffbffffdeefffe5ffffffffffffffffffffffffffffffffffffff -fffcfffffdfefafafafdfffefefffffffeffeae1e4ccc0c4f21c42d90011e00000ff1112ff232c -ff2243ff457fff79c6ffd6ffffdbffffe4fffff1ffeefbffc1f1ff98e6f382dfe7fc0005ff0f17 -ff1e26ff1d25ff1119ff0d15ff1a22ff2931d50000d80003e1000cf1001ced1335e14351df6b6b -de847bf9d1c9f6d8cdf4e7d6effce2e9ffecd9ffecceffecc7ffecfff3fffff4fffff7fffffbff -fbfbfbe9f5f1eafff8eefffff7fffbf7fffbf2fdf5e9f4ececf6eeecf6eee4eee6dbe2dbfff4fb -fff2fbffeffbffecfbffe7fbffe4fbffe0faffdaf5ffecfbffeafbffebfaffebf1f9fffbe7fffb -e3fffbe7fffbfcffdafbd8bae67571ff445cff002cc30000d30000ff1644ff0443f3002af5002c -ff2d6cff9dcaffe5e8e6ffe896ffcff60000ff3437f45f65ffb9bbfff0ecffa3a0f60a0cff1f0f -cbffe8fcfae1d5ffe8f9f7deff003ddd0025deb4a8fff7e8cbffffe9a580ff1d00ff1209cdffff -ffeaffd90010ff4e24ffdaf4ffebf1fdcbc2d4595ef8243aff6e73ffeab5caffbdff0028d34249 -c5cea1ffffdaff98a4ff1a3ed7444ce3ccaaffe9d0c80015f61b3be4bb9fe6ffdaffe9dae60628 -ff0331ffc9d2ffdde5f0ffffdbfffff4ffffffbcc5ff353dd50000ffa8a2fbffdafff0daf1ccaf -ff1239f9354dc8ffd7ff0028fb0000fffacac0ffdbfff1fbee477bd72e4dff5f60ff6264bc1e1d -ffd2d1ffdedce59a97a17876f5e9e9f9ffffcbdde1d60005d70000f44f5dfff7d2ffc4b2ff183f -ff3e57ffffd8fffce8f3b8b2b63345b40015e80027ff0847ff0b4aff003ceb835cf3775bff8278 -da393e890004f1838effebf1fff5f4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffdde9bbff3c56d70006ffd5c6ffffdacc353eff0a38ff0b39bc788ffff1ff -fffdffd0e3ddf2fffffffeffffdae7ffeaffffffffffffffffffffffffffffffffffffff -fff7fffffcfff9ffffecfdf7f9fffffff9fff6c7d7c48097d42707c3310acf6b3aeebc8be6ddb4 -c4d7c3ccebede3ffffd9edebe1e2e6edcddcfaabcaff82b2ff5796ff337eff1e6fff2823ff2823 -ff1c17fc0000db0000ce0000d90000ea0000ff1350ff215eff4378ff7397ffa4b5ffcdcdffebde -fffae6eeffffeaffffe2ffffd8ffffc7ffffa9fff292fae385f3daf9fffff8fffff7ffffeafbf5 -daefe8d3ede4d5f3e9dcfaf0eafff1ebfff1e7ffe8e7f9e3fbfff1fffff1fffff1faf0e4bdf6d3 -c7ffdddaffeee0fff1e3fff1e6fff1e7fff1e9fff1ffc6d5ffb1d0ff9cc3ffbbcdfbfff1d2fff1 -e0fff1fffeefffd5d5dd5056a90311d8162ee91231d40013ff2c50ff9fc4ff9e9df5435be90017 -e1000fff164bff94a0f4ffdeacffdfff241fff2a3fff7183fffaf2d6fff6f5dfc7ff2330f30000 -e2ffdfe0ffdfcfffdffffedfff4564e7022bea797bffefdab8ffffffffcaff2000ef0000f7ffff -ffe3ffc80000ff2103ff9ec8ffe2f1fff3e8ffc0b9ff9092ffb3a4f9ffb8a2ffb6ff0533d66561 -98f4abd7f5c1ff5974ff002bff4c5fecfeceffd0c1df2c3fe51632fc958effffdafff3d8f04e5b -fc012cfd7685f9adbae2e6f1d0ffffe8f9ffffc1c6ff4649da0000fb5563ffffdafffcdafff9d4 -ff0b39f10a2ec5ffd8ff3662ff0105ffb294ebffe8fffbfbff83aaec2e54ff585fffa191f1000f -ff576affc1bdfff0d9ddfee3e5fff9f7fffffaeefcbb0011d80001ff3953ffe5c8f7c8aeeb213b -f92d48ffd4bfffd7fbff9ac3eb5382e24676fa779fffb7cffcdbe2e3e4dfffdda1ffe2b3ffe3ca -ffb5afb4323ad56b75ffdee6facccfffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffaf2cbfe2544e4000dffb2a4ffffdaf4696eff0936ff0e3797415effd6ea -fff8fedbeae5f0fffff9ffffeed9e0fff1ffffffffffffffffffffffffffffffffffffff -fff1fffffafff2ffffd7f8edf3fffefff4ffffb4d2c64470ef0b00ef431bffba8dffffdaddffed -c8ffeebceadddcf7f2da3714e53013f8210fff0b06f90000e60000d40000c90000a00000b40f00 -cd2814e43f2bff5b47ff8975ffc4b0ffd0bcdad8c9e7e4d5fdf7e9fffdf1fffcf1fffbf1fffaf1 -fff9f1f8e8fff8e9fff6edfff2f2ffeff7ffebfcffe9ffffe7ffffebffffebffffe8fff9e4f9f2 -e9faf4f0fcf8f2fdf9f2fbf8d9f9d2d8f2cde0eecdfefadffffbe6fff6e6fff1e6ffefe6e8d9c2 -eadec6efe5ccf2ecd2f1f0d4ecefd2e7eecfe4ebcc802c2cd71b3eff0e47f44d69e2e2c6caffe6 -f4ffe6d68584ec0529db0a27ff6a78ffdddaffecdafff7d9f8eac5ffffdaa8ffd3e5ffceffaa9c -ff4259ff1533f14e53fed0aeebffd3ff6569ff223eff557cfaeff7b0ffffc5fcd5ff515de90000 -fac8a7e2ffd3e9ffd3fff0d3ff8e8ff91d36f8444fffe4c1b0ffffe2ffcaff1c00e10000ffedff -eae1ffd90026ff060086ffe381fff196ffe8ccd4adff3d4eff0c27ff0213df0000e5000ec5645b -8ef6a9b2d59ffd2c49ff0028ff768fffffdaffb5b1fa646dd21229ff6b7bffeddafffdd5fd9c93 -f10128d5394ff497aaf1e9f8d7ffffeeffffffe8e9ff7e7aff0801ef082cf6f3caf8ffdafcffda -ff0d3bf70020c1ffdaff96acf40403dd4d42fffde8f1fffbffb2cbf01847ff3946ffcda9ff3657 -c2000cad4440fffde6ebfff1e7fffbdfeaecfffaffca4a4bf00019ff244bffd5c0f0d9b7da3543 -e71230ff8384fff9fbffe2e9f9c3d1ffcddcfff5fbf5fffbd4fffbbdfffbfff9bdfff0c1ffe3ca -ffbab4ac2a32c25862ffe4ecfff1f4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffff9daf60a30ec0015e48c80fbfed3ffa0a1fb0c33f212348f2146ffc6e0 -fff5ffe4efebedfffff2ffffdddbdcfff8ffffffffffffffffffffffffffffffffffffff -ffecfffff9ffedffffc2f2e2edfffcffefffffa8d4ce1654d60000ff141cff99abffe2f3ffecfb -f093a5e54456ff3649f40000f80100fd0600ff0800fd0600f50000eb0000db0000fff9dafff9da -fff9daffedcef0cfb0e6c5a6f5d4b5ffe6c789fff994fffba8fffbc1fffbddfffbf7fffbfff4f4 -ffe9efffd9f5ffdbf7ffe0fbffe6ffffecffffefffffeffffff0ffeefffff1fffff7ffffffffff -fffbfffff7fffff4fffff3ffffffdcffffdcfffcdcfff4dcffd4c5ffb1a9ffa2a1ffa4a6ff4973 -ff4169ff3358fe2748ea1f3cdf1f38da2339d8253a5e341bd70f2bfb0026f5183bd9cba8d1ffdc -ffe9cdee2c46e7001bff4a64ffbdbefff3dafcffdaddffd3d2ffd0dbffda7bffabcaffcaffffca -ffdecaff7673ec4944ff8f7dffe7caffc4a7e8203aff2d72ffc8f2b3ffffafffe7ff8f93ee0003 -ff4c56f9f3b9fff7c7ffbaadffa08ef71f2cff192dfff5c3cef5ffd9ffcaff1100e30000ffbfe6 -c1e6ffff647fed0000c9ffe7b3fff1b2ffe8aca986d21624fa0013ff1425ff2b2eff3e6bffb8ad -e6ffd9d5d2a9dc3141e70010f52d47fca699ff9aa1ff9897c10e21ff466affcecde9ffd3ffe4c6 -e60023d52441ffa3bcfff7ffe3ffffedffffffefecffada4ff2e22f5001ee3dab3e0ffdaeeffda -ff0b39f00019bcffdaffd8daf3120cbb0000ffede8dcfffaffdde9ef0037fe1528ffedb6ffa9a8 -a91b1a881816ffcac7fff3f1fff8f8e5edf0f2ffffe8a592ff0430ff0b39ffc2b4faf8cfe06263 -e20727f1364b99ffe8b5ffe8d8ffdcffe4d3ffd1d1ffbec6ffa4acee8f95ff9b74dd6145f56157 -c9282d650000891b26ffdce2fff5f4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffff3daee001df3001cc5695eecf3c7ffd3d0ed1031e21631a01e4affc9e9 -fff1ffebf1efeaffffe7fffcd2e1dcffffffffffffffffffffffffffffffffffffffffff -ffdef5fff7ffe9ffffb0eed9e8fffcffecffffa4dadb0045d80000ff0f3dff9ac4ffe7ffffc8e1 -d63f4ee10000e40000d10000ea0003ff152eff5b62ffa496ffe1c0fffacaffffcaecf8f4f7ffff -f7fffff7fffff7fffff7fffff7fffff7ffffbbfffcbdfffac4fff7cdfff4daf7f3e6f0f2f0ebf2 -f5e8f2fffff4fffff4fffff4fffdf4fff8f0fdeae4f5e0dbf2dad6fbfffffffefffffafffff4ff -ffefffffe9ffffe0faffbddaf7d7b1fff5d4ffeed4ffe1d1f67771bb1f23b5030fcb0c1cff0229 -f60019df0002d00000d20000e00007f10021ff1433c3d19cff7c8cff254cff052cd2b28cdfffd4 -ffcbbcff0024e03a48ffbbbeffe8daba8b716a3e23a05947eb7b77fb6e74b84b2affac8bffdfc1 -ffd5bafa6c56d63425ff655bffb3abebffcbba2336ff1a75ffb4ffdaffffb6ffffffcbc4f1000d -ff0718ffb289ff8e73ff4447e47353d80204ff0112ffffc1fce6ffe0ffcafb0400ef0000fc76a8 -97eef8ffe5e5c80000ff3d8affb0d6ffede8ffbcb1ff696aff6767ffa580ddd68eff96a1ffc9c1 -ffedd3ffd1bafd8785e93a4bc10017990000ff8796ffbeb7b30b1aff2f5dffb4c1d3ffd1fcffda -df0020d11234ffa6c3fff4ffe4ffffe9fffffff2ecff9b8df01100ff0c3ae9d9b5c5ffd1e2ffda -ff0432e4000db7ffdaffe8daff2c22ae0000ffe2e8cafff7fff9fbf40031f60016fffbb6fffbc8 -efb699e26769f3506bff81a3ffd0e7fcffffd6fffffae6c3ff0a34f1001affaea7f8ffdaff9e95 -f51436f0092ddcf5b1deca95e68d6ff95752ff3541ff2235fe1528f00c1dda1910b60000f11b27 -fa2c409d0007b03d4affd7dafffbf4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffeedae6000ff80021ac4e44e1eabdffe0dae3122fd51a2fbc2c5dffd8fc -ffeeffeef2f1e7ffffd8fff3cde8dff5ffffffffffffffffffffffffffffffffffffffff -ffd4edfff6ffe6ffffa6ead3e7fffcffeaffffa4dfe4003fd1142acc6173d3dbe8c8ffffade1d4 -905132c50000eb0000edffffebffffebffffeaffffeaffffe7ffffd9f6ffd0edfff2f2fffcfcff -fcfcfffcfcffececffe1e1fde8e8fff5f5ffffdcffffdbfeffdbfaffe2faffedfffffbfff9ffff -f5ffffd4ffe4d5ffe4d9ffe4dfffe4e4ffe4eaffe4edffe4f0ffe4fffbfffff3f9ffe8f3ffecff -ffe5ffffddfdffa6ccef78a0571f00ba7355ffbca6ffa69bec494ac5030ee1061aff2a42ff1935 -fc0f29e5071cda121feb383eff7272ffb0aaffd7cee0ffcfffbcc2ff294ada0000966c44d2fbb7 -ff867fc600006c190bffeddaffefdaffc3b4b92e33f60f33f4001db20000c50000ff0814ff3844 -ed33279a0200a50400ff5850ffb2b4aeffd19c2632ff2081ffa7fffffaffb5fffffff3e1e10010 -ee0000ff8369f73d31e80000ad3d18b80000f90005ffffbdffdeffe9ffcaf20000f90000df487f -7df3f3fff9e8b10600e5003aff97b5fff1e8ffe9dfff96a0ff5364f54339a54219943c30b54a44 -e3706dffb6adffeadaffe0daff5f74d40001ff7c8fffd4c9ac0a17ff2856ffa7bbc8ffd0ebffda -da001ec1001eff95b5fff2ffcdeffbbbdadcf9cec7f46555ab0000ff2d5bf7e5c1b6ffccd5ffd3 -ff002bda0003b6ffdafff0daff4236b00000ffdbe8c6fffbfffefbfb0032f50011ffffb6bbffc3 -ffffd4ffced2cf0020c30020ffb1d9fffeffaffff6feffd8fb062fd90002ffa19df2ffdaffc9bb -ff2549f90025ff3236ff1418eb0000d20000d20000e60000e30f04dc2913ff0712ff0617ff8aa5 -ffb4d3ffc0dcffccdafff1f1ece8ddffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffebdadf0008fb0024a03f36dae6b8ffe1dade142ece1b2ed23a6dffd8ff -ffecfff1f3f2e7ffffd1fdeecbece1f0ffffffffffffffffffffffffffffffffffffffff -ffe6fffff6ffe6ffffb4f8e1ddfdf2ffeaffff9ed9ee0049ff3b28b50000e0ffcdabffeaffb0c0 -ff345bb2000094b945ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffff9fffbb5ffe792ffcad2ffb6ffe9b6ffc3c0ffd0d2e4fffbffb39db2ffc6fffdc6a80000 -a31404bc0000ff0118702f055c3e08ff152cff5f5ce4ffc6c51c15ea0210a34424ffcbc696ffb7 -ff1c45f5001edf0008fff4daff426ef9908affe5d3e2ffffe5ebe99d0e14ff3843ba1000f9eba2 -d34841ff0138c0ffdaffffdaffbfc8f50024c00000e45159e5e6bcacffc7ec0f00e70700e50307 -ec1125ff3a5dff76a1ffb5e2ffd8ff9effdaff648af3002ec38786ddffecffeeecce798093bd99 -ff0047ff0047ff1861ff6aa1ffc8e8ffeef4f8fff3bdefd2dee3ddfff2e8ff6b7bcb0000f20f09 -ffffcafff1e8ff0c62683200f8ffcadcffe8fff4fb820000ff1150f80011ff403cef0018ff0d3b -ff0937cb353eddd4adf9ffdaffd4cada001fdf0d00ffc5b3ff675cc4332effe4e3fff6f3829c93 -d8ffffff1d21c20000b12703ffba82ffbe86bc320ed30000ff303481fff1dcffeaffd9b7c20000 -d90000ffcee6ffefffafdefffc0008d50400ce915bebffbdebffbdf1b47eff5c58ff818dffffcf -fff1c5e8b28ed37d64e66e60ff8280ffabb1ffc4cfff3850cb0004940000cc292affb8adffe5cf -f3ac8e804825875063a67787d4b4bffaeff3f8ffffeaffffe0ffffd8fffcffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffdbfb934545790000ff2024ffbaacfff1c0d9757dfc0046ff1609ff807c -ffe4ecfffcffe7ffffd2e7ecfbeae3fff2e4ffffffffffffffffffffffffffffffffffff -ffe8fffff7ffe9ffffbaf8e3e1fff5ffecffffade3f71561ff210ec30000f5ffd1b6ffeaff9daa -ff1e45d60000f8ff9bffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffff0fbf1dfcbe4cf9affcb95ff9179ff3b47d42647c34b6fff635ac1ffabfff5c6bd0000 -c5291deb0000ff5970c6a26e6e501aff071ee72929f7ffc6a70400cc00008e2005ffd2c6bdffd8 -ff214cfb0024f4001dfff7daff1540d56863ffe7d9edfffff7ffffdf6162ff414cc91000ffeeaa -d7594de400149be8a4ffffdaffd5d2ff2848dc0005ff1c47ff6f89ff7e89bf0000dc2513ff6e5f -ffbdafffefe1ffffefe0fffacdffffb8ffe7ff88aaff0447c07176eaffecffeee9f3a8acf1ffe9 -afebc7c8fbdae4fff1e9fff1e9fff1e4fff1ddfff1d9fff1f1fef5fffce8ffa3a4f10000f31f14 -feffc3ffdfd0e60042dc0c00ffe3cafffbe8ffeefb9d0030ff3161f04241ffca99f8cfb3ff8f9a -ff224ff5032bff888fffe6daffcfd1ee243ed90000ff9e96ffa09cbb2322bb5354ffefeffffcfa -f7ffffff5867ff1a2eff122dff4762ff3b56f2000cd40000fb1d2ccdfffdffffe6ffa695d20000 -ed121affc7defff3ffbff6fff10007c20500e57d5afff8c1fff8c1ffa582f83b35ff3341ffffd4 -fffcd4ffd0b0d58771b6473ca61a19a30208a60002e82939d11f2bce3236f77872ffcdbdffeed4 -ffe7c6e4c49eebbcccf7d1deffeff8fffcfff9ffffecfffdcdf3e6b7e6d6ffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffe0fbc7817fae0502ff080cff8174ffecbbfea3a8ff1c72df0000ff5d59 -ffdae2fffcffe4ffffd5eaeffff0e9fff2e4ffffffffffffffffffffffffffffffffffff -ffdff2fff9ffedffffc8f8e8ebfffaffefffffc5f1ff4b89ff0400d30000fee5bdcaffeafa99a2 -ff0c33ff070bffffa3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffeafbff859eff2b41ff2024ff1f1dd7010dc7000fd60020fd1f2acca471ffe6c6df1016 -e6302dfe091bffaebbffffc3d6b580ff4057ef2428ecd39bcb3527ea0210be3221ffdfc6cbffda -ff1e4bfc0026ff0a38fffddad4000ab13b39ffe3daf9fdfff0ffffffb9b0ff3742e41100fff6ba -ff9a87e50015989b70fffddaffefdaff9596f02640ff1543ff2250ff0f3dc80000e10001fe4447 -ff958effd2c0f6f2d9d7fadcc1f8d8d5ffecffb5d2ff205dbc495aecebd6fff7ecffd8d6fffdec -73ffe881ffe89affe8bdffe8d2fcd4d7c5b1ffc1bfffd6dce8f9eff2ffe8ffd0b9ff0e12f22a1b -f0f1b5f0ecd3de2f66ff0a0eff808cffd4d5ffecfbd35d80d94960c97958ffffb6b7ffdaffdfc8 -ff1c44df0008ff4569ffd1daffbcc3e73447ff141dff2930ffaaafff696d530000ffbcc0ffeaef -ffdee4fff9e8ffd5dcff3c65d8000fcd0004e21b44ffa4abfff9e8fff1edffcbccff575df01420 -ff4b5cffc6dafffaffccffffffa195f25b52f55650ff9996ff9c99de3f398d0000800000ffffdc -fffcdcffecd2ffcebcfca49ae47271cb484dbc2f37dc6163fe8c8bffc1b9ffdfd0ffe9d1fff3d3 -ffffdcffffdcfff4fffff6fffff9fffffdfffbffffeefff9d7f1e8c9e9deffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffeafbffcac2e53d3ae00000ff4036fffbc9ffdddcff3086c30000ef3d39 -ffbbc3fffcffdfffffdaeff4fff6effff2e4ffffffffffffffffffffffffffffffffffff -ffdceafffafff2ffffd9faeff4fffffff4ffffe0feff8ab6f40000de0000eb9481e4ffeaffbcc1 -ff1138ff0e12ffde90ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffe7f7edff6a86ff001afa0000ff3628ed6e5dff5a7eff348aff0d24e65244ffdbc6f53737 -f91924e9000dffd5c6f9ffc6fffac6ff7582f71924d47b59f06b58fb1321e4322efff0c6dbffda -ff0b39ee001eff1644ffffdabb0000a7292affdbdacbb5d9e6ffffffead3ff151cff0c04ffeaba -ffeccfec1a3fce5453ffddcdfffedaffffdae0c1a2f97b7cff3c62ff1543ff2b4cff1438f5001f -cf000fce001cf11a3cff3a66ff5083f4ffecffd1e6ff255bba193affd0cafffeecffdfd6ffdedd -ffd0bcffd8c5ffd0c1ffa29ff75f6eff294fff1a4fff265bdbdcd7dbffe8ffdcaced140be2180a -f2dda8f9ffe8ffb2d2ff0e12ff4247f7c5bcfff6fbffaccaba203ab33a27ffecadffefcdff7b7f -e00017c30004ec6e6fffe9d5ffb1a9d12636ff3b55b10000ff939dffd6d69a2626b0403fffd9e1 -ffa0ad85ffd5c6fffbebfffbf5e9e9f9ededebfffbc6fffb98ffe8ffb1beff5264e31730ff4662 -ff9db5ffd5e7ecf7fdcdfffffff6d3e47e6fb9000ce5000fff0a2cd81e2ba842339c714eefe5cc -ffefd8fff8e6fff3e6ffede6ffe7e6ffe1e3ffd3d8ffd7cefff1e6fff6e6fffbe6ffffe5e3f1d0 -e7ffdcedffe6fffbfffffcfffffdfffffefffefffffbfffff9fffff8ffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffff3f9ffeddef04d48ba0000ff251ffffdcafff0e8ff0958cf0000f2403c -ffb6befffcffe5ffffe2f7fcfff6effff2e4ffffffffffffffffffffffffffffffffffff -f9e2eafffbfef9ffffeefff9f9fffffff9ffffefffffc6ddf30300e10000c93335ffffeaffebea -ff1f46f70000c53e04ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffabfff4e4a09dff1b32ff0b0ff47950ffeab7ffefe8ffd2fbff0219d70000ffb1a1ec4940 -ff0016e60003ffe8c6f7f6b6fff4c1ff7971e30002a50700f48268d80000d70005fffcc0deffce -ff0028de0015ff0e3bf1ffdad10013bf373bffd2dacf9ecbdcfffffffedadc0000ff0200ffc39f -fff6cfbb5153ef0027ff8991fffedac6ffdaacffdac7ffdaedfaccfccdb3ffd7e3ffced5ff8789 -cf3d47d6061efa001dff0c30ff2041fff7ecffd6e4eb2351c20021ffc0cbf8ffecd5cab8c55666 -ff274dff183eff0f35ff253fff334cff1e41fb001dd80000ffdce6d5ffe8deeeadce1300cd0000 -e59b78ffffe8ffeafbf9110d98391dc3e3bef0fffbffddfbb90010bd0000ff4539ff1341fc0025 -d80016a45b4aacf9b5caffdaeebca3df1b33e5133ae6354fffc9cdffe5dcffaa99a43429bc2222 -dd252dfef2f2ebfffbc5fffa7cfccc80ffd0c6fffbebfffbfffbfbff3f48d50616ce1632ff8aab -ffe0fbfff1fed8efe7cbffedd5eabfa16958930006d80018ff3964ff9badfff0dff5ffdffffef1 -fffdf1fffbf1fff6efffe9e4ffdedcffd7d7ffd2d4fffdf1fffff1fffff1fbfff1f5fff1f0fff1 -e2ffe8d8fadfeef9f5ecf5f2eaf0eeeef0effaf8f9fffdfffffcfffffbffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffeef5eef5efd7e3413cb20000ff2927fffecafff8e8a9001cf20600ff5652 -ffc0c8fffcffe7ffffebfffffff3ecfff0e2ffffffffffffffffffffffffffffffffffff -f9f0f3fffbfcfffffffefffffefffffffefffffcfffff4f8e71200ea0000c10004fff6eafff0ea -ff2141f00000940000ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffaefffbe7eacff87465e8351fe96f46ffe4b4f5ffe8eafffbf60919b20000ff7d6bd75440 -fe0013f8000dfff0c6ffc69affeab9ff9f84ff0f26c40000ffd3b3e4000af5000aedffc6c9d9aa -ff012fdd001be80023e2ffdaff314fdd4a52ff92a2ffcfffd2fffff4ffdac30000fb0000fa5c43 -f4e6b5847b5ce80011f02a43e89c8cdcffcfb5ffdaa5ffdab0ffdabdffdacffff3c7ffefc4ffe8 -d5ffd6dec59df56157ff0619e50000fbafb3ffd4daec3960d80017ff9bb6eaffecb9c3aab21534 -ff001aff0018f1232ded7461ffb08ff9a284cb503e9c0300ffdafadfffe8e8ffc7dd2410c20000 -d7443affe3d4ffeffbee140b823815c2ffd1dcfffbffe3fbc70017d70000fe0003fc0025ff0533 -ff4c61cedeaf97ffdaacffdaefab98ff13418a0012ffd8eeffeee8fff4d5ffecc6f49f80ab0e00 -a10000ff0037ff4b74ffc6cdfff9e8fff9e8ffa5ace11a43c60000e51807d0231fdc6372ffcae5 -fff8fff5ffffe0fbeaddfcdadbffd9dbcfb9f6a4a6ffabbdffd5e7ffe6e8fffee8eaffe8fffefb -fffefbfffdfaf4efecf1e9e7f7efedfff9f8fffcfbfbfffbf4fef6e2ece4eff9f1f8fffbf8fffb -f7fffbf1fef5eaffffedfffeecfdf7edf3f1f3edeffeedf3ffeff8fff1fcffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd7ffefe3f2d3e94a44c00000ff2425ffffcaf7f1d9a80031fe1205ff5955 -ffbbc3fffcffe7fffff0fffffff3ecffe6d8ffffffffffffffffffffffffffffffffffff -fcfffffffffffffdfffffcfffffefff4fdfaedfffbebffffd31600ff060ad80000ffebeafff3ea -de0a21ff0c10cd0000ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffcfffbfffce8ffad8dea3a23ff2621ff8885fff0dca7ffefff6060b20000ee775fd26a4d -ff0016f5000affeec6e56852ffd7a7ffc298ff465df5000affeac6fc1120ff031ad4ffc6c7c49b -ff2250f01032c20008d5ffdaff6d89eb515bdf2238ffddffcbffffe0ffdaba0000ff100bcf1808 -e1eab196d59eff3357e71633c51a2ad95d5dffb4a4ffe5c8f1e8c1d5dbafbea3accbdbd0d2ffef -c3ffe1dbffd1dfc78bcf4f2ac30000b94959ffd7d7ff6d8ede0019ff5b82dfffecc5e0c1ff4a76 -e10000eb3d32fcab80ffffc1fcffc1f3de9fcd754dae280fff8ec4f1ffe8ebffcaff4435d30000 -f11725ffb8b7ffedfbff0e12d72022fdfde3c6f5e1fff1fbd13b54ff5b5dff5a40f8938bff9a9b -ffc3bffffddad9ffd7c4cda0fa4e5eff0937b54b6fffedfafcffefd1ffcef4ffd1ffe5b2f76647 -ff3727ff6f8aff213cf70b1fff303fff2433d60000f1000bff3550e94d1aff9776ffdcd8e1f7ff -cdffffdcfffff0fff1ffffdcf4fff1f5fff1f9fff1fbfff1fbfff1f9fff1dbedd7bdd0baf5f2f9 -f5f4faf6f9fef9fffff7fffff2fffff1fffff0fffffbfffff7faffeeedf3f6f1f8fffbfffffaff -fff8fffff8ffe0ffffe6ffffeefffff9fffffff8fbffecf5ffe3f0ffdeeeffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd1fffbedffe8ff7972ea0000ff0004d7c38ee0ebcdff75a2e20000ec3a36 -f39ca4f3edfbe7fffff0fffffff9f2ffe9dbffffffffffffffffffffffffffffffffffff -f8fffffefffffffbfffffafffffdffe7f6f1ddfff6dcffffc41100ff1d21e8000bffe6eafff5e9 -b40001ff2d31ff2512ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffd3f8ffe9e8ffbc9eff2f25ff090dff516cffc8cb96ffe6ffcbbfca0000fa9275da8662 -ff0016e30000ffd0abb00500c39363cea472ff3950da0000ffedc6d80000de0000c6ffc6cec29c -ff4270ff2848ab0000cfffdaff91abec4f5a950000ffd9ffaaffe2d2ffd7b60000ff2924cf0900 -f7ffcfbfffe1ffadbdff3b55ca0000de0007ff1240ff2d56ed233dbb0f1fff1174ff4f9bffb8d2 -fff8e3ffffcffff0b4ffa370ff6a40840017ffdcd9ff9bb8e4001fee2654bcfbd0deffe0ff9ed0 -a00000e36847fff7bdffffbdffffbdffab83ff3a33fd0009ff296ddee2c7eeffcaff5c52f40000 -ff1b36ffb6bfffebfbff171bff1631ffe8e8adc9bbfffefbd79692fff0cafee0987dffdacfffda -fff2daffe3daf99f94c53d41f00019f1001affe7ffcfbec4acdfc0c8ffe3dcffcff2d999ffa97f -ffc5acffc38bb52b07be0000ff1418ff181cc90000c63c18ffd69eff954cfff2bdf9fff3c0ffff -8eeefacdfffff1ffedffffd3d3d5c8d6f6dfbfffe496ffd094fecec9ffeeebfff4fffff4f4f2fd -f7fafff9fffff4ffffeeffffe4ffffd3faf7c9f2eefffdfffffdfffffafffff8ffffe4f7f9d6ec -ffdbf3ffe6ffcaffeed6fff5eafffff8fffffffbfffff4ffffefffffecffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffc7fffbe7ffe8ffa9a1ff0d11dc0000897842d7eacaffd3fbbf0000c81612 -d37c84ded8e6e7fffff0fffffffbf4ffefe1ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffd36690dd0000f20000ff7a51eed3ca -7d8393bd0d18ff0e00dcffffe3fffcf5fffffffdfffffaffefe4e8e0e2e1e7f2eeffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffdcfffff7fffdedd6e94d37ea0000ff1b32ff9db2d0ffffc9ffe1cd1321ff0e12ffffa3 -f23d12e90000ffeccea13d47ff0d24fffec6bdc280db0000ff283fcc0a0b731400ffcdc6ffecff -8a2209ff1400ff140c86ffe5ffe4ffc50000ff2002eeff9afcc3bca4ffffb7ffebef0000ff2700 -cfffcab4ffffffbcffffeaffced2c3bc5c5dff0f30ff2a38ff1515930000b91700ff1515ff101e -d84440a4ffd0a7fff3ffcdfffa004fff644dbaa959fcffbcac0000e8001affd8f3e0ece8f2fdff -ee0000f11509ffd9c1ebfff6e9f9f8ecb2bef97783a80206af001bf5fcf58dfffb75b79cab0027 -ff297fffcbf3c3fffbbc3c317a0200a33e2affebcffff4cffffbcff8ecbaffffcbff7fa0ff5e7f -ff2e4de80d21bb030baa120fac2e22b44333ffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffe2ff -ffe5ffffeafffff1fffff8fffffffff5fffff0ffffe2ffffe6ffffeefffff8fffffffbfffff6ff -fff2fffff0fff1fffff5fffffefcfffff8fffff3ffffe9f6ffebf8ffebf6ffe8fffff4fff2fffb -d6fff1c8ffe6b0ffbfc8ffc1e6ffcfffe7daffecd5fffedaffffdaffffdafabca7ffadaeffcada -e3ffe1e2c599bb3212bd0000ff3b32ffcac3f0ffff93fff8ffffffffffffffffffffffffffffff -fffffffffffffffffff5fffff5eff1ffe5dac30000ff1f1afd0006fff3cfa4ffe1ed0000fa000a -ff3b53ffc3b5d8ffdf9effddccffe5fff3f4ffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffb9dc2f10907e90000ff663ef3d5cd -9aa1b1d73038ff1f00d8f6ece5faf3f9fffffffefffffcfff3edefecececf3f7f6ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffd4fffff8fffffbeaff8d7cff0109ef0008fb7284edfffddbffeae0353eff0307ffe888 -ee2a04f20000fff1cfaa3746fd0012ffe3b2d2c388fe0d1eff0f26c10000922a0dffd5c6f9eeff -9c1f0dff1a00ff3a2b9bfff5ffe9ffdf0016ff1900ffff9affcbc9b7ffffdcfff8f60000ff1b00 -efffc7cafffffffeffdbfffad9ffefe4a99bff6075ff8d9fffdcb8ffffb39c5b1bff0e13d70000 -d10000ac9d80cbffefffd2e6ff0051e300009f7332ffffc3e9313bff1349ffdcefd1e7dad7eae4 -ff1b00ec0900ff9090fffcf6dcfffff7fff8ffc9cdff3347ff1756ffeae8c6ffe8c7d0b3e5103e -ff205fffabbfd2ffe8ffc3d4ff5c6cf8424fff8e98ffa3aaed5457b32122c23433f20122e4001c -d20218c81622d03e3fe9746bffa797ffc8b3ffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffd5e8 -ffd8e9ffdeebfce7eef4f2f3eefdf8ebfffde9ffffebffffedfffff0fffff2fffff7fffff9ffff -fcfffff9faffdfeffceaf6fff5fcfffdfafffff6fcfff5fafff6fbfff5faffeeffffecf9ebfbf1 -e3fff1e2ffe6f1ffdcffffd4fffccfffe7d7ffd2b8e3deb6def2c1b4c495826e4b95513ed36c65 -ff3869ff1839e50000d60000ff2934ffc5cdf8ffffafffffffffffffffffffffffffffffffffff -fffffffffffffffffff7fefff8f4f5ffe8dacf0000ff1b16fd0006ffe9c9afffe1e60000f90009 -ff364effc0b5dfffdfaaffe3cbffe3fff3f4ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffd7f3fb251ddb0000ff4c27ffddd8 -c6cfdeee585aff1e00ccc0c4eae1e4fffefffefffffdfffefafafafffdfefffcffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffdffffef4fffff9efffddd3ff3c4ac00000cc3848fff3ededffeaff6f70f60000d2a049 -ea0d00ff0004fffacfb92e45e40000d8825ff0c090ff535cf20007b30000bd4930ffd2b5eff3ff -bb1612ff2000ff795db6ffffffedffff0645ff0e00ffca76ffd2d5d5fffffff6fffc0000f80100 -ffcca4e4fffffff5f3ffffeffff9e8fa7f82f40f2cff1428ea634db8a362ffffbfff8186ff0621 -de0001e36b6defffe7d7cbbd981d39b60000ae5c34fff3bdef3b47fd0633ffc4ccd9f1d7f7fff3 -ff662ada0000ff2041ffb2c2aafff1b2fff8ffdad2ff0a2eff3550ff9595fff3c1fdae8dff1327 -ea0003e3594ccbf3aaff9fc2ff2b4fca000aec0025fe0330dd0008d90004ff002fb40f1fba1e2b -c43b42d96766f69e94ffd5c3fff4dcfff8dcffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff0f6 -fff8fcfffefff9fffff2ffffeaffffe4ffffe0fffdf9fffbf7fffbf2fffbedfffbe6fffbdefff9 -d7fff6d3fff5fcfffafbfffafbfffaf9fffbf8fffbf7fffdf5fffdf5fffdfff5fffaf0f9e5efe7 -f8fff1ffffe6ffd5c0ffafa2ffb0a9ff1b49ff113fff1d48ff2f50e00b29aa0000aa0000c60000 -e20e34ff1031ff050dec0000ff131eff8b9bfff1ffddffffffffffffffffffffffffffffffffff -fffffffffffffffffff8fefffcfefdffeedae91a14ff140ffe0007ffc6adc6ffe1de130df50009 -ff2d44ffb5afedffdfbaffe8ceffe2ffe9e8ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffe9f9ef2f20d10000ff3e1dffeae9 -ecf8ffeb6c66f00000c48097f6c7d7fff9fff9ffffecfdf7f9fffffffcfffff7ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffaffe6deebfff4f6ffe5e6ff9ca6a90008b2121cffa9acffffeaffb0a5f30000ad5a0e -ee0000ff1014f0ffccd22246cc0000b82f1dffae8eff8e8ce60000b40000de5946ffd8a9e6fcff -e20816ff1f00ffbd91c7fffffff2ffff4d7ff70400ff662fffd2d5edffffffddfbff0200d70000 -ff766efbfcfff9002bff0032db0e2dcc0722e8001fff052cff0d31ff0b2cffcab4ff6e83ff173e -ff163affada1fbffddf2d2bbb33a43e90007ee8776e9d6acc51b26ae0000c45e5aeaeecbfffce3 -ffc96cf11308ff0c38ff98baa5ffff81fff8f8d5c1d70000fe0003f70000ce4a24f46442f40906 -b50000a01c00c3c572ff9cadd04155a7041fce1537fc2954ff295cff467fff7ab6ffbbbcffc4c2 -ffd3cdffe4d9fff3e2fffde6ffffe6ffffe6ffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff5ffff -f4fffff2fffff0ffffedffffe9fffed5f9edcaeee2fffff1fffff1f8fff1eefff1e4fff1d9ffef -d2fff1cefff1fff9dffffce1ffffe6ffffedf2fff4e7fffbddffffcdfff6fffcfffefffffcfffb -fffdf1efb4acca4e50e42535ff364fc70000dd0006ff002bff1745ff1341ff0230ff0533ff1543 -8affbbd6ffc5ffd697eb6639db301efc626cffb6daffe5ffffffffffffffffffffffffffffffff -fffffffffffffffffffbfcfff9ffffffeed4ff5546ff0b06ff0008ff9988e2ffe1dd3c28e9080e -ff1c33ff9f9fffffdfc7ffe8d5ffe4fddedcffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffd7dfe2db321bd20000ff3619ffecef -f4ffffda7265ca0000c64470ffb4d2fff4fff3fffed7f8edf2fffffffafffff1ffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffff0fffdd8d2d4ecc8d6ffeffbffebf1be5657bd0e13ff3e4cfff4eaffe9d2f21e13a52b00 -ec0000ff1e22cfffc4ed1949c40000cb0a0bff8b7bffa195ed0211c20000e64e41e3eca9dfffff -ff0019ff1200ffedafd8fffff3e8ffffa6bcea0000ff1000ffd8d1f5fdffffbfe8ff0e09c40000 -ff2435fff9ffe90007cc0000c00000be5e50f4baa6ff97a3ff1d54d50007b50000bb0008b31021 -b37c67deffc6feffd4ffbaafff2e4aff033cffc0bee6e6c0e44e59b600008c0d07e4ae8cffd5c0 -f7df75f32e1bff2d59ffc1e7b0ffff7ffff8fffbdeea000bf00000c30000b40a00ff6044ff4d3c -ca1100c35729ffe89ffffff1fffef1edd4cdffcfcfffcdd6ffc2d3ffcbe2ffd7f1fff8f1fff9f1 -fffbf1fffef1fffff1fbfff1e7f6e1d8ebd5ffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffe2f9f1 -e5faf3e9fcf6eefdf8effaf6ecf2f0e7ebeae5e7e6faf3d9ffffe6ffffe6feffe6f4ffe2eaffdc -f0ffe6eeffe6ffc9a3ffbe99f7bc9cf3d8bdfdffebe9fffbd8ffffc9ffffeaedf6f9fffffefffb -fffaf1df9491a7111cdc0018ff365795634ac38d75f0b6a0ffc8b2ffd7bffff0d3fffddaffffda -c1ffe1e7ffcffffcbaef844ec13015e5565cffb8dfffddffffffffffffffffffffffffffffffff -fffffffffffffffffffbfbfff4ffffffeeccff957cfe0100ff0109f46760feffdfe77551de1b17 -f9061cff7b82fffbdfd6ffe8e1ffebf9dddaffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffbfeae1de4a2ce00000ff280cffd3da -f1ffffda8873cb0000ce1654ffa8d4ffefffedfffcc2f2e2edfffffff9ffffecffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffdfffeae1dcd6ebbfd8fff6fff5ffffd1ab9ee22627ff0404f4aaabfff7d4ff513bb81c00 -f60000ff292cacffb8ff134fd50006ff192bff5a5aff8d76ff4446dc0000d22922cfffb8d2ffff -ff0018f20000fffdafe7ffffcfd3f9ffede8e20000e80000f6f0d8edffffffb1dcff482cd20000 -f90012ecf3ffff7d8bff303cc43a2dbfcd98b3ffddd1ffe8ca5d70c50007f00748e4496bd3ab9f -cbffc8dbffd0f9cda0ff4747f00000fb003dffeae9e9ffe8ffc4c8ff2e4d980000db503bef1f1d -a67413a10100ff2645ffb9d5d2ffffacfff8ffffe2d83538ff565bdf3734e5594cffaf9dffcbb7 -ffb69cffd6b3fff6cad6fffbd8fffbddfffbe4fffbeafffbf1fffbf7fffbf8fffbe4e9e3ebf0ea -f6fbf5fbfffbfbfffbf9fffbf9fffbf9fffbffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff1f7f5 -f2f4f3f7f1f3fff1f7fff5fffff1ffffeeffffecffeef0c8ffffdcffffdcfffadcfcd0b7f1b7a3 -ffc3b3ffdbcce8370ecf2f0bc04121d28068fad6c6fbfffbe3ffffd5ffffd7d5e0fafffffbfffb -fffdf1ffc5bdd35256ff4759ff809ac8e9b4ffffdafff9daffdecbffcdbfffe8d8fff0dafff5da -ff002fff3354ff3b43f30000b20000c03339fab4ccfff3ffffffffffffffffffffffffffffffff -fffffffffffffffffffaf5fff0ffffeeecc3ffcfadf40000ff020adf393bfff1ddfab481d93124 -df0003ff505effead7e4ffe8edfff1ffe6e2ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffcffffffd7b57f50200ff0f00f7a6af -eefffff4b298fc3100db0045ffa4daffecffe8fffcb0eed9e9fffffff7ffffdef5ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffcdffd8f9f7e8ffe8fff8fcffc8ffffc4d0baff4441fa0000ac4852ffffd4ff8667d92200 -ff0b00ff383290ffadff1254ed2226ff4c63ff2b37c76445ff8c84fe0013b20000c1ffc6c8ffff -fd0016d90000ffffafe0f0efadbbdeffffe8dd0000ec0000e2ffe8dcffffffb9dfff945ff90200 -f3000cd3f8ffaa863c930000b00000f74e53ffffe1cbffefe7fffaffe9faffe0f9fff5faf9ffef -ffffe1fcb79ad83b2cd20000d90000ff1667fffffacaffefffe1e1ff5a78b10000ff231ecf0000 -c052059b1e00de6864ffc6d1cfd0d4e3feedffffe3d5a581ffe1d2fdc4bdffc0beffe5e0fff7e8 -fffce8fff6e8ffefe8cfd0d5dce1e5e0eeefd8eeecd5f5f0deffffddffffdbffffd0dbddd5dfe1 -dfe4e8edeef3fdf8fffffbfffffafffffaffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7ff -fff5ffffd9e7fbc0d4ffb8d2ffc1e1ffd4f8ffd8ffedfec8ffffd4fffbd4ffd5bbf18277e04b4d -f94753ff5a6bff1000ec0200d51300e85c4bffc1bbfff6faf5ffffe4fffffff5fff2f1f7f8fffb -fefff1fff9e6ffada1ff7d7cff8288ffecccffeadaffc5ceff5778ff1c4aff2c5aff3561ff2249 -b20000f0000eff1c24ff0500c81103cb645de5c4cfeff6ffffffffffffffffffffffffffffffff -fffffffffffffffffff7f0ffebffffdcecbdffe6bce60000ff030bd1161fffe4dbffeaacd94430 -c60000f3283bffcdc1f0ffe8f0fff1fff4efffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffc6ffffffa67fff1100f20000d6808b -e2f6ffffd7baff7730e4003fffa4dfffeaffe7fffca6ead3e6fffffff6ffffd4edffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffff95ee9effffedffecffeeffff90faf6add4b9ff5852ff10007c0918ffffd4ffa783f12d07 -ff1704ff3f3480ffa6ff1658ff393cff768dff0f219a4421ffbaadff1229990000b2ffc6c4ffff -fb0014c90000fbffafd5dadd98accdf0ffe8dc0000fb0200cbffe8cfffffffc5e8ffca86ff2500 -fa0013c9ffffe4ffa9ff4532e10000ff0829ff4a83f7a5b3d5ece4e9ffff98f6debffff1f8fff3 -ffb6b8ff2f41da0000d50000ec4a23ff68b5e9ffff96ffd2ffd2cfff3b59b30000ff3131ef0000 -ffba7dffa874fff5d8fff7f6ffd6e9fff1f8ffffe3f4ffd1d1fffbf1fffbffebedf1e3e3f1fffb -ebfffbfdf1f1e5a8b8ffe0ffffe4ffffe9fffff1fff2e6f4e7f2f8e0fcfdd4fbf8f8fffff9ffff -fefefffff9fffff0ffffeffffff1fffff3ffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff0ff -ffccded38fa6ab55729c2e53a62450bc2c5dcf376af0ffcdffffcffff9cfffb7a0e14946ca000a -e20006fc001aff5621ff3910ff311cff6d63ffc7c9ffedfafffaffe3f3fffff6fff3eef5cddad1 -f4fff1ffffe6ffd5bdd47464bd3d32b6ffd3e6ffdaffd1b8cc3f45b60006d10015cf001aa90000 -a0514afaa98effe5b4ffdd9effd19dffedd4fff5fffff7ffffffffffffffffffffffffffffffff -fffffffffffffffffff8efffeaffffd4ecbaffe9bcde0000ff030bc90310ffdddaffffbdda4f38 -b90000e41026ffbbb3f5ffe8f2fff1fff9f4ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffe5eaffede1f14c48b20000ae2a04 -e2ffcafff2e8ff0359ff1609ff807cffe4ecfffcffe7ffffd2e7ecfbeae3fff2e4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffdbffffcdfcecd1f1e6f8fffffffbfffff4ffd7a8b8976073fb3739ff777fffffc6b9ad71 -d90000ff1b32ffa382b552336a0000ff9296c54345c0061bff91bfff5482fe0027ffe2dadfffc8 -a80c10ff002fffc6e6d5fff1a5fffbf9b0ceff096e770002763227b8c49ed9ffe1ceffcd7e694e -c95258ffacc8ffffcffcecbbdb9f7dc45041c21318d70009ee000cf50013ff0021f10013c80000 -9d00008d0000ad2d22ee8572ffc6aeffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffff8fffffcfffffffafdfff2faffedfbffecffffe8ffffe6ffd4ffffe0ffff -e9f4fff1e1ffffe4ffffeffffff1fffff3fff4fffff4fffff2fffff0ffffedffffebffffeaffff -e9fffff2f7fffcf3ffffeeffffeaffffebfff0ccf8e3ceedf9f0ffffeaffe9e1ffcfeae5e2ffe3 -e2ffe3edfffff6eeffffeafffff4dab9b089ffffdafff1d3ffd0cbffb6bf7e0000a7423ac63b40 -ff002cec0015f6001fcf484cbb7865cd2b38cd0000ff3153ff9cb4fff3dadcffdaa75a4ac30000 -f2203ddcffcbd5fffffff9fbff6989d20000c21b15b7ffddaefffbffccf5d4ffe4f6f8ebffe5ff -fff7ffeeffffe8c0b8ff2a33e10000fff0eaf7ffeab6d9b893756ac34a5dff91a2f5ffe9a0ffec -ddffe1fcffcffff8baffe2a5ffedbcfffadae2fffb7fd5d4ffffffffffffffffffffffffffffff -ffffffffffffffffffebffffedeaf1ffcbdaffc0d7ff5f7bba000cf61a34ffa0b770ffe1c10000 -ff545ca20000d4ffbce0ffdaffdae7e0c8ecffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff6fbfff9e8ff7167bf0000c12e0d -edffcafff4e8ff0051df0000ff5d59ffdae2fffcffe4ffffd5eaeffff0e9fff2e4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffe0ffffd8fef1d5efe6f5fefbfffcfffff6ffe7c1ceb58696f1000eff5769ffffc6b1e291 -dd0007ff2635e8a37ac34630ff193fffe1dae7af98ca2835ff9dc1ffb5bebcac88ddffdaffffcc -ba0612f50020ffa4c1d4fff196fff0ebc1d5ff2287ff4f70ff5d70ffb7afffebcfffbfa2a22217 -c00001ff2e4fffffd2ffeec5ffccadfca18ff87470f64b54f62d40f51d35e70d26ed1d33ec3341 -e2474bde635cf39383ffd1b9fff0d4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffcfefdfdfdfdfffefffffcfffffafffff9fffff7fffff6ffe3ffffe8ffff -edfcfff7fbfffefbfffcfcfff7fdffedf8fffffafffff8fffff7fffff4fffff1ffffefffffd7ee -ebb5cdbae4ffa7c7edbccff0f3f9fffefdfffefffffcfffaf9fff6ffedffffeeffffe8e4ffeaca -ffddbdf7c6c2ffdafeffedffffb7cfc21324d83341b2000de00525ff3b62c60004ff4865c3091e -f00019f6001fff1543ff687aff9a98ff667eff2452ca0019f9334cffc3b1e6ffdadd9483e70010 -ff2444f8ffd3e6fffffffdfbff869dea0001d82423c8ffddb5fffbffdeffd5ffe4f9f9edffe7ff -fff7ffeaffffe8cabfff383de60000e1cebff1ffeceeffe6dc858dfd1850ff2e72ff98c2ffe6ec -ff86a2ff5a6aff1014ea0000ff4a42ffd4d0fff9ffddffffffffffffffffffffffffffffffffff -ffffffffffffffffffeeffffe7e4ebffe2eeffdff1ff8ea5cc0c25e40822ff657d82ffdbbb0000 -ff3b43a60000e7ffbae7ffdafff4fffff2ffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff4fbffffe8ffa68ee40000e3331c -ffffcaffecddf3135ac30000ef3d39ffbbc3fffcffdfffffdaeff4fff6effff2e4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffeaffffe8fff9ddeee8f2f8f6fffdfffff9ffffe6efe0c0cbd30000ff283fffffc3a1ffb2 -c26343f17961e1bc88de332cff0533fff6dab6e1a9a2000bff5b75ccffc468ffc0b0ffdaffebcf -f7273dff1546ffb9cfd4fff1a0fffbfbffffff9de2e10000ce0000f90002ff544eff5547dd0802 -f60000ff343cfde9c8fff3d5fff7dcfff2dcffe8d7ffc2b5f1978edd7c75f0636bff878cffb5b4 -ffd5ccffe5d3fff2d9fffcdcffffdcffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffafefffdfffffffff9fffff2ffffedffffe9ffffe6ffffe9e8faeef5ff -f1ffffe9ffffe2ffffdfffffd8ffffd0ffffd4fffbc5ffe7a9d2c0b8ccc1eeede9fff8fbfff2fb -ffeffbebffffe8ffffe8fff5f7fff3ffffe8e0d3b1dac09bf6d5acffd4dfffa0a4ff6e6aff4d44 -f12b22c72c28e08084ffe5f0ff9cb8db0221d00014ad0000da273aff8795ff606fffa2b5ffffda -ffe6d4ffd4d3ffeadaf7ffdad9ffdaf1ffd2ffdbc4d42c3bc10011d56863f8ffdaffe2ceff0532 -f60c31ffd4baf0fffff8fffbffacb4ff061ff4292fddffd4c1fffbffeeffd9ffe4fffcf1ffebff -fff9ffe2ffffe9dccbff5350ef0000fff3e4f2ffecfcffecffacc0fa0035d4000fff003bff2466 -ff5787ff2344d60000b40000e21911ffc4baf4ffffc1ffffffffffffffffffffffffffffffffff -ffffffffffffffffffeaf9fee5e4eafff5fbffe8f1ffc4d2e23246d20011ff1b36b5ffe1e3232e -ff333bbd0000e1d990f4ffdafff7fffff1ffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffedf5f0ffe8ffcea6ff1713ff3026 -ffe8bbfff4e0ed5a87cf0000f2403cffb6befffcffe5ffffe2f7fcfff6effff2e4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffff8fffff9ffffe9efedf1f3f2fffefffffdfffffcfffff7fbe20000fd0012d5ba8392ffb4 -dbd395fff4beffedb3fd1b27cf0000f2ffda8dfcadb10000ff0331bfdda98affbbffdecaffb4ad -ed152dff2952ffc6d2d9fff1a9fffbe4ffffffe1ffff2b26f60000eb0000f81f0edc2a0ca80000 -9f0000c30000ffe6d4fff8e5fffbe6fffde6ffffe6ffffe6f1f6d8dce3c4ffdfd8ffefe6fff3e6 -fff9e6ffffe6feffe6f0ffe1eeffe3ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffafffffcfffefffff4ffffe2fff8cefeeebbf9e4b1f5deffe7fafff9ff -f1ffffdbffffd1ffffd2ffffdbffffe2ffffa0fff1a3ffec8fffcaaaffd3dbfff1edfff1fbfff1 -f3f0e1ffe6eaffd0ccffc8b6ffccb1f3a07ebd4626ad0f00c10b008d2a0bae1300ed0400fd0000 -db0000c10000d83d29ffb697ffd3bce2726eef6066f5978dffffdae2ffdae8fccbe7c4a6ffffda -ffffdafffcdaffffdae5ffd6c0ffc1e1ffd9f0ffdaffc1c0de0f2bd0333efffedafff2dafa1035 -d90006fb8180fefdffe6fffbffccc0ff1a33ff1b2ce2d3b2d4fffbfff5ffd9ffdefffdf4ffefff -f5f5ffd7ffffe8f5dbff7467fc0000ffbcc2fffcecf9ffecffd3d7ff2d63f90034f5003bca2245 -edd3baffcfadff9e74df6232cf7044e1c9a7d6ffffaeffffffffffffffffffffffffffffffffff -fffffffffffffffffff9fdffeef1f6fffcfbfff3f1ffdfe1f15763d30015eb000feeffe1ff8a8a -ff373fe20000d88656f7f5ccfffbffffdfffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffad0dad9ffe8eae8adff2f25ff1e22 -ffc2a5ffffe8f9b9caf20600ff5652ffc0c8fffcffe7ffffebfffffff3ecfff0e2ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffbfffffcfff8f2f4f5f3f4fefffffbfffff9fffff8ffffff2f3ee70000ac523097ee90 -fffec5ffffc6fffcc6ff081fe6000fdcffdab6ffdaff1743ff002eff7882fc8684ff2654d82b2f -950000cc1f32fcb1aebeebccc3fffbe2ffffe3c8dbff1117d30200be1f09df754dffc691ffedb2 -fff8bcfff7bcfff7f1fff9f1fffdf1fefff1f2fff1e9fff1e2fff1ddfff1fffff1fffff1fcfff1 -f7fff1ebffebd8f9dedaffe4e4fff1ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffdf7f9fffefffefffff9fffff4ffffeefffdddfbf1d4f4e9ffe9fafff5fa -f2fffad9fffac7ffedd0fae6fefff9fff6fae9ddc5fee9d4fff6e6fff0e6ffe9e6ffc1c5b84a53 -650000d70528bb0017c11e23e94c43f83e32e90000d00000da0000a30000d50f00ff3c39ff5b63 -ff3a42ff100dff391eff875aeff0c6ffa6a1ff5669ffada8e6ffdab6ffdacef9c194533ff4001d -e80011e50022fc1539f7012af8022bff6d8cffc6daffeddaec1a37c0000cfec8b0ffeacfdf0e2b -c50000fc344effeaffd4fffbf4e5c4ff3142ff0821de9084d7feecfbfaffd4ffd4fffcf4ffefff -e2eaffc1ffffe9ffecff9981ff0c05d22248df9b9ce2fddeedfbe1ffdfdfffe3ecfffcecc2ffdf -bcffe1e3ffcffffcbaffa46ed64c2fde6665ffbad4ffedffffffffffffffffffffffffffffffff -fffffffffffffffffffffbfffbfffff5fffbfffff1ffe1d6fa777cea162ded000bffe0d4ffc2b6 -ff2624ff0601db3924f2d5b5feffffffddffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff5c5d1c4ffe8cbfbaffc3727ff070b -ff8c7efeffe8f8fffbfe1205ff5955ffbbc3fffcffe7fffff0fffffff3ecffe6d8ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffff4fffff6fffff7fdfff9fbfafffef4ffffeeffffeaffffffbd99f9000ebb0804c1885b -ffb29fffedc6ffe6bcfc0011ff0230e4ffccceffdaff6a85fe0027ff0634ff002ac10000d83536 -9c100fce7169f8dbc9cee4cde7fffbf5ffffdacedcffefdafff3dafffadafffcd3ecffd1daffca -c7fabfbdf5b8fffbfbfffcfbfcf8f5eef3edebfbf1f0fffbebfffbe9fffbe6fff3ebfff9eafff8 -ddf9ebceedded5f4e5eafffbeafffbffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffdbeae5ecf5f2fffefffff9fffff4ffffefffffecffffeaffffdfe8fff4ef -f8ffefe3ffefceecd0ddc0b8ffb3c4ffb8daff0a3bff0637ff0031ff002bff002bff0132ff0d3e -ff1647f41045d91539e24654ff7f7fff7271ff202cfa0000fe0000fc0300ff3422ff968fffd6d8 -ffbbbdff544df01301ff1300fff4daffb9d6ff0634ff335effd5bfefffd2ffd1c9f6001fe1000a -dc0009d2182df82945e6000fbc0000ff284bffd3dafffedad5001db60000cf756ae6c5a6e32c40 -dc0005ff0836ffdcfdc1fffbd9ffd0ff5056ff051ee35a62ccd7cfeeffffd1f6cbfffaf4ffefff -d0e1f3affff8d9ffecffba99ff1d11ff1f5aff9aa8edffecd9ffecf9ffecffffeccfffec93ffec -e9d4b9ffe7ccffaa96ff1e18d30000ff0735ff86d7ffb5ffffffffffffffffffffffffffffffff -fffffffffffffffffffff8fff9ffffdbffefdfffe6fbebd4ff9e9bff3248ec000af35c6dffc1ab -a10700ff130eeb0104ffd0b9f5ffffffeaffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffd6e3b5ffe8baffb7f03723e50000 -fb4f4de2f3d3d2fffbe20000ec3a36f39ca4f3edfbe7fffff0fffffff9f2ffe9dbffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffebfbfff2fffff6fffffcfff6fffce6fff7e0fff9defffdcfffc6ff343ffa000fff222d -ff1a31ff6b64f68269eb0000ff153ae3a691edffdaffd2bdee3348ec0f30ff2847ef092dffb9b0 -f1a38dffefcdfbffe6e7e8d8fff9fbfff5ffffedffd4efe6e6fdf5f4fffef2fdf9f4fffcf0ffff -e9ffffe3fffffbfffffcfffffefffff9f4fbfaf0f9fff4fffff8fffff8ffd6f6f1e3fffdebffff -e7fffddef0f0e2f0f1f8fffff9ffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd3f9ece8fdf6fffcffffefffffe1ffffc4f0ffa3d9ff8ec9ee9c9effe1d5 -feffe8f2ffe8ecdbc7ef7f8bff4172ff3372de0001df0002d30000b20000a70000dc202fff9fa8 -ffd0d4ffd2f8ffd4e8fff8f3ffffe8fff0dbff7575ff102cff0219fd0200ff2a2cf8b2aae6fffd -e6fffdd69088df0000cf0000e4ffdaffcddae6000fff1743fbd4b7e7ffd6ffd9daff002aff5070 -f48f87f9f6cdfff7daff737ca800039c4639e4ffd0d0e2b2f11636e3000ce7716feed6b4ff717f -ff0634f70020ffe0ffb5fffbc8ffddff7574ff112af43e55d1c9c7e6ffffcdedc4fff9f4ffefff -c2d9e9a1fff2ceffecffd4abff2e1aff4e88ffd7e5f5ffecf1ffecffd0ceff9dadd68a8e8b806e -f83d5aff465bff272ff40000ff000aff6781ffd5fdffe7ffffffffffffffffffffffffffffffff -fffffffffffffffffffff5fff6ffffccffebcfffe8fbffe6ffc6beff4258db0000dd052cffceb0 -600000ff231edd0000ffbcaceeffffffe9ffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffedfbacffe8b5ffc0e7341ecc0000 -e12428c7dcbbbdfffbbf0000c81612d37c84ded8e6e7fffff0fffffffbf4ffefe1ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffdef1ffeffffff4fffffbfff4fffbd9f9eecbfaeac9ffed86ffc6ff6b69ff162dff0015 -bd0000c70000c02c1edf0000ff3356ff7e81ffffdad6ffdad5cca5ff9791ffe8d7eeffdaffe1cf -ffedc9f0ffdcebffe6c5b9adffd4e3ffebffffdaf2e0ffffebfffffcfcfffff4ffffeaffffeaff -fff3fffff6fff1fffff5fffffefefffff9fffff3ffffeaffffdefcffd8f8e9ffffebffffeeffff -f4fffff9ffffe8e6f1e5ddeaeadfedffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffdcffffebfffffffbffffd6edff9dc9ff5c9aff206cf50050b05f5be6bdab -ffffe3fcffe3ffd6c8fc546dfe0030e8001ab63027ff9b8dffe9cffff7cfffffcfddffc8c1ffc2 -c3ffcff0feffcbfffeb3ffffa8fffac8ffedbead93ca3f46f01533ff0300ff2233c1c1b792ffff -92ffffe1e1d7ff2f40f200003fffb6e4eabe960000c14e4bb8ffd38fffdafffedad60005e5000e -e8394affdec9ffe0daff80a7ea0013d12636ffe9c9d0f5bfff5778ff3361ffa1a4fffddaffaeb9 -ff2755e00009ffe6ffaefffbb7ffddff928cff1f38ff3656dcc8cae0ffffcce8c0fff8f4fff0ff -bad6e499ffeec7ffecffe2b5ff381fd70536ffacb7ffffecffe6dbf44f71ff003af90034ec0038 -d00016ed0019ff1416ff472fffba91f1ffda96ffff3ffffbffffffffffffffffffffffffffffff -ffffffffffffffffffffe8fde8f3f5c8ffedcefff1f1ffe6ffe4d8ff485dc70000f3002afff1cf -500900ff342fc80000f39d90ebfffff5bbebffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffbffffd1e5e4ffe9ec920019ff1956 -e70012ffaeb9fff4caee0308fa000aff2c47ffa1a9ffffdfbfffe3d4ffeafffaf4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffff3ffffb8d0da5d87bf1e54 -bf1e54da5d87ffb8d0fff3ffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffddf6ffe1f8ffe9fcfff1fffff7fffffcfffcfffff8fffffff3fffff3fff3dcee -f0dfeffdf5fffefefff6fdffe6eff6ffe0ffffdeffffcdecffe6fdfffafff7ffffe8ffffe2ffff -d1e3efe4f8ffeeffffeaffffd9faffcbf0f6cef7fbd6ffffe8fce0f0ffece9ffeccef3d1d9f4d5 -ffffecfffaecffebe3fff9daff4661f2001c9200007f0000ff1240ff4f6f5a280fff2c1bffb294 -70ffef76fffff7a6d1ff1961ff393dd4ab53c3ffffffd5e2ffb0c0ffe3c8e3ffc8b0ffdde4fffb -ffe1fffff7a1fff5a5ffdfa9ff716aff2235ff0928ff072eff032ff00000ee0007e5123fffe5fb -a6c8b8ffffe8f34343f20000e7ffffded6d4b50e20ff0017ffdac4aeffddbdfffbffd5fff2252a -d87355c49c69cd533ce40000e60000d27151b6ffabffc4dad40000ff2d5ba2f5af65ffdaeee2bc -d60000ff5482ffeed9fbffdadfffdaffffdaad35348f0000ffe2d3a0b483ffd9e5fffaf4dcfff0 -9aeac3e4fff4ffecf4ffb6e8f9003cff1b1fffefc483ffcbe2fffbc30013ff003de80001ff625c -b5ffffbcffffc8ffffabe0f0b4d0dbf9fffffffbfffff9fbdcffffe6ffffeffef9fffdfffffaff -fffbfff5f7f6f3fefad4ffe4fffff4ffeefffff7ffeefffff2cac2ff343deb0000ff1700f4ffe8 -81cad9ff2376e70000eb1800fcffcac0ffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff5f5ffe0f6f4fff1f1da4a6bff104d -f80023ff808affe2b9ff2b2aff000fff132eff8590ffffdfcaffe8ddfff1fffbf4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffffaffffefffffcfeeffaad3 -ffaad3ffcfeeffeffffffaffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffff6fffff7fffff9fffff4f9f8eff2eeeaebe6e6e6e3e5e4fffafffffafffffbff -fffdfffefffffbfffff8fffff7fffffeffffe9eef2d5e3e4d9efede1fffcdcfffed7fffed7ffff -a9ffedc0fffbd1fffbe4fffbf5fcf5fee5e9ffe3efffe8f9f6d1c8fff7ecfffcecffffecffffec -ffffecfffcecfff0e2ffdac0e51431f20025eb6367f47475ff8dafffc9dad8d3abfc0000dc4d3d -99fec6b2ffffffe7ffff558aff363ced743feeffffffd6f3ffa0bbffaf9fe9f2b1c8ffdde9fffb -ffe9ffd21500e12404ed230ff10b0df50010f50f29e43848ce5356f90102e70001df0d3affe4fb -abcabbfafee3f34e4aef0000f5fffffffcfbe74f5cfc0013ffa898bdffddc2fff9ffd8ffe90000 -f20007ef000cf20007f6000bff162dff5168ffaa97d34b4fb20000ff1644ced4a8a9ffdafff2da -e3000fff002de07f76d6c6a2cbeeb8fffcdacc4549d12032ffe0daffffdadfeed9e0ffe7cbffe1 -c1ffdae7fff1fffdf1ffccd3c55e71ca0000ff606cd9f1cffffffbff3475ff1e5dff313ddfb470 -ffeae6ffe7e3ffbfb6de6658c53423d42e18cf1700af0000ebfffff1fffff7fffdfffefffffcff -fffdfffafafaf6faf9d5ffe4fefef2ffedfffff7ffeafffff6d8cdff484df60000ff0f00ffffe8 -8bc5d9ff2e7be70000ee0c00ffffcabefdffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffdad2dfeefffff4f6f1ffbbd2f80034 -ff0334ef444dffd7b1ff6a5eff0516f00009ff5868fff1d8d5ffe8e0fff1fffbf4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffff7fffffffcfffff2ffffebff -ffebfffff2fffffcfff7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffe6ffffe9ffffedfffff2fffff9fffffffffffffdfffffbffe6f0e8f6fff8f9fffb -fbfffbfbfffbfafff9fcfffbfcfffbd6fffbd8fffbddfffbe4fffbeafffbf1fffbf7fffbf8fffb -f8ffddffffddfff5ddffb7b0ee5a66d30c29ce000bd40003d25d6fffb6c6ffe0ecffe6ecffeeec -fff7ecffffecffffecffcebabf0008eb0a2cffe0d5ffeddaffcddaffdddae3ffdaff1722ba0307 -b96e6bfff9f6fff0f6ff9da9db1c23f40b0ee89fcaff94c6ff577ee82e2fc27e57edffd5f1fffb -e1d2e9c60000cf0000ec0000ff212cfa6b65dcb095c6e5b9c0ffd0ff2b23dc0000df103cffe1fb -c2d8ccf9fde2ff6c62f40000dfc2defffbfbffa9adf4000bff605adcffddcefffbffd0fff23132 -af2c18852807b42f1cff4b4fff787bffa689c5c585864531b90000ff1f4ddf726dfde3c2ffdbda -f72b46ac0002e04a53fac0aadce3b7ffeed1bc252ea50000ffced7ffeddacfffe8e3ffe8feffe8 -fff9e8fff9e8f0eed5c4e8c2c7ffd6ba0000ff2434fffee8fceeeeff9cd2ff0342ee3739a37230 -c30000d90000e40000ea0000ff1b00ff4709ff3000e60000faeef2fff9fcfffefffefffffeffff -fffffffffefffff6f9d8ffe3fefaefffedfffff9ffe2fffffbeeddff6966ff0b04fc0300ffd4c9 -a1bedcf84586eb0000f20000ffdbb0bdfcffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffe6d4e4edffffdef6e9ffe6f1bf0013 -ff0534c71d26ffe5c3ffa98efd181fd20000ff3046ffdfcfe2ffe8e6fff1fffcf4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffddf7eee6f9f3f4fdfaffffff -fffffff4fdfae6f9f3ddf7eeffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffd2ffffd6ffffdfffffe9fffff4fffffefffffffcfffffaffc5d8c2e4f3defbfff1 -fffff1fffaedfeede3fff2eafff8f1f1f4e3fffef1fff8f1ffddddffb6bfffb8c9ffc2d9ffbfd9 -ce0000e10005f40011f8000ff00007f4000bff061fff1b34a70022de3458ff6386ff85a2ffc7d7 -ffeeecffffecf0ffecffe8dac00009db112bfff4dafffedaff9896ffbdb0d8ffdaffada6db1225 -f21237ffd2e3fff7e3edceb2b9151cde0000a8195bff427efb0e389f0000ad150affdccbfffffb -c3e0e8ff4738ff1b25ff2a3dff7e8dffebd8e0ffe3c7ffecceffefff705cd7000bed204bffd4f2 -ebf6eefcffe8ff9e8dff070bad5b89fffbfbffe5dde50003ec1f26f9f9d3ddfffbffddffffffc6 -ffffc6e7ffb9f4ffc2ffffc6feffc6e3ffc6c0ffbeffe8c8ffb4b7ff6380cc001bef384cffb2c6 -ff84909a2422f12d45ffe2d7ffffdafff7dade444e970000ff6276fc8986f5ffdfffd6c0ffb1b9 -ffc5dfff9db4b657539ba37cceffdff4110bae5f3ee3ffe8dadfd9ffc7fbd90010fe0017dc0000 -ce352fe23f36f03e32ff4939ff7663ff9077ff5232ec0000fbb7ceffe7f7fff9fff9fffff1fffc -f9fffffffcfffff1f9d2ffd7fffbf2ffeffffcfcffd8fffff9ffecff8e81ff1b14f20000f08b93 -c2bbe5ed6799f50000eb0000fa8d76c3ffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff2ffebffffc4f5e0fff3f1a30010 -e90026c11c23ffedcfffd3a9f12a27c70000ff1735ffcdc7f1ffe8ebfff1fffcf3ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffff7fffff1ffffeaffffe6ffff -e6ffffeafffff1fffff7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffe8fffde8fffcebfffaecfdf7eff8f5f1f3f2f4f0f1f4eef0ffffe6ffffe6fffde6 -fff7e6ffdacfffbfb9ffb2b0ffaeafe0596aff9aaeff9fbaff4d6fde0b36fb1144ff255eff205c -d30000e90000fd061bf7252ef04742f87563ffad91ffd5b4db405fd52a4ec60732d31942ff85a2 -ffe6ecffffecdeffe1ffe8dacc001bcc192cfffedaf1f4c9bc4443d25f5cd1e5b4fff7e3fb485e -fb001eff94a4fff8cfecfac5dd6567ff1750b71d63ff5f93fd3854ad0000cf0000ffa9b5fff5fb -bdfbf8b9ba76cc4734ff1732ff788dfff0e0dcffefeffff1ffe9faffbb9ad51218fb305bffb0d2 -fffffbfbffe8ffd6bdff26218c0142fff9fbfff2ddda0003f20010ffd8c8edfffbfff3fff6000c -fa000ffe0013f40314d0090cb10000a60000a80000ffefdafff1daffaeacd50012ec0015ff7393 -ffb3b9a73c36c7000bffe1daffffdaffffdaffb2b3d3011eff6078ff878cec8677c11c22f7001f -ff3056ff0023960000a33126fff6d3ff4231b35438ffffe8e8d8d9ffd7fbf51748ff435eff3e41 -c8d9f7dae1fde7ddf6ffe1f6ffecfdffe6f3ffbdc8bd545bfd7ba7ffd3f1fff4fff2fffddcfdf2 -f2fffffffaffffebf9d2ffd2fffcf4ffefffeaf2ffcbffffe9ffecffae96ff221bef0000e3435f -efc0f7ea95b6ff0a05ea0000ea423fd0ffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff0ffe9ffffbdffe7fffbedc33448 -cc0017d43037ffeacfffe2a9e7392ed10000ff1539ffbcbfffffe8f0fff1fffff4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffffffff7fffffeffedffffdfffff -dfffffedfffffffefffff7ffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffeaffffecffffeffffff4fffff9fffdfbfceef7f4e6f5f0fff8dcffe4ccefae9c -dc847ad96766d24950c02431ad0818e20629ff6d91ff89afff2751d8000afc0027ff2152ff2253 -ffe0ddffe6ddfff2ddffffdbcef6c2abffbea8ffd2a7ffddffe2e8ffa2b5e84063d2133eff5b7e -ffd3dffffceccaefcdffeadaca0d23d3313effffdae6ddb6d42e3cff3b54fda79af0fff6f9818d -fa0c23ff564dffe7afffffccffdfdbff9cd1ff9ed2ffdbf4ffbebeff3b41ff0922ff6087ffdaec -bfffff7cee8f8d3b23d50004ff4970fee0d8c7ffe7ffdceaffc0ffffe3b6c41615fa335cfd81a6 -fffbfbf9ffe8ffebcaf837269c002ffff9fbfffedddc040fff0016ffafb3fbfffbfefdfff40009 -ff0219ff1d34ff354cff3c53ff3242ff0a21f30008fb5966ffffdae6e1b9ff465dff0e3cff4a6c -ffacb5bf1927c5000affe6dae0ffcfeeffdaffd2c3b00112c31023b62b30c61d1aab0000e00006 -ff2641ff011cbc0000fb2934ffc8caff0408f4000dff829dffe1f5fff2fbf6cabfffe9c2ffefb6 -bcffffcdffffd9ffffe0fafffbfbfffff6fff1cae5a7778ffc4482ffc0ecffefffeafff9c9f9e9 -edfffffff9ffffe6f9ddffd7fffaf4ffefffdaebfdb9ffffd9ffecffc2a1ff2519f20000e00636 -ffcaffedc6d8ff311df00000e40313d5ffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffedffc7e7e2c6fffbd6ecd5ffa3ae -bc0012e9484effc4acf1de9add4432e60000ff2248ffb1bbfffee8f4fff1fffff4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffe1f7ffebf6eef9f5d8fff4 -d8fff4eef9f5ffebf6ffe1f7ffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffaee9ffb7edffc8f4ffdefcffeffffffcfff1ffffe6ffffffc8b3db7b6b9e2920 -a00e0fd2202cf7273dea0522cc0000c30011ff8b9bffc2cfff6670c9252cf65d60ffa2a3ffadac -dffff1e6fff6ecfff5e9f0e9e8e3e0ffeceefff6fbfff4fbf8ffecfff4ecffb3c6fa4f73e93f63 -fd8e9efddfd4e3fedfffccb7c01122ed565fffffdafad3b6ff2b4fff2351ff445fe0ffffffd0cb -f66757d53e13e79452fffec6fff9ecffeaffffeffff8fffbfffcddffa49bff2740ff1648fc99b6 -c3ffffd6ffcdd4303bd30003ff3375fbeee8acfffbf0f9ffffc6ffffecb6a50801e7234bcf4b73 -fff9fbf0ffe0fff0cad73117d4004dfff8fbfaffdbea1d24ff0f28ff8194ebe1e0f0ffffcc3024 -f10615ff0a21ff605cf7cf9ce4da9df26b58fa000fde0007ffffdaabffc2ffa9a7ff305eef1a38 -ff96a8ff0c38e71d37ffefdaa2f2adafffbefff1d0ac272aad161faf3534dc6044df7754ffb388 -ffd9adffa07cd94430ff3c3cff7682ea0000eb0004e7274effe2fbfffefbe9f4d6d2b281ffe9b2 -ffe9ffffe6ffffe1f8ff96a8e15766d5353faf0004820000fd1b67ffb2e8ffecffe2fff6b9f7e2 -e9fffffff7ffffe1f8e9ffe0fff9f4ffefffd0e7f7a7fff8ceffecffcfa6fd2612f90000e1001b -ffd4fff5f0f6ff5334f90200dc0000d6ffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffebff9abdb7c0fffbc5e9cdffe0e6 -b80015f6555bf99a84d7d78dd94b35f6000fff2f55ffaab8fff9e6f5fff1fffff4ffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffcfefffe7fafffdffeaffff -eafffffffdffffe7faffcfefffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffe60041e80652e9316fec6a96eda9c0efe3e7ebffffdcffffffaf9fd25448970000 -bc040cff5064ff86a5ff7d9eff5778660000ff887affd4c0cf8266834f2abb9e72fff8c6ffffcf -eefffff4ebfff5b1daec5b9ee70664e70045e80046f50053b6ffd5f8ffecffe6ecff7a99d22a4d -cf5a6cf4cfc6f4ffeccd9b82ba1422ff7279fffedaffc5b1ff214fff0432e5000edcffffffffef -ffc093b04302be5915ffe6b4ffffefbfe5e8c3e8eec6fff4e9ffddffc9b6ff2b44ee001ae97396 -c3fffffff4daff2052ce0001ff256de4e7e06effeda7fff1ffdefffff1b68a0000d41038ad244e -fff7fbdbecccfff3cabc2506ff0a72fff7fbe4fecff73035ff1d36ff5f7bcbb8bae7fffffdb88f -ff5e55ff3b40ffae8fddffc6c8ffc6fbc597ed0f1afc0025ffffda92ffd2ffd6c1ff2d55b10004 -ff8fa8ff3c6ae1263bfff7da7ce99aa3ffc8ffffdaffd0caffd8daffe0dae3b57af9ffb3d6ffbd -c1ffbdc8ffaa9e7a3caa0b00cc0000a92f06b336248d232dffecfbcbb2b6db97948f0000ff0d11 -e10000ff1a18ff2318fc0200f50000ff2600ff4007ff3a00fd0458ffabe6ffeaffe0fff5b1f5de -e6fffffff6ffffdff8f0ffe4fff8f4fff0ffcae6f49efff3c7ffecffd3a6ed250cff0600d8000f -ffcffff5ffffff6842ff0900ce0000d6ffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffb0eee3eafffffff8fbffe5f1ffd0e1 -d22a3bc60c1affbac5c2e4d4c62944ff203bd20000ffba96acc37fe6ffe8fffdfbffffffffffff -ffffffffffffffffffffffffffffffffffffffecffffeffffff4fffffbfff8ffffeaffffd6fff5 -caffeefffbfffcfffff1ffffe2ffffd1ffffc1ffffb6ffffafffffffe1faffe7feffecfffff1ff -fff7fffbf2f5e6eae9dbe6e2ffd2ecffc5d7ffc2c6f6dfd1f2ffecd9ffeccaffecc3ffec82fffb -a0fffbcbfffbeefffbfbfffbeefffbd4fffbbefff988ffe3ffffffffcbf3f2002cc60000cb0000 -c80000d90500cb0015d96371950900f40000ffb2b6f1ffca5ce59df2fffbc9f8e4d80025f81131 -ffe2ccffe2d6e7fff6b5f9ffff4fceff2935d20000caffbbf5ffd3f80026f6002de3fff1b1ffe2 -98e8a3ff495ef1001aea0013d72b3bbc6458ff1b46fc0025b84d00ffd7d2ffebffffa6cfde1f05 -ed2d00ffb699f1ffffff2d18dc0000a4d896a9ffeaffc9e3ff3452e9301cff0c00ffa0d6ffd7d6 -fffec3a94400dd1b00ffcac3ffece5a6ffff9dffffff90d0ffeffbe2fff1f8002dff002dffe5c6 -f4ffcfffd2ddcd1a37ff1837ca0000ffedcdd2fedbdbffffc6d1ffffa9e6ed165aff002dff656e -ffd5b1ffffddfedfe5c15a8fff0836d80013ddffdae6ffdadb0004ff0e3cf9ffda99ffc0acffb6 -b45221c40f00ffc890ffd8b6ff373bd40000c304007f3e5cffe1f6ffedf3ffcabfb26d4ec37044 -d2733db1480eb7002bce5c75d8d6c9bfffeea0ffe7b0ffe3eafff3fffcf3e9ffcff8ffcffffecf -ffc9adff8b83ff525dff253fff0e2fffd6cbf3333ed90000ff0e2fff2647ee000cb10000b9392e -ff1400ff1a04ff1712f81318e1232ff45b6fffb2caffdbf6fadaeffff4fffff8fffff9ffdce0e9 -d0dfe4eaffffebffffdaf7ffd9ffffd1ffffd1fffffef9ffffe0ffff97c4ff225bde0000ce1f40 -ffdcffffc6eef64325f21b00b70f0cffd5ffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffbaefe7edfffffff9fbffe8f1ffcddb -ce2939bd000eff98a7ddf9ebe9576eff0924ea0000ff8d6ddbdb9fedffe8fffffbffffffffffff -ffffffffffffffffffffffffffffffffffffffdeeeffe3f0ffecf5fff8fbf9ffffeeffffe6ffff -e0ffffffdcffffdfffffe2ffffe5ffffe9ffffeaffffdff5ffd8ecffecf5ffeef6fff1f7fff2f7 -fdf4f7f8f4f5f3f3f3f1f3f2ffe8e9fff7ecf8ffece7ffecf4ffecffeee5ffcbdbffbbdbffede8 -ffe5e8ffcedbffb5c6ffafb9ffc9c2f3f6dbe6ffe8b3fffcf8fffaffc4dae6163ae50019ff3f42 -ff5340f04b2dff9bdbffdeddc95c45e00000ff4f4bd0dc9c9fffcbf9fffbf1fff8f10033e4001b -ffaf98ffcac5f0f9e8c9ffffff8afdff0915e70000edffcaf1ffd3f0001eff0036eefff1c0ffe9 -e2ffccff526af5001eff1745ffc3aedbffdae6b49bff1e41f73d0affb3bdffedffffd2eedc421c -c00400e35e4fffd9ffff1200f00000c6e2a8b5ffeaffb2cdf72139c53010ff0c00fe4b8ffff0ec -f5ffc6e5ab61f5230cff3845ffd2cf8efff0abffffff94ceffeffbe7fff1f9002ef1001cffbaa3 -e4febfffeaefdf3750ff1736cb0000ffeacdd4f5d6dcffffcad7ffffe0ffff87bff5002bdc191d -f7b88ff8ffddf6ecebffc5f0ff0533e6001de7ffdae9ffdad80001ff002affffdac2ffceffe1ca -ff0019b20000da0813ff2a38d80000d50000e54e4591cab7f7fffaffeeefff8990d63336ff574d -ff7a61ff6946f70029ff4a78ffcad6fff3e3fffee3fff4e1ffdfe0ffd3e3ffead4ffd0c0ffa39d -ff686ff6283de1000ec80000b50000ffb2a2b92325b60000ff032aff234ae90320ae181abc5c4c -da673bf9936bffcaa6ffe8cafaeed4dff2ded7fff1d9fffff7fffff8fffff9fffffbfffffcffff -fffefffffdfffffdffb6f2ffcaffffc4ffffcefffff0fff8fff1eaff969dd42333db0000bd1e3a -ffddffffb9e1f33a1ef61a00bb1612ffdcffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffcdefeef2fffffffbfbffeef1ffccd4 -cb2d3bb10000ff6277f8fffbff9cadf2000bff0f13f1452dfff2c6f9ffe8f5fffbffffffffffff -fffffffffffffffffffffffffffffffffffffff1fcffeff8feedf3f3edefedf3f1ecfdf7edfffe -eafffffbd8dfffe1eaffeffaffecfbffe9fbffe6fbffd4ecffc9e2e5fffee4fffae2fdf4e3f6f0 -ebf4f1f7f7f7fffcfefffbffcde8c9e6ffece0ffece7ffe2d2a19ce34263ff1458ff2064ff0b26 -ff122dff102bff021ded0f1ef4514cffb79effefcad4fff3f2ffefffd3cce1545dfb3a4bff8f92 -ffc5afffb389ffe3fbfffce8ffcba7ff3024b80000c0a472e3ffe8fffdfbfff8f1ff073cd10000 -ea6449ff666beabfb6d4ffffffcfffe00000ff0112ffffcaebffd3ec001aff0443fffff1d8fff4 -fffdd6fb4458d60000ff2646fbffda9dffda9efeb4684b2bff0e00ff5d7affe5fffff9ffeb864e -a90000d9181dffa3f6f40000f90000f5eabdc7ffeaff85a3cc0b1cad4d1bff4122e20027ffece6 -c0ffc6ffffbcff4444b20000ffb2b59cfff5c3ffffffa6d6ffeffbeaffebef1140e0000bf27b73 -d2f0b0fffaf3fb6679ff1534cd0000ffb19bdaecd2e0ffffd3e1fffff7ffffd6fbf11e3fa50000 -ffdaacebffddcce0d5fff0ffff002efd022dfbffdaf0ffdada0003e70010ffefccfeffdaffc1e7 -ff1c5bde0015e31f47df425ddf1640e85d72f7fde1a8fff3e7ffefffc3cbff2549fd0020ff4e64 -ffa59cffb495f2000eff304fff7c97ffa8abff8883f14446e60c1dee000dcf112ad7122de41533 -f4173aff1b43ff1d4aff2050ff2253fff0d7d78076dc4450ff718cff97b2ff8f9bffaaa0ffe7ce -dec9aefff1d7ffffecf1fff6e0ffffd1ffffc6ffffbdffffd6fffbdcfffbe7fffbf5fffbfffcfb -fff5fbffeffbffe3f2d7fde4e3fff1e0ffe8eaffdfffffd4ffd8b0de72559d0f00e01700ba394b -ffe1ffffacd7f53119fc1a00bf1d18ffe0ffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffe5f0f6f8fffffdfcf8ffe7e2ffd1d1 -d13e48ae0000ff2945fffcfbffdae2cf000aff2d2fca0000ffe3caf7e8d3e7fffbffffffffffff -fffffffffffffffffffffffffffffffffffffffbfffffcfffffdfffaf8f9eef0efeaf0eeecf5f2 -eef9f5acfff1b3fff1bffff1cefff1dffff1eefff1f9fff1fffff1d2ffffd6ffffdfffffe3fff9 -ebfcf6fafcfbfffcfffffaffccffe6dcf0d4e8aeace85c76dd1845d7002dde0031e8083eda0000 -f00804f90b09e60000ce0000dd0000ff4338ff8476ffffe3f8ffe1ffffddf1a899e5414aff8692 -ffe4d1ffffcfeefff7bcc5a8fff2caffc3a4ad0f00f09d7dfffae8f1dee0ffe6e6ff0933cd0000 -d6381bff1c2bfd8c8ed9ffffffe5ffa50000ff1829ffe8cae4ffd3da082bff0d4cffedede9fff4 -ffffdaf56e72dc000fe91f39ffceb6eaffdabebb92842a1fe80000d7143cd9bdeef5ffffffc784 -bb0c00f81a29ffb1ffef0000ff0b0fffe8c5dbffeafa4c6fba0411c68f4fffb07cd10003e78e86 -9dffbfe7ffcfff8292cc0000f87a7eb6ffe3e3ffffffc9ecffeffbfbfff1f0526be2000df2424d -d7f7b6f2fff3ff9ca5ff1130da0000ed6b5ee9e6d3e4ffffdcedffb2e4e5ffe7fbf73f57ae0500 -fff5c8e9ffdd9fc4b3fffaffff002cff0e3cffedccf4ffd7e70017c90000e6b49bffe6dafffdfb -ffc7d7ffcfe5fff1fbfff9fbf8f0eee2fffbb2fffbc8ecc0fabaaeff4564ed0018ff0027ff7b8e -fff1d1eaffcfc10000ee0000ff2933ff4b44dd392dc20f08c10000c900009d000dae011fcc2541 -f3536dff869dffb4c9ffd3e6ffd4e6feffe6ffedd9ffc4c0ffdfe6ffdfe6ffeae6fffae6feffe6 -ffe5ffffe6ffffe6ffffdfffffdbffffe3ffffeffffff0ffcefff1c9ffe2d0f2d7fafbebfff3f1 -ffe8f1ffdff1ffb8cfffd8b2ffe2baffdeb6ffc69dffa17cff704fdc3115b90000ff7938d87d82 -ffe6ffffaedbff2c19ff1900bc1f18ffe5ffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffbedfcfffefff5fcf5ebe3d6ffe0d8 -e55c63ba0000ff0020fff2f8ffeae8cb3d31ff3c33c10000ffbbb8fed4c8d9fffbffffffffffff -fffffffffffffffffffffffffffffffffffff8fffff9fffffbfffffefffffffefffffdfffffcff -fffbffc7ffe6ceffe6d9ffe6d0f6cdd4e2c1ebe1c8ffecd9fff6e6eaffffebfffff0fffff4ffff -f9fffffefffffffefffffdfff0ffecffc4c8ff3167ff0549ff2e72ff80aeffd5cebaffd2ffffb6 -fffeb6fff5b6ffc190fc6143e71308ee0000f10000ffaea0ecdaace7ffd4fff9d4ba1928fa3551 -ffe6e1e3ffe3a7e9ce7e6755ffe5caffdfb6ac2200fb6b60ffe3e8d2c2c3ff9fa9ff0018da0200 -e6320fff080cff6573ddfffafbfcff7c1f00ff1f30ffb6b1d0ffc7e14d5bff0f4effb2c1fcfff4 -eaffdaffc1aef3394ef51436ff425cff5e76ff345cff0533ff1b00e13857dfc5f5feffffffcc8d -cd2000fe373effbefffa0000ff1d21ffe2c3e6ffe5e11a45c70617f6c986ffe0a3ff294ab7332f -c9ffd7e2ffe3ffc5d6ff4b7ab72224d8e3a9fff1ffffeeffffeffbfffdf1fca2a4f1001cff1434 -ecffced4fff3ffc9c8ff0d2ce30000cc2d2affeadfeaffffe3f8ff69c9bbfff1fbee364e9f0000 -ffebc8f8ffddafcbbdfffafff3072dff1644ffc2afeef4c8f82341b50004c67466ffaec5cbfffb -c8fffbebfffbffedfbffe5fbffd8e2e4cbcffbcdd8e33f40fb2036f9001cf20017ff3459ffc8ba -c0ffe174ffe3a00501ae281dc15b45d48769eda887ffc4a6ffdfc7ffe1cdffcbcfffcfd1ffd9d7 -ffe4ddfbf1e5f9fdecf7fff1f2fff1ebfff1ecfbe6ebe1d5fff0e9fff8f1fffbeff7fff1ebfff1 -fff0ffffefffffe3ffffdbffffdfffffe6ffffe6ffffe5fff1ffe6fbffe6faead3ffded3ffdfe1 -ffcbd9ff9bb2ff6f8bff4f35ff3c27ff271cff1c15ff0e0cff0507ff1015ff272cffe792fbcbc1 -ffebffffb1e1ff2619ff1700b71e16ffe9ffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffe8fffffaffedfef4d6e5d0fff6e6 -ff8588d4000cf0000ee8b4c1fff1e6ee9b7bee3521cf0000ff6273ffcdcbcbfffbffffffffffff -ffffffffffffffffffffffffffffffffffffc9e9ded7f1e8eefff9fbfffffffdfffff9fffff6ff -fff4ffffb1b9ff929cfc626ed63443c4172ac60f25d3152edf1d37ffcfe4ffd8ebffe7f7fff4ff -fff9fffffefff9fffff0fffaffcfd7ff5c7ff80033ff074bff73b7ffdaecd9ffec89ffece4ffca -e6ffcaf0ffcaffffcaffe5bfff8e82ff3744ff011cff4c55d38a5fe0ffcaffffd4ad000ee00028 -ffe0efcefff3e0fffba63b45ff8e8fffddb69f1600d70913ffcce4e1e0dcff4c5fee0000e61200 -fa2f07fa0000ff425cd9ffe5bcfaef7e8035ff1728ff5b6fcaffc8ffa8a3ff0847e96481fffaf4 -ddffd4d5c39fcd5554cc0018d80001e2000bf90022ff0533ff9560ffb1b7ffedffffedffff875a -c91c00d75a48ffe9fff60700ff272bffe5c2dfefd2e90238e0011cffc084ffdba3ff7b86d31a1f -ffe1d1f4fff2fff0f6ffd2e0980000d14025ffcdeefffbffffeffbfff8f1ffe6d2fc0027fa001d -eaffcfb6fff3ffe6ddff0927f40006b90005fff1edf0ffffe9ffff92fff1fff1fbf32645a10000 -f36e5dfffaddf4f0edfff3ffe71532ff1644fa8f89e8e3bbff697cb70c1ca83834ff6795ffbdc5 -fcdbccffa6acff2867ff003bde0f3bde153ffe0035f20000fb000dff1228ff4b59fba49bdeffdb -9effef70fff3f4efdcedecd8e8ebd6e8f2daf8ffeafcffedffffedffffedebfffbe9fffbe4fffb -dffffbd9fffbcefff7c2ffefbdffebeafffbe6fff4e0f8ebe1f5eadff3e8dbf3e6dcf8eae0fff1 -bdffffc6ffffd1ffffe0fffff1fff6ffffecfff1d7dec9aeffdcd0ffb9b1f88b88e76469e34955 -dd2d41d01029c50017e60000cb0000c40000d70000e40000f70010ff425aff96a9ffff9afaf2db -fff0ffffa2d4ff170fff1400b42117ffeeffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffe3fffff8ffe7fff4c8eacffffde6 -ffaaabf00524ec000ab26f81efd5c4fff9cac01f03e30000ff0722ffd1d5c1fffbffffffffffff -ffffffffffffffffffffffffffffffffffffb7e6d6cdf3e6ecfffdf9fffffffcffffeff8f7d1de -ebbcccfc0022fa0023f70224f00524e80823df0921d8081ed4091deb3d78fc5d93ff92beffc8e6 -ffeffffffcfff1ffffe1fffafe2156da1b46c63651e2858fffe1defff7ecffeee0d9c2b4ec6176 -d46973cc8d88ecccbdfff7e8ffede8ffc2ccff869bff2626b32e0be6ffc3ffffd1cf001ffe003c -ffd6fac6fffefffdfbd2002cff2843ffd5b6e45130da0000ff6e94f4fffbff1d35e80000ea1900 -fb1e00e10000ff3144d8ffd99cffe69ce683ff0617ff0e29cdffd1fff3dfff003dbe1941fff3f4 -d6dfb2c4bc95b68068bf4142dd1b33f9203fff435bff6471fffc91ffffe8fff0ffff90bded230d -d02100c19f6fb7ffffb91300ff352afff4c9edf7dcff0544f20015dc7344ff5b2fff4338ff1828 -fd5578ecc2d8dbfffff7ffecec5648e00000ff9dcbebfffeffe0ecfff3f1f2ffe6f30025df0002 -e9ffcf8effe1fff3e3ff0523ff0518b20000ffecedf2ffffe7ffffb2ffffffecfbff4973d80000 -e92d2effd2c6fff1fbffcbf1e12138ff113fe75f63e5d5b1ffabb5c6353c8e090cff3361ff2b46 -ff5755eb222ac80000ca0000dc2a2adc5245ff0c27ff4134ff674efaab82eeecb9deffd9d2ffe4 -defff1f1ffffe3ffffe9fffff1fffff9fefffbfcffeef0ffdee6f9d2dff0ddf6f3e2f8f6e9fbfb -f2fffff9fffffcfffffffefffffdfff1fffff0ffffeaffffe6ffffe1ffffeafffff0fffff4ffff -d9ffffd7fff1dff2defaeed4ffe8caffcaa6f9936bda673bff3146f7273de21127c50008af0000 -b50000d0000eea0e28de5020cd2906e42014ff3a42fd4255d95062f0a3adfff3f6ffff9acfe4c3 -fff3ffff7fb2fd0000ff1000b92b1ffff4ffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffe1fffff7ffe7fff5c2edcfffffe6 -ffc1c1ff1434ed000b8d4257ccc0aaffffcaa30e00f40000d30000ffd5ddbcfffbffffffffffff -ffffffffffffffffffffffffffffffffffffd8fffce0ffffeafffff8fffffaeff3d4b4bfa67787 -875063b20000d1161fff585bff9a96ffcabdffe0cbffe2c7ffddbfc50020df0049ff4d8bffa0cc -ffe1f8fffbffebffffdbfffef1002cf04066cdd5bda5ffeca4ffecd8e8cdee4a6ce90024ff1268 -ff0051e81759ed81a1fff2fbfffbfbfffafbddc2c7ff1c14990000d8ffaaffffcff80a3bff1a66 -ffceffafffedffeaf7c10000fe0017ffceb6ffb79af5000eff3b67eafffbff162be90000e81800 -f00900c80000ff2531dcffd695ffe9b6ffb7fb000be20000cbffd3fffcdffd0035a10018ffeff4 -fff7dafff8d3eee5beffd9beffe0d2ffeddaffffdacfffdabeff84dcffe8ffe4ffe63e7bda0000 -e63500cdeba571ffff891100ed3d26ffffd2fcffeaff1254e8000bac2802a900009b0000ff1023 -cc0010ec9bc6afffffb5ffebffd2bfea0000f97aafd0f3edfdcbd7ffeeeee2ffe6e5001dcb0000 -e7ffcf6effcdfff7e3ff0220ff1124b10000ffe9edf5ffffe7ffffadffffffd6eaff83b5ff435c -ff4351ffd0cfffe1f5a24f7dde293cff0c3adc424ce3cfacffd3d8d25052810000ff1240d20000 -dd1e0cde2b15fe0003ff3f43ffffb3ceffb6ffcf8dffc187ffeea3d8ffbfabffcfb3ffe3e0f9e3 -ffc4e5ffb7fde0f3ffeaeeffffedffffecffffe9ffffebffffeffffde5fffee5f8ffe4f9ffe2fa -ffdefcffdafeffd6ffffd4ffffd2ffd5d5dfe8f5fbe8ffffd3fdf9d0faf6eafffff5fffffefeff -ffdbf6ffb2caf45b6fe1232ff81318ff1712ff1a04ff1400e00000f0000ef90017f0000ee8000c -ff1934ff6a82ffacc3ffffb3ffda9cffd1acffe3d6ffd0ceb9b6b1abeddfb2fffff4ff99a3c7a1 -fff1ffed5e93ec0000ff0e00c03226fff7ffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff5ffe1fff3f4ffe8ffe8e6feb8fff5 -c4f0cce07257e20000ff3517fffee8d5fdffe8003dff241fc40000ffffcab9d6e8ffffffffffff -ffffffffffffffffffffffffffffffffffffc1fffffcd7f9fbefdfcbffcdffdfafff0322e9001b -8e90821bb47cbbbcb7ffd0faffd6fbfcfffbc1fffbd8fffbfffafbfcffdac1544feb0014ff2654 -ff8393c8ffdaffeccbff0937ff2b0de7204974e6e78cffffffffafe21100d50000ff42aaf20022 -fa9285a83719bd0000ff496dffb6dea0f2fdbcffffa06a52f3001cff3f66ffb8aace5252d3162c -ffb1a8fbffdab4ffffffe5ffa50000eb3124fff4af8c7831a8251bff74abbf0000ff1009e4ffb6 -cc0000a70c07ff4556ffb6b3ceffe3ffeff4a10018fd0035fffcdfcbffd3e20000fb000bb6ffb7 -e0ffffd5ffffb7fffb93fff194ffe6dbffdcffddd4ff7d9effb0aeff0116dc0000ff0e41b26472 -c6e4e2edfffff9daffba0000ff4464ffdbc6f2d1b2ee6e6fff2b4dff1f46f3223f96fffbc9d9cf -ffc8e7ffe8fbccffecc3fffbfff6fbea3f74c90700f88163fffddfe3fff3c4dcc684362cc90000 -ff231ca2ffb0edffcffff1cfdd584fb52620f2967fffffcfe9ffcfbcffcff4ffcfffaf9cff273c -c80000b60000d70009fb3b46ff041dec0515f64a46ffa28fffa08ae24e42e62327ff3645dfdbbe -e9e2c6fdebd3fff4e0fff4e4ffefe4ffede4ffeae4ffe4f4ffe7f4ffe7eeffe3e2f3eae1effdec -ebfff4e4fff4fff9fbfff9fbfff9fbfff9fbfae6e8f2dee0fff9fbfff9fbeadffffdf2fffff7ff -fff7fffff7fffff7fffff3fff1e0ffdfffc6f7ffc6fff9c6e86e57d60008ff0017ff1930ff0f26 -ff2204ff0e00f60000f80000ff1100ff1e00ff1b00ff1200ef004dff1381ff6ac8ffbbffffe5ff -f9ffffd4ffffc0fffffffebafffbbdfff0bdffb08cf75642df140eee0107ff0713e60004de0000 -c70000b30409b84435d49876f9e9b8ffffcfffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff3ffdffff3f4ffe8ffeeecffc2ffff -d3ffdbf28469f60000ff0f00fee1d1c4e1ffe10045ff201bd60000fffacad0f4ffffffffffffff -ffffffffffffffffffffffffffffffffffffcafffffae1fffdf8e5dcffcdffbd94ff001ff60436 -b4b8a9dee4c8ffffe8fff7e8ffe7e8ffbac8ffb3bdfff2e8fcffe8feffdabb9a7bf4394eff1e4c -e35b5fb6ffc8f1ffd6ff2547ff1c00f5526faaffffbcffffffc687fb0f00ee0b1cff82ceff86bb -fff4dafebd95ff2536ff4367ff9cc2c8f9ffcaffffe0a891e90024ff2349ffc3baff9a95e92940 -ec7070f6ffd8dfffffffdffffb2040c50000ffd7a1f2ad76860000ff5188c70600ff130ce6ffb6 -d20000af0b09fd384cffa4a4d8ffe3fff3f4be1941ff003dfff3dfcdffd1ff0e29ff06179ce683 -fff7fffff6fffff7fbdfcdc3d9b4a4ff9d98ff5265ff0122eb6450d3000aff153fff7093d4a1a6 -dbfef7f9ffffffe7ffef203cfcbea9cdffdac6ffdafff4cfffbdbaffa3a5f5938afff8e8ffd4e8 -ff3c677e000fc3ddbac0ffe8c6e6c1ffe9e8e11200db5240efc6b4f4fff8e8e8e0bf6161d10002 -ea0000fac7a8ffe1d4ffaebbff1737da000fff6772ffddccfff8d4c8ffd4f8ffd4ffd0beff6c7a -ff1d3aee1a31ff5e64ffa39bffd3c6efc7aee0e8bfe6ffdde3ffddc6ddafd7c4a4ffddc6f1fff4 -f5fff4fbfff4fffff4fffbf4fff6f4ffeeefffe6e9f7fbeaf4fdeaeeffeae9ffeae4ffecdfffee -ddfff1dbfff1e9ffe8e9ffe8e9ffe8e9ffe8e9ffe8e3ffe2cdf3ccbae0b9e7ffc1f6ffc0ffe9b9 -ffc3a5ff8c83ff4d57ff142dfb0014dc0002ff1929ff0c21d50000cb0000fc0011ff182fff0b22 -d90010d80015d4012ee44762fc9da3ffe4d7ffffe8f0ffe8bcfffbc7fffbddfffbfbfffbfff2fb -ffcfe7ffb4d7ffabd4a31801b8230fd0281be21f1bed0c12fe0312ff0d1eff1b2cff4860ff4659 -f54a53e25e5ae18674efbc9dfff0c7ffffd4ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffefffdbfff3f4ffe8fff8f6ffcdffff -e4ffecff9f84ff160fe00000db9c97b7c1e5da155cff1712e90000ffeecadfffffffffffffffff -ffffffffffffffffffffffffffffffffffffd9fffff5f1fffcffebf5ffc7fe856aff0221ff4163 -e6f3e1ffd1c3fff5c3d3eea9d38d69ff162bff0a25ff5c5ce7c997fff0daf4ffd5ffd5baf53e52 -9f1218b2d09ceaffd4c24847ff0700ff9fa9dbfffffefcffff5a3eff1300ff625ff4e0ffffdef6 -eeffe4ffffcfff7374ff001bf4496defe5fdd5ffffffefdadc2237ee0228ffc3c4ffe8daf3334a -c71b2bb8ce9dfffaffffcdf4ff6385a80000ff694cffd2b6910000ff2356d31600ff160fe6ffb6 -de0000bb0d0ef7213bff828ad7ffd3fffaf4e96481ff0847ffa8a3caffc8ff5b6fff17287e8035 -ffe3ffffe0ffffb7e4ff5993ff215eff1d4eff0a2fc7000084673fb5443cff9aadffdbe6efecdd -e4fffbfff6ffffb1e0e84854f3d2b3caffdad4ffdafacbb1ff8993ff6573cb4d4ee10b17ef0008 -ff001bff4b4ffbd0a3e6ffcaeeffcaf0dfa9ff3c37e1423fd4898dfff9fffff4ffffb5c5ff2c3b -e20000e91837ff3f6aff2253cc0000c10000ff2f54ffa9b2ffd0c7ddffdcffffdcffecdcffc3c7 -ff9aa4ffa5a4ffe2cefffddcf0fffbe2fffbcefffbc1fffbc1fffbcefff8e2fff9f2fffbc9fcf7 -d0fefbdcffffe7ffffedf7ffeeecf9ebe0f0e9d8ead2ffe4d8ffe8ddffe8e4ffe8eaffe8f1ffe8 -f7ffe8f4ffe4ffeecaffe6c2ffdebaffeecaffeecaffeecaffcba7d48e6ab43a00c13500d52e00 -ee2100ff1400ff1100ff0f00ff0e00ff0016ff0f26ff081ff5000ae50913dd302ab42b197e0700 -ffddffffe2ffffebfffff8ffe4ffffcaffff95f8fe6ee0e196ffd5aeffd6c9ffc7d7bc9fdb6768 -e6213dfe002bfe002af4051ae8000ee10005e60009f50016fa041bf20012e60006ffd1caffcfc6 -ffcec1ffd0bfffd9c3ffe8cdfff7d9fffddcffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffebfbd7fff3f4ffe8fffefcffcdffff -e4ffecffb59aff2f28d70000d46973c0b3dfe05387ff0a05f10000ffab96d8ffffffffffffffff -ffffffffffffffffffffffffffffffffffffe6f7ffeefffff5ffedf5c59df94b42ff1931ff8997 -f2fff3ffc2a3ffa370aa682ca82200e50000f30000fa0002cd1d06ffadc9fff6dafffcdaf43d51 -9b0000d97b71ffdcc5c5323aca0c00ffe1daebffffffbcdcff0500ff1900ffa895c4fffff0ffff -8fe6bbdcffd8ffba9abd0000e1183cffe4fff1ffffffeddad45c5be2001dffa3b1fff5dae32139 -cf0007cfedb9ffedffffd6ffff5f7db20000ff1b16ffadadf11c2ee00c32da2603ff130ce6ffb6 -eb0000ce0f16f60629ff5d6fdde7c4fcfff4ffb2c1ff0f4ee14d5bd0ffc7ffb6b1ff1f307c1f00 -fbedfcffefffffadd7ff2e78ff0643ff2758ff6677d59f7bade7b4dbc5aeffe7e6fff4eae6ffed -e2fff1ffd9e1e23261ff1644ffa9b4ffefdaffc0b6ff284ae80011dc0005d80001ff221bc70000 -f40906e423128e0d00faa36effecb6ffe4b3ff343bd52b38c7667affdaf7ffecffffc2dbff4558 -e80004a50000ea0027ff003ae9001ee50333ff728bffd1d2fff0e1e9ffddffffe6fff3e6ffeae6 -ffede6fffbe6f0ffe6d9ffe6fff5ffffeefff1e3faf8eaffffeeffffe2ffffd4f9ffcff8c4f5fc -cdf9ffdeffffedfffff7fffffffbfffff6fffff2ffffffdfffffdffff4d7ffe1ccffd0c4ffc4bf -ffbebfffbabfe20000d90000da0000ee0000ff0307fb0000d60000b30000ff100bff0803fa0000 -f30000d40700be2000b43707af460fef1e24ec2e2ef15549ff997efff0c4ffffc6f7ffc6d9ffb5 -bdfff6c3fff0dbf4f0ffecf7ffddf9ffb7e2ff80b7ff5794f10008f6000ef0000ddd0000c80000 -c30000d70006eb121dd20014c2000ac50917f44b52ffa4a4ffd9d3ffded3ffe1d3feffe6ffffe6 -ffffe6ffffe6fffde6fffbe6fff8e5fff1dfffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffeafad6fff3f4ffe8fffefcffcdffff -e4ffecffbfa4ff3932ec0000e64c66dfb7ecf2a3c2f70000f50000df3d38cdffffffffffffffff -fffffffffffffffffffffffffffffffffffff8e7ffdbffffe8ffeaf68573ff1f2aff4752ffcfc6 -edfff3ffe6b1ff785eff1d18ff3328ff8c6bffa381ff4943f30000ff214fff99a2ffcac6ff0835 -b20000ff5064ffb0beff0b39af1900fff7e8e9ffffffabcfeb0000ff1800ffc2a6abffffc1ffff -9ef4dbd5ffe3ffffcab6180dff173bffcff3fcffffffeadad9a78eec0529ff6680f8f3cbd6122a -e2000bebffdaf7b7e9ffddffe43949b60000ff0601ff5e66ff94a6b62534d92d07ff0801e7ffb6 -f70007e31320f6001bff3e5bedd3bce9fff4ffededff0d4cda082be4ffd3ffe8caff1829a50000 -e0ffffd9ffffe6dedced3e69f9002eff2f60ffd1baabffcfc7fff4f7fff4fff6f1feffedd2ffea -e3ffe6ffc8c9c3000dff1846ffc1d3ffe3daffc7cbff0c39db0004ff0432ff4469cf6d3cffecb6 -ffc792b6350ed91807cc0000bc0000ff443ddd1b24bd2438c76689fbc4eeffdbffef9ab9d95260 -e13738ba3351f16886ff94b2ffa9c0ffccd6fff8f1f0fff1dbfff1edeedefff9edfff9f1fff8f1 -fffef1f1fff1d9fff1cafff1d7eff9e1edfbf2e6fcffe9ffffebffffe8ffffdcfff4b6ddfffdff -fffcfffff8fffff4ffffefffffebffffddffffd5f8ffa7a2ff8e8bff6569f43e4af6273bff213d -ff284aff2f54f90000ff0e12ff1e22ff181cff080cff090dff2327ff3e42ff005fff0562ff1a6c -f94284ff79abffb8dbffecfffff3ffffeac6ffeac6ffe2beffe7c3ffe5c1ffb995c97551994521 -9137009c2e00b82900e82a10ff241aff110cea0000ca0000f90010ff041dff122bff1932fb3a3d -f26f5dffae8cffdbb1ffe7dfffebdfffeddafff4d8ffffdfedffdfc6fdc69ddea4ddfff1e2fff1 -e9fff1f2fff1fefff1fffdf1fff3ebffe9e3ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffeafad6fff3f4ffe8fffefcffcdffff -e4ffecffb99eff322bff0900fb345dffbffdfff4ffce1000ff0a00b00000c5ffffffffffffffff -ffffffffffffffffffffffffffffffffffffffe5ffc8ffffd4ffdefb4d4fff1124ff8281ffffe3 -e6fff3ffb092ff4951ff1530ff6e74fff6caffffcaffa599ff102bc80000cc0f25ff5369ff0c3a -d6000afd8a87ffb2c3ff1240d51d00fff0e3d5fffff1ccdde80c00ff1000ffa78ec0ffffc1ffff -e2feffebffecddfdbab44325f30011ff698ff8faefffe8daebf8cafd173bff1b42cdebb7f7314a -f4001de7ffdaeeb4e4ffecffb84d47d80000f00000ff1b23ffc5cfa66e5fcf2c03f40000e7ffb6 -ff0011fa192bee0013ff284fffcabed8fff4fffff1ff0443ec001aebffd3ffffcaff0112e00000 -fbfeffc1ffffacfff09e7070d9001dff1945edd6ad77ffcfdcfffffffcfffff3fbf5fff1c2ffdd -e6ffddffded6eb000dc70a20ffb0a5fffedaf1c2a8c5343be0263bff9f9efff9da85743eeeffca -e6ffcafff5c8ff5a5eef0008c80000b60000ff767af58496ffbee2fff0fffff3fff1cee6f5b7b8 -ffcbbae4c1c8fcdde3fff9fbfffffbf0fffbdffffbc6fff0a6fad9f2eae8f8f0eefdf8f5fefdf9 -f5fff7e6fcf0d8f8e9cdf6e497fffbabfffbcbfffbe9fffbf9fffbfbfffbf4fffbbedaccffcad4 -ffc3cfffb5c4ff9eb1ff8098f25f7be04362d43354fb2330ed101fd60004c60000c40000cf0000 -dc0000e60000942710b2452ec55841b2452e90230c91240dc1543df2856ec6b9e5d0b2e4e5abe6 -ffaaf2ffb3ffffc0ffffb7ffffb1fffa4f48df2926ea1f23ff3946ff3e55ff263dff1930ff243b -df0000da0000de0000f10000ff0d00ee1800c60d00a60000ffccbdffd7c6ffe0cbffdec5f7dec0 -fcefcdffffddffffdde1f4d4d6f1cecbf8cfd0ffe2c7ffe8baffe8afffe8a9ffe8d8faeadffeef -ecfff7f5fffbfcfffbfffdfafff5f4fef0f0ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffecfcd8fff3f4ffe8fffbf9ffcdffff -e4ffecffab90ff231cff0d00ff174cffc1fff0ffffb62400ff2200a50000c3ffffffffffffffff -ffffffffffffffffffffffffffffffffffffffe1ffbaffffc0f8d1ff2336ff192cffb8aee9ffe3 -d7ffe8f62753e22249de4a62fcaeaefffbe8fffde8ffcec8df757fc74245a3332fff5f71ff7d9e -e9a894b5ffccffd7c0ff0331ff1c00ffcbc6b9ffffd2fff8d75225ed0d00f27563e6fcffd6ffff -ffeaffffe7e2a8d793d57c54ec0003ec0023cbd4b7ffe6dad9ffdaff2043e70010ccffcaff7f99 -fc0025b3e5aafff0fffffdffdeb297e82a1ecc0000ff0911ff9f9dadca9ec22300e10000e1ffae -ff0718ff1e35eb0010ff1c4affc9c5c0ffe9eefff1ff0036f0001ef1ffd3edffcae70000ff0915 -ff8dccf1ffffa7fffba1b09be60f3bff1748ffae9aa2ffcffff5ffffddffffe7fffbfff1a9f8bf -eaffd6ffdbccff061bd40005d9424bbf78669a4035af0f1bf24d5bffd5c1e6ffdaffe9e8c3e3be -c0ffe8bed8b58e0d1fff4c77ffd4e8ffe8d8ffe5e1ffdbe5ffeffffcf9fff0fffff1fffff9fff4 -ffffe1ffecf8f2e6f0eeeff4f6fffff6ffffe5edf0d7d8ddd3ced5f9f4fbf2f1f7edf2f6f0f8fb -fcfdfffffaffffeefcffe3f4afffddcdffddeafbcfeabda6ffc6b9ffeaddfecbb6a08165f53334 -f83033fa292ff81a25f10615e60002da0000d00000c70702d1160fdd2b21e93f32ea4a3ae24d39 -d64832ce432cfffce8fffce8fffce8fffce8fff6e2ffedd9feecd8fff0dcffffe8fffce8ffede8 -ffa8b6ff5275f1073cdd0014c70000ff364dff0920f6000bfd0012e10000b40000c50000ff0015 -e60000ec0005ee1120ff5d58ffb59cfff6caffffcaf8ffcab7fffbbffffbcbfffbdcfffbe6fff3 -f0f2edfff9fafff6fbf2fff1f0fff1edfff1e7fff1caf9d9aee4c2a6e2bea9e7c2fff8fffff8ff -fff9fffff9fffffbfffcfdfffbfefffbffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffedfdd9fff3f4ffe8fff7f5ffcdffff -e4ffecffa085ff1811ff0600fb023cffbeffdfffffad3302ff360bb20000c0ffffffffffffffff -ffffffffffffffffffffffffffffffffffffffddffb3ffffb3f1c8ff0d28ff2134ffd9cad8ffe3 -b9eccdf90043e0396daeb5aed5feecfff3fbffe5fbfff8f7aeffe2edffdac5b792ffbfc0ffd6da -c0ffda4cffdab1f8b6eb0014ff2b0dffafb0a7ffffb5ffffcd8845d21000de4e43f1d3f9f2f9ff -ffd7ffffe5f4bae9a5ffdfb2ff3346ff052cf8ffe1ffe5dac8ffdaff2043cd0000d2ffdaffc0da -f90022518449fff6ffb8d3caffffdae94430b20000ff151dd7574cb9ffccb91e00d60000d9ffa6 -ff0a1bff213aeb0010ff184affcacbb1ffe2e3fff1f6002df80026f5ffd3caffbbd20000ff2935 -ff2287ffccebb9fffbd2e1ccff3d70ff3b6cffa1aae4ffcffbb6ecffd6ffffddfffffdf494dfa6 -e7ffcdffd0baff0412ff002cff0230da0011b90000e6000fff4573ffb3c0fff0d3ffc6fbfff6fb -c3fffb9dd4bdffe8fbffdcfbe1f1e795fffafff1e4ecc9cfc1b8d5d6e9ffddffffd9ffffd2fff1 -ddffe4ffeeffffddf5f3d2e7ffe3f8ffefffffe7ffffdfffffd9fffffdfff2f6ffe9f4faf2f9ff -fffafffff1ffffe7ffffe1fffff1bfffcaa9ff635ce7000fff0019ff314aff1d2ea80000df0000 -e80000f70000ff0902ff140dff1912ff1a13ff1912bb3e1edf6a47ffb086ffeebdfff7bdffffbd -fff9b1e3e59affe2fbffe2fbffe2fbffe2fbffe2fbffe2fbffb3ccd37b94cf0500d20800d70d00 -df1200e61700eb1c00ee1f00f12000ff0017e00000d40000dd2120be2a1c9f3015da8863fff0c6 -e3ffffe3ffffdfffffd4fbffd6ffffd6ffffc8f4ffbae6f3eed4efffe4fffff1ffffeeffffe0ff -ffdbffffe7ffffe9ffe5d0cbffeeeafff8f4fff7f4ffe9e7ffe2e1fff3f4fff3f4ffe8ffffeaff -ffeefffff3fffff9fffefefff5fffff1ffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffdbffffcdfcecd1f1e6f8fffffffbff -fff4ffd7a8b8976073b91900f20000dbffd4e0e0c8bd2943bc0009da0000e3ffa3ffffffffffff -ffffffffffffffffffffffffffffffffffffffe6ffe9fffbfec5b2ff122bff353dd5ffd0c6fffb -ffc8fbe60000ff1200ff5149ffbba4daffe3b3ffffe4ffffffe3ffc7e6f8e6f8fffbfcfffff6ff -fff8fffbfcfff0ffffe7ffffff0800be533381ffc5dfffffff87e8ff0047fe2d30e0fe8ee7ffff -bdffffbfffffffeeffff79b3e50022a86948b3ffc8b0f189fcffcaff1c5bd3001db8fadfd2ffe8 -ff3d56fe0003a8ffffffb5dfe3e1d4ff619aff1a3ba91901ff1717ffb27dffdeffe1f0f3fff7fa -df1c46b10000bb8758977f39ffaa83a9cc8af9ffcdfffbcae6aa88ff9d8bffbbb7ff7078b40000 -ff3c48ff8990ffbcbbff92869f452d854a28e5c499fffecfd4ffffddfffff0fffffffbffffeeff -ffe2ffffa7cef16f9bc30728d02641ea6171ffaeafffeddeffffe4d5f4cbacdbadfff3f4fff3f4 -fff5f4fff6f4fff7f4fff8f4fff8f4fff9f4eaf9ffebfbffeeffffeeffffebffffe9ffffe7ffff -e7ffffffecfbffecfbffeefbffe9f5ffe0eaffe2eaffeaf1fff2f8cced7ae9ea82ffcf7aff8c51 -ff3a1bff0f00ff1502ff2714ff3664ff002cf4001dff133df21737b5000cae0313d83b46f50053 -e80046e70045e70664ec5b9ef5b1daf4ebffeeffffb0fff3bcfff3d2fff3eefff3fffaf3ffebf3 -ffe0f3ffd5eeffd8bdffb69eff6d5be7281ed90200ed0004ff0f1bff2430ea0000ec0000ef0000 -f30000f70000f00200e40d00dc1400b9b9b9cececeedededffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffe0ffffd8fef1d5efe6f5fefbfffcff -fff6ffe7c1ceb58696d61200fa0000eebd9de3dbc6ea657afa001df30000ebe37effffffffffff -ffffffffffffffffffffffffffffffffffffffe9ffeafffbf7c9b2ff2032ff373ee5f2c7d6fffb -ffdafff12c00f20700ff3226ffbba2dbffe6adfffddcffffffe9fffff4fffff1ffffefffffe2f5 -f0b7cae8b8c8ffd9e7fff4fff60000da4d3cc4ffdaddffffffbcf1fc003dcc0004de8243dffffd -b0ffe6cdffebffdce2ff3c73d90004d23338fffac8e4ffacfff8c0ff0847ee0038d3ffefdcffe8 -ff2739e90000acfffff895b1f3eadbff0031db0000fd574be50000ff7d5bfffdf5c3ffe9ffffe6 -f62640eb0002ff8067dc3815ff2015fffbd4fff8d4f8bfa2aa5541e27066ffcac9ffaeb4eb4049 -ce0000ff072cff3956f2293ca900089d1110e9726affd4c7d8fff8cef4e7d0e5deeaeaeafff6fe -ffefffffd3e8feb6ceffbdd6ffc0d5ffcfdeffeef4fff8f4fffff4f1fff4e4ffeed0ffe9ccffe4 -caffdecdfcdcd8ffe2eaffeef0fff1f2fff1dbffffdcffffe0ffffe4ffffe5fffae3faf2e2f5ef -e4f3eea6cca5b9d3b0e2e5cafff8e8ffede8ffb9bfd9606fa21d30ff4736ff4e3fff493dff2921 -e20000d80000ea0000ff0208ea0013cf0000e1000aff1541ff234bea0025e10020ff2143fff4fb -fff6fbffeceee8e3e0e9f0e9ecfff5e6fff6dffff1fff1e3ffe5dbffcbc7ffa3a9fe7483e9435b -d31a39c90326ff3136ff2229f60a14e90001e50000e50000eb0000f00000d40005dd1015eb3532 -fc6457ff9880ffc7a6ffecc3fff3c6c8c8c8dadadaf4f4f4ffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffeaffffe8fff9ddeee8f2f8f6fffdff -fff9ffffe6efe0c0cbec0000eb1b0fff273ff5deceffb1beff0026ff1917c65513ffffffffffff -ffffffffffffffffffffffffffffffffffffffe6ffeefffbedd2b5fa4041ff3a40ffc7b5f5fffb -fff3ffffa76ada2605d81d0effc1a5d9ffe49effe7b2eadffff0ffffc5c8ffd3d4ffcdcdff9d9c -d35b5abd4141e76768ff9a9dfb0006f63d42ffddcde3fff6f4fff6ad5959b30000f90004fff4a4 -d4d786e7c586ff9689ff294aef0014ff4668ffdee1ffffb6eeb089ef0026ff0e64f4fffbdefcd8 -df1a21da0000bdfff3e6a5a9fff7e8ed082ff8001bffbbc2de0000e5241de0f5bdc4ffd1ffffca -ff343dff1b1dffaca2ff3120d70000ffdedcffb3b2ad3b3a6a0000bb4545ffbebfffb2b3c74c4e -bd0000e0000bff002efd0c36e81132ed2d46ff667aff9aaaf1fffff2ffffe9faf4e7f6f1f7ffff -f8fffff9fffffbfffffffcfffffcfff3effdf3f1fefefefffcfefffcfefffafeffa9ffe8afffe8 -b1ffdfb9ffdacdffdfe4ffe8f0ffe8f5ffe8c9f9bfc9eeb8cce2b1d9dab0f1dab8ffe5cafff0da -ffeddaffdfb2e09f79b64e35b71d15e3141eff1530ff1833ff112cc30000d00000dd0000d60000 -b40000a00408a52a23af473aff0029f90930ff4a65ffa8b3ffdbd5ffddc8ffe6c5ffffd8a7ffdd -a8ffd2abffbecef6c2ffffdbfff2ddffe6ddffe0ddde0008e4000eef0018f6061ffb0922fa0620 -f7001bf40018cc0000de0000fa0013ff122cff2339ff2236fd1a2bf11322f9d1c9f6d8cdf4e7d6 -effce2e9ffecd9ffecceffecc7ffece0e0e0ecececfefefefffffffffffffffffffffffff8f8f8 -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffff8fffff9ffffe9efedf1f3f2fffeff -fffdfffffcfffff7fbe10000e73921ee0011ffe6dfffe0e2f40017f43b27c70000ffffffffffff -ffffffffffffffffffffffffffffffffffffffddfbf4fffbe7e3bee36a55ff3a40ff8c99ffeffa -edfffffff6b5d45532ba160cffbca6e6ffe1aaffdbaad7c0ffe9f4ff3131ff312bfa4436fa5541 -e43f2bcf190be91a14ff3838ff3849fa2a40fe777ef9ffe3b2ffe3b0eab0e83e47fc001aff6515 -ff4a01ff3d0cff3626ff1623ef1931ff8b9affe9eafff4b6ce513fc2000eff5995fff8fbf1e9d2 -cf382fdf0000bde4b7fff1deffe9ddff7e97ff5477ffb9d4ff2246bb0000db7c4ecfcc7dffefb5 -f30000ff0500ffc0acff4e35c60000cb213ec82540af1b31ae2e3df58790ffdadcffbbb8a3605a -ff3a61ff4469ff5b7cff7d98ff9fb5ffbbcbffc8d4ffccd5fffefffffffff9fffff1ffffe9fffe -e3ffffddffffdbffffcbffffc2f7fdc2e8f3d8ebfcfcfafffff5fffff0ffffe7ffd8ffdfdfffdf -edffdfffffdffffbdfffeddaffddd1ffd4ccfff1bcffedbcffc399fd7e5ddd412acc1507c70000 -c70000e60000f10000fc0001fb0000ef0000e50000e40000e60000ed0033f0093fee2551eb4867 -ea6f81f19ca1fdc6c1ffe1d7f4ffd3faffd8ffffdaffffdaffffdaffffdaffffdaffffdaffd5b4 -ffad91f87563f04742f7252efd061be90000d30000ff1225ff1326ff1124ff111ee50d12ca0403 -b00000a10000f12639ff4352ff6f79ff9b9dffb9b2ffc4b5ffc2adffbca4eeffffeaffffe2ffff -d8ffffc7ffffa9fff292fae385f3daf8f8f8fffffffffffffffffffffffffffffffbfbfbf4f4f4 -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffffbfffffcfff8f2f4f5f3f4feffff -fbfffff9fffff8ffffc70000f43b27f40017ffe0e2ffe6dfee0011e73921e10000ffffffffffff -fffffffffffffffffffffffffffffffffffff1ddf6f9fffbe3facccd9a6dff3b3fff4776ffbbdc -c6ffffffffc6bd5e40a90504ff9088ffffdddcffe4f0fadfffebece70000c70000cb0700ff6441 -ff7d5aff3b23ee0000f40000ff9fa4e93149d31223d3a17cb7ffcfc0ffd4ffbdc1ff427be50000 -d90000e00000f90000cd2d1da97053d0d4b3f1ffeaffab82c20004a7001affa8c4ffeafbffe8de -e27c63f30a06925030fff1d1ffc1c3ff888ffc455bff2d53ff95adc30020eb0000bb310aff684a -b20000d00000ffd7afb49159a9200dcb224bfc5d83ff9ebcffc9deffe6f1ffeff1fff6f1eedad1 -ffe2e0fcd6d3f7d8d3fff5edfffcf1fffff1fffff1fbffeee8d7ddf0e4e8f8f4f5f6fcfae8fbf5 -d8f6eccdf3e6c9f3e5e0ffffe7fffff5fffffff9ffffefffffe6ffffdfffffc6f5ffbbadffc1b6 -ffc3bdffb8b8ff979eff6573ff3447e8142ada0500dd0000e10000f10000fd0000ff130eff2722 -ff342fff0f13ff161aff0206c400009000009c0000ff7a56ffdfb6fdfde5fcf6e0ffefdefff3e7 -fff0eaffebeaffe7eaffe4eaa1ffdab9ffdad8ffcedeb79af26d70ff3756ff0f3dfe0027ff1b34 -ff061ff4000bf00007f8000ff40011e10005ce0000950000a60000c3332be5705fffad92ffe1bd -fff8cdfffccdffcfbdffdcc6fff0d5ffffdff4ffdfe4ffdfd8ffdfd2ffdff8e8fff8e9fff6edff -f2f2ffeff7ffebfcffe9ffffe7fffffffffffffffffffffffffffffffffffffffffdfdfdf8f8f8 -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffffffffffffffffffffffffffffffff4fffff6fffff7fdfff9fbfafffe -f4ffffeeffffeaffffc65513ff1917ff0026ffb1bef5deceff273feb1b0fec0000ffffffffffff -ffffffffffffffffffffffffffffffffffffede5fafffffbe3ffddb9c885fa393cff1e50ff84ba -a1ffffe1f5c0b85c4db5000cec404effcebcffffdafff3dcffdcdcff0109de0000f04b35ffc59f -ffcda7ff5a44e50100fd0006f9f2eae16774ce050fd24d2eeef5a7e7ffccffe9e6ff9fdeff1f21 -ff2228ff313dff5663edae8dc4f6b7dfffddf9ffe1ff553fdd0000be4a57f8eeedffdcfbffe6e8 -ffc89ffa1b14b70000ffdcbce4000ab22b287600008c0000ffe7e8f76589ff293ad53f30ff877d -ea0018e52f48ebffe88ffec9d1e8d4ffbddcffe0fbffe5fbffecfbfff4fbfffbfbfffffbf9fffb -ddfffbd7fff5c9ffe8d7fff6dcfffbdbfffbdbfffbbdf4ddd7c6ccf4e1e7fff8fffff7fffff6ff -fff6fffff5fffff4fffff0ecffe7e6ffdde1ffd8e3ffccdfffaac4ff7796f55072ff162eff2139 -ff2f46ff2f46ff1b31e7000bbc0000a50000ff0f17ff0f17ff0f17ff0d15ff0a12ff060efe030a -fc0108951303f58770ffedcafffccaf9ffcadcffcab2ffb6aaffbbcbffd4d9ffd4dbf7bdead3aa -ffbaa4ffa19cff828aff6a79ff0836ff1846ff0b39ee0017ec0019ff1b3eff324eea263ed40003 -ce000bd30c29ee5a66ffb7b0fff5ddffffddf8ffddffefedfff2edfff8edfffeedf2ffe7d8fbdb -c0f4ceb1eec5e4ffe8e2ffe8dbffe7d2ffe4ceffe7c8ffe8c4ffe8c1ffe8ffd9f5ffdbf7ffe0fb -ffe6ffffecffffefffffeffffff0ffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffebfbfff2fffff6fffffcfff6fffc -e6fff7e0fff9defffdebe37ef30000fa001dea657ae3dbc6eebd9dfa0000d61200ffffffffffff -ffffffffffffffffffffffffffffffffffffeef1fffffefbd8ffddaced99f43638ff0030ff549a -85ffffd7edc7fb9296fa1840d40015da5050ffc6afffcab9ff8183f3001beb2d37ffad9cfff4cf -ffe1bcb74938dc1e28ff5e7ac9ffffeebfb9ff5653ff341fff6e43ffc99dfff9ebfff6ffefdfe2 -ffc7eaffbcf1ffd6ecffffe3e0ffdcfff0ccffa6a7f71a12f90012fab0afdbfffbffb4deffdde8 -fffdc8e81208e40000ff6449c90000b83e339a5148ba0530ddfffaffcde9ffd0cec3c09dfffcea -ffaed8ffb7e6cdffff96ffffe6fffffff9fffffafffaf3fbf2f3f8e9f3f5dfefefe1f7f5eaffff -f0ffffebfffedef0f0e4f2f3f5fdfffcfffff5f4fae7e4ebfffcfffff9fffff4ffffeafdffc4df -ffb2d4ffbde5ffcffbff7773ff5e5cff4342f83436fa2d32f11e25dc030cc80000e60000e90000 -e90000df0004d5120ecc2417c8331fc63b24b20308c52122e4534eff8c7effbca4ffdcbbffecc4 -fff3c7f4ffe8f7ffe8f8fee2f6f0d8fff0dcfff7e8fff4e8fff2e8ff9b6de6754bcf4624d32a13 -e91f13f70d0ced0000d40000b70000f2001bff113fff1745ff6474ffd7c4fbffdad1ffccffe8f9 -ffe3effee5e9f5fcf5e4fffbd1fffbc0fffba9ffede2ddf4ebe7fef7f9fff5fffff1ffffebffff -e7ffffe6ffffeefff1f1fff1f5fff1faffeffdfaebfef2e6ffebe2ffe7e0fffff4fffff4fffff4 -fffdf4fff8f0fdeae4f5e0dbf2dad6ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffdef1ffeffffff4fffffbfff4fffb -d9f9eecbfaeac9ffede3ffa3da0000bc0009bd2943e0e0c8dbffd4f20000b91900ffffffffffff -fffffffffffffffffffffffffffffffffffff1fafffffdfbd1ffdda4ffa4f13536f1001dff3a88 -70fffff7ffeaffdae8ff4b80c900009f0000e36b5df76359c10000ae0000ce3144ffd8ceffffe1 -cdc7a7692319d83b4effb9e1a0ffffffffefffb0a2ff4332ff0d00d94b37c1c9b4b5ffff5fffff -c3ffffffeaffffeeffebfff1dbe8bdff6261f7000ef40000ff1833fff1e8c3fffbff94c3ffd8e8 -ffffcad30000fa0000d00d00ff1523ffb6a8fff4e3ffcaf3b0fffffff1ffe0ffea63febab7ffff -ffe6ffffd8ffc1fbff6dbeebffe9ffdfffffc2f1ebbdeae5e3ffffe6ffffe7ffffe0ffffbedcdc -ffeeffffeeffffebffffe6ffffe6ffffe4ffffe1ffffe0fffffefffff9ffffd3e2d1839da9325a -a60e41ce1a57f63375ff2019fb0000d50000c70000d30000e60000f10000f10000ff020eed0006 -d10600c1200cc85632e59f6cffe4a6ffffbdffc3b8ffdecdfffde1f2ffe1d4ffe1b6ffe19dffde -7fffccf7fffbd0bdbf80354a8f0026f00550ff2379ff1a70ff0050ff1d0afb0000e20000e70000 -ff0600ff1502ff0900f1000070a368bce5adedffd0ede8c0ffeecffff0daffe9daffbbb0d6ffff -cef7fbcbf0f6d9faffeaffffeeffffe4f8ffd1e3effff0fffff3fffff4fffff2fffff1ffffe7ff -fadcfff4d5fffff6f4fff3f4ffecf4ffe4f4ffdcf4ffd4f4ffc4eaffb3dcd4ffe4d5ffe4d9ffe4 -dfffe4e4ffe4eaffe4edffe4f0ffe4ffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffff2ffffbb0000dd0000c95723d3fffdffd5ffdb0012fa0100ed250cffd3a6 -c7ffec9efff3cae6f4fff0fffff8f4f0ffe4d9eef1d8f5f1ebfffbf8fff1cfae9daa443ffc555d -ffadbeeefffffffbffffccf0e771abd3196ae70053ff006aff1d8bff1730d4e3a885ffcfd8ffc4 -ff0e2fc60000f7132abbd395ffffcfffffcfffc9a7f78374ef4045ef0a21ed000be30001d9ffcf -ddf5b7d19f7ad7433ff9001af1000ff90017ff0122d88985f5aea8ffddd2fff7e4fffee4fcffe2 -f4ffe4eeffe4e9ffffe9ffffdffdffe6ffffe9ffffe9ffffe9ffffe5ffffffe0ffffdeffffdbff -ffdbffffe0ffffeafffff0fffff1ffe6fcf0f4fffbfbfffbfffefbfff9fbfff5fbfff2fbfff1fb -8bffa5b6ffbbe9ffc6ffe8b2ff9277f03433e50001d30000ff0017ff0e23ff1829f4101dda040c -ce070adb1f1eee3634ee0038ff0157ff1a70ff1165e70046c90037d10d4be52c6688ffd5a0ffe1 -b6ffe1d4ffe1f2ffe1fffde1ffebdaffd1c6fffebafffbbdfff0bdffb08cf75642df140eee0107 -ff0713ff1e17ff150eff0600f70000f20000f50000fc0000ff0500e60041e80652e9316fec6a96 -eda9c0efe3e7ebffffdcffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffff1ffffcc0000e20000d85326dffffcffdaffea0021f10000fd2612ffcfa6 -ceffeca7fff8d0e7f7ffeffffff9f4e9ffe0f2ffffedffffebfffbf7fff1fbe0cdc96f66c62a2e -ed2935b9d8c9cbeadbd7f6e7cbeadbb2d1c2a9c8b9bbd7c9cfebddffcfc0ffffd4feffd4ff9999 -ff0128e7000ae85e5cafffbdffffd4fffdd4ffe7c8ffc1afff8e8aff5861f2293ce70f27ff0127 -ec001cd10011b80410b22222bd4e43cf7d68de987ffad2d3fff0eefffaf4fffff4f7fff4e0ffe9 -cffde1cbffe2e8ffffdbfbfad4f4f3dffffee9ffffe9ffffe9ffffe9fffff5fffff7fffffbffff -fffffffffcfffff2f8ffeff6ffedf6cad9bac8d1b4d3d3b9efe3cdffecdbfbd5c8cd9e94a36e66 -e50007fd081aff182dff182fff0f26ff0f26ff1e35ff2e45e0181bca0001bb0000ca0000ee000b -ff041bfe0013ee0003852c30bc6669ffb6b6ffebe8ffeee8fff2e8fff4e8fff5e8fcddb1ffddb5 -ffdab9ffcbb3ffaea0ff8782ff6263fa4b50a31801b8230fd0281be21f1bed0c12fe0312ff0d1e -ff1b2cb70000c60000de1116f72a2fff3c41ff454aff474cff464bffaee9ffb7edffc8f4ffdefc -ffeffffffcfff1ffffe6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffff1ffffe20006e80000f14a28eff3f6ffe4fff50b40e50000ff2519ffc2a1 -d9ffecb9ffffdaebfdffeffffffaf4ddffd7f5fffff0ffffd8f8e9f2fff1fffde6ffc1b2c03a37 -920000d45c5ef2918bffdcc7ffffddd8ffddb0ffdd94ffdd84ffddfbffdcffe4d6ff7091ff1a4b -ff002fff3156ebc6abbcffdcfff1d0fffadcfff7dcfff2dcffe9d8ffbfb2eb9188d5746df80023 -ff002dff1741eb5560d2a089c2eab5b8ffdaa1ffdce4f1f9f2ffffebffffe4ffffdcffffc7fffc -bafff5bbfff8f1fff8ecfff3e5fceceffff6f1fff8f1fff8f1fff8f1fff8ddffcee0ffcceafacb -fcf7cffff8d7fff4daffeedaffebdaff9f8ff16c5dcf3f34e34941ff6a67ff6264de1f249f0000 -ff041bff0014e90000c70000b20000a70000b00000c20907f9000ed60000d10000e72e2cffc39e -feffc6cdffc6b3ffc6ffffcafffdcafffbcafff7cafff1c7ffc29bc7815d9c522fff3940ff353c -ff2b33ff1f27ff1119ff030bf60000ef0000f4051ae8000ee10005e60009f50016fa041bf20012 -e60006b24856cf6573fb919fffbac8ffd1dfffd3e1ffc7d5ffbccaffeaffffecffffeffffff4ff -fff9fffdfbfceef7f4e6f5f0ffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffe0f0ffec3235ed0000ff3421fdd2e5ffeffffc486bdf0000ff221bffae96 -e9ffeccbffffeaf2ffffeffffffcf4d2ffd2fbffffdff1f1d0f0e1edfff1ffffe6fff3dcff9d90 -d0453ee90000ff0a23ff3f58ff7d86ffaaa0ffc3a9ffd1a9ffd6a8c7b19cf23d5eec0021ee0023 -ff4166f6c6baffffe6fffde6ffe8d6fff5e2fffbe6fffde6ffffe6ffffe5e8edcfd8dfc0ffc4c4 -ffceccffddd7ffeee3fff7e6fffde6ffffe6ffffe6b4e0e9ccf8ffdcffffd9ffffd6ffffcfffff -d2ffffd1ffffffffe4ffffe4ffffe4ffffe4ffffe4ffffe4ffffe4fbf1d6fff7bcfff4bcffe3b2 -ffa57ef2684bda3521cb1104c30000ff3c40ff0004c10000b30000d20000f00000ee0000dd0000 -cf0000cd0609c31a13b22f1bab512fbf8b5cead49bffffc6ffffc6ffffc6f0e8aaf4eaadffffc6 -ffffc6fffac0ebd89eff8b79ff5445ef150cee0000ff0a0eff1d21ff191dff0a0edb0000d80000 -d70000db0000e90000f10700fe2111ff311fd20014c2000ac50917f44b52ffa4a4ffd9d3ffded3 -ffe1d3f3e6f7fff4fffff9fffff9fffff9fffff9fffff9fffdf0ffe8fffde8fffcebfffaecfdf7 -eff8f5f1f3f2f4f0f1f4eef0ffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd3e5fbfb7e6ced0000ff130effa5c8e1ebffff919fe20000ff1b14ff8e81 -f9ffecd8fffffcfcffffeffffffbf2d2ffd7faf7fff5ffffe9fffbe6fff1f5ffe6fffcdcffecd4 -ffd1beee0005ed0004ee0005f5000cfe0015ff0019ff0016fa0011b62b4ae00028e20022ee3765 -cae6cdb9fff1fffdf1ffb8e3ffefe9fff0e8fcf2e6f4f8e7edffece9fff1e2fff1ddfff1bffff1 -c8fff1dcfff1f5fff1fff8f1ffe8edffceddffbed2d9f5f8edffffeefffff1fffff4fffff0faff -f8fffff9ffffffedcdffdbbbffc5a5ffbd9dffbd9dfeb595e79e7ed38a6acb0900cf0700da0300 -ec0200ff0803ff1813ff2722ff302bc10000cb0000d70300e30200f00200ff0b0dff1c20ff2c30 -cceca1dff9b0f7ffbffffdbeffeeb5ffecb8fff6c6fff4c6eaffc6edffbaeed89feb9b76ea5d4c -f22b2eff1021ff071eff3034ff0105d00000c90000e80000ff070bff0a0efe0003ee1714e51912 -d82113d1351ed85938e8855bfdaf7effc994ffe7dfffebdfffeddafff4d8ffffdfedffdfc6fdc6 -9ddea4e3ffffe3ffffe3ffffdaffffd0f6ffcbf1fcc9effac9effad2ffffd6ffffdfffffe9ffff -f4fffffefffffffcfffffaffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd0e5faffc8a3e30000f50000fa72a4b3e3faffd7d2ef0000ff0b04ff6966 -fbeedde2fffffff9ffffedfffefaefd8ffe3fffafff9ffffe9fffbe2fff1d6fbd2ffffd9fff6d4 -ffeccfe9c5abd5a18cc27267c75052e03f4ff9324fff2148ff123ef0457aff357bff5a98fcd2dc -a7fffb9afffbfffafbff8dccfff7f7fbf1f0ede9e6e3e8e2e3f3e9eefff9ebfffbe9fffbe0f1e7 -e8f8eef7fffaf9fffbfcfffbfffffbfffffbfffefbfff7ecfff5ecfff2ecffeeecffced0ffb3b9 -ffafb8ffb6c0ff856bff7056f2583ee84e34e64c32db4127c3290fae1400ff0c14ff060efc0005 -f40000f10000f30000f80001fc00055f6829a3a76afbf5bbffffcafffbcaffe9bcffcca2fac098 -ffffc6ffffc6fff3c6ffe1c4ff847aff2c33eb0006df0000ce0000e30000f30008ed0002de0000 -e10000ff0015ff1c33c62721d3302beb423fff5657ff5b60ff4249e0111bbd0000ffd2bfffcfb9 -f9cdb2e9d2b0e2e3b9e5fbcaebffdae4ffdae1f4d4d6f1cecbf8cfd0ffe2c7ffe8baffe8afffe8 -a9ffe8e3ffffe3ffffe0ffffd7fffed7fffee1ffffe3ffffe3ffffe6ffffe9ffffedfffff2ffff -f9fffffffffffffdfffffbffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd6ebfffffdcacc0000da0000ef42818edae8fffce8ff0700f60000ff484d -f6d8cdeafffffff7ffffedfffefef2d5ffe4fff8fffbffffe9fffbd7ffebc1f2c5f5ffd9fffdd4 -fff3cde0fffbe6fffbe2faede4e9e3fcecedffebf2ffd7e3fbc2d1f7bfd8ffc4e8ffddfffff5ff -d5ffffc6ffffeeffffffdff5eef3f7f2f5faf9fafffffdfffffbfffff9fffff8fffff8ffffe4f8 -ffeafcfff4fffffbfff9fffff0ffffe9ffffe4ffffffbea2ffbea5ffb29dff8f80ff635afb4844 -ff4344ff4b4eff2312fa1100e90000e80000f00700ef0600de0000cc0000d90214dc0f1ee32a32 -ef5150ff8176ffb19effdbc0ffedcfd0cab2e6dac4fff4e1fff7e8fff2e8ffece6ffbcbae29897 -af1509cd261ef03232ff2631ff081efa000ffa000fff0015f9403ef32c2ff2121dfe0014ff0015 -ff0016fd0012f8000d3200006d2e29c08780fecfc5fff4e6fff9e8fffce8fffbe6f5fffff2ffff -f0ffffeaffffe4ffffe0ffffdcffffdbfffff2fff1f0fff1edfff1e7fff1caf9d9aee4c2a6e2be -a9e7c2f8fff4f8fff4f8fff4f8fff4f8fff4f8fff4f8fff4f8fff4fff6fffff7fffff9fffff4f9 -f8eff2eeeaebe6e6e6e3e5e4ffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffdbf0ffffffcabe0000c80000e6276c7ad4ddffffe8ff1200eb0000ff343d -f2cac2eefffffff7ffffeefffffff4d4ffe4e5d0e1fcffffe7fffbc0f9d6c8ffd1f1ffdcffffd4 -ffdcb2ffecffffe9fffee1fdfff7fff9ffffedffffe4ffffd8ffffc2ffffebfffffff0ffffe4ff -ffddfaeceff8ceffffb0ffffd7eaeeedfafffefefffff9fffff3ffffeeffffe1ffffceeee7ffff -ebffffecfbffe8e6f1ecd7e8f4cee5ffcae6ffcae8db3c15e8401cf23b1cee220ae40200e70000 -f90000ff0d06fc0200ee0000e50000ee0000ff0800ff1100ff0800f40000ffcbd6ffced3ffd5cf -ffe3ceeff7d2dbffdacbffe1c0ffe1ffadeaff5b99ce0041ba0024de003efc0755f30045d80028 -de0002e8000eec0815df010ccc0000c60000d10006e01117ff051ce40000bd0000b33922ccb77e -ccffbd9effbf6bffa6ffdffbffe2fbffe8fbfff0fbfff9fbf7f9f4f2fffbebfffbe7ffffe7ffff -e9ffffe8ffffe6fbffe2f4ffdfefffddecffe5d0cbffeeeafff8f4fff7f4ffe9e7ffe2e1fff3f4 -fff3f4ecdec4fceed4fffee4fffee4fffee4fffde3f1e3c9ded0b6ffddf6ffe1f8ffe9fcfff1ff -fff7fffffcfffcfffff8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffcbfffbfff7e8e00000c81300f00000cbffcaffc4c6a26e7bde0000ff291f -ffb39bffffe6e6ffffcddafaffdbffffd7ffdfdbbee9e2c6fdebd3fff4e0fff4e4ffefe4ffede4 -ffeae4fff3f4fff3f4fff5f4fff6f4fff7f4fff8f4fff8f4fff9f4ffe9ffffe7ffffdbffffe0ff -ffeefffff1ffffe4ffeed4efffffdaffffdae8ebc0eefbcdf2ffdaebffdae6ffdac2f5baf8ffc6 -ffffc6fff2c6ffa18dff393ff30008e90000f40009b10000d8001dd10016a20000aa0000e7102f -fb2443da03227f30299f7461d0dab5e3ffe1e3ffe1fcffe1fff4e1ffccc5fff9bdffecb6ffaf84 -f46a4ee83024eb090bf50001f30000ff1e17ff150eff0600f70000f20000f50000fc0000ff0500 -cf376abc2c5da624509c2e53ab5572d38fa6ffccdefff0ffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffc8fffbffede8ff334eee0000d00000eaeeb1ffdad2e5acbbff150eff554d -ffd7bfffffe3dffffddefffffff6ffffe8fff1fff4f5fff4fbfff4fffff4fffbf4fff6f4ffeeef -ffe6e9bbf9d4c5ffddd7ffebe2fff1e7fff1edfff1f0fff1f1fff0fff6fbfff9faf0f2ede6fff3 -dcfffbcbfffbbffffbb7fffbf8ffdaf8f9cfeecdaeffc4b4ffd1d1ffc9d8ff9db7ff6f90ea0000 -fa000fff0920ff0a21ff0016f50010f20716f5131fff2351ff4775ff5074f14052d76461edb39d -e6d6b2bec599ffa4b1ffc2c4ffdccfffe7cfffdbc3ff9a8df54f51e21c29ca2a1ac71b0fc50500 -cf0000e50000fe000eff1223ff2132b70000c60000de1116f72a2fff3c41ff454aff474cff464b -ffd8ffffd4f8ffc1e1ffb8d2fbc0d4ffd9e7fff5fffff7ffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffaaffdfffdae1ffb2b4ef0000a41e00cd4e3dfff7e3ffebfbfe0000ff342f -ffab92ffffddddfff3befaf0ccf0fef2ffffc9fcf7d0fefbdcffffe7ffffedf7ffeeecf9ebe0f0 -e9d8ea8cffcb9fffd8baffe8c7ffe8d6ffe8e4ffe8f0ffe8f5ffe8ffffddffffddfcefcdf7dec0 -ffdec5ffe0cbffd7c6ffccbdff99a1ff6f7af14052f62c46ff274bff123eed0016c70000ef0715 -ed0211f00313fd0c1dff1426ff0a1eed0005d80000ff354fff5e73ff7c87ff8d8cffc1b3fff5da -fffedaffffdaff0f17ff161eff2429ff3331ff3432ff272cff1a22ff131bff0d28ff031ef6000f -ec0005ec0005f6000fff021dff0c27b24856cf6573fb919fffbac8ffd1dfffd3e1ffc7d5ffbcca -ffecffffeefffff1fffff5fffff1f7f7f1f3f2f4f3f1f7f5ffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffafffe2ffc6d2fff0cae40000a44613dd0000ffffe8ffedfbd70000c80300 -d76952f8deb9edffe6cbffe1cffeece6ffffc4f5fccdf9ffdeffffedfffff7fffffffbfffff6ff -fff2ffd8ffdfdfffdfedffdff7fdd7ffe9cdffd9c6ffcdc1ffc7bfffdbb1ffae8cf26f5dfb3a3d -ff1932ff122bff041df90010f5001ee3000cd70000d8000cc91226af3132863426642a14f8000d -ef000be12021ed735cffd3a2f4ffc5c5ffb997ff9efffbdafff4daffc7b9ff8485f74859f81b3c -f2001fde0007ff1e19ff100aec0000d20000c80000d00000e10000ea0000d9000ce10019f11d33 -ff4c5bff858dffc1c3ffd6d3ffd9d3f3e6f7fff4fffff9fffff9fffff9fffff9fffff9fffdf0ff -e5e7e6e7ebeaecf2f0effaf6eefdf8e9fcf6e5faf3e2f9f1ffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd8fffbffced1ffffcaf30000d3532ce90002ffedddfff4fbd60405b90800 -c64c37ffbe9efffbd6ffffddffffe3ffffe6fffdfffffcfffff8fffff4ffffefffffebffffddff -ffd5f8ffded0ffbfb4ff8d87f15d5de53c43eb2f3dfd3245ff374deb121dd70006c30000c80000 -dd0000f0000df6000ef10008ff012fff0735ff2d4cff6b77ffb6adfff5d8ffffdaf1ffdabfffc6 -cbffbfcce69df0c291ffa68fff7273ff2639f200078d1c18940f12b00a18df0a28ff002cfd0026 -fd0026ff0230932600972300a62706c43d1ff56e50ffb08fffe1bcffe3bcffdfdfffe4dfffeadf -fff2defeedcfe1ecc4cdedbec4eebce3ffffe3ffffe3ffffdaffffd0f6ffcbf1fcc9effac9effa -caeee2d5f9ede9fffeedfffff0fffff2fffff4fffff5ffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffeefffbfffce8ffffc8ff3e37ff2b26ff011cffa9b0fffffbdd3c32a91106 -a31708e06651ffac95ffbfa6ffc7afffdac2ffcad4ffc3cfffb5c4ff9eb1ff8098f25f7be04362 -d43354ff475fff2c44fa041bd40000bd0000bc0000c70000d20000fe002afe002be6213ddb6768 -d7bc9fc9ffc7aeffd696ffd5ffffdafffddafff7daffeedaffe3d8ffd9d6ffcfd3ffcad1ff2a40 -ff1e33ff1529ff1c2eff2b3cff3343ff2e3dff2432ff0937f80021fe0027ff1744fd2242c20d20 -a70d17af272bf7ffdaffffdafff9daffd3bbefbba3d9ba9bc9c79ec0d4a3e1ddc4e0e6cae1f6d5 -e1ffe3d6ffe8c8ffe8bfffe8b9ffe8e3ffffe3ffffe0ffffd7fffed7fffee1ffffe3ffffe3ffff -e0fffde4ffffeafffff2fffff9fffffffefffff8fcfff0f6ffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffbfad9ffe8fff5c8ffc695fb0000ff0924ff5273e7fffbffa491c64434 -990100c4130bfb3630ff342fff2c24ff3228f53334f83033fa292ff81a25f10615e60002da0000 -d00000f20002f70007fb000ff41319e92622de3629d7422ed24730ffabd4ffb4d7ffcfe7fff2fb -fbfffbddfffbc7fffbbcfffbffffdafffddaffdbc3ffa59cf9666eee3147ed0d2ff00026ff323e -ff2938ff1125f10006d50000ce0000de0000f00005ff002aed001cfa2845ff909affcfc4fed9bc -f4facef0ffdad6fff6eafbf5ffebf4ffe0f4ffe4f8fff6fff4ffffdffffffffff1fffff1fbfff1 -f7fff1ecffecd2f0d6bce0c4b0d7baf8fff4f8fff4f8fff4f8fff4f8fff4f8fff4f8fff4f8fff4 -e9ffffebfffdeefdf8f4f2f3fce7eeffdeebffd8e9ffd5e8ffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffff8d7deb7ffe8ffebcaffffb6d60000f20b1df71547d8fffbffe8cfffab98 -d43329e81617ff181fff0707ed0000ea0000df0000e80000f70000ff0902ff140dff1912ff1a13 -ff1912e10000f90c12ff534dff9a86ffd0acffebb8fff0b2ffeeaac0ffffd4fffff9ffffffe5ff -ffbbffff6ac8ff1381ef004dd9001ae00324e40f2dd9112bca0d23c00f21c31b2acc2735d80000 -ec0001fa000fd203099c19058f5226b2aa6cd9efa7ffffdaf5f0c8fffed5ffffdaffffdafefcd3 -eeefc5ffffdadff4fffff2ffffe5ffffd9ffffd9ffffe5fffff7ffeeffffffedf0fff1f4fff1f4 -ffeff4ffeef4ffedf4ffecf4ffecf4ecdec4fceed4fffee4fffee4fffee4fffde3f1e3c9ded0b6 -f0fffff5fffffffffffff8fffff1ffffeaffffe5ffffe2ffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffff4ecfff0e8ffe9dfffe0d6e85a4e890000f02a1dffc1b5ffebdaffdcce -fb9a91c04a48990e13a0000cca1b2cf0394dff257bff085eff004bff1862ff679effb3d8ffdff6 -ffebfbb0fff3b6ffedc8ffe9eefff3fffaf3ffebf3ffdef1ffc5deff6d8eff5778ff3455ff1334 -ff001ffc001bff0020ff0627ff0400fc0000f40000ed0000eb0000e50000db0400d60e00875063 -a67787d4b4bffaeff3f8ffffeaffffe0ffffd8fffcffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffffffff1fffaebfff1e4ffe4daff766faa0000ed1814ff9a98fffddafffbda -fff7dafff1daffdcccffd3c8ffdfd9ffdedafce2d1ebd1c0dfc8b6eddbc7fffce8fffee8fffee8 -fffee8fff1e3ffe9dfffd3cfffadb3ff7e8df54f67e42b4ade183bd10013c70009ba0000b30000 -ba0000cd000fe40e26f41e36e9121aeb1e23ee3835f75f52ff8e76ffbd9cffe5bcfff3c6ebbccc -f7d1deffeff8fffcfff9ffffecfffdcdf3e6b7e6d6ffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffddfff8e7ffeefffdecffece1ffa4a2dc2328ea0712ff3f4eddd4adfff8d3 -fffcdafff9dafff4dafff0daffe8d5ffdfcdb9ffbcbcffb5ccffb3edfdbcfff8c3ffdfb7ffb999 -fb997edb0005fa0c24ff243dff1c35ee0015dd0003ea000eff0823c83841c4343dc3333cca3a43 -dc4c55f86871ff838cff949dffe1d9ffe3d8f5e8d7e8f5dbe1ffe4d9ffecceffecc7ffecfff4ff -fff6fffff9fffffdfffbffffeefff9d7f1e8c9e9deffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffc1ffffcbfff6edffeffff3ecffd3d6ff5e6aeb1024fb051ce67d77ffa09a -ffc2bdffc3bfff9a98db6160af3333991b1cec442aec3e26f03723f93122ff2a21ff1e1aff0e0d -f90102b20000d70000ff1629ff2d3aff272cfa3433ff6b65ffa198ffe8e4ffe2deffdbd7ffd6d2 -ffd9d5ffe3dfffeae6ffeae6eeffffeaffffe2ffffd8ffffbffffea4ffed93fbe48bf9e0fffbff -fffcfffffdfffffefffefffffbfffff9fffff8ffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffbfffffc6ffffdffef6fff8f8ffe6ecff9eaaf34254d91227ff1138ff264c -ff385dff3054f31234d00014be0003ba0000dd0000d80000d00000ca0000cf0000d50000df1406 -ea2f1cff7073ffa6a6ffd5cdffddccffbea3f2b692ffdcb1fffccdfffaf1fffaf1fffaf1fffaf1 -fffaf1fff8effff8effff8effdedfff9eafff0e7ffe9e9ffe7efffe9faffedffffeaffffeef9f5 -ecf5f2eaf0eeeef0effaf8f9fffdfffffcfffffbffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffd4ffffd9ffffe6fafffffbfffff0f6ffd8deff969cdc6569bd0000cd0000 -de0007e5000fe10014ef0329ff294cff486aff2540ff2641ff2a3de23634bc4f38b28357c7c58a -e0f7b3ffdbd9fff2edfff8edfffeedf3ffe8d3f6d6d3ffe1d9ffedf6f8f3f7f9f4f9fbf6fbfdf8 -fdfffafefffbfefffbfefffbffd9f5ffd8f4ffd8f3ffdcf7ffe5ffffefffffeffffff0ffeaffff -edfffeecfdf7edf3f1f3edeffeedf3ffeff8fff1fcffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -fffffffffffffffffff4fffff7fefff6f6fffcf4fffffafdfff8f4ffefe4f6d2c4d20621db172f -df283cdb3543db454eee696cff9c9affc2beffc8c1ffdbd1ffecdcf2ead3d6e5c6cef4cddfffe8 -d8ffe8c9c4dbd3cfe6dee0f5e5f0ffe7f8ffe4feffe2ffffe2fffff9fcfffcfffffcfffffcffff -fcfffffcfffffcfffffcfffffffff4fffff4fffff4fffbf2fff2eaffeee8ffeee9ffefebe0ffff -e6ffffeefffff9fffffff8fbffecf5ffe3f0ffdeeeffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffeffffff3fffff4fff2ebfdf9fafef9fff8f7fff1f4ffecffded6ffe5da -ffeadaffe3ccfbd8baeedebaf8f9cffeffdac0fff5cdfffbdbfffbeefffbfffefbffe6ecffe1ef -ffeafbfff4fffff4fffff4fffff2fffff1fffff0ffffe1ffeacbfffffdfffffdfffffdfffffdff -fffdfffdfbfff2f0fbebe9f4cfffdfcdffdcceffd9d5ffdae0ffe0eaffe4edffe4f0ffe4caffee -d6fff5eafffff8fffffffbfffff4ffffefffffecffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff -showpage -%%Trailer -end -%%EOF - -%%EndDocument - @endspecial 7165 2039 a - currentpoint grestore moveto - 7165 2039 a 382 2039 a - currentpoint currentpoint translate 1 .5 div 1 .5 div scale neg exch -neg exch translate - 382 2039 -a 382 2039 a - currentpoint currentpoint translate 1 0.88127 div 1 0.88127 div scale -neg exch neg exch translate - 382 2039 a 523 2322 2732 4 v 521 2434 4 -113 v 573 2401 a Ff(Signal)29 b(Name)p 2258 2434 V 1235 -w(Wish)m(b)s(one)g(signal)p 3253 2434 V 523 2438 2732 -4 v 523 2454 V 521 2567 4 113 v 573 2533 a(Master)i(Con\014guration)e -(connected)i(to)h(FIF)m(O)p 2258 2567 V 3253 2567 V 523 -2571 2732 4 v 521 2683 4 113 v 573 2650 a(RxClk)p 2258 -2683 V 1482 w(CLK)p 2509 2650 28 4 v 32 w(I)p 3253 2683 -4 113 v 521 2796 V 573 2763 a(Rst)p 2258 2796 V 1599 -w(not)e(RST)p 2660 2763 28 4 v 32 w(I)p 3253 2796 4 113 -v 521 2909 V 573 2875 a(RxD[7:0])p 2258 2909 V 1388 w(D)m(A)-8 -b(T)p 2507 2875 28 4 v 34 w(O\(7:0\))p 3253 2909 4 113 -v 521 3022 V 573 2988 a(V)g(alidF)g(rame)p 2258 3022 -V 1281 w(STB)p 2496 2988 28 4 v 32 w(O)p 3253 3022 4 -113 v 521 3135 V 573 3101 a(V)g(alidF)g(rame)p 2258 3135 -V 1281 w(CYC)p 2515 3101 28 4 v 32 w(O)p 3253 3135 4 -113 v 521 3248 V 573 3214 a(ReadByte)p 2258 3248 V 1347 -w(A)m(CK)p 2517 3214 28 4 v 33 w(I)30 b(and)g(not)g(R)-8 -b(TY)p 3144 3214 V 33 w(I)p 3253 3248 4 113 v 521 3361 -V 573 3327 a(Ready)p 2258 3361 V 1486 w(WE)p 2470 3327 -28 4 v 33 w(O)p 3253 3361 4 113 v 521 3474 V 573 3440 -a(F)g(rameERR)p 2258 3474 V 1293 w(T)g(A)m(G0)p 2554 -3440 28 4 v 34 w(O)p 3253 3474 4 113 v 521 3587 V 573 -3553 a(Ab)s(orted)p 2258 3587 V 1408 w(T)g(A)m(G1)p 2554 -3553 28 4 v 34 w(O)p 3253 3587 4 113 v 523 3590 2732 -4 v 521 3703 4 113 v 573 3669 a(Sla)m(v)m(e)31 b(FIF)m(O\(t)m(w)m -(o-clo)s(c)m(k)i(domain)c(FIF)m(O\))p 2258 3703 V 3253 -3703 V 523 3706 2732 4 v 521 3819 4 113 v 573 3785 a(Data[7:0])p -2258 3819 V 1378 w(D)m(A)-8 b(T)p 2507 3785 28 4 v 34 -w(I\(7:0\))p 3253 3819 4 113 v 521 3932 V 573 3898 a(Chip)28 -b(Select)p 2258 3932 V 1283 w(STB)p 2496 3898 28 4 v -32 w(I)p 3253 3932 4 113 v 521 4045 V 573 4011 a(STB)p -759 4011 28 4 v 32 w(I)i(and)g(not)h(F)-8 b(ullFlag)p -2258 4045 4 113 v 793 w(A)m(CK)p 2517 4011 28 4 v 33 -w(O)p 3253 4045 4 113 v 521 4158 V 573 4124 a(F)g(ullFlag)p -2258 4158 V 1408 w(R)g(TY)p 2508 4124 28 4 v 33 w(O)p -3253 4158 4 113 v 521 4271 V 573 4237 a(W)g(rite)p 2258 -4271 V 1515 w(WE)p 2470 4237 28 4 v 33 w(I)p 3253 4271 -4 113 v 523 4274 2732 4 v 521 4387 4 113 v 573 4353 a(Sla)m(v)m(e)31 -b(Con\014guration)p 2258 4387 V 3253 4387 V 523 4390 -2732 4 v 521 4503 4 113 v 573 4469 a(RxClk)p 2258 4503 -V 1482 w(CLK)p 2509 4469 28 4 v 32 w(I)p 3253 4503 4 -113 v 521 4616 V 573 4582 a(Rst)p 2258 4616 V 1599 w(not)f(RST)p -2660 4582 28 4 v 32 w(I)p 3253 4616 4 113 v 521 4729 -V 573 4695 a(RxD[7:0])p 2258 4729 V 1388 w(D)m(A)-8 b(T)p -2507 4695 28 4 v 34 w(O\(7:0\))p 3253 4729 4 113 v 521 -4842 V 573 4808 a(V)g(alidF)g(rame)p 2258 4842 V 1281 -w(T)g(A)m(G0)p 2554 4808 28 4 v 34 w(O)p 3253 4842 4 -113 v 521 4955 V 573 4921 a(ReadByte)p 2258 4955 V 1347 -w(not)30 b(WE)p 2631 4921 28 4 v 34 w(I)p 3253 4955 4 -113 v 521 5068 V 573 5034 a(Ready)p 2258 5068 V 1486 -w(not)g(R)-8 b(TY)p 2669 5034 28 4 v 33 w(O)p 3253 5068 -4 113 v 521 5181 V 573 5147 a(STB)p 759 5147 28 4 v 32 -w(I)30 b(and)g(not)h(WR)p 1353 5147 V 33 w(I)p 2258 5181 -4 113 v 896 w(A)m(CK)p 2517 5147 28 4 v 33 w(O)p 3253 -5181 4 113 v 521 5294 V 573 5260 a(F)-8 b(rameERR)p 2258 -5294 V 1293 w(T)g(A)m(G1)p 2554 5260 28 4 v 34 w(O)p -3253 5294 4 113 v 521 5407 V 573 5373 a(Ab)s(orted)p -2258 5407 V 1408 w(T)g(A)m(G2)p 2554 5373 28 4 v 34 w(O)p -3253 5407 4 113 v 523 5410 2732 4 v 382 5539 2989 4 v -382 5652 a(HDLC)30 b(con)m(troller)2021 b(7)61 b(of)31 -b(15)p eop -%%Page: 8 8 -8 7 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a(3.2.3)105 -b(T)-9 b(ransmit)34 b(Channel)p 382 618 3842 4 v 380 -731 4 113 v 432 697 a Ff(Signal)28 b(name)p 1224 731 -V 359 w(Direction)p 1691 731 V 100 w(Description)p 4222 -731 V 382 735 3842 4 v 382 751 V 380 864 4 113 v 432 -830 a(Con)m(trol)i(in)m(terface)p 1224 864 V 1691 864 -V 4222 864 V 382 867 3842 4 v 382 884 V 380 997 4 113 -v 432 963 a(Rst)p 1224 997 V 705 w(Input)p 1691 997 V -247 w(System)g(async)m(hronous)g(reset\(activ)m(e)i(lo)m(w\))p -4222 997 V 382 1000 3842 4 v 382 1017 V 380 1130 4 113 -v 432 1096 a(Serial)c(In)m(terface)p 1224 1130 V 1691 -1130 V 4222 1130 V 382 1133 3842 4 v 382 1150 V 380 1263 -4 113 v 432 1229 a(TxClk)p 1224 1263 V 589 w(Input)p -1691 1263 V 247 w(T)-8 b(ransmit)29 b(Clo)s(c)m(k)p 4222 -1263 V 380 1375 V 432 1342 a(Tx)p 1224 1375 V 729 w(Output)p -1691 1375 V 174 w(T)-8 b(ransmit)29 b(Data)p 4222 1375 -V 380 1488 V 432 1454 a(TxEn)p 1224 1488 V 616 w(Input)p -1691 1488 V 247 w(TX)h(enable)g(\(activ)m(e)i(high\))p -4222 1488 V 382 1492 3842 4 v 382 1508 V 380 1621 4 113 -v 432 1587 a(Bac)m(k-end)f(In)m(terface)p 1224 1621 V -1691 1621 V 4222 1621 V 382 1625 3842 4 v 382 1641 V -380 1754 4 113 v 432 1720 a(TxD[7:0])p 1224 1754 V 495 -w(Input)p 1691 1754 V 247 w(T)-8 b(ransmit)29 b(data)i(bus)p -4222 1754 V 380 1867 V 432 1833 a(V)-8 b(alidF)g(rame)p -1224 1867 V 387 w(Input)p 1691 1867 V 247 w(V)g(alid)29 -b(F)-8 b(rame)31 b(indication)d(during)h(all)g(frame)h(b)m(ytes)h -(transfer)p 4222 1867 V 380 1980 V 432 1946 a(Ab)s(ortedT)-8 -b(rans)p 1224 1980 V 288 w(Output)p 1691 1980 V 174 w(Error)29 -b(in)g(the)i(transmitted)e(data)i(\(Ab)s(ort)g(pattern)f(w)m(as)h -(generated\))p 4222 1980 V 380 2093 V 432 2059 a(Ab)s(ortF)-8 -b(rame)p 1224 2093 V 357 w(Input)p 1691 2093 V 247 w(Ab)s(ort)30 -b(F)-8 b(rame)p 4222 2093 V 380 2206 V 432 2172 a(W)g(rite)p -1224 2206 V 621 w(Input)p 1691 2206 V 247 w(W)g(rite)30 -b(b)m(yte)p 4222 2206 V 380 2319 V 432 2285 a(Ready)p -1224 2319 V 592 w(Output)p 1691 2319 V 174 w(Can)g(accept)h(new)f(data) -p 4222 2319 V 382 2322 3842 4 v 382 2521 a Fd(3.2.4)105 -b(Bac)m(k-end)36 b(in)m(terface)f(mapping)f(to)h(Wish)m(b)s(one)h(SoC)e -(bus)382 2692 y Ff(The)d(HDLC)h(receiv)m(e)g(bac)m(k)m(end)g(in)m -(terface)g(can)g(b)s(e)f(used)g(as)h(a)g(sla)m(v)m(e)g(core)h(or)e -(master)382 2805 y(according)25 b(to)h(the)f(b)s(elo)m(w)g(mapping.)37 -b(The)24 b(core)i(supp)s(orts)e(SINGLE)g(WRITE)h(Cycle)382 -2918 y(only)i(using)g(8-bit)h(data)h(bus)e(without)g(address)g(lines.) -39 b(The)27 b(c)m(hoice)i(b)s(et)m(w)m(een)g(master)382 -3031 y(and)c(sla)m(v)m(e)i(is)d(left)i(for)f(the)h(system)g(in)m -(tegrator)h(and)e(m)m(ust)h(do)f(the)h(con\014guration)f(and)382 -3144 y(glue)30 b(logic)g(as)h(de\014ned)e(in)g(the)h(tables.)p -382 5539 2989 4 v 382 5652 a(HDLC)g(con)m(troller)2021 -b(8)61 b(of)31 b(15)p eop -%%Page: 9 9 -9 8 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 523 460 2732 4 v -521 573 4 113 v 573 539 a Ff(Signal)29 b(Name)p 2258 -573 V 1235 w(Wish)m(b)s(one)g(signal)p 3253 573 V 523 -576 2732 4 v 523 593 V 521 706 4 113 v 573 672 a(Master)i -(Con\014guration)e(connected)i(to)h(FIF)m(O)p 2258 706 -V 3253 706 V 523 709 2732 4 v 521 822 4 113 v 573 788 -a(TxClk)p 2258 822 V 1483 w(CLK)p 2509 788 28 4 v 32 -w(I)p 3253 822 4 113 v 521 935 V 573 901 a(Rst)p 2258 -935 V 1599 w(not)e(RST)p 2660 901 28 4 v 32 w(I)p 3253 -935 4 113 v 521 1048 V 573 1014 a(TxD[7:0])p 2258 1048 -V 1389 w(D)m(A)-8 b(T)p 2507 1014 28 4 v 34 w(I\(7:0\))p -3253 1048 4 113 v 521 1161 V 573 1127 a(W)g(rite)p 2258 -1161 V 1515 w(A)m(CK)p 2517 1127 28 4 v 33 w(I)30 b(and)g(not)g(R)-8 -b(TY)p 3144 1127 V 33 w(I)p 3253 1161 4 113 v 521 1274 -V 573 1240 a(Ready)p 2258 1274 V 1486 w(not)30 b(WE)p -2631 1240 28 4 v 34 w(O)p 3253 1274 4 113 v 521 1386 -V 573 1353 a(Ab)s(ortedT)-8 b(rans)p 2258 1386 V 1182 -w(T)g(A)m(G0)p 2554 1353 28 4 v 34 w(O)p 3253 1386 4 -113 v 521 1499 V 573 1466 a(V)g(alidF)g(rame)p 2258 1499 -V 1281 w(T)g(A)m(G1)p 2554 1466 28 4 v 34 w(I)p 3253 -1499 4 113 v 521 1612 V 573 1578 a(Ab)s(ortF)g(rame)p -2258 1612 V 1251 w(T)g(A)m(G0)p 2554 1578 28 4 v 34 w(I)p -3253 1612 4 113 v 521 1725 V 573 1691 a(Alw)m(a)m(ys)30 -b(Activ)m(e)p 2258 1725 V 1170 w(CYC)p 2515 1691 28 4 -v 32 w(O)p 3253 1725 4 113 v 521 1838 V 573 1804 a(Alw)m(a)m(ys)g -(Activ)m(e)p 2258 1838 V 1170 w(STB)p 2496 1804 28 4 -v 32 w(O)p 3253 1838 4 113 v 523 1841 2732 4 v 521 1954 -4 113 v 573 1920 a(Sla)m(v)m(e)h(FIF)m(O\(t)m(w)m(o-clo)s(c)m(k)i -(domain)c(FIF)m(O\))p 2258 1954 V 3253 1954 V 523 1958 -2732 4 v 521 2071 4 113 v 573 2037 a(Data[7:0])p 2258 -2071 V 1378 w(D)m(A)-8 b(T)p 2507 2037 28 4 v 34 w(I\(7:0\))p -3253 2071 4 113 v 521 2183 V 573 2150 a(Empt)m(yFlag)p -2258 2183 V 1293 w(R)g(TY)p 2508 2150 28 4 v 33 w(O)p -3253 2183 4 113 v 521 2296 V 573 2263 a(Read)p 2258 2296 -V 1534 w(WE)p 2470 2263 28 4 v 33 w(I)p 3253 2296 4 113 -v 521 2409 V 573 2375 a(WE)p 733 2375 28 4 v 33 w(I)30 -b(and)g(not)g(Empt)m(yFlag)p 2258 2409 4 113 v 704 w(A)m(CK)p -2517 2375 28 4 v 33 w(O)p 3253 2409 4 113 v 521 2522 -V 573 2488 a(ChipSelect)p 2258 2522 V 1311 w(STB)p 2496 -2488 28 4 v 32 w(I)p 3253 2522 4 113 v 523 2526 2732 -4 v 521 2638 4 113 v 573 2605 a(Sla)m(v)m(e)h(Con\014guration)p -2258 2638 V 3253 2638 V 523 2642 2732 4 v 521 2755 4 -113 v 573 2721 a(TxClk)p 2258 2755 V 1483 w(CLK)p 2509 -2721 28 4 v 32 w(I)p 3253 2755 4 113 v 521 2868 V 573 -2834 a(Rst)p 2258 2868 V 1599 w(not)f(RST)p 2660 2834 -28 4 v 32 w(I)p 3253 2868 4 113 v 521 2980 V 573 2947 -a(TxD[7:0])p 2258 2980 V 1389 w(D)m(A)-8 b(T)p 2507 2947 -28 4 v 34 w(I\(7:0\))p 3253 2980 4 113 v 521 3093 V 573 -3060 a(V)g(alidF)g(rame)p 2258 3093 V 1281 w(STB)p 2496 -3060 28 4 v 32 w(I)p 3253 3093 4 113 v 521 3206 V 573 -3172 a(W)g(rite)p 2258 3206 V 1515 w(WE)p 2470 3172 28 -4 v 33 w(I)p 3253 3206 4 113 v 521 3319 V 573 3285 a(Ready)p -2258 3319 V 1486 w(not)30 b(R)-8 b(TY)p 2669 3285 28 -4 v 33 w(O)p 3253 3319 4 113 v 521 3432 V 573 3398 a(STB)p -759 3398 28 4 v 32 w(I)30 b(and)g(WR)p 1191 3398 V 33 -w(I)p 2258 3432 4 113 v 1058 w(A)m(CK)p 2517 3398 28 -4 v 33 w(O)p 3253 3432 4 113 v 521 3545 V 573 3511 a(Ab)s(ortF)-8 -b(rame)p 2258 3545 V 1251 w(T)g(A)m(G0)p 2554 3511 28 -4 v 34 w(I)p 3253 3545 4 113 v 521 3658 V 573 3624 a(Ab)s(ortedT)g -(rans)p 2258 3658 V 1182 w(T)g(A)m(G0)p 2554 3624 28 -4 v 34 w(O)p 3253 3658 4 113 v 523 3661 2732 4 v 382 -3860 a Fd(3.2.5)105 b(CPU)36 b(in)m(terface)382 4032 -y Ff(This)24 b(in)m(terface)j(is)d(used)i(when)f(the)h(FIF)m(O)g(and)f -(registers)h(are)g(included)e(in)g(the)i(Core.)382 4144 -y(This)k(in)m(terface)i(is)f(compatible)g(to)h(WishBone)g(sla)m(v)m(e)g -(bus)f(in)m(terface)h(that)h(supp)s(orts)382 4257 y(single)25 -b(read/write)h(cycles)h(and)f(blo)s(c)m(k)g(cycles.)40 -b(The)26 b(in)m(terface)i(supp)s(orts)c(the)j(follo)m(w-)382 -4370 y(ing)i(wish)m(b)s(one)g(signals.)p 382 5539 2989 -4 v 382 5652 a(HDLC)h(con)m(troller)2021 b(9)61 b(of)31 -b(15)p eop -%%Page: 10 10 -10 9 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 523 460 1447 4 v -521 573 4 113 v 573 539 a Ff(Signal)p 1104 573 V 339 -w(Note)p 1968 573 V 523 576 1447 4 v 523 593 V 521 706 -4 113 v 573 672 a(RST)p 762 672 28 4 v 32 w(I)p 1104 -706 4 113 v 334 w(Reset)p 1968 706 V 521 819 V 573 785 -a(CLK)p 772 785 28 4 v 32 w(I)p 1104 819 4 113 v 324 -w(Clo)s(c)m(k)p 1968 819 V 521 932 V 573 898 a(ADR)p -782 898 28 4 v 33 w(I\(2:0\))p 1104 932 4 113 v 128 w(3-bit)30 -b(address)g(line)p 1968 932 V 521 1044 V 573 1011 a(D)m(A)-8 -b(T)p 770 1011 28 4 v 34 w(O\(7:0\))p 1104 1044 4 113 -v 101 w(8-bit)30 b(receiv)m(e)h(data)p 1968 1044 V 521 -1157 V 573 1123 a(D)m(A)-8 b(T)p 770 1123 28 4 v 34 w(I\(7:0\))p -1104 1157 4 113 v 139 w(8-bit)30 b(transmit)g(data)p -1968 1157 V 521 1270 V 573 1236 a(WE)p 733 1236 28 4 -v 33 w(I)p 1104 1270 4 113 v 362 w(Read/write)p 1968 -1270 V 521 1383 V 573 1349 a(STB)p 759 1349 28 4 v 32 -w(I)p 1104 1383 4 113 v 337 w(Strob)s(e)p 1968 1383 V -521 1496 V 573 1462 a(A)m(CK)p 780 1462 28 4 v 33 w(O)p -1104 1496 4 113 v 277 w(Ac)m(kno)m(wledge)p 1968 1496 -V 521 1609 V 573 1575 a(CYC)p 778 1575 28 4 v 32 w(I)p -1104 1609 4 113 v 318 w(Cycle)p 1968 1609 V 521 1722 -V 573 1688 a(T)-8 b(A)m(G0)p 817 1688 28 4 v 34 w(O)p -1104 1722 4 113 v 239 w(TxDone)31 b(in)m(terrupt)p 1968 -1722 V 521 1835 V 573 1801 a(T)-8 b(A)m(G1)p 817 1801 -28 4 v 34 w(O)p 1104 1835 4 113 v 239 w(RxReady)30 b(in)m(terrupt)p -1968 1835 V 523 1838 1447 4 v 382 2066 a Fc(4)135 b(Design)45 -b(description)382 2273 y Fb(4.1)112 b(Receiv)m(e)37 b(Channel)382 -2444 y Fd(4.1.1)105 b(Design)36 b(notes)382 2616 y Ff(Receiv)m(e)h(c)m -(hannel)f(pro)m(vides)f(in)m(terface)i(to)g(the)f(bac)m(k)m(end)h(via)f -(a)h(simple)d(handshak)m(e)382 2729 y(proto)s(col)21 -b(that)g(can)g(b)s(e)f(used)g(to)i(connect)f(the)g(con)m(troller)g(to)g -(either)g(a)g(shared)f(memory)382 2842 y(or)25 b(FIF)m(O)g(bu\013er.)38 -b(This)22 b(proto)s(col)j(uses)f(the)h(hand)e(shac)m(k)j(proto)s(col)e -(of)h(the)g(Wish)m(b)s(one)382 2955 y(SoC)30 b(bus.)523 -3068 y(Receiv)m(e)41 b(c)m(hannel)e(supp)s(orts)f(only)g(8-bits)i -(aligned)e(data.)69 b(Eac)m(h)41 b(frame)e(starts)382 -3180 y(with)21 b(a)i(starting)g(\015ag)g(\(01111110\))k(and)22 -b(ends)g(with)g(starting)g(\015ag)h(\(01111110\).)43 -b(Since)382 3293 y(the)30 b(receipt)g(ion)e(is)h(sync)m(hronous)g(only) --8 b(,)30 b(the)g(c)m(hannel)f(uses)g(the)h(external)g(clo)s(c)m(k)g -(and)382 3406 y(a)36 b(b)m(yte)g(m)m(ust)f(b)s(e)g(read)h(from)f(the)g -(c)m(hannel)g(within)e(the)j(\014rst)f(7)g(clo)s(c)m(k)h(pulses)e -(after)382 3519 y(the)40 b(ready)f(signal)g(is)f(asserted.)69 -b(If)39 b(no)h(data)g(is)f(read)g(during)e(this)i(p)s(erio)s(d)e -(\(while)382 3632 y(V)-8 b(alidF)g(rame)35 b(signal)f(is)g(activ)m(e\)) -j(F)-8 b(rameErr)35 b(is)f(signaled)g(rep)s(orted)g(to)i(the)f(bac)m(k) -m(end)382 3745 y(as)c(long)g(the)h(V)-8 b(alidF)g(rame)31 -b(is)f(activ)m(e.)45 b(F)-8 b(rameErr)31 b(is)f(signaled)g(also)h(when) -f(non)h(8-bit)382 3858 y(aligned)e(data)i(is)f(receiv)m(ed)g(and)g -(when)f(F)m(CS)i(error)f(is)f(found.)382 4098 y Fd(4.1.2)105 -b(Timing)382 4273 y Fb(4.2)112 b(T)-9 b(ransmit)36 b(Channel)382 -4445 y Ff(T)-8 b(ransmit)29 b(c)m(hannel)g(pro)m(vides)g(in)m(terface)i -(to)f(the)h(bac)m(k)m(end)f(via)g(a)g(simple)e(handshak)m(e)382 -4558 y(proto)s(col)21 b(that)g(can)g(b)s(e)f(used)g(to)i(connect)f(the) -g(con)m(troller)g(to)g(either)g(a)g(shared)f(memory)382 -4670 y(or)27 b(FIF)m(O)g(bu\013er.)39 b(This)25 b(proto)s(col)i(uses)g -(the)g(handshac)m(k)g(proto)s(col)f(of)i(the)f(Wish)m(b)s(one)382 -4783 y(SoC)j(bus.)523 4896 y(T)-8 b(ransmit)33 b(c)m(hannel)g(supp)s -(orts)f(only)h(8-bits)h(aligned)f(data.)52 b(Eac)m(h)34 -b(frame)g(starts)382 5009 y(with)21 b(a)i(starting)g(\015ag)g -(\(01111110\))k(and)22 b(ends)g(with)g(starting)g(\015ag)h -(\(01111110\).)43 b(Since)382 5122 y(the)23 b(transmission)d(is)i(sync) -m(hronous)f(only)-8 b(,)24 b(the)f(c)m(hannel)f(uses)g(the)h(external)f -(clo)s(c)m(k)h(and)382 5235 y(a)35 b(b)m(yte)g(m)m(ust)g(b)s(e)f -(written)f(to)j(the)e(c)m(hannel)g(within)f(the)h(\014rst)g(7)h(clo)s -(c)m(k)g(pulses)e(after)382 5348 y(the)d(ready)g(signal)f(is)g -(asserted.)41 b(If)30 b(no)g(data)h(is)e(inserted)g(during)e(this)i(p)s -(erio)s(d)f(\(while)p 382 5539 2989 4 v 382 5652 a(HDLC)i(con)m -(troller)1976 b(10)61 b(of)31 b(15)p eop -%%Page: 11 11 -11 10 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a Ff(V)-8 -b(alidF)g(rame)38 b(signal)e(is)h(activ)m(e\))j(ab)s(ort)d(pattern)h -(is)f(transmitted)g(and)h(rep)s(orted)f(to)382 661 y(the)30 -b(bac)m(k)m(end)h(via)f(Ab)s(oredT)-8 b(rans)29 b(signal)h(as)g(long)g -(the)h(V)-8 b(alidF)g(rame)30 b(is)f(activ)m(e.)382 896 -y Fd(4.2.1)105 b(Design)36 b(notes)382 1068 y(4.2.2)105 -b(Timing)382 1240 y Ff(The)43 b(c)m(hannel)f(starts)i(accepting)g(data) -g(after)f(asserting)g(the)g(V)-8 b(alidF)g(rame)44 b(signal.)382 -1352 y(This)d(signal)h(can)i(con)m(trol)f(no)g(of)h(idle)d(pattern)j -(bits)e(\(e.g.)80 b(if)42 b(this)g(signal)g(is)g(de-)382 -1465 y(asserted)f(for)f(8)h(bits)f(only)f(a)i(single)f(Idle)f(pattern)i -(\(8)g(ones\))g(is)f(inserted\).)71 b(V)-8 b(alid)382 -1578 y(F)g(rame)31 b(signal)e(m)m(ust)i(b)s(e)e(asserted)i(for)f(8)h -(clo)s(c)m(ks)g(after)f(an)m(y)h(v)-5 b(alid)29 b(write)g(op)s -(eration.)382 1817 y Fb(4.3)112 b(External)37 b(FIF)m(O)h(and)g -(registers)382 1989 y Ff(The)28 b(con)m(troller)g(has)g(optional)f -(external)h(FIF)m(O)h(bu\013ers,)f(one)h(for)f(data)h(to)g(b)s(e)f -(trans-)382 2102 y(mitted)40 b(and)g(one)g(for)g(data)h(to)h(b)s(e)d -(receiv)m(ed.)71 b(Status)41 b(and)e(con)m(trol)i(registers)f(are)382 -2214 y(a)m(v)-5 b(ailable)36 b(to)g(con)m(trol)h(these)g(FIF)m(Os.)59 -b(These)36 b(t)m(w)m(o)h(blo)s(c)m(ks)f(\(FIF)m(Os)h(and)f(registers\)) -382 2327 y(are)28 b(built)e(around)h(the)i(HDLC)f(con)m(troller)f(core) -i(whic)m(h)e(mak)m(e)i(them)f(optional)f(if)g(the)382 -2440 y(core)33 b(is)f(to)h(b)s(e)f(used)g(in)g(di\013eren)m(t)g(kind)e -(of)j(applications.)46 b(The)32 b(curren)m(t)h(implemen-)382 -2553 y(tation)j(supp)s(orts)f(the)h(follo)m(wing)f(con\014guration:)52 -b(The)35 b(size)h(of)h(the)f(T)-8 b(ransmit)35 b(and)382 -2666 y(receiv)m(e)h(FIF)m(Os)g(is)e(\(8)25 b Fa(\002)e -Ff(128\))37 b(bits)d(whic)m(h)h(enables)f(128)j(maxim)m(um)d(HDLC)i -(frame)382 2779 y(size.)523 2892 y(The)21 b(transmit)f(bu\013er)g(is)g -(used)g(to)i(prev)m(en)m(t)g(under\015o)m(w)d(while)g(transmitting)h(b) -m(ytes)382 3005 y(to)37 b(the)g(line.)58 b(All)36 b(b)m(ytes)h(will)d -(b)s(e)i(a)m(v)-5 b(ailable)36 b(once)i(the)f(transmit)f(is)f(enabled.) -59 b(The)382 3118 y(Receiv)m(e)22 b(bu\013er)e(is)g(used)h(to)g(pro)m -(vide)g(data)g(burst)f(transfer)h(to)h(the)f(Bac)m(k)i(end)d(in)m -(terface)382 3231 y(whic)m(h)31 b(prev)m(en)m(ts)i(the)g(bac)m(k)g(end) -f(from)g(reading)g(eac)m(h)h(b)m(yte)g(alone.)48 b(The)32 -b(FIF)m(O)h(size)382 3344 y(is)26 b(suitable)f(for)i(op)s(erating)f -(frequencies)g(2.048MHz)j(on)e(the)g(serial)e(in)m(terface)j(and)e(50) -382 3457 y(MHz)33 b(on)f(the)h(bac)m(k)g(end)f(in)m(terface.)47 -b(Other)32 b(frequencies)f(can)i(op)s(erate)g(if)e(the)i(dela)m(y)382 -3569 y(b)s(et)m(w)m(een)41 b(HDLC)f(frames)g(is)f(less)h(than)g(the)g -(dela)m(y)g(needed)g(for)g(the)g(bac)m(k)h(end)f(to)382 -3682 y(empt)m(y)29 b(the)g(in)m(ternal)e(FIF)m(O)j(\(the)f(next)g -(calculations)f(is)f(an)i(example)f(to)i(b)s(e)e(applied)382 -3795 y(for)i(di\013eren)m(t)g(frequencies\))523 3908 -y(7)h(bits)e(\(minim)m(um)f(bits)h(b)s(et)m(w)m(een)i(HDLC)g(F)-8 -b(rames\))31 b(/)g(2.048MHz)i(=)d(3.418)j(us)523 4021 -y(128)f(Bytes)f(\(Maxim)m(um)f(frame)g(size\))h(/)g(50MHz)h(=)e(2.56)i -(us)523 4134 y(These)37 b(FIF)m(Os)h(are)f(implemen)m(ted)f(on)h -(Single)f(p)s(ort)g(memory)-8 b(.)62 b(Tw)m(o)37 b(in)m(terrupt)382 -4247 y(lines)32 b(are)i(used,)f(one)h(to)h(signal)d(transmission)f -(done)i(and)g(one)h(to)h(request)e(transfer)382 4360 -y(of)h(receiv)m(ed)h(frame)f(to)g(memory)-8 b(.)53 b(These)33 -b(in)m(terrupts)g(are)h(also)g(re\015ected)h(in)e(Status)382 -4473 y(registers)d(to)h(supp)s(ort)e(p)s(olling)e(mo)s(de)j(for)g(the)h -(con)m(troller.)382 4711 y Fb(4.4)112 b(Registers)382 -4883 y Ff(All)29 b(in)m(ternal)g(registers)h(are)h(8-bit)f(width.)382 -5119 y Fd(4.4.1)105 b(T)-9 b(ransmit)432 5290 y(Tx)34 -b(Status)h(and)g(Con)m(trol)f(Register:)48 b(Tx)p 2094 -5290 32 4 v 37 w(SC)99 b Ff(O\013set)31 b(Address)e(=)h(0x0)p -382 5539 2989 4 v 382 5652 a(HDLC)g(con)m(troller)1976 -b(11)61 b(of)31 b(15)p eop -%%Page: 12 12 -12 11 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 523 460 3806 4 v -523 477 V 521 589 4 113 v 573 556 a Ff(BIT)p 928 589 -V 945 589 V 328 w(7)p 1226 589 V 237 w(6)p 1507 589 V -277 w(5)p 1871 589 V 472 w(4)p 2541 589 V 504 w(3)p 2970 -589 V 395 w(2)p 3420 589 V 424 w(1)p 3908 589 V 408 w(0)p -4327 589 V 523 593 3806 4 v 521 706 4 113 v 573 672 a(FIELD)p -928 706 V 945 706 V 143 w(N/A)p 1226 706 V 100 w(N/A)p -1507 706 V 101 w(F)m(CSen)p 1871 706 V 99 w(FIF)m(OOv)m(er\015o)m(w)p -2541 706 V 101 w(Ab)s(orted)p 2970 706 V 99 w(TxAb)s(ort)p -3420 706 V 99 w(TxEnable)p 3908 706 V 98 w(TxDone)p 4327 -706 V 523 709 3806 4 v 521 822 4 113 v 573 788 a(RESET)p -928 822 V 945 822 V 183 w(0)p 1226 822 V 237 w(0)p 1507 -822 V 277 w(0)p 1871 822 V 472 w(0)p 2541 822 V 504 w(0)p -2970 822 V 395 w(0)p 3420 822 V 424 w(0)p 3908 822 V -408 w(0)p 4327 822 V 523 825 3806 4 v 521 938 4 113 v -573 904 a(R/W)p 928 938 V 945 938 V 241 w(R)m(O)p 1226 -938 V 147 w(R)m(O)p 1507 938 V 174 w(W)m(O)p 1871 938 -V 369 w(R)m(O)p 2541 938 V 415 w(R)m(O)p 2970 938 V 291 -w(W)m(O)p 3420 938 V 308 w(W)m(O)p 3908 938 V 305 w(R)m(O)p -4327 938 V 523 941 3806 4 v 573 1063 a Fd(Tx)35 b(FIF)m(O)e(bu\013er)i -(register:)47 b(Tx)p 1875 1063 32 4 v 37 w(Bu\013er)100 -b Ff(O\013set)31 b(Address)e(=)h(0x1)p 523 1187 1313 -4 v 523 1204 V 521 1317 4 113 v 573 1283 a(BIT)p 928 -1317 V 945 1317 V 594 w(7-0)p 1834 1317 V 523 1320 1313 -4 v 521 1433 4 113 v 573 1399 a(FIELD)p 928 1433 V 945 -1433 V 143 w(T)-8 b(ransmit)29 b(Data)j(b)m(yte)p 1834 -1433 V 523 1436 1313 4 v 521 1549 4 113 v 573 1515 a(RESET)p -928 1549 V 945 1549 V 440 w(0x0)p 1834 1549 V 523 1553 -1313 4 v 521 1665 4 113 v 573 1632 a(R/W)p 928 1665 V -945 1665 V 532 w(W)m(O)p 1834 1665 V 523 1669 1313 4 -v 382 1867 a Fd(4.4.2)105 b(Receiv)m(e)432 2039 y(Rx)35 -b(Status)g(and)f(Con)m(trol)h(Register:)47 b(Rx)p 2104 -2039 32 4 v 38 w(SC)100 b Ff(O\013set)30 b(Address)g(=)g(0x2)p -523 2164 3696 4 v 523 2180 V 521 2293 4 113 v 573 2259 -a(BIT)p 928 2293 V 945 2293 V 328 w(7)p 1226 2293 V 237 -w(6)p 1507 2293 V 236 w(5)p 1789 2293 V 431 w(4)p 2459 -2293 V 504 w(3)p 2888 2293 V 451 w(2)p 3450 2293 V 387 -w(1)p 3751 2293 V 338 w(0)p 4217 2293 V 523 2296 3696 -4 v 521 2409 4 113 v 573 2375 a(FIELD)p 928 2409 V 945 -2409 V 143 w(N/A)p 1226 2409 V 100 w(N/A)p 1507 2409 -V 101 w(N/A)p 1789 2409 V 100 w(FIF)m(OOv)m(er\015o)m(w)p -2459 2409 V 101 w(Ab)s(orted)p 2888 2409 V 99 w(F)-8 -b(rameError)p 3450 2409 V 100 w(Drop)p 3751 2409 V 99 -w(RxReady)p 4217 2409 V 523 2413 3696 4 v 521 2526 4 -113 v 573 2492 a(RESET)p 928 2526 V 945 2526 V 183 w(0)p -1226 2526 V 237 w(0)p 1507 2526 V 236 w(0)p 1789 2526 -V 431 w(0)p 2459 2526 V 504 w(0)p 2888 2526 V 451 w(0)p -3450 2526 V 387 w(0)p 3751 2526 V 338 w(0)p 4217 2526 -V 523 2529 3696 4 v 521 2642 4 113 v 573 2608 a(R/W)p -928 2642 V 945 2642 V 241 w(R)m(O)p 1226 2642 V 147 w(R)m(O)p -1507 2642 V 146 w(R)m(O)p 1789 2642 V 341 w(R)m(O)p 2459 -2642 V 415 w(R)m(O)p 2888 2642 V 360 w(R)m(O)p 3450 2642 -V 283 w(W)m(O)p 3751 2642 V 236 w(R)m(O)p 4217 2642 V -523 2645 3696 4 v 573 2766 a Fd(Rx)35 b(FIF)m(O)f(bu\013er)h(register:) -47 b(Rx)p 1886 2766 32 4 v 38 w(Bu\013er)100 b Ff(O\013set)31 -b(Address)e(=)h(0x3)p 523 2891 1301 4 v 523 2907 V 521 -3020 4 113 v 573 2986 a(BIT)p 928 3020 V 945 3020 V 588 -w(7-0)p 1822 3020 V 523 3024 1301 4 v 521 3137 4 113 -v 573 3103 a(FIELD)p 928 3137 V 945 3137 V 143 w(Receiv)m(ed)h(Data)h -(b)m(yte)p 1822 3137 V 523 3140 1301 4 v 521 3253 4 113 -v 573 3219 a(RESET)p 928 3253 V 945 3253 V 434 w(0x0)p -1822 3253 V 523 3256 1301 4 v 521 3369 4 113 v 573 3335 -a(R/W)p 928 3369 V 945 3369 V 539 w(R)m(O)p 1822 3369 -V 523 3372 1301 4 v 573 3494 a Fd(Rx)j(F)-9 b(rame)34 -b(length:)47 b(Rx)p 1563 3494 32 4 v 38 w(Len)99 b Ff(O\013set)31 -b(Address)e(=)h(0x4)p 523 3618 1082 4 v 523 3635 V 521 -3748 4 113 v 573 3714 a(BIT)p 928 3748 V 945 3748 V 478 -w(7-0)p 1602 3748 V 523 3751 1082 4 v 521 3864 4 113 -v 573 3830 a(FIELD)p 928 3864 V 945 3864 V 143 w(F)-8 -b(rame)31 b(Length)p 1602 3864 V 523 3867 1082 4 v 521 -3980 4 113 v 573 3946 a(RESET)p 928 3980 V 945 3980 V -325 w(0x0)p 1602 3980 V 523 3983 1082 4 v 521 4096 4 -113 v 573 4062 a(R/W)p 928 4096 V 945 4096 V 430 w(R)m(O)p -1602 4096 V 523 4100 1082 4 v 382 4351 a Fb(4.5)112 b(T)-9 -b(ransmit)36 b(F)-9 b(rame)518 4523 y Fa(\017)46 b Ff(The)29 -b(CPU)g(should)e(c)m(hec)m(k)k(TxDone)f(\(in)e(Tx)h(status)g(register)h -(0x0\))g(bit)e(of)i(it)f(is)609 4636 y('1')34 b(or)e(w)m(ait)h(for)g -(TxDone)g(in)m(terrupt.)46 b(TxDone)33 b(bit)e(is)h(reset)h(to)h('0')f -(after)g(the)609 4749 y(\014rst)d(write)f(to)i(Tx)f(FIF)m(O)h(Bu\013er) -g(register)f(\(0x1\).)518 4936 y Fa(\017)46 b Ff(The)36 -b(CPU)g(should)f(write)h(frame)g(data)i(b)m(ytes)f(to)g(Tx)f(FIF)m(O)h -(bu\013er)f(register)609 5049 y(\(0x1\).)518 5237 y Fa(\017)46 -b Ff(After)41 b(writing)d(all)i(data)h(b)m(ytes)g(to)g(TX)f(bu\013er)g -(register,)j(the)e(CPU)f(should)609 5350 y(write)35 b('1')h(to)g -(TxEnable)e(to)i(enable)e(data)i(transmission)d(to)j(the)g(line.)53 -b(After)p 382 5539 2989 4 v 382 5652 a(HDLC)30 b(con)m(troller)1976 -b(12)61 b(of)31 b(15)p eop -%%Page: 13 13 -13 12 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 609 548 a Ff(writing)19 -b(to)j(this)e(bit)g(no)h(further)e(write)i(op)s(eration)f(to)i(Tx)e -(FIF)m(O)i(bu\013er)e(register)609 661 y(is)30 b(allo)m(w)m(ed)g(till)e -(TxDone)j(is)e(set)i(\(all)f(writes)f(will)f(b)s(e)i(ignored\).)518 -848 y Fa(\017)46 b Ff(It)24 b(is)e(optional)h(for)g(the)g(CPU)h(to)g(c) -m(hec)m(k)h(the)e(status)h(bits)e(of)i(Tx)f(status)h(register.)382 -1092 y Fb(4.6)112 b(Receiv)m(e)37 b(F)-9 b(rame)518 1264 -y Fa(\017)46 b Ff(The)21 b(con)m(troller)g(sets)h(RxReady)f(bit)g(in)f -(Rx)h(Status)g(and)g(con)m(trol)h(register)f(\(0x2\))609 -1376 y(and)26 b(sets)h(the)f(TxReady)g(in)m(terrupt)f(line)g(to)i -(indicate)e(v)-5 b(alid)25 b(frame)h(in)f(in)m(ternal)609 -1489 y(bu\013er)30 b(is)f(a)m(v)-5 b(ailable.)518 1677 -y Fa(\017)46 b Ff(It)30 b(is)f(recommended)h(that)g(the)g(CPU)g(read)g -(the)g(Rx)f(Status)h(and)g(con)m(trol)g(reg-)609 1790 -y(ister)g(\(0x3\).)518 1978 y Fa(\017)46 b Ff(The)24 -b(CPU)g(should)e(read)i(the)g(F)-8 b(rame)25 b(length)f(register)g -(\(0x4\))i(to)f(c)m(hec)m(k)g(the)g(size)609 2090 y(of)j(the)h(frame.) -40 b(The)27 b(v)-5 b(alue)28 b(of)g(this)f(regiter)h(is)f(v)-5 -b(alid)26 b(only)i(after)g(the)h(RxReady)609 2203 y(bit)h(is)f(set)i -(and)f(remains)f(v)-5 b(alid)29 b(till)f(the)j(\014rst)e(read)h(from)g -(the)h(Data)h(bu\013er.)518 2391 y Fa(\017)46 b Ff(The)41 -b(CPU)g(should)f(read)h(Rx)h(FIF)m(O)g(bu\013er)e(register)i(\(0x3\))h -(F)-8 b(rame)42 b(length)609 2504 y(times)26 b(to)h(get)g(all)e(frame)h -(b)m(ytes.)40 b(P)m(erforming)25 b(extra)i(reads)f(\(read)h(from)e -(empt)m(y)609 2617 y(bu\013er\))30 b(pro)s(duces)f(in)m(v)-5 -b(alid)28 b(data.)518 2804 y Fa(\017)46 b Ff(If)34 b(the)h(CPU)g(do)s -(es)f(not)h(read)g(all)f(frame)g(b)m(ytes)i(as)f(so)s(on)f(as)h(p)s -(ossible)e(the)i(in-)609 2917 y(ternal)g(bu\013er)f(will)f(o)m(v)m -(er\015o)m(w)j(and)f(FIF)m(OOv)m(er\015o)m(w)h(bit)e(will)f(b)s(e)h -(set)i(and)e(the)609 3030 y(curren)m(t)f(frame)h(should)d(b)s(e)i -(dropp)s(ed.)48 b(No)34 b(further)e(read)h(op)s(erations)g(should)609 -3143 y(b)s(e)f(attempted)h(till)e(RxReady)h(bit)g(is)f(set)i(again)f -(and)g(RxReady)h(in)m(terrupt)e(is)609 3256 y(signaled)e(indicating)f -(new)i(a)m(v)-5 b(ailable)30 b(frame.)518 3444 y Fa(\017)46 -b Ff(The)32 b(soft)m(w)m(are)i(can)e(drop)f(en)m(tire)i(frame)f(from)g -(the)g(Receiv)m(e)i(FIF)m(O)e(bu\013er)g(b)m(y)609 3557 -y(writing)g(1)h(to)h(drop)f(bit)f(in)g(the)i(status)g(and)e(con)m(trol) -i(receiv)m(e)h(register)e(\(0x3\).)609 3670 y(This)k(is)h(suitable)g -(for)h(dropping)e(bad)h(frames)h(\(for)g(an)m(y)g(reason\))h(or)f -(frames)609 3782 y(with)29 b(incorrect)i(addresses.)382 -4026 y Fb(4.7)112 b(Connection)37 b(to)g(TDM)h(con)m(troller)382 -4197 y Ff(This)24 b(con)m(troller)h(can)i(get/send)f(data)h(from/to)f -(TDM)h(con)m(troller)e(through)g(soft)m(w)m(are)382 4310 -y(con)m(trol.)38 b(The)21 b(soft)m(w)m(are)j(con\014gures)d(the)h(TDM)g -(con)m(troller)f(to)i(select)f(the)g(c)m(hannel.)38 b(It)382 -4423 y(adds/remo)m(v)m(es)24 b(the)f(address)f(and)g(con)m(trol)h -(information)e(\014elds)h(of)h(the)g(HDLC)f(frame.)382 -4536 y(Then)42 b(passes)h(the)g(data)h(\014eld)e(b)s(et)m(w)m(een)i -(the)f(t)m(w)m(o)h(con)m(trollers)f(through)f(optional)382 -4649 y(DMA)31 b(transfer.)382 4893 y Fb(4.8)112 b(Clo)s(c)m(ks)37 -b(Sync)m(hronization)382 5064 y Ff(Since)24 b(the)g(core)i(can)f(op)s -(erate)g(in)e(di\013eren)m(t)h(clo)s(c)m(k)i(domains)d(\(The)h(serial)g -(line)f(domain)382 5177 y(and)28 b(the)i(bac)m(k)m(end)f(in)m(terface)h -(domain\),)f(all)f(con)m(trol)h(signals)f(pass)h(through)f(t)m(w)m(o)i -(\015ip)382 5290 y(\015ops)40 b(to)i(reduce)f(the)g(metastabilit)m(y)-8 -b(.)72 b(These)41 b(Flip)e(Flops)i(are)g(clo)s(c)m(k)m(ed)h(with)d(the) -382 5403 y(same)31 b(clo)s(c)m(k)f(of)h(the)g(in)m(terface)g(that)f -(read)h(these)g(signals.)p 382 5539 V 382 5652 a(HDLC)f(con)m(troller) -1976 b(13)61 b(of)31 b(15)p eop -%%Page: 14 14 -14 13 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a Fb(4.9)112 -b(Diagrams)382 2195 y - currentpoint currentpoint translate 0.5377 0.5377 scale neg exch neg -exch translate - 382 2195 a 382 2195 a - gsave currentpoint currentpoint translate 0 neg rotate neg exch neg -exch translate - 382 2195 -a @beginspecial 0 @llx 0 @lly 667 @urx 328 @ury 6670 -@rwi @setspecial -%%BeginDocument: -%!PS-Adobe-2.0 EPSF-2.0 -%%Title: HDLC_top.dia -%%Creator: Dia v0.84 -%%CreationDate: Sat Feb 3 10:41:15 2001 -%%For: a user -%%Magnification: 1.0000 -%%Orientation: Portrait -%%BoundingBox: 0 0 667 328 -%%Pages: 1 -%%BeginSetup -%%EndSetup -%%EndComments -[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright -/parenleft /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one -/two /three /four /five /six /seven /eight /nine /colon /semicolon -/less /equal /greater /question /at /A /B /C /D /E -/F /G /H /I /J /K /L /M /N /O -/P /Q /R /S /T /U /V /W /X /Y -/Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c -/d /e /f /g /h /i /j /k /l /m -/n /o /p /q /r /s /t /u /v /w -/x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright -/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior -/acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf -/threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla -/Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde -/Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex -/Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring -/ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis -/eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave -/uacute /ucircumflex /udieresis /yacute /thorn /ydieresis] /isolatin1encoding exch def -/Times-Roman-latin1 - /Times-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Italic-latin1 - /Times-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Bold-latin1 - /Times-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-BoldItalic-latin1 - /Times-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Book-latin1 - /AvantGarde-Book findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-BookOblique-latin1 - /AvantGarde-BookOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Demi-latin1 - /AvantGarde-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-DemiOblique-latin1 - /AvantGarde-DemiOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Light-latin1 - /Bookman-Light findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-LightItalic-latin1 - /Bookman-LightItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Demi-latin1 - /Bookman-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-DemiItalic-latin1 - /Bookman-DemiItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-latin1 - /Courier findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Oblique-latin1 - /Courier-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Bold-latin1 - /Courier-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-BoldOblique-latin1 - /Courier-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-latin1 - /Helvetica findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Oblique-latin1 - /Helvetica-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Bold-latin1 - /Helvetica-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-BoldOblique-latin1 - /Helvetica-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-latin1 - /Helvetica-Narrow findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Oblique-latin1 - /Helvetica-Narrow-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Bold-latin1 - /Helvetica-Narrow-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-BoldOblique-latin1 - /Helvetica-Narrow-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Roman-latin1 - /NewCenturySchoolbook-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Italic-latin1 - /NewCenturySchoolbook-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Bold-latin1 - /NewCenturySchoolbook-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-BoldItalic-latin1 - /NewCenturySchoolbook-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Roman-latin1 - /Palatino-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Italic-latin1 - /Palatino-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Bold-latin1 - /Palatino-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-BoldItalic-latin1 - /Palatino-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Symbol-latin1 - /Symbol findfont -definefont pop -/ZapfChancery-MediumItalic-latin1 - /ZapfChancery-MediumItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/ZapfDingbats-latin1 - /ZapfDingbats findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/cp {closepath} bind def -/c {curveto} bind def -/f {fill} bind def -/a {arc} bind def -/ef {eofill} bind def -/ex {exch} bind def -/gr {grestore} bind def -/gs {gsave} bind def -/sa {save} bind def -/rs {restore} bind def -/l {lineto} bind def -/m {moveto} bind def -/rm {rmoveto} bind def -/n {newpath} bind def -/s {stroke} bind def -/sh {show} bind def -/slc {setlinecap} bind def -/slj {setlinejoin} bind def -/slw {setlinewidth} bind def -/srgb {setrgbcolor} bind def -/rot {rotate} bind def -/sc {scale} bind def -/sd {setdash} bind def -/ff {findfont} bind def -/sf {setfont} bind def -/scf {scalefont} bind def -/sw {stringwidth pop} bind def -/tr {translate} bind def - -/ellipsedict 8 dict def -ellipsedict /mtrx matrix put -/ellipse -{ ellipsedict begin - /endangle exch def - /startangle exch def - /yrad exch def - /xrad exch def - /y exch def - /x exch def /savematrix mtrx currentmatrix def - x y tr xrad yrad sc - 0 0 1 startangle endangle arc - savematrix setmatrix - end -} def - -/colortogray { -/rgbdata exch store -rgbdata length 3 idiv -/npixls exch store -/rgbindx 0 store -0 1 npixls 1 sub { -grays exch -rgbdata rgbindx get 20 mul -rgbdata rgbindx 1 add get 32 mul -rgbdata rgbindx 2 add get 12 mul -add add 64 idiv -put -/rgbindx rgbindx 3 add store -} for -grays 0 npixls getinterval -} bind def -/mergeprocs { -dup length -3 -1 roll -dup -length -dup -5 1 roll -3 -1 roll -add -array cvx -dup -3 -1 roll -0 exch -putinterval -dup -4 2 roll -putinterval -} bind def -/colorimage { -pop pop -{colortogray} mergeprocs -image -} bind def - -19.842200 -19.842200 scale -9.062040 -22.610037 translate -%%EndProlog - - -1.000000 1.000000 1.000000 srgb -n 6.496390 18.950000 m 6.496390 22.000000 l 12.439990 22.000000 l 12.439990 18.950000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 6.496390 18.950000 m 6.496390 22.000000 l 12.439990 22.000000 l 12.439990 18.950000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Zero ) dup sw 2 div 9.468190 ex sub 20.269690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Deletion) dup sw 2 div 9.468190 ex sub 21.069690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 13.371400 18.800000 m 13.371400 21.950000 l 19.034600 21.950000 l 19.034600 18.800000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 13.371400 18.800000 m 13.371400 21.950000 l 19.034600 21.950000 l 19.034600 18.800000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Flag ) dup sw 2 div 16.203000 ex sub 20.169690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Detection) dup sw 2 div 16.203000 ex sub 20.969690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -0.967907 14.300000 m -0.967907 17.300000 l 17.239990 17.300000 l 17.239990 14.300000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -0.967907 14.300000 m -0.967907 17.300000 l 17.239990 17.300000 l 17.239990 14.300000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Rx Controller) dup sw 2 div 8.136041 ex sub 15.994690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -4.360008 18.750000 m -4.360008 21.850000 l 0.639992 21.850000 l 0.639992 18.750000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -4.360008 18.750000 m -4.360008 21.850000 l 0.639992 21.850000 l 0.639992 18.750000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -1.860008 ex sub 20.494690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 19.034600 21.162500 m 21.265000 21.100000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 19.823082 20.740248 m 19.034600 21.162500 l 19.845490 21.539934 l s -1.000000 1.000000 1.000000 srgb -n 7.671390 6.350000 m 7.671390 9.400000 l 13.614990 9.400000 l 13.614990 6.350000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 7.671390 6.350000 m 7.671390 9.400000 l 13.614990 9.400000 l 13.614990 6.350000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Zero ) dup sw 2 div 10.643190 ex sub 7.669690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Insertion) dup sw 2 div 10.643190 ex sub 8.469690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 14.846400 6.200000 m 14.846400 9.350000 l 20.509600 9.350000 l 20.509600 6.200000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 14.846400 6.200000 m 14.846400 9.350000 l 20.509600 9.350000 l 20.509600 6.200000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Flag ) dup sw 2 div 17.678000 ex sub 7.569690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Insertion) dup sw 2 div 17.678000 ex sub 8.369690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -0.967907 10.600000 m -0.967907 13.600000 l 17.264990 13.600000 l 17.264990 10.600000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -0.967907 10.600000 m -0.967907 13.600000 l 17.264990 13.600000 l 17.264990 10.600000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Tx Controller) dup sw 2 div 8.148541 ex sub 12.294690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -2.835010 6.300000 m -2.835010 9.400000 l 2.164990 9.400000 l 2.164990 6.300000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -2.835010 6.300000 m -2.835010 9.400000 l 2.164990 9.400000 l 2.164990 6.300000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -0.335010 ex sub 8.044690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 3.584067 17.300000 m 3.584067 18.200000 l -0.610008 18.200000 l -0.610008 18.750000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 8.136041 17.300000 m 8.136041 18.250000 l 9.468190 18.250000 l 9.468190 18.950000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 12.688016 17.300000 m 12.688016 18.350000 l 16.203000 18.350000 l 16.203000 18.800000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 17.678000 9.350000 m 17.678000 10.250000 l 12.706766 10.250000 l 12.706766 10.600000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 12.129090 9.400000 m 12.129090 10.300000 l 8.148541 10.300000 l 8.148541 10.600000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 0.914990 9.400000 m 0.914990 10.450000 l 2.364990 10.450000 l 2.364990 10.650000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 20.509600 6.987500 m 22.465000 6.950000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 21.672817 7.365266 m 22.465000 6.950000 l 21.657477 6.565413 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 20.509600 8.562500 m 22.495400 8.550000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 21.697934 8.955028 m 22.495400 8.550000 l 21.692898 8.155044 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 19.034600 19.587500 m 21.220400 19.550000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 19.827621 19.173836 m 19.034600 19.587500 l 19.841344 19.973718 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -2.835010 7.075000 m -5.185008 7.100000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -3.630710 7.483488 m -2.835010 7.075000 l -3.639220 6.683533 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -2.835010 8.625000 m -5.035008 8.550000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -3.648174 8.997511 m -2.835010 8.625000 l -3.620917 8.197975 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -4.221844 8.177489 m -5.035008 8.550000 l -4.249101 8.977025 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -4.360008 19.525000 m -5.888040 19.500000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -5.081604 19.113141 m -5.888040 19.500000 l -5.094691 19.913033 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -4.360008 21.075000 m -6.138040 21.050000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -5.165553 21.463713 m -4.360008 21.075000 l -5.154305 20.663792 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -5.332495 20.661287 m -6.138040 21.050000 l -5.343743 21.461208 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Tx) dup sw 2 div 23.262000 ex sub 6.950000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(TxClk) dup sw 2 div 22.912000 ex sub 8.400000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Rx) dup sw 2 div 21.962000 ex sub 19.350000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(RxClk) dup sw 2 div 21.912000 ex sub 21.050000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(RxEn) dup sw 2 div 19.912000 ex sub 15.450000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(TxEn) dup sw 2 div 19.412000 ex sub 11.750000 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 20.062000 12.100000 m 17.264990 12.100000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 18.064990 11.700000 m 17.264990 12.100000 l 18.064990 12.500000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 17.239990 15.800000 m 20.062000 15.800000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 18.039990 15.400000 m 17.239990 15.800000 l 18.039990 16.200000 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(TxD[7:0]) dup sw 2 div -6.038040 ex sub 6.900000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(RxD[7:0]) dup sw 2 div -6.538040 ex sub 18.850000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -6.038040 ex sub 9.650000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -6.592040 ex sub 22.353400 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 2.812093 6.285000 m 2.812093 9.335000 l 7.182093 9.335000 l 7.182093 6.285000 l f -0.100000 slw -[1.000000] 0 sd -[1.000000] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 2.812093 6.285000 m 2.812093 9.335000 l 7.182093 9.335000 l 7.182093 6.285000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(FCS-16) dup sw 2 div 4.997093 ex sub 8.004690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 4.997093 9.335000 m 4.997093 10.385000 l 6.212093 10.385000 l 6.212093 10.585000 l s -1.000000 1.000000 1.000000 srgb -n 1.462093 18.885000 m 1.462093 21.935000 l 5.832093 21.935000 l 5.832093 18.885000 l f -0.100000 slw -[0.001000] 0 sd -[1.000000] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 1.462093 18.885000 m 1.462093 21.935000 l 5.832093 21.935000 l 5.832093 18.885000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(FCS-16) dup sw 2 div 3.647093 ex sub 20.604690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 4.717960 17.335000 m 4.717960 18.285000 l 4.739593 18.285000 l 4.739593 18.885000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 14.846400 7.775000 m 13.587960 7.650000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 7.671390 7.875000 m 7.182093 7.810000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 2.812093 7.810000 m 2.164990 7.850000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 13.371400 20.375000 m 12.439990 20.475000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 6.437960 20.300000 m 5.832093 20.410000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 1.337960 20.300000 m 0.639992 20.300000 l s -showpage - -%%EndDocument - @endspecial 5940 2195 a - currentpoint grestore moveto - 5940 2195 a 382 2195 a - currentpoint currentpoint translate 1 0.5377 div 1 0.5377 div scale -neg exch neg exch translate - 382 2195 -a 1451 2391 a Ff(Figure)30 b(1:)41 b(HDLC)31 b(core)382 -3767 y - currentpoint currentpoint translate 0.47441 0.47441 scale neg exch -neg exch translate - 382 3767 a 382 3767 a - gsave currentpoint currentpoint translate 0 neg rotate neg exch neg -exch translate - 382 3767 a @beginspecial -0 @llx 0 @lly 756 @urx 293 @ury 7560 @rwi @setspecial -%%BeginDocument: -%!PS-Adobe-2.0 EPSF-2.0 -%%Title: /home/jamil/Projects_org/hdlc/HDLC_cont.dia -%%Creator: Dia v0.86 -%%CreationDate: Mon Apr 2 21:24:20 2001 -%%For: a user -%%Magnification: 1.0000 -%%Orientation: Portrait -%%BoundingBox: 0 0 756 293 -%%Pages: 1 -%%BeginSetup -%%EndSetup -%%EndComments -[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright -/parenleft /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one -/two /three /four /five /six /seven /eight /nine /colon /semicolon -/less /equal /greater /question /at /A /B /C /D /E -/F /G /H /I /J /K /L /M /N /O -/P /Q /R /S /T /U /V /W /X /Y -/Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c -/d /e /f /g /h /i /j /k /l /m -/n /o /p /q /r /s /t /u /v /w -/x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright -/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior -/acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf -/threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla -/Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde -/Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex -/Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring -/ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis -/eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave -/uacute /ucircumflex /udieresis /yacute /thorn /ydieresis] /isolatin1encoding exch def -/Times-Roman-latin1 - /Times-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Italic-latin1 - /Times-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Bold-latin1 - /Times-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-BoldItalic-latin1 - /Times-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Book-latin1 - /AvantGarde-Book findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-BookOblique-latin1 - /AvantGarde-BookOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Demi-latin1 - /AvantGarde-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-DemiOblique-latin1 - /AvantGarde-DemiOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Light-latin1 - /Bookman-Light findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-LightItalic-latin1 - /Bookman-LightItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Demi-latin1 - /Bookman-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-DemiItalic-latin1 - /Bookman-DemiItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-latin1 - /Courier findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Oblique-latin1 - /Courier-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Bold-latin1 - /Courier-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-BoldOblique-latin1 - /Courier-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-latin1 - /Helvetica findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Oblique-latin1 - /Helvetica-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Bold-latin1 - /Helvetica-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-BoldOblique-latin1 - /Helvetica-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-latin1 - /Helvetica-Narrow findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Oblique-latin1 - /Helvetica-Narrow-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Bold-latin1 - /Helvetica-Narrow-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-BoldOblique-latin1 - /Helvetica-Narrow-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Roman-latin1 - /NewCenturySchoolbook-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Italic-latin1 - /NewCenturySchoolbook-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Bold-latin1 - /NewCenturySchoolbook-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-BoldItalic-latin1 - /NewCenturySchoolbook-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Roman-latin1 - /Palatino-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Italic-latin1 - /Palatino-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Bold-latin1 - /Palatino-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-BoldItalic-latin1 - /Palatino-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Symbol-latin1 - /Symbol findfont -definefont pop -/ZapfChancery-MediumItalic-latin1 - /ZapfChancery-MediumItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/ZapfDingbats-latin1 - /ZapfDingbats findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/cp {closepath} bind def -/c {curveto} bind def -/f {fill} bind def -/a {arc} bind def -/ef {eofill} bind def -/ex {exch} bind def -/gr {grestore} bind def -/gs {gsave} bind def -/sa {save} bind def -/rs {restore} bind def -/l {lineto} bind def -/m {moveto} bind def -/rm {rmoveto} bind def -/n {newpath} bind def -/s {stroke} bind def -/sh {show} bind def -/slc {setlinecap} bind def -/slj {setlinejoin} bind def -/slw {setlinewidth} bind def -/srgb {setrgbcolor} bind def -/rot {rotate} bind def -/sc {scale} bind def -/sd {setdash} bind def -/ff {findfont} bind def -/sf {setfont} bind def -/scf {scalefont} bind def -/sw {stringwidth pop} bind def -/tr {translate} bind def - -/ellipsedict 8 dict def -ellipsedict /mtrx matrix put -/ellipse -{ ellipsedict begin - /endangle exch def - /startangle exch def - /yrad exch def - /xrad exch def - /y exch def - /x exch def /savematrix mtrx currentmatrix def - x y tr xrad yrad sc - 0 0 1 startangle endangle arc - savematrix setmatrix - end -} def - -/mergeprocs { -dup length -3 -1 roll -dup -length -dup -5 1 roll -3 -1 roll -add -array cvx -dup -3 -1 roll -0 exch -putinterval -dup -4 2 roll -putinterval -} bind def -19.842200 -19.842200 scale --6.128970 -19.350000 translate -%%EndProlog - - -1.000000 1.000000 1.000000 srgb -n 34.131900 7.950000 m 34.131900 10.950000 l 41.231900 10.950000 l 41.231900 7.950000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 34.131900 7.950000 m 34.131900 10.950000 l 41.231900 10.950000 l 41.231900 7.950000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(HDLC \(RX\)) dup sw 2 div 37.681900 ex sub 9.644690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 12.231900 13.100000 m 12.231900 16.050000 l 18.481900 16.050000 l 18.481900 13.100000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 12.231900 13.100000 m 12.231900 16.050000 l 18.481900 16.050000 l 18.481900 13.100000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(TX FIFO) dup sw 2 div 15.356900 ex sub 14.769690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 33.981900 12.950000 m 33.981900 15.950000 l 41.081900 15.950000 l 41.081900 12.950000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 33.981900 12.950000 m 33.981900 15.950000 l 41.081900 15.950000 l 41.081900 12.950000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(HDLC \(TX\)) dup sw 2 div 37.531900 ex sub 14.644690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 41.081900 14.450000 m 43.131900 14.500000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 42.322385 14.880375 m 43.131900 14.500000 l 42.341891 14.080613 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 43.081900 9.450000 m 41.231900 9.450000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 42.031900 9.050000 m 41.231900 9.450000 l 42.031900 9.850000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 10.897600 14.500000 m 12.231900 14.575000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 11.410713 14.929473 m 12.231900 14.575000 l 11.455609 14.130734 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 31.918600 14.465000 m 33.981900 14.450000 l s -1.000000 1.000000 1.000000 srgb -n 14.981900 16.900000 m 14.981900 18.800000 l 18.221100 18.800000 l 18.221100 16.900000 l f -0.100000 slw -[1.000000] 0 sd -[1.000000] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 14.981900 16.900000 m 14.981900 18.800000 l 18.221100 18.800000 l 18.221100 16.900000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Regs) dup sw 2 div 16.601500 ex sub 18.044690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 14.981900 17.850000 m 10.897600 17.800000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 14.177064 18.240177 m 14.981900 17.850000 l 14.186856 17.440237 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 11.702436 17.409823 m 10.897600 17.800000 l 11.692644 18.209763 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Line) dup sw 2 div 42.681900 ex sub 8.600000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Line) dup sw 2 div 42.893900 ex sub 13.793400 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -() dup sw 2 div 14.873500 ex sub 7.200000 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 27.225000 12.990000 m 27.225000 15.940000 l 31.918600 15.940000 l 31.918600 12.990000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 27.225000 12.990000 m 27.225000 15.940000 l 31.918600 15.940000 l 31.918600 12.990000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(TX Sync) dup sw 2 div 29.571800 ex sub 14.659690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 25.218600 14.515000 m 27.225000 14.465000 l s -1.000000 1.000000 1.000000 srgb -n 20.525000 13.040000 m 20.525000 15.990000 l 25.218600 15.990000 l 25.218600 13.040000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 20.525000 13.040000 m 20.525000 15.990000 l 25.218600 15.990000 l 25.218600 13.040000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(TX FCS) dup sw 2 div 22.871800 ex sub 14.709690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 18.481900 14.575000 m 20.525000 14.515000 l s -1.000000 1.000000 1.000000 srgb -n 6.178970 4.650000 m 6.178970 19.300000 l 10.872570 19.300000 l 10.872570 4.650000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 6.178970 4.650000 m 6.178970 19.300000 l 10.872570 19.300000 l 10.872570 4.650000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div 8.525770 ex sub 12.169690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 12.350900 8.133360 m 12.350900 11.083360 l 18.600900 11.083360 l 18.600900 8.133360 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 12.350900 8.133360 m 12.350900 11.083360 l 18.600900 11.083360 l 18.600900 8.133360 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(RX FIFO) dup sw 2 div 15.475900 ex sub 9.803050 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 11.016600 9.533360 m 12.350900 9.608360 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 11.529713 9.962833 m 12.350900 9.608360 l 11.574609 9.164094 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 32.037600 9.498360 m 34.131900 9.450000 l s -1.000000 1.000000 1.000000 srgb -n 15.000900 5.083360 m 15.000900 6.983360 l 18.240100 6.983360 l 18.240100 5.083360 l f -0.100000 slw -[1.000000] 0 sd -[1.000000] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 15.000900 5.083360 m 15.000900 6.983360 l 18.240100 6.983360 l 18.240100 5.083360 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Regs) dup sw 2 div 16.620500 ex sub 6.228050 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 15.000900 6.033360 m 10.916600 5.983360 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 14.196064 6.423537 m 15.000900 6.033360 l 14.205856 5.623597 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 11.721436 5.593183 m 10.916600 5.983360 l 11.711644 6.393123 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -() dup sw 2 div 11.142500 ex sub 6.933360 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 27.344000 8.023360 m 27.344000 10.973360 l 32.037600 10.973360 l 32.037600 8.023360 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 27.344000 8.023360 m 27.344000 10.973360 l 32.037600 10.973360 l 32.037600 8.023360 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(RX Sync) dup sw 2 div 29.690800 ex sub 9.693050 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 25.337600 9.548360 m 27.344000 9.498360 l s -1.000000 1.000000 1.000000 srgb -n 20.644000 8.073360 m 20.644000 11.023360 l 25.337600 11.023360 l 25.337600 8.073360 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 20.644000 8.073360 m 20.644000 11.023360 l 25.337600 11.023360 l 25.337600 8.073360 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(RX FCS) dup sw 2 div 22.990800 ex sub 9.743050 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 18.600900 9.608360 m 20.644000 9.548360 l s -showpage - -%%EndDocument - @endspecial 6682 3767 a - currentpoint grestore moveto - 6682 3767 a 382 3767 a - currentpoint currentpoint translate 1 0.47441 div 1 0.47441 div scale -neg exch neg exch translate - 382 3767 -a 1344 3963 a Ff(Figure)f(2:)41 b(HDLC)30 b(con)m(troller)382 -4347 y Fc(5)135 b(T)-11 b(esting)45 b(and)g(v)l(eri\014cations)p -382 4472 2174 4 v 380 4585 4 113 v 432 4551 a Ff(Requiremen)m(t)p -1114 4585 V 226 w(T)-8 b(est)31 b(metho)s(d)p 1714 4585 -V 100 w(V)-8 b(alidation)29 b(metho)s(d)p 2554 4585 V -382 4588 2174 4 v 382 4605 V 380 4718 4 113 v 432 4684 -a(In)m(terface)i(timing)p 1114 4718 V 1714 4718 V 2554 -4718 V 382 4721 2174 4 v 380 4834 4 113 v 1114 4834 V -1714 4834 V 2554 4834 V 382 4837 2174 4 v 382 4854 V -380 4967 4 113 v 432 4933 a(F)-8 b(unctionalit)m(y)p -1114 4967 V 1714 4967 V 2554 4967 V 382 4970 2174 4 v -382 5539 2989 4 v 382 5652 a(HDLC)30 b(con)m(troller)1976 -b(14)61 b(of)31 b(15)p eop -%%Page: 15 15 -15 14 bop 2072 228 a Fe(www.Op)-5 b(enCor)g(es.or)g(g)46 -b Fd(Pro)6 b(ject)p 382 266 2989 4 v 382 548 a Fb(5.1)112 -b(Sim)m(ulation)35 b(and)k(T)-9 b(est)36 b(b)s(enc)m(hes)382 -723 y(5.2)112 b(V)-9 b(eri\014cation)35 b(tec)m(hniques)j(and)g -(algorithms)382 898 y(5.3)112 b(T)-9 b(est)37 b(plans)382 -1106 y Fc(6)135 b(Implemen)l(tations)382 1309 y Ff(The)25 -b(design)f(is)g(implemen)m(ted)f(using)h(the)h(VHDL)h(language.)39 -b(The)25 b(design)f(is)g(divided)382 1422 y(in)m(to)30 -b(three)g(main)f(blo)s(c)m(ks,)h(serial)f(Receiv)m(e)i(c)m(hannel,)f -(Serial)f(T)-8 b(ransmit)29 b(c)m(hannel)g(and)382 1535 -y(the)45 b(T)-8 b(op)45 b(blo)s(c)m(ks.)84 b(The)45 b(Receiv)m(e)h(and) -f(T)-8 b(ransmit)44 b(serial)f(c)m(hannels)i(p)s(erform)e(the)382 -1648 y(HDLC)33 b(functionalit)m(y)-8 b(.)49 b(The)33 -b(T)-8 b(op)34 b(blo)s(c)m(ks)f(p)s(erform)f(the)i(F)m(CS)f -(calculation)g(\(Whic)m(h)382 1761 y(is)44 b(either)h(F)m(CS-16)h(or)f -(F)m(CS-32\),)51 b(the)45 b(frame)g(bu\013ering)f(the)h(in)m(terface)h -(with)d(the)382 1873 y(bac)m(k)28 b(end)f(system)h(and)f(the)h(sync)m -(hronization)f(b)s(et)m(w)m(een)h(the)g(clo)s(c)m(ks.)40 -b(The)28 b(F)m(CS)f(and)382 1986 y(Bu\013ering)i(can)i(b)s(e)f(c)m -(hanged)h(b)m(y)f(replacing)f(the)i(corresp)s(onding)d(\014les.)382 -2230 y Fb(6.1)112 b(Scripts,)37 b(\014les)g(and)h(an)m(y)g(other)g -(information)p 382 2320 2227 4 v 380 2432 4 113 v 432 -2399 a Ff(RX)p 1106 2432 V 2607 2432 V 382 2436 2227 -4 v 380 2549 4 113 v 432 2515 a(RxChannel.vhd)p 1106 -2549 V 106 w(T)-8 b(op)30 b(Rx)g(Channel)p 2607 2549 -V 380 2662 V 432 2628 a(Rxcon)m(t.vhd)p 1106 2662 V 268 -w(Rx)g(Con)m(troller)p 2607 2662 V 380 2774 V 432 2741 -a(Zero)p 614 2741 28 4 v 32 w(detect.vhd)p 1106 2774 -4 113 v 101 w(Zero)g(detect)i(and)e(serial)f(to)i(parallel)p -2607 2774 V 380 2887 V 432 2854 a(\015ag)p 578 2854 28 -4 v 33 w(detect.vhd)p 1106 2887 4 113 v 136 w(Flag)g(detection)p -2607 2887 V 382 2891 2227 4 v 380 3004 4 113 v 432 2970 -a(TX)p 1106 3004 V 2607 3004 V 382 3007 2227 4 v 380 -3120 4 113 v 432 3086 a(TxChannel.vhd)p 1106 3120 V 107 -w(T)-8 b(op)30 b(Tx)g(c)m(hannel)p 2607 3120 V 380 3233 -V 432 3199 a(TXcon)m(t.vhd)p 1106 3233 V 249 w(Tx)g(Con)m(troller)p -2607 3233 V 380 3346 V 432 3312 a(zero)p 598 3312 28 -4 v 33 w(ins.vhd)p 1106 3346 4 113 v 244 w(Zero)g(insertion)f(and)g -(parallel)g(to)i(serial)p 2607 3346 V 380 3459 V 432 -3425 a(\015ag)p 578 3425 28 4 v 33 w(ins.vhd)p 1106 3459 -4 113 v 264 w(Flag)g(insertion)p 2607 3459 V 382 3462 -2227 4 v 380 3575 4 113 v 432 3541 a(T)-8 b(op)p 1106 -3575 V 2607 3575 V 382 3578 2227 4 v 380 3691 4 113 v -432 3657 a(TxBu\013.vhd)p 1106 3691 V 269 w(Tx)30 b(bu\013er)p -2607 3691 V 380 3804 V 432 3770 a(TxF)m(CS.vhd)p 1106 -3804 V 264 w(Tx)g(F)m(CS-16)p 2607 3804 V 380 3917 V -432 3883 a(TxSync.vhd)p 1106 3917 V 247 w(Tx)g(sync)m(hronization)p -2607 3917 V 380 4030 V 432 3996 a(RxBu\013.vhd)p 1106 -4030 V 268 w(Rx)g(bu\013er)p 2607 4030 V 380 4143 V 432 -4109 a(RxF)m(CS.vhd)p 1106 4143 V 263 w(Rx)g(F)m(CS-16)p -2607 4143 V 380 4256 V 432 4222 a(RxSync.vhd)p 1106 4256 -V 246 w(Rx)g(sync)m(hronization)p 2607 4256 V 380 4369 -V 432 4335 a(WB)p 594 4335 28 4 v 33 w(IF.vhd)p 1106 -4369 4 113 v 269 w(WishBone)g(in)m(terface)p 2607 4369 -V 380 4481 V 432 4448 a(hdlc.vhd)p 1106 4481 V 383 w(T)-8 -b(op)30 b(HDLC)h(con)m(troller)p 2607 4481 V 382 4485 -2227 4 v 382 4689 a Fb(6.2)112 b(Design)37 b(con)m(v)m(en)m(tions)g -(and)i(co)s(ding)e(st)m(yles)382 4898 y Fc(7)135 b(Reviews)46 -b(and)f(commen)l(ts)382 5137 y(8)135 b(References)p 382 -5539 2989 4 v 382 5652 a Ff(HDLC)30 b(con)m(troller)1976 -b(15)61 b(of)31 b(15)p eop -%%Trailer -end -userdict /end-hook known{end-hook}if -%%EOF Index: hdlc/web_uploads/HDLC_cont.jpg =================================================================== Cannot display: file marked as a binary type. svn:mime-type = application/octet-stream Index: hdlc/web_uploads/HDLC_cont.jpg =================================================================== --- hdlc/web_uploads/HDLC_cont.jpg (revision 19) +++ hdlc/web_uploads/HDLC_cont.jpg (nonexistent)
hdlc/web_uploads/HDLC_cont.jpg Property changes : Deleted: svn:mime-type ## -1 +0,0 ## -application/octet-stream \ No newline at end of property Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (revision 19) +++ hdlc/web_uploads/ (nonexistent) @@ -1,742 +0,0 @@ -%!PS-Adobe-2.0 EPSF-2.0 -%%Title: HDLC_top.dia -%%Creator: Dia v0.84 -%%CreationDate: Sat Feb 3 10:41:15 2001 -%%For: a user -%%Magnification: 1.0000 -%%Orientation: Portrait -%%BoundingBox: 0 0 667 328 -%%Pages: 1 -%%BeginSetup -%%EndSetup -%%EndComments -[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright -/parenleft /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one -/two /three /four /five /six /seven /eight /nine /colon /semicolon -/less /equal /greater /question /at /A /B /C /D /E -/F /G /H /I /J /K /L /M /N /O -/P /Q /R /S /T /U /V /W /X /Y -/Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c -/d /e /f /g /h /i /j /k /l /m -/n /o /p /q /r /s /t /u /v /w -/x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright -/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior -/acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf -/threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla -/Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde -/Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex -/Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring -/ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis -/eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave -/uacute /ucircumflex /udieresis /yacute /thorn /ydieresis] /isolatin1encoding exch def -/Times-Roman-latin1 - /Times-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Italic-latin1 - /Times-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Bold-latin1 - /Times-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-BoldItalic-latin1 - /Times-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Book-latin1 - /AvantGarde-Book findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-BookOblique-latin1 - /AvantGarde-BookOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Demi-latin1 - /AvantGarde-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-DemiOblique-latin1 - /AvantGarde-DemiOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Light-latin1 - /Bookman-Light findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-LightItalic-latin1 - /Bookman-LightItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Demi-latin1 - /Bookman-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-DemiItalic-latin1 - /Bookman-DemiItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-latin1 - /Courier findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Oblique-latin1 - /Courier-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Bold-latin1 - /Courier-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-BoldOblique-latin1 - /Courier-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-latin1 - /Helvetica findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Oblique-latin1 - /Helvetica-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Bold-latin1 - /Helvetica-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-BoldOblique-latin1 - /Helvetica-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-latin1 - /Helvetica-Narrow findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Oblique-latin1 - /Helvetica-Narrow-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Bold-latin1 - /Helvetica-Narrow-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-BoldOblique-latin1 - /Helvetica-Narrow-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Roman-latin1 - /NewCenturySchoolbook-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Italic-latin1 - /NewCenturySchoolbook-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Bold-latin1 - /NewCenturySchoolbook-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-BoldItalic-latin1 - /NewCenturySchoolbook-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Roman-latin1 - /Palatino-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Italic-latin1 - /Palatino-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Bold-latin1 - /Palatino-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-BoldItalic-latin1 - /Palatino-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Symbol-latin1 - /Symbol findfont -definefont pop -/ZapfChancery-MediumItalic-latin1 - /ZapfChancery-MediumItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/ZapfDingbats-latin1 - /ZapfDingbats findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/cp {closepath} bind def -/c {curveto} bind def -/f {fill} bind def -/a {arc} bind def -/ef {eofill} bind def -/ex {exch} bind def -/gr {grestore} bind def -/gs {gsave} bind def -/sa {save} bind def -/rs {restore} bind def -/l {lineto} bind def -/m {moveto} bind def -/rm {rmoveto} bind def -/n {newpath} bind def -/s {stroke} bind def -/sh {show} bind def -/slc {setlinecap} bind def -/slj {setlinejoin} bind def -/slw {setlinewidth} bind def -/srgb {setrgbcolor} bind def -/rot {rotate} bind def -/sc {scale} bind def -/sd {setdash} bind def -/ff {findfont} bind def -/sf {setfont} bind def -/scf {scalefont} bind def -/sw {stringwidth pop} bind def -/tr {translate} bind def - -/ellipsedict 8 dict def -ellipsedict /mtrx matrix put -/ellipse -{ ellipsedict begin - /endangle exch def - /startangle exch def - /yrad exch def - /xrad exch def - /y exch def - /x exch def /savematrix mtrx currentmatrix def - x y tr xrad yrad sc - 0 0 1 startangle endangle arc - savematrix setmatrix - end -} def - -/colortogray { -/rgbdata exch store -rgbdata length 3 idiv -/npixls exch store -/rgbindx 0 store -0 1 npixls 1 sub { -grays exch -rgbdata rgbindx get 20 mul -rgbdata rgbindx 1 add get 32 mul -rgbdata rgbindx 2 add get 12 mul -add add 64 idiv -put -/rgbindx rgbindx 3 add store -} for -grays 0 npixls getinterval -} bind def -/mergeprocs { -dup length -3 -1 roll -dup -length -dup -5 1 roll -3 -1 roll -add -array cvx -dup -3 -1 roll -0 exch -putinterval -dup -4 2 roll -putinterval -} bind def -/colorimage { -pop pop -{colortogray} mergeprocs -image -} bind def - -19.842200 -19.842200 scale -9.062040 -22.610037 translate -%%EndProlog - - -1.000000 1.000000 1.000000 srgb -n 6.496390 18.950000 m 6.496390 22.000000 l 12.439990 22.000000 l 12.439990 18.950000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 6.496390 18.950000 m 6.496390 22.000000 l 12.439990 22.000000 l 12.439990 18.950000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Zero ) dup sw 2 div 9.468190 ex sub 20.269690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Deletion) dup sw 2 div 9.468190 ex sub 21.069690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 13.371400 18.800000 m 13.371400 21.950000 l 19.034600 21.950000 l 19.034600 18.800000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 13.371400 18.800000 m 13.371400 21.950000 l 19.034600 21.950000 l 19.034600 18.800000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Flag ) dup sw 2 div 16.203000 ex sub 20.169690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Detection) dup sw 2 div 16.203000 ex sub 20.969690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -0.967907 14.300000 m -0.967907 17.300000 l 17.239990 17.300000 l 17.239990 14.300000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -0.967907 14.300000 m -0.967907 17.300000 l 17.239990 17.300000 l 17.239990 14.300000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Rx Controller) dup sw 2 div 8.136041 ex sub 15.994690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -4.360008 18.750000 m -4.360008 21.850000 l 0.639992 21.850000 l 0.639992 18.750000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -4.360008 18.750000 m -4.360008 21.850000 l 0.639992 21.850000 l 0.639992 18.750000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -1.860008 ex sub 20.494690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 19.034600 21.162500 m 21.265000 21.100000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 19.823082 20.740248 m 19.034600 21.162500 l 19.845490 21.539934 l s -1.000000 1.000000 1.000000 srgb -n 7.671390 6.350000 m 7.671390 9.400000 l 13.614990 9.400000 l 13.614990 6.350000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 7.671390 6.350000 m 7.671390 9.400000 l 13.614990 9.400000 l 13.614990 6.350000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Zero ) dup sw 2 div 10.643190 ex sub 7.669690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Insertion) dup sw 2 div 10.643190 ex sub 8.469690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 14.846400 6.200000 m 14.846400 9.350000 l 20.509600 9.350000 l 20.509600 6.200000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 14.846400 6.200000 m 14.846400 9.350000 l 20.509600 9.350000 l 20.509600 6.200000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Flag ) dup sw 2 div 17.678000 ex sub 7.569690 m gs 1 -1 sc sh gr -0.000000 0.000000 0.000000 srgb -(Insertion) dup sw 2 div 17.678000 ex sub 8.369690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -0.967907 10.600000 m -0.967907 13.600000 l 17.264990 13.600000 l 17.264990 10.600000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -0.967907 10.600000 m -0.967907 13.600000 l 17.264990 13.600000 l 17.264990 10.600000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Tx Controller) dup sw 2 div 8.148541 ex sub 12.294690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n -2.835010 6.300000 m -2.835010 9.400000 l 2.164990 9.400000 l 2.164990 6.300000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n -2.835010 6.300000 m -2.835010 9.400000 l 2.164990 9.400000 l 2.164990 6.300000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -0.335010 ex sub 8.044690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 3.584067 17.300000 m 3.584067 18.200000 l -0.610008 18.200000 l -0.610008 18.750000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 8.136041 17.300000 m 8.136041 18.250000 l 9.468190 18.250000 l 9.468190 18.950000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 12.688016 17.300000 m 12.688016 18.350000 l 16.203000 18.350000 l 16.203000 18.800000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 17.678000 9.350000 m 17.678000 10.250000 l 12.706766 10.250000 l 12.706766 10.600000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 12.129090 9.400000 m 12.129090 10.300000 l 8.148541 10.300000 l 8.148541 10.600000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 0.914990 9.400000 m 0.914990 10.450000 l 2.364990 10.450000 l 2.364990 10.650000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 20.509600 6.987500 m 22.465000 6.950000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 21.672817 7.365266 m 22.465000 6.950000 l 21.657477 6.565413 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 20.509600 8.562500 m 22.495400 8.550000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 21.697934 8.955028 m 22.495400 8.550000 l 21.692898 8.155044 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 19.034600 19.587500 m 21.220400 19.550000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 19.827621 19.173836 m 19.034600 19.587500 l 19.841344 19.973718 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -2.835010 7.075000 m -5.185008 7.100000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -3.630710 7.483488 m -2.835010 7.075000 l -3.639220 6.683533 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -2.835010 8.625000 m -5.035008 8.550000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -3.648174 8.997511 m -2.835010 8.625000 l -3.620917 8.197975 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -4.221844 8.177489 m -5.035008 8.550000 l -4.249101 8.977025 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -4.360008 19.525000 m -5.888040 19.500000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -5.081604 19.113141 m -5.888040 19.500000 l -5.094691 19.913033 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n -4.360008 21.075000 m -6.138040 21.050000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -5.165553 21.463713 m -4.360008 21.075000 l -5.154305 20.663792 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n -5.332495 20.661287 m -6.138040 21.050000 l -5.343743 21.461208 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Tx) dup sw 2 div 23.262000 ex sub 6.950000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(TxClk) dup sw 2 div 22.912000 ex sub 8.400000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Rx) dup sw 2 div 21.962000 ex sub 19.350000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(RxClk) dup sw 2 div 21.912000 ex sub 21.050000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(RxEn) dup sw 2 div 19.912000 ex sub 15.450000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(TxEn) dup sw 2 div 19.412000 ex sub 11.750000 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 20.062000 12.100000 m 17.264990 12.100000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 18.064990 11.700000 m 17.264990 12.100000 l 18.064990 12.500000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 17.239990 15.800000 m 20.062000 15.800000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 18.039990 15.400000 m 17.239990 15.800000 l 18.039990 16.200000 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(TxD[7:0]) dup sw 2 div -6.038040 ex sub 6.900000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(RxD[7:0]) dup sw 2 div -6.538040 ex sub 18.850000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -6.038040 ex sub 9.650000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Backend) dup sw 2 div -6.592040 ex sub 22.353400 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 2.812093 6.285000 m 2.812093 9.335000 l 7.182093 9.335000 l 7.182093 6.285000 l f -0.100000 slw -[1.000000] 0 sd -[1.000000] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 2.812093 6.285000 m 2.812093 9.335000 l 7.182093 9.335000 l 7.182093 6.285000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(FCS-16) dup sw 2 div 4.997093 ex sub 8.004690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 4.997093 9.335000 m 4.997093 10.385000 l 6.212093 10.385000 l 6.212093 10.585000 l s -1.000000 1.000000 1.000000 srgb -n 1.462093 18.885000 m 1.462093 21.935000 l 5.832093 21.935000 l 5.832093 18.885000 l f -0.100000 slw -[0.001000] 0 sd -[1.000000] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 1.462093 18.885000 m 1.462093 21.935000 l 5.832093 21.935000 l 5.832093 18.885000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(FCS-16) dup sw 2 div 3.647093 ex sub 20.604690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 4.717960 17.335000 m 4.717960 18.285000 l 4.739593 18.285000 l 4.739593 18.885000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 14.846400 7.775000 m 13.587960 7.650000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 7.671390 7.875000 m 7.182093 7.810000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 2.812093 7.810000 m 2.164990 7.850000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 13.371400 20.375000 m 12.439990 20.475000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 6.437960 20.300000 m 5.832093 20.410000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 1.337960 20.300000 m 0.639992 20.300000 l s -showpage Index: hdlc/web_uploads/hdlc_project.html =================================================================== --- hdlc/web_uploads/hdlc_project.html (revision 19) +++ hdlc/web_uploads/hdlc_project.html (nonexistent) @@ -1,610 +0,0 @@ - - - - - - -

Jamil Khatib

- - HDLC controller core - -

HDLC controller core

- -

- -

(C) Copyright 2001 Jamil Khatib.
- -

- -


1  List of authors and changes
-2  Project Definition
-    2.1  Introduction
-    2.2  Objectives
-3  Specifications
-    3.1  System Features Specification
-    3.2  External Interfaces
-        3.2.1  Receive Channel
-        3.2.2  Back-end interface mapping to Wishbone SoC bus
-        3.2.3  Transmit Channel
-        3.2.4  Back-end interface mapping to Wishbone SoC bus
-        3.2.5  CPU interface
-4  Design description
-    4.1  Receive Channel
-        4.1.1  Design notes
-        4.1.2  Timing
-    4.2  Transmit Channel
-        4.2.1  Design notes
-        4.2.2  Timing
-    4.3  External FIFO and registers
-    4.4  Registers
-        4.4.1  Transmit
-        4.4.2  Receive
-    4.5  Transmit Frame
-    4.6  Receive Frame
-    4.7  Connection to TDM controller
-    4.8  Clocks Synchronization
-    4.9  Diagrams
-5  Testing and verifications
-    5.1  Simulation and Test benches
-    5.2  Verification techniques and algorithms
-    5.3  Test plans
-6  Implementations
-    6.1  Scripts, files and any other information
-    6.2  Design conventions and coding styles
-7  Reviews and comments
-8  References
- -


-1  List of authors and changes

- -

- -

- - - - - - -
Name Changes Date Contact address
Jamil Khatib Initial release 9-1-2001
Jamil Khatib TX interface added, Spec improved 27-1-2001
Jamil Khatib External FIFO buffer added 3-2-2001
Jamil Khatib Registers and CPU interface added 8-2-2001
Jamil Khatib Drop bit, TDM interface are added 9-2-2001
Jamil Khatib More design descriptions added 2-4-2001
Jamil Khatib FIFO buffers calculations added 9-4-2001
- - -


-2  Project Definition

- -


-2.1  Introduction

-HDLC protocol is used as a data link of most of the current communication systems like ISDN, Frame Relay etc. HDLC is a family of protocols that varies in address size, control field, FCS and no. of data bits. - -


-2.2  Objectives

-The aim of this project is to develop the basic HDLC functionalities to be used by many communication systems. - -


-3  Specifications

- -


-3.1  System Features Specification

- -
    - -
  1. Synchronous operation - -
  2. 8 bit parallel back-end interface - -
  3. Use external RX and TX clocks - -
  4. Start and end of frame pattern generation - -
  5. Start and end of frame pattern checking - -
  6. Idle pattern generation and detection (all ones) - -
  7. Zero insertion and removal for transparent transmission. - -
  8. Abort pattern generation and checking (7 ones) - -
  9. Address insertion and detection by software - -
  10. CRC generation and checking (CRC-16 or CRC-32 can be used which is configurale at the code top level) - -
  11. FIFO buffers and synchronization (External) - -
  12. Byte aligned data (if data is not aligned to 8-bits error signal is reported to the backend interface) - -
  13. Q.921, LAPD and LAPB compliant. - -
  14. The core should not have internal configuration registers or counters, instead it provides all the signals to implement external registers. - -
  15. There is No limit on the Maximum frame size as long as the backend can read and write data (depends on the external FIFO size) - -
  16. Bus connection is not supported directly (TxEN and RxEN pins can be used for that reason) - -
  17. Retransmission is not supported when there is collision in the Bus connection mode. - -
  18. This controller is used for low speed application only (relative to the backend bus). - -
  19. Supports connection to TDM core via backend interface and software control for time slot selection and control (signaling ,etc.) generation. - -
  20. Backend interface uses the Wishbone bus interface which can be connected directly to the system or via FIFO buffer. - -
  21. Optional External FIFO buffers, configuration and status registers. - -
  22. The core will be made of two levels of hierarchies, the basic functionality and the Optional interfaces and buffers. -


-3.2  External Interfaces

- -


-3.2.1  Receive Channel

- -

- -

- - - - - - - -
Signal nameDirectionDescription
Control interface
Rst Input System asynchronous reset(active low)
Serial Interface
RxClk Input Receive Clock
Rx InputReceive Data
RxEn Input RX enable (active high)
Back-end Interface
RxD[7:0]OutputReceive data bus
ValidFrameOutputValid Frame indication during all frame bytes transfer
FrameErrOutputError in the received data (lost bits)
AbortedOutputAborted Frame
ReadInputRead byte
ReadyOutputValid data exists
- - -


-3.2.2  Back-end interface mapping to Wishbone SoC bus

-The HDLC receive backend interface can be used as a slave core or master according to the below mapping. The core supports SINGLE READ Cycle only using 8-bit data bus without address lines. The choice between master and slave is left for the system integrator and must do the configuration and glue logic as defined in the tables. - -

- -

- Figure -


- - - - - - - - - - - - - - - - - - - - - - - - - -
Signal NameWishbone signal
Master Configuration connected to FIFO
Rst not RST_I
ReadByteACK_I and not RTY_I
Slave FIFO(two-clock domain FIFO)
Chip SelectSTB_I
STB_I and not FullFlagACK_O
Slave Configuration
Rst not RST_I
ReadBytenot WE_I
Readynot RTY_O
STB_I and not WR_IACK_O
- - -


-3.2.3  Transmit Channel

- - - - - - - - - -
Signal nameDirectionDescription
Control interface
Rst Input System asynchronous reset(active low)
Serial Interface
TxClk Input Transmit Clock
Tx Output Transmit Data
TxEn Input TX enable (active high)
Back-end Interface
TxD[7:0]Input Transmit data bus
ValidFrameInputValid Frame indication during all frame bytes transfer
AbortedTransOutputError in the transmitted data (Abort pattern was generated)
AbortFrameInputAbort Frame
WriteInputWrite byte
ReadyOutputCan accept new data
- - -


-3.2.4  Back-end interface mapping to Wishbone SoC bus

-The HDLC receive backend interface can be used as a slave core or master according to the below mapping. The core supports SINGLE WRITE Cycle only using 8-bit data bus without address lines. The choice between master and slave is left for the system integrator and must do the configuration and glue logic as defined in the tables. - -

- -

- - - - - - - - - - - - - - - - - - - - - - - - - - -
Signal NameWishbone signal
Master Configuration connected to FIFO
Rst not RST_I
WriteACK_I and not RTY_I
Readynot WE_O
Always Active CYC_O
Always Active STB_O
Slave FIFO(two-clock domain FIFO)
WE_I and not EmptyFlagACK_O
Slave Configuration
Rst not RST_I
Readynot RTY_O
- - -


-3.2.5  CPU interface

-This interface is used when the FIFO and registers are included in the Core. This interface is compatible to WishBone slave bus interface that supports single read/write cycles and block cycles. The interface supports the following wishbone signals. - -

- -

- - - - - - - - - - -
ADR_I(2:0)3-bit address line
DAT_O(7:0)8-bit receive data
DAT_I(7:0)8-bit transmit data
TAG0_OTxDone interrupt
TAG1_ORxReady interrupt
- - -


-4  Design description

- -


-4.1  Receive Channel

- -


-4.1.1  Design notes

- -

-Receive channel provides interface to the backend via a simple handshake protocol that can be used to connect the controller to either a shared memory or FIFO buffer. This protocol uses the hand shack protocol of the Wishbone SoC bus. - -

-Receive channel supports only 8-bits aligned data. Each frame starts with a starting flag (01111110) and ends with starting flag (01111110). Since the receipt ion is synchronous only, the channel uses the external clock and a byte must be read from the channel within the first 7 clock pulses after the ready signal is asserted. If no data is read during this period (while ValidFrame signal is active) FrameErr is signaled reported to the backend as long the ValidFrame is active. FrameErr is signaled also when non 8-bit aligned data is received and when FCS error is found. - -


-4.1.2  Timing

- -


-4.2  Transmit Channel

-Transmit channel provides interface to the backend via a simple handshake protocol that can be used to connect the controller to either a shared memory or FIFO buffer. This protocol uses the handshack protocol of the Wishbone SoC bus. - -

-Transmit channel supports only 8-bits aligned data. Each frame starts with a starting flag (01111110) and ends with starting flag (01111110). Since the transmission is synchronous only, the channel uses the external clock and a byte must be written to the channel within the first 7 clock pulses after the ready signal is asserted. If no data is inserted during this period (while ValidFrame signal is active) abort pattern is transmitted and reported to the backend via AboredTrans signal as long the ValidFrame is active. - -


-4.2.1  Design notes

- -


-4.2.2  Timing

-The channel starts accepting data after asserting the ValidFrame signal. This signal can control no of idle pattern bits (e.g. if this signal is de-asserted for 8 bits only a single Idle pattern (8 ones) is inserted). Valid Frame signal must be asserted for 8 clocks after any valid write operation. - -


-4.3  External FIFO and registers

-The controller has optional external FIFO buffers, one for data to be transmitted and one for data to be received. Status and control registers are available to control these FIFOs. These two blocks (FIFOs and registers) are built around the HDLC controller core which make them optional if the core is to be used in different kind of applications. -The current implementation supports the following configuration: -The size of the Transmit and receive FIFOs is (8×128) bits which enables 128 maximum HDLC frame size. - -

-The transmit buffer is used to prevent underflow while transmitting bytes to the line. All bytes will be available once the transmit is enabled. The Receive buffer is used to provide data burst transfer to the Back end interface which prevents the back end from reading each byte alone. The FIFO size is suitable for operating frequencies 2.048MHz on the serial interface and 50 MHz on the back end interface. Other frequencies can operate if the delay between HDLC frames is less than the delay needed for the back end to empty the internal FIFO (the next calculations is an example to be applied for different frequencies) - -

-7 bits (minimum bits between HDLC Frames) / 2.048MHz = 3.418 us - -

-128 Bytes (Maximum frame size) / 50MHz = 2.56 us - -

-These FIFOs are implemented on Single port memory. Two interrupt lines are used, one to signal transmission done and one to request transfer of received frame to memory. These interrupts are also reflected in Status registers to support polling mode for the controller. - -


-4.4  Registers

-All internal registers are 8-bit width. - -

-4.4.1  Transmit

- -

- -

Tx Status and Control Register: Tx_SC Offset Address = 0x0
- -

- -

- - -
BIT 7 6 5 4 3 2 1 0
FIELD N/A N/A FCSen FIFOOverflowAbortedTxAbortTxEnableTxDone
RESET 00000000
- -

- -

Tx FIFO buffer register: Tx_Buffer Offset Address = 0x1
- -

- -

- - -
BIT 7-0
FIELD Transmit Data byte
- - -


-4.4.2  Receive

- -

- -

Rx Status and Control Register: Rx_SC Offset Address = 0x2
- -

- -

- - -
BIT 7 6 5 4 3 2 1 0
FIELD N/A N/A N/A FIFOOverflowAbortedFrameErrorDropRxReady
RESET 00000000
- -

- -

Rx FIFO buffer register: Rx_Buffer Offset Address = 0x3
- -

- -

- - -
BIT 7-0
FIELD Received Data byte
- -

- -

Rx Frame length: Rx_Len Offset Address = 0x4
- -

- -

- - -
BIT 7-0
FIELD Frame Length
- -


-4.5  Transmit Frame

- -
    - -
  • The CPU should check TxDone (in Tx status register 0x0) bit of it is '1' or wait for TxDone interrupt. TxDone bit is reset to '0' after the first write to Tx FIFO Buffer register (0x1). - -
  • The CPU should write frame data bytes to Tx FIFO buffer register (0x1). - -
  • After writing all data bytes to TX buffer register, the CPU should write '1' to TxEnable to enable data transmission to the line. After writing to this bit no further write operation to Tx FIFO buffer register is allowed till TxDone is set (all writes will be ignored). - -
  • It is optional for the CPU to check the status bits of Tx status register. -


-4.6  Receive Frame

- -
    - -
  • The controller sets RxReady bit in Rx Status and control register (0x2) and sets the TxReady interrupt line to indicate valid frame in internal buffer is available. - -
  • It is recommended that the CPU read the Rx Status and control register (0x3). - -
  • The CPU should read the Frame length register (0x4) to check the size of the frame. The value of this regiter is valid only after the RxReady bit is set and remains valid till the first read from the Data buffer. - -
  • The CPU should read Rx FIFO buffer register (0x3) Frame length times to get all frame bytes. Performing extra reads (read from empty buffer) produces invalid data. - -
  • If the CPU does not read all frame bytes as soon as possible the internal buffer will overflow and FIFOOverflow bit will be set and the current frame should be dropped. No further read operations should be attempted till RxReady bit is set again and RxReady interrupt is signaled indicating new available frame. - -
  • The software can drop entire frame from the Receive FIFO buffer by writing 1 to drop bit in the status and control receive register (0x3). This is suitable for dropping bad frames (for any reason) or frames with incorrect addresses. -


-4.7  Connection to TDM controller

-This controller can get/send data from/to TDM controller through software control. The software configures the TDM controller to select the channel. It adds/removes the address and control information fields of the HDLC frame. Then passes the data field between the two controllers through optional DMA transfer. - -


-4.8  Clocks Synchronization

-Since the core can operate in different clock domains (The serial line domain and the backend interface domain), all control signals pass through two flip flops to reduce the metastability. These Flip Flops are clocked with the same clock of the interface that read these signals. - -


-4.9  Diagrams

- -

- -Figure - -

Figure 1: HDLC core
- -


- -

- Figure

Figure 2: HDLC controller
- -



-5  Testing and verifications

- -

- -

- -
Requirement Test method Validation method
Interface timing
- - -

-5.1  Simulation and Test benches

- -


-5.2  Verification techniques and algorithms

- -


-5.3  Test plans

- -


-6  Implementations

-The design is implemented using the VHDL language. The design is divided into three main blocks, serial Receive channel, Serial Transmit channel and the Top blocks. -The Receive and Transmit serial channels perform the HDLC -functionality. The Top blocks perform the FCS calculation (Which is -either FCS-16 or FCS-32), the frame buffering the interface with the -back end system and the synchronization between the clocks. The FCS and Buffering can be changed by replacing the corresponding files. - -


-6.1  Scripts, files and any other information

- - - - - - - - - - - - - - - - - - - - -
RxChannel.vhd Top Rx Channel
Rxcont.vhd Rx Controller
Zero_detect.vhd Zero detect and serial to parallel
flag_detect.vhd Flag detection
TxChannel.vhd Top Tx channel
TXcont.vhd Tx Controller
zero_ins.vhd Zero insertion and parallel to serial
flag_ins.vhd Flag insertion
TxBuff.vhdTx buffer
TxFCS.vhd Tx FCS-16
TxSync.vhd Tx synchronization
RxBuff.vhdRx buffer
RxFCS.vhd Rx FCS-16
RxSync.vhd Rx synchronization
WB_IF.vhd WishBone interface
hdlc.vhd Top HDLC controller
- - -


-6.2  Design conventions and coding styles

- -


-7  Reviews and comments

- -


-8  References

- -

- -

File translated from -TEX -by -TTH, -version 2.67.
On 9 Apr 2001, 23:57.
- Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (revision 19) +++ hdlc/web_uploads/ (nonexistent) @@ -1,450 +0,0 @@ -%!PS-Adobe-2.0 EPSF-2.0 -%%Title: /home/jamil/Projects_org/hdlc/hdlc_fifo.dia -%%Creator: Dia v0.84 -%%CreationDate: Sat Feb 3 22:02:38 2001 -%%For: a user -%%Magnification: 1.0000 -%%Orientation: Portrait -%%BoundingBox: 0 0 441 161 -%%Pages: 1 -%%BeginSetup -%%EndSetup -%%EndComments -[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright -/parenleft /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one -/two /three /four /five /six /seven /eight /nine /colon /semicolon -/less /equal /greater /question /at /A /B /C /D /E -/F /G /H /I /J /K /L /M /N /O -/P /Q /R /S /T /U /V /W /X /Y -/Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c -/d /e /f /g /h /i /j /k /l /m -/n /o /p /q /r /s /t /u /v /w -/x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef -/space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright -/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior -/acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf -/threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla -/Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde -/Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex -/Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring -/ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis -/eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave -/uacute /ucircumflex /udieresis /yacute /thorn /ydieresis] /isolatin1encoding exch def -/Times-Roman-latin1 - /Times-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Italic-latin1 - /Times-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-Bold-latin1 - /Times-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Times-BoldItalic-latin1 - /Times-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Book-latin1 - /AvantGarde-Book findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-BookOblique-latin1 - /AvantGarde-BookOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-Demi-latin1 - /AvantGarde-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/AvantGarde-DemiOblique-latin1 - /AvantGarde-DemiOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Light-latin1 - /Bookman-Light findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-LightItalic-latin1 - /Bookman-LightItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-Demi-latin1 - /Bookman-Demi findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Bookman-DemiItalic-latin1 - /Bookman-DemiItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-latin1 - /Courier findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Oblique-latin1 - /Courier-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-Bold-latin1 - /Courier-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Courier-BoldOblique-latin1 - /Courier-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-latin1 - /Helvetica findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Oblique-latin1 - /Helvetica-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Bold-latin1 - /Helvetica-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-BoldOblique-latin1 - /Helvetica-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-latin1 - /Helvetica-Narrow findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Oblique-latin1 - /Helvetica-Narrow-Oblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-Bold-latin1 - /Helvetica-Narrow-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Helvetica-Narrow-BoldOblique-latin1 - /Helvetica-Narrow-BoldOblique findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Roman-latin1 - /NewCenturySchoolbook-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Italic-latin1 - /NewCenturySchoolbook-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-Bold-latin1 - /NewCenturySchoolbook-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/NewCenturySchoolbook-BoldItalic-latin1 - /NewCenturySchoolbook-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Roman-latin1 - /Palatino-Roman findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Italic-latin1 - /Palatino-Italic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-Bold-latin1 - /Palatino-Bold findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Palatino-BoldItalic-latin1 - /Palatino-BoldItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/Symbol-latin1 - /Symbol findfont -definefont pop -/ZapfChancery-MediumItalic-latin1 - /ZapfChancery-MediumItalic findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/ZapfDingbats-latin1 - /ZapfDingbats findfont - dup length dict begin - {1 index /FID ne {def} {pop pop} ifelse} forall - /Encoding isolatin1encoding def - currentdict end -definefont pop -/cp {closepath} bind def -/c {curveto} bind def -/f {fill} bind def -/a {arc} bind def -/ef {eofill} bind def -/ex {exch} bind def -/gr {grestore} bind def -/gs {gsave} bind def -/sa {save} bind def -/rs {restore} bind def -/l {lineto} bind def -/m {moveto} bind def -/rm {rmoveto} bind def -/n {newpath} bind def -/s {stroke} bind def -/sh {show} bind def -/slc {setlinecap} bind def -/slj {setlinejoin} bind def -/slw {setlinewidth} bind def -/srgb {setrgbcolor} bind def -/rot {rotate} bind def -/sc {scale} bind def -/sd {setdash} bind def -/ff {findfont} bind def -/sf {setfont} bind def -/scf {scalefont} bind def -/sw {stringwidth pop} bind def -/tr {translate} bind def - -/ellipsedict 8 dict def -ellipsedict /mtrx matrix put -/ellipse -{ ellipsedict begin - /endangle exch def - /startangle exch def - /yrad exch def - /xrad exch def - /y exch def - /x exch def /savematrix mtrx currentmatrix def - x y tr xrad yrad sc - 0 0 1 startangle endangle arc - savematrix setmatrix - end -} def - -/colortogray { -/rgbdata exch store -rgbdata length 3 idiv -/npixls exch store -/rgbindx 0 store -0 1 npixls 1 sub { -grays exch -rgbdata rgbindx get 20 mul -rgbdata rgbindx 1 add get 32 mul -rgbdata rgbindx 2 add get 12 mul -add add 64 idiv -put -/rgbindx rgbindx 3 add store -} for -grays 0 npixls getinterval -} bind def -/mergeprocs { -dup length -3 -1 roll -dup -length -dup -5 1 roll -3 -1 roll -add -array cvx -dup -3 -1 roll -0 exch -putinterval -dup -4 2 roll -putinterval -} bind def -/colorimage { -pop pop -{colortogray} mergeprocs -image -} bind def - -22.676800 -22.676800 scale --0.032491 -15.040000 translate -%%EndProlog - - -1.000000 1.000000 1.000000 srgb -n 6.047691 8.000000 m 6.047691 10.000000 l 11.044491 10.000000 l 11.044491 8.000000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 6.047691 8.000000 m 6.047691 10.000000 l 11.044491 10.000000 l 11.044491 8.000000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(FIFO[1]) dup sw 2 div 8.546091 ex sub 9.194690 m gs 1 -1 sc sh gr -1.000000 1.000000 1.000000 srgb -n 6.029491 12.990000 m 6.029491 14.990000 l 10.994491 14.990000 l 10.994491 12.990000 l f -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0.000000 0.000000 0.000000 srgb -n 6.029491 12.990000 m 6.029491 14.990000 l 10.994491 14.990000 l 10.994491 12.990000 l cp s -/Courier-latin1 ff 0.800000 scf sf -0.000000 0.000000 0.000000 srgb -(FIFO[2]) dup sw 2 div 8.511991 ex sub 14.184690 m gs 1 -1 sc sh gr -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 11.044491 9.000000 m 11.044491 9.100000 l 15.994491 9.100000 l 15.994491 10.350000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 10.994491 13.990000 m 10.994491 14.150000 l 16.044491 14.150000 l 16.044491 11.400000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 16.094491 11.450000 m 17.944491 11.450000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 16.894491 11.050000 m 16.094491 11.450000 l 16.894491 11.850000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 6.047691 9.000000 m 6.047691 9.100000 l 2.944491 9.100000 l 2.944491 11.700000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 6.029491 13.990000 m 6.029491 14.000000 l 2.994491 14.000000 l 2.994491 13.000000 l s -0.100000 slw -[] 0 sd -[] 0 sd -0 slc -0.000000 0.000000 0.000000 srgb -n 1.029491 11.640000 m 2.879491 11.640000 l s -0.100000 slw -[] 0 sd -0 slj -0 slc -0.000000 0.000000 0.000000 srgb -n 1.829491 11.240000 m 1.029491 11.640000 l 1.829491 12.040000 l s -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Write) dup sw 2 div 17.844491 ex sub 12.700000 m gs 1 -1 sc sh gr -/Courier-latin1 ff 1.000000 scf sf -0.000000 0.000000 0.000000 srgb -(Read) dup sw 2 div 1.344491 ex sub 10.750000 m gs 1 -1 sc sh gr -showpage Index: hdlc/web_uploads/index.shtml =================================================================== --- hdlc/web_uploads/index.shtml (revision 19) +++ hdlc/web_uploads/index.shtml (nonexistent) @@ -1,261 +0,0 @@ - - -

HDLC controller


HDLC controller features

  • 1. 8 bit parallel backend interface
  • 2. use external RX and TX clocks
  • 3. Start and end of frame pattern generation
  • 4. Start and end of frame pattern checking
  • 5. Idle pattern generation and detection (all ones)
  • 5. a) Idle pattern is assumed only after the end of a frame which is signaled by an abort signal
  • 6. Zero insertion
  • 7. Abort pattern generation and checking
  • 8. Address insertion and detection by software
  • 9. CRC generation and checking (Optional, external, since CRC-16 or CRC-32 can be used)
  • 10. FIFO buffers and synchronization (External)
  • 11. Byte aligned data (if data is not aligned to 8-bits extra random bits are inserted)
  • 12. Q.921, LAPB and LAPD compliant.
  • 13. For complete specifications refer to spec document

System specifications and interfaces

Check the system spec and interaces or you can download the PS file or PDF file

Core top block diagram

- - - - - -


The VHDL code is ready in the opencores CVS. The code needs verification contact me if you are intrested in helping me. - - - -

Resource usage

-Rx Channel Block: which includes HDLC Framing extraction, zero removal and conversion from serial to parallel. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
VendorDeviceSizeFrequency Board TestedFunctional TestNotes
AlteraEP20K100BC356-3108 LCs91.48MHz--No optimization was peroformed, using Quartus II
- - - -
- -Tx Channel Block: which includes HDLC Frame generation, zero insertion and conversion from parallel to serial. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
VendorDeviceSizeFrequency Board TestedFunctional TestNotes
AlteraEP20K100BC356-3100 LCs112.42MHz--No optimization was peroformed, using Quartus II
- - - -
-HDLC controller Block: which includes both the Rx and Tx channels, FCS-16 generation and checking, 128 byte buffering for each direction and Wishbon SOC bus interface and controller registers. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
VendorDeviceSizeFrequencies (MHz)Board TestedFunctional TestNotes
AlteraEP20K100BC356-3630 LCs, 2 ESBsCLK_I=74.02,RxClk=101.86,TxClk=106.42--No optimization was peroformed, using Quartus II
- - - - - -


- - - -


    Jamil Khatib


    Jamil Khatib

Contact email:


Index: hdlc/web_uploads/HDLC_top.jpg =================================================================== Cannot display: file marked as a binary type. svn:mime-type = application/octet-stream Index: hdlc/web_uploads/HDLC_top.jpg =================================================================== --- hdlc/web_uploads/HDLC_top.jpg (revision 19) +++ hdlc/web_uploads/HDLC_top.jpg (nonexistent)
hdlc/web_uploads/HDLC_top.jpg Property changes : Deleted: svn:mime-type ## -1 +0,0 ## -application/octet-stream \ No newline at end of property Index: hdlc/web_uploads/hdlc_fifo.jpg =================================================================== Cannot display: file marked as a binary type. svn:mime-type = application/octet-stream Index: hdlc/web_uploads/hdlc_fifo.jpg =================================================================== --- hdlc/web_uploads/hdlc_fifo.jpg (revision 19) +++ hdlc/web_uploads/hdlc_fifo.jpg (nonexistent)
hdlc/web_uploads/hdlc_fifo.jpg Property changes : Deleted: svn:mime-type ## -1 +0,0 ## -application/octet-stream \ No newline at end of property Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (nonexistent) +++ hdlc/web_uploads/ (revision 18) @@ -0,0 +1,2834 @@ +#!/bin/bash +# AUTOMATICALLY GENERATED SCRIPT +# Scans the cores directory, excludes the projects and subdirectories +# listed below, and generates a script which checks in all of the +# remaining files to the SVN repository +# This should be run and the output piped to a new file something like: +# ./ > +# and then probably the execute permission enabled on +# Encapsulate the checkins inside this loop we can +# break out of in the event of a problem checking +# one of them in + +# Function to check the return value of each SVN checkin +function check_svn_return_value { if [ $? -gt 1 ]; then echo "Error during checkins - aborting script."; exit 1; fi +} +ALL_DONE="0" +while [ $ALL_DONE = 0 ]; do + pushd "100baset" + popd + pushd "1394ohci" + popd + pushd "2dcoprocessor" + popd + pushd "395_vgs" + popd + pushd "3des_vhdl" + popd + pushd "4bitprocesor" + popd + pushd "6502vhdl" + popd + pushd "68hc05" + popd + pushd "68hc08" + popd + pushd "8051_serial" + popd + pushd "8051_to_ahb_interface" + popd + pushd "8b10b_encdec" + svn import -m "Import from OC" "8b10b_encdec_v1d0.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "8b10_dec.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "8b10_enc.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "enc_8b10b_TB.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "encdec_8b10b_TB.vhd" "" + check_svn_return_value + popd + pushd "8bituartvhdl" + popd + pushd "aacencode" + popd + pushd "acxbrd" + svn import -m "Import from OC" "jopcore.pdf" "" + check_svn_return_value + popd + pushd "adaptivefilter" + popd + pushd "adaptive_lms_equalizer" + popd + pushd "adder" + svn import -m "Import from OC" "high-speed-adder-128bits-opencore.v" "" + check_svn_return_value + popd + pushd "ae18" + popd + pushd "aemb" + popd + pushd "aes128" + popd + pushd "aes_128_192_256" + svn import -m "Import from OC" "aes_dec.vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "aes_enc.vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "aes_pkg.vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "aes_top.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "key_expansion.vhdl" "" + check_svn_return_value + popd + pushd "aes_core" + popd + pushd "aes_crypto_core" + popd + pushd "aes_fekete256" + svn import -m "Import from OC" "AES.ZIP" "" + check_svn_return_value + popd + pushd "ahb2wishbone" + popd + pushd "ahbahb" + popd + pushd "ahb_arbiter" + popd + pushd "ahb_system_generator" + popd + pushd "all_digital_fm_receiver" + svn import -m "Import from OC" "architecture.png" "" + check_svn_return_value + svn import -m "Import from OC" "fmsquare.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "fmtriangular.jpg" "" + check_svn_return_value + popd + pushd "alternascope" + svn import -m "Import from OC" "Alternascope_Sept15_2005.rar" "" + check_svn_return_value + svn import -m "Import from OC" "BlockDiagram_small.GIF" "" + check_svn_return_value + svn import -m "Import from OC" "OpenCores.JPG" "" + check_svn_return_value + popd + pushd "alu_with_selectable_inputs_and_outputs" + popd + pushd "amba_compliant_fifo_core" + popd + pushd "ambasdram" + popd + pushd "aquarius" + svn import -m "Import from OC" "aquarius.files" "" + check_svn_return_value + svn import -m "Import from OC" "aquarius.html" "" + check_svn_return_value + svn import -m "Import from OC" "cpublock.gif" "" + check_svn_return_value + svn import -m "Import from OC" "fpgaboard.gif" "" + check_svn_return_value + svn import -m "Import from OC" "rtl.gif" "" + check_svn_return_value + popd + pushd "aspida" + svn import -m "Import from OC" "aspida_dlx_core.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "aspida.gif" "" + check_svn_return_value + svn import -m "Import from OC" "faq.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_aspida.gif" "" + check_svn_return_value + popd + pushd "asynchronous_clocks" + popd + pushd "ata" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "preliminary_ata_core.pdf" "" + check_svn_return_value + popd + pushd "auto_baud" + svn import -m "Import from OC" "auto_baud.v" "" + check_svn_return_value + svn import -m "Import from OC" "auto_baud_with_tracking.v" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "a_vhd_16550_uart" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "vhdl_16550_uart_2_2.pdf" "" + check_svn_return_value + popd + pushd "a_vhdl_can_controller" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "avr_core" + svn import -m "Import from OC" "AVR_Core8F.tar.gz" "" + check_svn_return_value + popd + pushd "ax8" + popd + pushd "basicdes" + popd + pushd "basicrsa" + popd + pushd "baudgen" + svn import -m "Import from OC" "am_baud_rate_gen.vhd" "" + check_svn_return_value + popd + pushd "baud_select_uart" + popd + pushd "bc6502" + popd + pushd "big_counter" + popd + pushd "binary_to_bcd" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "bcd_to_binary.v" "" + check_svn_return_value + svn import -m "Import from OC" "binary_to_bcd.v" "" + check_svn_return_value + popd + pushd "bips" + popd + pushd "biquad" + svn import -m "Import from OC" "biquad.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "biquad.v" "" + check_svn_return_value + svn import -m "Import from OC" "bqmain.v" "" + check_svn_return_value + svn import -m "Import from OC" "bquad_blk.gif" "" + check_svn_return_value + svn import -m "Import from OC" "coefio.v" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "multa.v" "" + check_svn_return_value + svn import -m "Import from OC" "multb.v" "" + check_svn_return_value + svn import -m "Import from OC" "vsource.html" "" + check_svn_return_value + popd + pushd "bluespec-80211atransmitter" + popd + pushd "bluespec-bsp" + popd + pushd "bluespec-convolutional-codec" + popd + pushd "bluespec-fft" + popd + pushd "bluespec-galoisfield" + popd + pushd "bluespec-h264" + svn import -m "Import from OC" "h264.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "memo497.pdf" "" + check_svn_return_value + popd + pushd "bluespec-ofdm" + popd + pushd "bluespec-reedsolomon" + popd + pushd "bluetooth" + svn import -m "Import from OC" "BBspec.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "bluetooth_ver" + popd + pushd "board" + svn import -m "Import from OC" "blockdiagram.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "boardflow.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "board.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "coreflow.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "led.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "matrics.gif" "" + check_svn_return_value + svn import -m "Import from OC" "power_led.gif" "" + check_svn_return_value + svn import -m "Import from OC" "XC95108-PC84.sym" "" + check_svn_return_value + popd + pushd "boundaries" + popd + pushd "brisc" + popd + pushd "butterfly" + popd + pushd "c16" + popd + pushd "cable" + popd + pushd "cachemodel" + popd + pushd "cam" + popd + pushd "camellia" + svn import -m "Import from OC" "camellia_core_tb.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "CAMELLIA_CORE.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "Camellia_doc.pdf" "" + check_svn_return_value + popd + pushd "camellia-vhdl" + popd + pushd "can" + svn import -m "Import from OC" "CAN.gif" "" + check_svn_return_value + popd + pushd "cas" + popd + pushd "cdma" + popd + pushd "cereon" + svn import -m "Import from OC" "AssemblerReference.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "CereonArchitectureReferenceManual_Version1.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "ProcedureCallingStandards.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "ProcessorIdentificationScheme.pdf" "" + check_svn_return_value + popd + pushd "cf_cordic" + svn import -m "Import from OC" "cf_cordic.tgz" "" + check_svn_return_value + popd + pushd "cf_fft" + svn import -m "Import from OC" "cf_fft_test_large.tgz" "" + check_svn_return_value + svn import -m "Import from OC" "cf_fft_test.tgz" "" + check_svn_return_value + svn import -m "Import from OC" "cf_fft.tgz" "" + check_svn_return_value + popd + pushd "cf_fir" + svn import -m "Import from OC" "cf_fir.tgz" "" + check_svn_return_value + popd + pushd "cf_fp_mul" + svn import -m "Import from OC" "cf_fp_mul.tgz" "" + check_svn_return_value + popd + pushd "cfft" + popd + pushd "cfinterface" + popd + pushd "cf_interleaver" + svn import -m "Import from OC" "cf_interleaver.tgz" "" + check_svn_return_value + popd + pushd "cf_ldpc" + svn import -m "Import from OC" "cf_ldpc.tgz" "" + check_svn_return_value + popd + pushd "cf_rca" + svn import -m "Import from OC" "cf_rca.tgz" "" + check_svn_return_value + svn import -m "Import from OC" "rca_tile.png" "" + check_svn_return_value + popd + pushd "cf_ssp" + svn import -m "Import from OC" "cf_ssp.tgz" "" + check_svn_return_value + svn import -m "Import from OC" "ssp_cordic.c" "" + check_svn_return_value + svn import -m "Import from OC" "ssp_first_order.c" "" + check_svn_return_value + popd + pushd "cia" + popd + pushd "claw" + popd + pushd "clocklessalu" + popd + pushd "cmpct" + popd + pushd "c-nit_soc" + popd + pushd "color_converter" + popd + pushd "constellation_vga" + popd + pushd "const_encoder" + svn import -m "Import from OC" "Const_enc_oc.doc" "" + check_svn_return_value + svn import -m "Import from OC" "const_enc.vhd" "" + check_svn_return_value + popd + pushd "cordic" + svn import -m "Import from OC" "cordic.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "core_arm" + popd + pushd "cowgirl" + popd + pushd "cpu6502_true_cycle" + popd + pushd "cpu65c02_true_cycle" + popd + pushd "cpu8080" + popd + pushd "cpugen" + svn import -m "Import from OC" "cpugen.jpg" "" + check_svn_return_value + popd + pushd "cryptopan_core" + popd + pushd "cryptosorter" + svn import -m "Import from OC" "cryptosorter.pdf" "" + check_svn_return_value + popd + pushd "csa" + popd + pushd "dallas_one-wire" + popd + pushd "dct" + svn import -m "Import from OC" "dct.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "htmlbook.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "modexp.shtml" "" + check_svn_return_value + popd + pushd "ddr_sdr" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "doc" "" + check_svn_return_value + svn import -m "Import from OC" "LICENSE.dat" "" + check_svn_return_value + svn import -m "Import from OC" "vhdl" "" + check_svn_return_value + popd + pushd "ddsgen" + popd + pushd "decoder" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "deflatecore" + popd + pushd "des" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "design_dsp320tmsc10_with_vhdl" + popd + pushd "dfp" + svn import -m "Import from OC" "dfp.gif" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "digifilter" + popd + pushd "diogenes" + svn import -m "Import from OC" "diogenes.tar.bz2" "" + check_svn_return_value + popd + pushd "dirac" + popd + pushd "djpeg" + popd + pushd "dmacontroller" + popd + pushd "dmt_tx" + popd + pushd "dram" + svn import -m "Import from OC" "dram.html" "" + check_svn_return_value + svn import -m "Import from OC" "dram.shtml" "" + check_svn_return_value + popd + pushd "dualspartainc6713cpci" + svn import -m "Import from OC" "6713_CPU.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "BotLayer.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "DSP_Front.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "DSP_near_done_tiny.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Mid1Layer.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Mid2Layer.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "SystemDiagram.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "TopLayer.jpg" "" + check_svn_return_value + popd + pushd "dwt2d" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "e123mux" + svn import -m "Import from OC" "Block_Diagram.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "E123MUX_Core.pdf" "" + check_svn_return_value + popd + pushd "e1framer" + popd + pushd "e1framerdeframer" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "fas_insert.vhd" "" + check_svn_return_value + popd + pushd "edatools" + popd + pushd "elevator" + popd + pushd "elphel_353" + popd + pushd "embedded_risc" + svn import -m "Import from OC" "Block_Diagram" "" + check_svn_return_value + popd + pushd "embed_z8" + popd + pushd "epp" + svn import -m "Import from OC" "epp.jpg" "" + check_svn_return_value + popd + pushd "epp-interface-v" + popd + pushd "epp-to-wishbone" + popd + pushd "erp" + svn import -m "Import from OC" "ERPTechnicalReport4.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "ERPTechnicalReport5.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "ERPverilogcore.txt" "" + check_svn_return_value + popd + pushd "ethdev" + popd + pushd "ethernet_tri_mode" + svn import -m "Import from OC" "ethernet_tri_mode.rel-1-0.tar.gz" "" + check_svn_return_value + popd + pushd "ethmac10g" + popd + pushd "ethmacvhdl" + popd + pushd "ethswitch" + popd + pushd "eus100lx" + svn import -m "Import from OC" "180px-EUS_B_N.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "180px-EUS_T_N.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "EUS100LX_BD.gif" "" + check_svn_return_value + popd + pushd "eusfs" + svn import -m "Import from OC" "eusfs-bd.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "EUSIIa_bottom_tn.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "EUS_II_topa_tn.jpg" "" + check_svn_return_value + popd + pushd "evision" + popd + pushd "extension_pack" + popd + pushd "fac2222m" + svn import -m "Import from OC" "ADC-DAC-AMP.png" "" + check_svn_return_value + svn import -m "Import from OC" "fac2222m.png" "" + check_svn_return_value + popd + pushd "fast-crc" + svn import -m "Import from OC" "CRC-generator.tgz" "" + check_svn_return_value + svn import -m "Import from OC" "CRC_ie3_contest.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "CRC.tgz" "" + check_svn_return_value + svn import -m "Import from OC" "Readme" "" + check_svn_return_value + popd + pushd "fbas_encoder" + svn import -m "Import from OC" "chroma_gen.png" "" + check_svn_return_value + svn import -m "Import from OC" "connect.png" "" + check_svn_return_value + svn import -m "Import from OC" "fbas_encoder-0.21.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "fbas-encoder_0.31.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "fbas-enc_scrs1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "luma_gen.png" "" + check_svn_return_value + svn import -m "Import from OC" "main.png" "" + check_svn_return_value + popd + pushd "fcpu" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "ffr16" + svn import -m "Import from OC" "FFR16.jpg" "" + check_svn_return_value + popd + pushd "fft_32" + popd + pushd "fftprocessor" + popd + pushd "fht" + svn import -m "Import from OC" "fht_tb.v" "" + check_svn_return_value + svn import -m "Import from OC" "fht.v" "" + check_svn_return_value + popd + pushd "fifouart" + svn import -m "Import from OC" "UART_datasheet.pdf" "" + check_svn_return_value + popd + pushd "filter" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "firewire" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "fir_filter_generator" + svn import -m "Import from OC" "design-of-high-speed.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "flha" + popd + pushd "floatingcore" + popd + pushd "floating_point_adder_subtractor" + svn import -m "Import from OC" "addsub.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "normalize.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "shift.vhd" "" + check_svn_return_value + popd + pushd "floppyif" + popd + pushd "fmtransmitter" + popd + pushd "fpga" + svn import -m "Import from OC" "docs.jar" "" + check_svn_return_value + svn import -m "Import from OC" "examples.jar" "" + check_svn_return_value + svn import -m "Import from OC" "Fpga.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "fpga_sw.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "gpl.txt" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "KRPAN.jar" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "opencores.cer" "" + check_svn_return_value + svn import -m "Import from OC" "pwm12_8s.v" "" + check_svn_return_value + svn import -m "Import from OC" "sources.jar" "" + check_svn_return_value + svn import -m "Import from OC" "sshot1.gif" "" + check_svn_return_value + popd + pushd "fpgabsp" + popd + pushd "fpgaconfig" + svn import -m "Import from OC" "altera_config.png" "" + check_svn_return_value + svn import -m "Import from OC" "fpgaConfig_system_block_diag.gif" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "fpgaproto" + popd + pushd "fpipelines" + popd + pushd "fpu" + svn import -m "Import from OC" "DEADJOE" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "fpu100" + svn import -m "Import from OC" "bug_report_260407.txt" "" + check_svn_return_value + svn import -m "Import from OC" "fpu_doc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "fpu32bit" + popd + pushd "fpuvhdl" + popd + pushd "freetools" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "froop" + popd + pushd "fsl2serial" + popd + pushd "gamepads" + svn import -m "Import from OC" "gcpad.png" "" + check_svn_return_value + svn import -m "Import from OC" "snespad.png" "" + check_svn_return_value + svn import -m "Import from OC" "snespad_wire.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_gcpad.png" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_snespad.png" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_snespad_wire.jpg" "" + check_svn_return_value + popd + pushd "gcpu" + popd + pushd "generic_fifos" + popd + pushd "generic_fifovhd" + popd + pushd "gh_vhdl_library" + svn import -m "Import from OC" "gh_vhdl_lib_3_34.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "gh_vhdl_lib_3_35.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "gh_vhdl_lib_3_36.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "gig_ethernet_mac_core" + popd + pushd "gix96" + popd + pushd "gpio" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "graphicallcd" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "graphiti" + svn import -m "Import from OC" "blockschaltbild.png" "" + check_svn_return_value + svn import -m "Import from OC" "flowers.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "graphitib.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "graphiti.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "testbild.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "tflowers.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_flowers.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_graphitib.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_graphiti.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_testbild.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_tflowers.jpg" "" + check_svn_return_value + popd + pushd "gsc" + svn import -m "Import from OC" "btyacc.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "graphviz-2.8.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "gsc-0.1.1.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "gsc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "keystone.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "treecc-0.3.8.tar.gz" "" + check_svn_return_value + popd + pushd "gup" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "gup_logo_thumb.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_gup_logo_thumb.jpg" "" + check_svn_return_value + popd + pushd "gzip" + popd + pushd "hamming" + popd + pushd "hamming_gen" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "hangyu" + popd + pushd "hasm" + popd + pushd "hdb3" + popd + pushd "hdbn" + popd + pushd "hdlc" + svn import -m "Import from OC" "HDLC_cont.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "hdlc_fifo.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "hdlc_project.html" "" + check_svn_return_value + svn import -m "Import from OC" "hdlc_project.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "HDLC_top.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "help" + svn import -m "Import from OC" "exp1pf.gif" "" + check_svn_return_value + svn import -m "Import from OC" "search.shtml" "" + check_svn_return_value + popd + pushd "hicovec" + popd + pushd "hierarch_unit" + popd + pushd "hmta" + popd + pushd "houmway" + popd + pushd "hpc-16" + popd + pushd "hpcmemory" + popd + pushd "hssdrc" + popd + pushd "ht_tunnel" + popd + pushd "hwlu" + popd + pushd "i2c" + svn import -m "Import from OC" "Block.gif" "" + check_svn_return_value + svn import -m "Import from OC" "i2c_rev03.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "index_orig.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "i2clog" + svn import -m "Import from OC" "Documentation" "" + check_svn_return_value + svn import -m "Import from OC" "front" "" + check_svn_return_value + svn import -m "Import from OC" "I2C_TrafficLogger.v" "" + check_svn_return_value + popd + pushd "i2c_master_slave_core" + popd + pushd "i2c_slave" + svn import -m "Import from OC" "iic_slave_3.v" "" + check_svn_return_value + popd + pushd "i2c_vhdl" + popd + pushd "i2s" + svn import -m "Import from OC" "dff.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "ebu_2_i2s.vhd" "" + check_svn_return_value + popd + pushd "i2s_interface" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "i2sparalell" + popd + pushd "ic6821" + svn import -m "Import from OC" "VHDL6821.vhd" "" + check_svn_return_value + popd + pushd "icu" + popd + pushd "ide" + popd + pushd "idea" + svn import -m "Import from OC" "block_opmode.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "control.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "IDEA core block.GIF" " core block.GIF" + check_svn_return_value + svn import -m "Import from OC" "idea_machine.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "IDEA mechine block.GIF" " mechine block.GIF" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "keys_generate.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "Paper_IES2001_sby.PDF" "" + check_svn_return_value + svn import -m "Import from OC" "port_inout.tar.gz" "" + check_svn_return_value + popd + pushd "iiepci" + svn import -m "Import from OC" "iie_pci_back.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "iie_pci_diagram.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "iie_pci_front.jpg" "" + check_svn_return_value + popd + pushd "ima-adpcm" + popd + pushd "interface_vga80x40" + svn import -m "Import from OC" "FPGA_VGA_Electrical_Interface.png" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "VGA80x40_documentation.pdf" "" + check_svn_return_value + popd + pushd "ipchip" + popd + pushd "irda" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "iso7816-3" + svn import -m "Import from OC" "iso7816-3.tgz" "" + check_svn_return_value + popd + pushd "isp" + popd + pushd "jop" + popd + pushd "jpeg" + svn import -m "Import from OC" "DiagramaCompJPGen.png" "" + check_svn_return_value + svn import -m "Import from OC" "floresconsubsamp211.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "floressinsubsamp.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "imagenfrutasQ05PSP.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "imagenfrutasQ15.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "imagenfrutasQ31.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "imagenfrutasQ50.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "imagenglobosPSPQ15.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "imagenglobosQ15.jpg" "" + check_svn_return_value + popd + pushd "jpegcompression" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "jtag" + svn import -m "Import from OC" "Boundary-Scan Architecture.pdf" " Architecture.pdf" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "k68" + popd + pushd "k7_viterbi_decoder" + popd + pushd "kad" + popd + pushd "kcpsm3_interrupt_handling" + popd + pushd "keyboardcontroller" + popd + pushd "keypad_scanner" + svn import -m "Import from OC" "keypad_scanner.v" "" + check_svn_return_value + popd + pushd "kiss-board" + popd + pushd "ksystem" + popd + pushd "l8051" + svn import -m "Import from OC" "L8051.tar" "" + check_svn_return_value + popd + pushd "lcd" + svn import -m "Import from OC" "alliance.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "counterc.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "counter.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "counterv.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "decoderc.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "decoderv.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "dffresc.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "dffresv.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "dflipflop.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml.old" "" + check_svn_return_value + svn import -m "Import from OC" "LCD.ht1.gif" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "mcc.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "mcv.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "ramc.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "ramv.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "struct.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "test.shtml" "" + check_svn_return_value + popd + pushd "lcd1" + popd + pushd "lcd_controller" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "CM920TUserGuide.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "ColorTFT-LCDController.ppt" "" + check_svn_return_value + svn import -m "Import from OC" "DUI0146C_LM600.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "tx18d16vm1caa.pdf" "" + check_svn_return_value + popd + pushd "ldpc_decoder_802_3an" + svn import -m "Import from OC" "ldpc_decoder_802_3an.tar.gz" "" + check_svn_return_value + popd + pushd "ldpc_encoder_802_3an" + svn import -m "Import from OC" "ldpc_encoder_802_3an.v.gz" "" + check_svn_return_value + popd + pushd "lem1_9min" + svn import -m "Import from OC" "d3_lem1_9min_hw.ucf" "" + check_svn_return_value + svn import -m "Import from OC" "Form1.cs" "" + check_svn_return_value + svn import -m "Import from OC" "lem1_9min_asm.csproj" "" + check_svn_return_value + svn import -m "Import from OC" "lem1_9min_defs.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "lem1_9min_hw.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "lem1_9min.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "trinity_talk_041205.pdf" "" + check_svn_return_value + popd + pushd "light8080" + popd + pushd "lin-a" + popd + pushd "line_codes" + popd + pushd "linuxvcap" + popd + pushd "llc1394" + popd + pushd "log_anal" + popd + pushd "lowpowerfir" + svn import -m "Import from OC" "FIRLowPowerConsiderations.doc" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "lpc" + popd + pushd "lpu" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "Mem Driven Processor.doc" " Driven Processor.doc" + check_svn_return_value + popd + pushd "lq057q3dc02" + popd + pushd "lwmips" + popd + pushd "lwrisc" + svn import -m "Import from OC" "200735153855.bmp" "" + check_svn_return_value + svn import -m "Import from OC" "200735153855.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "clairisc.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_200735153855.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_clairisc.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_we.GIF" "" + check_svn_return_value + svn import -m "Import from OC" "we.GIF" "" + check_svn_return_value + popd + pushd "m1_core" + popd + pushd "mac" + popd + pushd "macroblock_motion_detection" + popd + pushd "maf" + popd + pushd "mafa-pc-board" + popd + pushd "man2uart" + svn import -m "Import from OC" "Man2uartopencores.txt" "" + check_svn_return_value + popd + pushd "manchesterencoderdecoder" + svn import -m "Import from OC" "ME2.vhd" "" + check_svn_return_value + popd + pushd "marca" + popd + pushd "matrix3x3" + popd + pushd "maxii-evalboard" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_a.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_b.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_BOM.xls" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_Gerber&" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_PCB-Errata.txt" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_PCB.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_Placement.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "MAXII-Evalboard_V1.0_Schem.pdf" "" + check_svn_return_value + popd + pushd "mb-jpeg" + svn import -m "Import from OC" "mb-jpeg_STEP2_1b.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "mb-jpeg_STEP2_2b.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "mb-jpeg_STEP7_2.tar.bz2" "" + check_svn_return_value + popd + pushd "mcbsp" + popd + pushd "mcpu" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "mcpu-doc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "mcpu.pdf" "" + check_svn_return_value + popd + pushd "mcu8" + popd + pushd "md5" + popd + pushd "mdct" + svn import -m "Import from OC" "block_diagram.jpg" "" + check_svn_return_value + popd + pushd "membist" + popd + pushd "mem_ctrl" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "memorycontroller" + popd + pushd "memory_cores" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "memory_sizer" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "documentation.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "download.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "memory_sizer_dual_path.v" "" + check_svn_return_value + svn import -m "Import from OC" "memory_sizer.v" "" + check_svn_return_value + svn import -m "Import from OC" "people.shtml" "" + check_svn_return_value + popd + pushd "mfpga" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "mfpga_block.gif" "" + check_svn_return_value + svn import -m "Import from OC" "mfpga_block_new.gif" "" + check_svn_return_value + svn import -m "Import from OC" "micro_orcad.sch" "" + check_svn_return_value + svn import -m "Import from OC" "micro_protelbinary.lib" "" + check_svn_return_value + svn import -m "Import from OC" "micro_protelbinary.sch" "" + check_svn_return_value + svn import -m "Import from OC" "micro_sch.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "xcv50.jpg" "" + check_svn_return_value + popd + pushd "micore" + popd + pushd "microprocessor" + popd + pushd "milsa" + popd + pushd "milstd1553bbusprotocol" + popd + pushd "mini-acex1k" + popd + pushd "mini_aes" + popd + pushd "minimips" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "minirisc" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "mips789" + svn import -m "Import from OC" "cal_PI_2.GIF" "" + check_svn_return_value + svn import -m "Import from OC" "MIPS789.bmp" "" + check_svn_return_value + svn import -m "Import from OC" "pi_2200.GIF" "" + check_svn_return_value + svn import -m "Import from OC" "topview.GIF" "" + check_svn_return_value + popd + pushd "mipss" + svn import -m "Import from OC" "s70_32bit_to_9bit.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_ALU.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_ctrl_unit.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_data_mem_comp.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_data_mem.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_datapath.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_Ext_S_Z.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "s70_inc.vhd" "" + check_svn_return_value + popd + pushd "mmcfpgaconfig" + popd + pushd "moonshadow" + popd + pushd "most" + svn import -m "Import from OC" "MOST_Core_Compliance_Test_Specification.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "MOSTSpecification.pdf" "" + check_svn_return_value + popd + pushd "most_core" + popd + pushd "motion_controller" + popd + pushd "motionestimator" + popd + pushd "motor" + popd + pushd "mp3decoder" + popd + pushd "mpdma" + svn import -m "Import from OC" "BlazeCluster_v0.14.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "BlazeCluster_v0.15.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "mpdma20061020.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "mpdma20061023b.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "mpdma20061023c.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "mpdma20061023.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "SoftwareMultiprocessoronFPGA20070608.pdf" "" + check_svn_return_value + popd + pushd "mpeg2decoder" + popd + pushd "mpeg4_video_coding" + popd + pushd "mpegencoderdecoder" + popd + pushd "mup" + popd + pushd "ncore" + svn import -m "Import from OC" "CASM.C" "" + check_svn_return_value + svn import -m "Import from OC" "NCORE2.V" "" + check_svn_return_value + svn import -m "Import from OC" "NCORE3.V" "" + check_svn_return_value + svn import -m "Import from OC" "nCore_doc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "NCORE.tar.bz2" "" + check_svn_return_value + svn import -m "Import from OC" "nCore.v" "" + check_svn_return_value + svn import -m "Import from OC" "SIM.C" "" + check_svn_return_value + popd + pushd "nemo_emotion" + popd + pushd "neot" + popd + pushd "neptune-core" + svn import -m "Import from OC" "triton-block.png" "" + check_svn_return_value + popd + pushd "nnARM" + svn import -m "Import from OC" "Arch118.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "Architecture111.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "Architecture111.pdf.old" "" + check_svn_return_value + svn import -m "Import from OC" "Architecture_jc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "BS.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "default.htm" "" + check_svn_return_value + svn import -m "Import from OC" "Documentation.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "Download.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "GT.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index1.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml1" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml.old" "" + check_svn_return_value + svn import -m "Import from OC" "Introduction.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "News.htm" "" + check_svn_return_value + svn import -m "Import from OC" "News.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "nnARM.prog" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "People.htm" "" + check_svn_return_value + svn import -m "Import from OC" "People.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "PR.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "put.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "tag3.bmp" "" + check_svn_return_value + svn import -m "Import from OC" "Testbench" "" + check_svn_return_value + svn import -m "Import from OC" "topFrame.htm" "" + check_svn_return_value + svn import -m "Import from OC" "wishlogo.jpg" "" + check_svn_return_value + popd + pushd "nocem" + popd + pushd "noise_reduction" + popd + pushd "nonrestoringsquareroot" + popd + pushd "nova" + popd + pushd "npigrctrl" + svn import -m "Import from OC" "demo.png" "" + check_svn_return_value + svn import -m "Import from OC" "mpmc4.rar" "" + check_svn_return_value + svn import -m "Import from OC" "npi_eng.vhd" "" + check_svn_return_value + popd + pushd "oab1" + svn import -m "Import from OC" "index.htm" "" + check_svn_return_value + svn import -m "Import from OC" "title_logo.gif" "" + check_svn_return_value + svn import -m "Import from OC" "ver01.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "ver02.jpg" "" + check_svn_return_value + popd + pushd "oberon" + popd + pushd "ocmips" + svn import -m "Import from OC" "fpga.gif" "" + check_svn_return_value + svn import -m "Import from OC" "opencores.gif" "" + check_svn_return_value + svn import -m "Import from OC" "sim.GIF" "" + check_svn_return_value + popd + pushd "ocp_wb_wrapper" + popd + pushd "ocrp-1" + svn import -m "Import from OC" "block.gif" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "ocrp-1_bill_of_materials.txt" "" + check_svn_return_value + svn import -m "Import from OC" "ocrp-1_gerber.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "ocrp1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "ocrp1ord.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "ocrp-1_sch.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "PCB1-72dpi.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "PCB2-72dpi.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pic1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pic2.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pic3.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pic4.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pic7.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "xc95288xl_tq144.bsd" "" + check_svn_return_value + svn import -m "Import from OC" "xcv100_tq144.bsd" "" + check_svn_return_value + svn import -m "Import from OC" "xcv50_tq144.bsd" "" + check_svn_return_value + popd + pushd "ofdm" + popd + pushd "ofdm-baseband-receiver" + popd + pushd "ofdm_modulator" + popd + pushd "oks8" + popd + pushd "omega" + popd + pushd "opb_i2c" + popd + pushd "opb_isa" + popd + pushd "opb_onewire" + popd + pushd "opb_ps2_keyboard_controller" + popd + pushd "opb_psram_controller" + popd + pushd "opb_udp_transceiver" + popd + pushd "opb_vga_char_display_nodac" + popd + pushd "opb_wb_wrapper" + popd + pushd "open_1394_intellectual_property" + popd + pushd "open8_urisc" + popd + pushd "openarm" + popd + pushd "opencores" + svn import -m "Import from OC" "27dec03_IrishTimes.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "bottom.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "dr_logo_b.gif" "" + check_svn_return_value + svn import -m "Import from OC" "logos" "" + check_svn_return_value + svn import -m "Import from OC" "mdl_logo.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "ORSoC_logo.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "press" "" + check_svn_return_value + svn import -m "Import from OC" "regionalbreakdown.png" "" + check_svn_return_value + svn import -m "Import from OC" "siteranking.png" "" + check_svn_return_value + svn import -m "Import from OC" "sponsors" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_dr_logo_b.gif" "" + check_svn_return_value + svn import -m "Import from OC" "Ultimodule_Logo_Blue.JPG" "" + check_svn_return_value + popd + pushd "opencpu678085" + popd + pushd "openfire" + popd + pushd "openfire2" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "targetselection.itb" "" + check_svn_return_value + popd + pushd "openfire_core" + popd + pushd "openh263" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "openriscdevboard" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "open_tcpip" + popd + pushd "opentech" + svn import -m "Import from OC" "changes_1_4_0.txt" "" + check_svn_return_value + svn import -m "Import from OC" "changes_1_4_1.txt" "" + check_svn_return_value + svn import -m "Import from OC" "changes_1_5_0.txt" "" + check_svn_return_value + svn import -m "Import from OC" "changes_1_5_1.txt" "" + check_svn_return_value + svn import -m "Import from OC" "changes_1_6_0.txt" "" + check_svn_return_value + svn import -m "Import from OC" "changes_1_6_1.txt" "" + check_svn_return_value + svn import -m "Import from OC" "contents_1_4_0.txt" "" + check_svn_return_value + svn import -m "Import from OC" "contents_1_4_1.txt" "" + check_svn_return_value + svn import -m "Import from OC" "contents_1_5_0.txt" "" + check_svn_return_value + svn import -m "Import from OC" "contents_1_5_1.txt" "" + check_svn_return_value + svn import -m "Import from OC" "contents_1_6_0.txt" "" + check_svn_return_value + svn import -m "Import from OC" "contents_1_6_1.txt" "" + check_svn_return_value + svn import -m "Import from OC" "content.txt" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "icon.gif" "" + check_svn_return_value + svn import -m "Import from OC" "icon.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "icon.png" "" + check_svn_return_value + svn import -m "Import from OC" "logo_full.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "OpenTech_Info.xls" "" + check_svn_return_value + svn import -m "Import from OC" "OpenTechnologies_small.gif" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "openverifla" + svn import -m "Import from OC" "verifla_keyboard_protocol_verification_50procent.jpg" "" + check_svn_return_value + popd + pushd "or1200gct" + popd + pushd "or1k-cf" + popd + pushd "or1k-new" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "ovcodec" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "pap" + popd + pushd "pavr" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "todo.html" "" + check_svn_return_value + popd + pushd "pci" + svn import -m "Import from OC" "charact.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "contacts.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "current_stat.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "documentation.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "download.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "links.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "PCI_HOST_architecture.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pci_parity.html" "" + check_svn_return_value + svn import -m "Import from OC" "pci_prototype.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "PCIsim.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "pci_snapshots.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "PCI_VGA_conn.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "PCI_VGA_cristal.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "PCI_VGA_sch.gif" "" + check_svn_return_value + svn import -m "Import from OC" "PCI_VGA_sch.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "PCI_VGA_test_brd.gif" "" + check_svn_return_value + svn import -m "Import from OC" "pcixwin.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Pic00022.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Pic00026.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Pic00027.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Pic00028.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Pic00037.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "pics" "" + check_svn_return_value + svn import -m "Import from OC" "references.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "test_app.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "testbench.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "test_board.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "test_driver.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "test_snapshots.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_pcixwin.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_Pic00022.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_Pic00026.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_Pic00027.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_Pic00028.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_Pic00037.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "todo_list.shtml" "" + check_svn_return_value + popd + pushd "pci32tlite_oc" + popd + pushd "pci-board" + svn import -m "Import from OC" "PCI-Board.jpeg" "" + check_svn_return_value + svn import -m "Import from OC" "PCI-Board.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "PCI-CARD-SCH-v1.0.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "PCI-Card-v1.0.pdf" "" + check_svn_return_value + popd + pushd "pci_controller" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "pcie_vera_tb" + popd + pushd "pci_express" + popd + pushd "pci_express_crc" + popd + pushd "pci_ide_controller" + popd + pushd "pci_mini" + svn import -m "Import from OC" "PCI_Mini_IP_core_Datasheet2.0_oc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "pcix" + popd + pushd "pcmcia" + popd + pushd "performance_counter" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "perlilog" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "old-index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "Perlilog-0.2.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "Perlilog-0.3.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "perlilog-guide-0.2.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "perlilog-guide-0.3.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "perlilog-guide.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "perlilog.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "phoenix_controller" + popd + pushd "pic8259" + popd + pushd "picoblaze_interrupt_controller" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "pif2wb" + popd + pushd "pipelined_aes" + popd + pushd "pipelined_dct" + popd + pushd "piranha" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "power_inverter" + popd + pushd "ppcnorthbridge" + popd + pushd "ppx16" + popd + pushd "product_code_iterative_decoder" + popd + pushd "profibus_dp" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "programmabledct" + popd + pushd "project" + svn import -m "Import from OC" "datapath.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "Informations.doc" "" + check_svn_return_value + svn import -m "Import from OC" "memories_core_jenerator_implementations.rar" "" + check_svn_return_value + svn import -m "Import from OC" "Readme-Instructions.doc" "" + check_svn_return_value + svn import -m "Import from OC" "RegFile_SystemC_implementation.rar" "" + check_svn_return_value + svn import -m "Import from OC" "systemC_Implementation.rar" "" + check_svn_return_value + svn import -m "Import from OC" "Xilinx_project_from_files_from_SystemC_implementation.rar" "" + check_svn_return_value + popd + pushd "ps2" + svn import -m "Import from OC" "documentation.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "download.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "people.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "ps2_keyboard.v" "" + check_svn_return_value + svn import -m "Import from OC" "ps2_mouse.v" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "ps2core" + popd + pushd "ptc" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "ptc_spec.pdf" "" + check_svn_return_value + popd + pushd "pyramid_unit" + popd + pushd "quadraturecount" + popd + pushd "r2000" + popd + pushd "radixrsa" + svn import -m "Import from OC" "core.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "doc.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "dotty.gif" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "montgo.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "RSAAlgorithm.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "title_logo.gif" "" + check_svn_return_value + popd + pushd "raggedstone" + svn import -m "Import from OC" "README" "" + check_svn_return_value + popd + pushd "rc5-72" + popd + pushd "rc5_decoder" + popd + pushd "rfid" + svn import -m "Import from OC" "7Prog.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "TheMultiTagTesterFinal.exe" "" + check_svn_return_value + popd + pushd "rijndael" + svn import -m "Import from OC" "dekrip_files" "" + check_svn_return_value + svn import -m "Import from OC" "dekrip.htm" "" + check_svn_return_value + svn import -m "Import from OC" "enkrip_files" "" + check_svn_return_value + svn import -m "Import from OC" "enkrip.htm" "" + check_svn_return_value + svn import -m "Import from OC" "enkrip.pdf" "" + check_svn_return_value + popd + pushd "risc16f84" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "documentation.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "download.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "people.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "risc16f84_clk2x.v" "" + check_svn_return_value + svn import -m "Import from OC" "risc16f84_lite.v" "" + check_svn_return_value + svn import -m "Import from OC" "risc16f84_small.v" "" + check_svn_return_value + svn import -m "Import from OC" "risc16f84.v" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "risc36" + popd + pushd "risc5x" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "risc_core_i" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "RISCCore.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "Zusammenfassung.pdf" "" + check_svn_return_value + popd + pushd "riscmcu" + svn import -m "Import from OC" "BlockDiagram.gif" "" + check_svn_return_value + popd + pushd "risc_processor_with_os" + popd + pushd "rise" + popd + pushd "rng_lib" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "robot_control_library" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "rosetta" + popd + pushd "rs232_syscon" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "documentation.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "download.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "Image4.gif" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "people.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "rs232_syscon1.doc" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "rs232_syscon.htm" "" + check_svn_return_value + svn import -m "Import from OC" "rs232_syscon.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "rs_5_3_gf256" + svn import -m "Import from OC" "ReedSolomon(5,3)Codec.ppt" ",3)Codec.ppt" + check_svn_return_value + popd + pushd "rsa" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "rsa" "" + check_svn_return_value + svn import -m "Import from OC" "RSA.htm" "" + check_svn_return_value + svn import -m "Import from OC" "RSA.shtml" "" + check_svn_return_value + popd + pushd "rs_decoder_31_19_6" + popd + pushd "rsencoder" + svn import -m "Import from OC" "readme.txt" "" + check_svn_return_value + svn import -m "Import from OC" "reed_solomon.v" "" + check_svn_return_value + svn import -m "Import from OC" "rs_testbench.v" "" + check_svn_return_value + popd + pushd "s1_core" + popd + pushd "sardmips" + popd + pushd "sasc" + popd + pushd "sata1a" + popd + pushd "sayeh_processor" + popd + pushd "sbd_sqrt_fp" + popd + pushd "sc2v" + popd + pushd "scarm" + svn import -m "Import from OC" "arm1.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "chinese" "" + check_svn_return_value + svn import -m "Import from OC" "english" "" + check_svn_return_value + svn import -m "Import from OC" "images" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "main.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "test" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "scsi_interface" + popd + pushd "sdram" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml2" "" + check_svn_return_value + svn import -m "Import from OC" "intefacing block diagram.gif" " block diagram.gif" + check_svn_return_value + svn import -m "Import from OC" "interfacing_block_diagram.gif" "" + check_svn_return_value + svn import -m "Import from OC" "sdram_doc.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "sdram.html" "" + check_svn_return_value + svn import -m "Import from OC" "sdram_ip_doc_preliminary.pdf" "" + check_svn_return_value + popd + pushd "sdram_ctrl" + popd + pushd "sdr_sdram_ctrl" + popd + pushd "serial_div_uu" + svn import -m "Import from OC" "pwm_reader.v" "" + check_svn_return_value + svn import -m "Import from OC" "serial_divide_uu.v" "" + check_svn_return_value + popd + pushd "serpent_core" + popd + pushd "sfpga" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "OCRP-2_sch_preliminary.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "sfpga_block.gif" "" + check_svn_return_value + popd + pushd "sha1" + svn import -m "Import from OC" "sha1_readme_v01.txt" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "sha_core" + popd + pushd "simpcon" + popd + pushd "simplearm" + popd + pushd "simple-cpu" + popd + pushd "simple_fm_receiver" + popd + pushd "simple_gpio" + popd + pushd "simple_pic" + popd + pushd "simple_spi" + popd + pushd "simple_uart" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "single_clock_divider" + popd + pushd "single_port" + svn import -m "Import from OC" "single_port.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "slave_vme_bridge" + popd + pushd "smallarm" + popd + pushd "smbus_if" + svn import -m "Import from OC" "smbus_if.doc" "" + check_svn_return_value + popd + pushd "socbuilder" + popd + pushd "soft_core_risc_microprocessor_design_enabling_the_port_of_an_os" + popd + pushd "sonet" + svn import -m "Import from OC" "blockdia.doc" "" + check_svn_return_value + svn import -m "Import from OC" "overview.doc" "" + check_svn_return_value + popd + pushd "spacewire" + svn import -m "Import from OC" "Router.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "SpWinterfacewithCODEC.JPG" "" + check_svn_return_value + popd + pushd "spacewire_if" + popd + pushd "spates" + popd + pushd "spdif_interface" + popd + pushd "spi" + popd + pushd "spi_boot" + popd + pushd "spicc" + popd + pushd "spiflashcontroller" + popd + pushd "spimaster" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "spi_slave" + popd + pushd "spi-slave" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "srl_fifo" + popd + pushd "srtdivision" + popd + pushd "ss_pcm" + popd + pushd "ssram" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "steppermotordrive" + popd + pushd "sts1" + svn import -m "Import from OC" "spe.vhd" "" + check_svn_return_value + popd + pushd "svmac" + popd + pushd "sxp" + svn import -m "Import from OC" "sxp_block.gif" "" + check_svn_return_value + popd + pushd "system05" + popd + pushd "system09" + svn import -m "Import from OC" "index.html" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "xbasic.s19" "" + check_svn_return_value + popd + pushd "system11" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "system68" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "system6801" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "systemcaes" + popd + pushd "systemc_cordic" + popd + pushd "systemcdes" + popd + pushd "systemcmd5" + popd + pushd "systemc_rng" + popd + pushd "t400" + popd + pushd "t48" + popd + pushd "t51" + popd + pushd "t65" + popd + pushd "t80" + popd + pushd "t8000" + popd + pushd "tdm" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_core.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_ISDN_top.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_project.html" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_project.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_top.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "tdm_switch" + svn import -m "Import from OC" "map.dat" "" + check_svn_return_value + svn import -m "Import from OC" "ModelSim_Edition.exe" "" + check_svn_return_value + svn import -m "Import from OC" "stream_0.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_1.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_2.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_3.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_4.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_5.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_6.dat" "" + check_svn_return_value + svn import -m "Import from OC" "stream_7.dat" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_switch_b.v" "" + check_svn_return_value + svn import -m "Import from OC" "TDM_Switch_DS.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_switch_top_timesim.sdf" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_switch_top_timesim.v" "" + check_svn_return_value + svn import -m "Import from OC" "tdm_switch_top.v" "" + check_svn_return_value + svn import -m "Import from OC" "testbench_top.v" "" + check_svn_return_value + popd + pushd "template" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "test" + svn import -m "Import from OC" "apple.gif" "" + check_svn_return_value + svn import -m "Import from OC" "FLEX_w_CMYK_R_LG.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "include1.ssi" "" + check_svn_return_value + svn import -m "Import from OC" "include2.ssi" "" + check_svn_return_value + popd + pushd "test1" + svn import -m "Import from OC" "arrow_ltr.gif" "" + check_svn_return_value + svn import -m "Import from OC" "sed_awk.pdf" "" + check_svn_return_value + popd + pushd "test2" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "test3" + popd + pushd "test_project" + popd + pushd "test-project" + svn import -m "Import from OC" "vl.bmp" "" + check_svn_return_value + popd + pushd "tg68" + popd + pushd "tiny64" + popd + pushd "tiny8" + popd + pushd "tlc2" + popd + pushd "toe" + popd + pushd "tone_generator" + popd + pushd "totalcpu" + popd + pushd "trinitor" + popd + pushd "truescalar" + popd + pushd "ts7300_opencore" + svn import -m "Import from OC" "7300stclwp.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "turbocodes" + svn import -m "Import from OC" "turbo.tar.gz" "" + check_svn_return_value + popd + pushd "tv80" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "twofish" + popd + pushd "twofish_team" + svn import -m "Import from OC" "ciphertext.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "cleartext.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "key-mod.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "modifiedF.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "peracangan" "" + check_svn_return_value + svn import -m "Import from OC" "qper.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "s-boxes.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "twofish.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "ualpha" + popd + pushd "uart16550" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "uart8bit" + popd + pushd "uart_fifo" + popd + pushd "uart_serial" + popd + pushd "ucore" + svn import -m "Import from OC" "ucsys-0.0.1.rar" "" + check_svn_return_value + popd + pushd "ultimate_crc" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "ultramegasquirt" + popd + pushd "ultravec" + popd + pushd "upcable" + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "OneDollarDongle.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "usb11" + popd + pushd "usb1_funct" + popd + pushd "usb_dongle_fpga" + svn import -m "Import from OC" "block_diagram.png" "" + check_svn_return_value + svn import -m "Import from OC" "dongle_block.png" "" + check_svn_return_value + svn import -m "Import from OC" "mini_LR_DSC_0016.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "small_LR_DSC_0016.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "usb_dongle.jpg" "" + check_svn_return_value + popd + pushd "usbhost" + svn import -m "Import from OC" "alliance.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "HDL" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh10.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh11.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh12.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh13.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh14.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh15.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh16.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh17.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh18.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh19.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh20.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh21.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.sh22.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "HDL.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.1.gif" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "README" "" + check_svn_return_value + popd + pushd "usbhostslave" + svn import -m "Import from OC" "ALDEC_logo.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "usb_phy" + popd + pushd "usucc" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "utop_lvl_1" + popd + pushd "verilator" + popd + pushd "vgafb" + popd + pushd "vga_lcd" + svn import -m "Import from OC" "block_diagram.gif" "" + check_svn_return_value + svn import -m "Import from OC" "block_diagram.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "vga_core.pdf" "" + check_svn_return_value + popd + pushd "vhcg" + svn import -m "Import from OC" "morpheus1.1release.rar" "" + check_svn_return_value + svn import -m "Import from OC" "morpheus.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "Specification.pdf" "" + check_svn_return_value + popd + pushd "vhdl_cpu_emulator" + svn import -m "Import from OC" "vhdl_cpu_emulator_Beta.7z" "" + check_svn_return_value + popd + pushd "vhdlmd5" + popd + pushd "vhld_tb" + popd + pushd "video_starter_kit" + svn import -m "Import from OC" "main_designoverview0.0.2.pdf" "" + check_svn_return_value + popd + pushd "vip_regs" + popd + pushd "viterbi_decoder" + popd + pushd "viterbi_decoder_k_7_r_1_2" + popd + pushd "vmebus" + popd + pushd "vmm" + popd + pushd "warp" + popd + pushd "wb2hpi" + svn import -m "Import from OC" "BlockTransfer1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "BlockTransfer2.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "DspFill1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "DspMemory1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "DspMemory2.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "DSPMove1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "Registers.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "SistemMemoryFill1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "SistemMemoryMove1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "SystemMemory1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "TestBench051.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "wb2hpi_hw2.jpg" "" + check_svn_return_value + popd + pushd "wb2npi" + popd + pushd "wb_builder" + svn import -m "Import from OC" "users_manual.pdf" "" + check_svn_return_value + popd + pushd "wb_conbus" + popd + pushd "wb_conmax" + svn import -m "Import from OC" "conmax.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "wbc_parallel_master" + svn import -m "Import from OC" "wbc_parallel_master-spec_doc-r01.pdf" "" + check_svn_return_value + popd + pushd "wb_ddr" + popd + pushd "wb_dma" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + popd + pushd "wb_flash" + popd + pushd "wbif_68k" + popd + pushd "wb_lpc" + popd + pushd "wb_mcs51" + popd + pushd "wb_rtc" + svn import -m "Import from OC" "ports.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "structure.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "wb_tk" + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_arbiter.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_async_master.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_async_slave.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_bus_resizer.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_extensions.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_out_reg.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_ram.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "wb_test.shtml" "" + check_svn_return_value + popd + pushd "wb_vga" + svn import -m "Import from OC" "accel.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "index.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "mouse.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "palette.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "vga_chip.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "vga_core.shtml" "" + check_svn_return_value + svn import -m "Import from OC" "vga_core_v2.shtml" "" + check_svn_return_value + popd + pushd "wb_z80" + popd + pushd "wb_zbt" + popd + pushd "wisbone_2_ahb" + popd + pushd "wishbone" + svn import -m "Import from OC" "appnote_01.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "flex.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "press_release_12_08_2002.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "soc_bus_comparison.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "wbspec_b1.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "wbspec_b2.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "wbspec_b3.pdf" "" + check_svn_return_value + popd + pushd "wishbone2ahb" + popd + pushd "wishbone_bfm" + popd + pushd "wishbone_checker" + popd + pushd "wishbone_out_port" + popd + pushd "wishbone_to_ahb" + popd + pushd "wlanmac" + popd + pushd "wlan_modem" + popd + pushd "wpf" + popd + pushd "x25_protocol_interface_project" + popd + pushd "x86soc" + popd + pushd "xge_mac" + popd + pushd "xmatchpro" + svn import -m "Import from OC" "" "" + check_svn_return_value + popd + pushd "xtea" + popd + pushd "yacc" + popd + pushd "yellowstar" + svn import -m "Import from OC" "appendix.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "processor.v" "" + check_svn_return_value + svn import -m "Import from OC" "report.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "yellowstar_schematics.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "yellowstar_symbols.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "yellow_star.tar.gz" "" + check_svn_return_value + svn import -m "Import from OC" "ys_logo.jpg" "" + check_svn_return_value + popd + pushd "yoda" + svn import -m "Import from OC" "*" "*" + check_svn_return_value + popd + pushd "z80soc" + svn import -m "Import from OC" "mP5170003.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "mP5180007.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_mP5170003.JPG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_mP5180007.JPG" "" + check_svn_return_value + popd + pushd "zpu" + svn import -m "Import from OC" "compile.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "simulator2.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "simulator3.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "simulator.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_compile.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_simulator2.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_simulator3.PNG" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_simulator.PNG" "" + check_svn_return_value + popd + ALL_DONE="1" + echo "All checkins done" +done
hdlc/web_uploads/ Property changes : Added: svn:executable ## -0,0 +1 ## +* \ No newline at end of property Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (nonexistent) +++ hdlc/web_uploads/ (revision 18) @@ -0,0 +1,112 @@ +#!/bin/bash + +echo "#!/bin/bash" +echo "# AUTOMATICALLY GENERATED SCRIPT" +echo "# Scans the cores directory, excludes the projects and subdirectories" +echo "# listed below, and generates a script which checks in all of the " +echo "# remaining files to the SVN repository" +echo "# This should be run and the output piped to a new file something like:" +echo "# ./ >" +echo "# and then probably the execute permission enabled on" + +DO_CHECKIN="1" +DIRECTORY_HAS_CONTENTS="1" + +echo "# Encapsulate the checkins inside this loop we can " +echo "# break out of in the event of a problem checking" +echo "# one of them in" +echo "" +echo "# Function to check the return value of each SVN checkin" +echo "function check_svn_return_value { if [ \$? -gt 1 ]; then echo \"Error during checkins - aborting script.\"; exit 1; fi" +echo "}" +echo "ALL_DONE=\"0\"" +echo "while [ \$ALL_DONE = 0 ]; do" +for PROJECT in *; do + DO_CHECKIN="1" + DIRECTORY_HAS_CONTENTS="1" + if [ -d "$PROJECT" ] # Check if we're looking at a directory + then + # A list of projects we don't want to checkin + # automatically, they will be done manually + if [ "$PROJECT" = "or1k" ]; then DO_CHECKIN="0" ; fi + if [ "$PROJECT" = "or1k-backup" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "or1200-gct" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "or2k" ]; then DO_CHECKIN="0"; fi + + # The following need to be checked in to the repository + # with a slightly different name to its directory name + if [ "$PROJECT" = "8051" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "ac97" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "DebugInterface" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "ethmac" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "mips" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "uart" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "usb" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "miniuart2" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "video_systems" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "microriscii" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "oc54x" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "divider" ]; then DO_CHECKIN="0"; fi + if [ "$PROJECT" = "hsca_adder" ]; then DO_CHECKIN="0"; fi + # Bug with this project when using this script, so don't check it in + if [ "$PROJECT" = "ae68" ]; then DO_CHECKIN="0"; fi + + if [ $DO_CHECKIN -gt 0 ] + then + cd "$PROJECT" + # Now we're in the project subdirectory, we + # want to checkin everything apart from the + # stats and lint directories + + + # This pushd and the following popd make the script + # change into the right directory to do the checkin + # The command above runs an ls and word count (wc) + # and strips the whitespace to determine the number + # of files in the directory. An empty one with just + # a stats dir has a value of 4, so if it's more than + # that, odds are we have something to checkin. + #if [ `ls | wc -l | sed 's/^[ ]*//'` -gt 3 ] + #then + echo " pushd \"$PROJECT\"" + # echo "$PROJECT" + #else + #DIRECTORY_HAS_CONTENTS="0" + #fi + + # Only go through the directory checking if + # there's things in there + #if [ $DIRECTORY_HAS_CONTENTS -gt 0 ] + #then + for PROJ_FILE in *; do + DO_CHECKIN="1" + if [ "$PROJ_FILE" = "stats" ]; then DO_CHECKIN="0"; fi + if [ "$PROJ_FILE" = "lint" ]; then DO_CHECKIN="0"; fi + if [ $DO_CHECKIN -gt 0 ] + then + #Do checkin + #echo "#Checking in $PROJECT/$PROJ_FILE" + echo " svn import -m \"Import from OC\" \"$PROJ_FILE\" \"$PROJECT/$PROJ_FILE\"" + echo " check_svn_return_value" + #else + #echo "#Excluding $PROJ_FILE from checkin of $PROJECT" + fi + done + # We now write out the popd to change back to the main dir + # in the script + echo " popd" + #if [ $DIRECTORY_HAS_CONTENTS -gt 0 ]; then echo "$PROJECT"; fi + #fi #if [ $DIRECTORY_HAS_CONTENTS -gt 0 ] + cd .. + + #else + #echo "#Excluding project $PROJECT from checkin!" + fi #if [ $DO_CHECKIN -gt 0 ] + fi #if [ -d "$PROJECT" ] +done +echo " ALL_DONE=\"1\"" +echo " echo \"All checkins done\"" +echo "done" + +
hdlc/web_uploads/ Property changes : Added: svn:executable ## -0,0 +1 ## +* \ No newline at end of property Index: hdlc/web_uploads/svn_checkin.log =================================================================== --- hdlc/web_uploads/svn_checkin.log (nonexistent) +++ hdlc/web_uploads/svn_checkin.log (revision 18) @@ -0,0 +1,3638 @@ +/home/oc/cores/100baset /home/oc/cores +/home/oc/cores +/home/oc/cores/1394ohci /home/oc/cores +/home/oc/cores +/home/oc/cores/2dcoprocessor /home/oc/cores +/home/oc/cores +/home/oc/cores/395_vgs /home/oc/cores +/home/oc/cores +/home/oc/cores/3des_vhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/4bitprocesor /home/oc/cores +/home/oc/cores +/home/oc/cores/6502vhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/68hc05 /home/oc/cores +/home/oc/cores +/home/oc/cores/68hc08 /home/oc/cores +/home/oc/cores +/home/oc/cores/8051_serial /home/oc/cores +/home/oc/cores +/home/oc/cores/8051_to_ahb_interface /home/oc/cores +/home/oc/cores +/home/oc/cores/8b10b_encdec /home/oc/cores +Adding 8b10_dec.vhd + +Committed revision 7. +Adding 8b10_enc.vhd + +Committed revision 8. +Adding enc_8b10b_TB.vhd + +Committed revision 9. +Adding encdec_8b10b_TB.vhd + +Committed revision 10. +/home/oc/cores +/home/oc/cores/8bituartvhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/aacencode /home/oc/cores +/home/oc/cores +/home/oc/cores/acxbrd /home/oc/cores +/home/oc/cores +/home/oc/cores/adaptivefilter /home/oc/cores +/home/oc/cores +/home/oc/cores/adaptive_lms_equalizer /home/oc/cores +/home/oc/cores +/home/oc/cores/adder /home/oc/cores +/home/oc/cores +/home/oc/cores/ae18 /home/oc/cores +/home/oc/cores +/home/oc/cores/aemb /home/oc/cores +/home/oc/cores +/home/oc/cores/aes128 /home/oc/cores +/home/oc/cores +/home/oc/cores/aes_128_192_256 /home/oc/cores +Adding aes_dec.vhdl + +Committed revision 1. +Adding aes_enc.vhdl + +Committed revision 2. +Adding aes_pkg.vhdl + +Committed revision 3. +Adding (bin) aes_top.pdf + +Committed revision 4. +Adding key_expansion.vhdl + +Committed revision 5. +/home/oc/cores +/home/oc/cores/aes_core /home/oc/cores +/home/oc/cores +/home/oc/cores/aes_crypto_core /home/oc/cores +/home/oc/cores +/home/oc/cores/aes_fekete256 /home/oc/cores +Adding (bin) AES.ZIP + +Committed revision 1. +/home/oc/cores +/home/oc/cores/ahb2wishbone /home/oc/cores +/home/oc/cores +/home/oc/cores/ahbahb /home/oc/cores +/home/oc/cores +/home/oc/cores/ahb_arbiter /home/oc/cores +/home/oc/cores +/home/oc/cores/ahb_system_generator /home/oc/cores +/home/oc/cores +/home/oc/cores/all_digital_fm_receiver /home/oc/cores +Adding (bin) architecture.png + +Committed revision 2. +Adding (bin) fmsquare.jpg + +Committed revision 3. +Adding (bin) fmtriangular.jpg + +Committed revision 4. +/home/oc/cores +/home/oc/cores/alternascope /home/oc/cores +Adding (bin) Alternascope_Sept15_2005.rar + +Committed revision 2. +Adding (bin) BlockDiagram_small.GIF + +Committed revision 3. +Adding (bin) OpenCores.JPG + +Committed revision 4. +/home/oc/cores +/home/oc/cores/alu_with_selectable_inputs_and_outputs /home/oc/cores +/home/oc/cores +/home/oc/cores/amba_compliant_fifo_core /home/oc/cores +/home/oc/cores +/home/oc/cores/ambasdram /home/oc/cores +/home/oc/cores +/home/oc/cores/aquarius /home/oc/cores +/home/oc/cores +/home/oc/cores/aspida /home/oc/cores +Adding (bin) aspida_dlx_core.tar.gz + +Committed revision 1. +Adding (bin) aspida.gif + +Committed revision 2. +Adding (bin) faq.tar.gz + +Committed revision 3. +Adding (bin) thumb_aspida.gif + +Committed revision 4. +/home/oc/cores +/home/oc/cores/asynchronous_clocks /home/oc/cores +/home/oc/cores +/home/oc/cores/ata /home/oc/cores +Adding index.shtml + +Committed revision 2. +Adding (bin) preliminary_ata_core.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/auto_baud /home/oc/cores +/home/oc/cores +/home/oc/cores/a_vhd_16550_uart /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding vhdl_16550_uart_2_2.pdf + +Committed revision 2. +/home/oc/cores +/home/oc/cores/a_vhdl_can_controller /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/avr_core /home/oc/cores +Adding (bin) AVR_Core8F.tar.gz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/ax8 /home/oc/cores +/home/oc/cores +/home/oc/cores/basicdes /home/oc/cores +/home/oc/cores +/home/oc/cores/basicrsa /home/oc/cores +/home/oc/cores +/home/oc/cores/baudgen /home/oc/cores +Adding am_baud_rate_gen.vhd + +Committed revision 2. +/home/oc/cores +/home/oc/cores/baud_select_uart /home/oc/cores +/home/oc/cores +/home/oc/cores/bc6502 /home/oc/cores +/home/oc/cores +/home/oc/cores/big_counter /home/oc/cores +/home/oc/cores +/home/oc/cores/binary_to_bcd /home/oc/cores +/home/oc/cores +/home/oc/cores/bips /home/oc/cores +/home/oc/cores +/home/oc/cores/biquad /home/oc/cores +Adding (bin) biquad.pdf + +Committed revision 1. +Adding biquad.v + +Committed revision 2. +Adding bqmain.v + +Committed revision 3. +Adding (bin) bquad_blk.gif + +Committed revision 4. +Adding coefio.v + +Committed revision 5. +Adding index.shtml + +Committed revision 6. +Adding multa.v + +Committed revision 7. +Adding multb.v + +Committed revision 8. +Adding vsource.html + +Committed revision 9. +/home/oc/cores +/home/oc/cores/bluespec-80211atransmitter /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-bsp /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-convolutional-codec /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-fft /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-galoisfield /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-h264 /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-ofdm /home/oc/cores +/home/oc/cores +/home/oc/cores/bluespec-reedsolomon /home/oc/cores +/home/oc/cores +/home/oc/cores/bluetooth /home/oc/cores +Adding BBspec.shtml + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +Adding index.shtml + +Committed revision 6. +/home/oc/cores +/home/oc/cores/bluetooth_ver /home/oc/cores +/home/oc/cores +/home/oc/cores/board /home/oc/cores +Adding (bin) blockdiagram.jpg + +Committed revision 1. +Adding (bin) boardflow.jpg + +Committed revision 2. +Adding board.shtml + +Committed revision 3. +Adding (bin) coreflow.jpg + +Committed revision 4. +Adding index.shtml + +Committed revision 5. +Adding (bin) led.jpg + +Committed revision 6. +Adding (bin) matrics.gif + +Committed revision 7. +Adding (bin) power_led.gif + +Committed revision 8. +Adding XC95108-PC84.sym + +Committed revision 9. +/home/oc/cores +/home/oc/cores/boundaries /home/oc/cores +/home/oc/cores +/home/oc/cores/brisc /home/oc/cores +/home/oc/cores +/home/oc/cores/butterfly /home/oc/cores +/home/oc/cores +/home/oc/cores/c16 /home/oc/cores +/home/oc/cores +/home/oc/cores/cable /home/oc/cores +/home/oc/cores +/home/oc/cores/cachemodel /home/oc/cores +/home/oc/cores +/home/oc/cores/cam /home/oc/cores +/home/oc/cores +/home/oc/cores/camellia /home/oc/cores +Adding camellia_core_tb.vhd + +Committed revision 1. +Adding CAMELLIA_CORE.vhd + +Committed revision 2. +Adding (bin) Camellia_doc.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/camellia-vhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/can /home/oc/cores +Adding (bin) CAN.gif + +Committed revision 2. +/home/oc/cores +/home/oc/cores/cas /home/oc/cores +/home/oc/cores +/home/oc/cores/cdma /home/oc/cores +/home/oc/cores +/home/oc/cores/cereon /home/oc/cores +Adding (bin) AssemblerReference.pdf + +Committed revision 1. +Adding CereonArchitectureReferenceManual_Version1.pdf + +Committed revision 2. +Adding (bin) ProcedureCallingStandards.pdf + +Committed revision 3. +Adding (bin) ProcessorIdentificationScheme.pdf + +Committed revision 4. +/home/oc/cores +/home/oc/cores/cf_cordic /home/oc/cores +Adding (bin) cf_cordic.tgz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/cf_fft /home/oc/cores +Adding (bin) cf_fft_test_large.tgz + +Committed revision 1. +Adding (bin) cf_fft_test.tgz + +Committed revision 2. +Adding (bin) cf_fft.tgz + +Committed revision 3. +/home/oc/cores +/home/oc/cores/cf_fir /home/oc/cores +Adding (bin) cf_fir.tgz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/cf_fp_mul /home/oc/cores +Adding (bin) cf_fp_mul.tgz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/cfft /home/oc/cores +/home/oc/cores +/home/oc/cores/cfinterface /home/oc/cores +/home/oc/cores +/home/oc/cores/cf_interleaver /home/oc/cores +Adding (bin) cf_interleaver.tgz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/cf_ldpc /home/oc/cores +Adding (bin) cf_ldpc.tgz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/cf_rca /home/oc/cores +Adding (bin) cf_rca.tgz + +Committed revision 1. +Adding (bin) rca_tile.png + +Committed revision 2. +/home/oc/cores +/home/oc/cores/cf_ssp /home/oc/cores +Adding (bin) cf_ssp.tgz + +Committed revision 1. +Adding ssp_cordic.c + +Committed revision 2. +Adding ssp_first_order.c + +Committed revision 3. +/home/oc/cores +/home/oc/cores/cia /home/oc/cores +/home/oc/cores +/home/oc/cores/claw /home/oc/cores +/home/oc/cores +/home/oc/cores/clocklessalu /home/oc/cores +/home/oc/cores +/home/oc/cores/cmpct /home/oc/cores +/home/oc/cores +/home/oc/cores/c-nit_soc /home/oc/cores +/home/oc/cores +/home/oc/cores/color_converter /home/oc/cores +/home/oc/cores +/home/oc/cores/constellation_vga /home/oc/cores +/home/oc/cores +/home/oc/cores/const_encoder /home/oc/cores +Adding (bin) Const_enc_oc.doc + +Committed revision 1. +Adding const_enc.vhd + +Committed revision 2. +/home/oc/cores +/home/oc/cores/cordic /home/oc/cores +Adding cordic.pdf + +Committed revision 2. +Adding index.shtml + +Committed revision 3. +/home/oc/cores +/home/oc/cores/core_arm /home/oc/cores +/home/oc/cores +/home/oc/cores/cowgirl /home/oc/cores +/home/oc/cores +/home/oc/cores/cpu6502_true_cycle /home/oc/cores +/home/oc/cores +/home/oc/cores/cpu65c02_true_cycle /home/oc/cores +/home/oc/cores +/home/oc/cores/cpu8080 /home/oc/cores +/home/oc/cores +/home/oc/cores/cpugen /home/oc/cores +Adding (bin) cpugen.jpg + +Committed revision 2. +/home/oc/cores +/home/oc/cores/cryptopan_core /home/oc/cores +/home/oc/cores +/home/oc/cores/cryptosorter /home/oc/cores +/home/oc/cores +/home/oc/cores/csa /home/oc/cores +/home/oc/cores +/home/oc/cores/dallas_one-wire /home/oc/cores +/home/oc/cores +/home/oc/cores/dct /home/oc/cores +Adding dct.shtml + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding htmlbook.shtml + +Committed revision 3. +Adding modexp.shtml + +Committed revision 4. +/home/oc/cores +/home/oc/cores/ddr_sdr /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding doc/readme.txt + +Committed revision 3. +Adding LICENSE.dat + +Committed revision 4. + +Committed revision 5. +/home/oc/cores +/home/oc/cores/ddsgen /home/oc/cores +/home/oc/cores +/home/oc/cores/decoder /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/deflatecore /home/oc/cores +/home/oc/cores +/home/oc/cores/des /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/design_dsp320tmsc10_with_vhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/dfp /home/oc/cores +Adding (bin) dfp.gif + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/digifilter /home/oc/cores +/home/oc/cores +/home/oc/cores/diogenes /home/oc/cores +Adding (bin) diogenes.tar.bz2 + +Committed revision 2. +/home/oc/cores +/home/oc/cores/dirac /home/oc/cores +/home/oc/cores +/home/oc/cores/djpeg /home/oc/cores +/home/oc/cores +/home/oc/cores/dmacontroller /home/oc/cores +/home/oc/cores +/home/oc/cores/dmt_tx /home/oc/cores +/home/oc/cores +/home/oc/cores/dram /home/oc/cores +Adding dram.html + +Committed revision 1. +Adding dram.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/dualspartainc6713cpci /home/oc/cores +Adding (bin) 6713_CPU.pdf + +Committed revision 1. +Adding (bin) BotLayer.jpg + +Committed revision 2. +Adding (bin) DSP_Front.jpg + +Committed revision 3. +Adding (bin) DSP_near_done_tiny.jpg + +Committed revision 4. +Adding (bin) Mid1Layer.jpg + +Committed revision 5. +Adding (bin) Mid2Layer.jpg + +Committed revision 6. +Adding (bin) SystemDiagram.jpg + +Committed revision 7. +Adding (bin) TopLayer.jpg + +Committed revision 8. +/home/oc/cores +/home/oc/cores/dwt2d /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/e123mux /home/oc/cores +Adding (bin) Block_Diagram.jpg + +Committed revision 1. +Adding E123MUX_Core.pdf + +Committed revision 2. +/home/oc/cores +/home/oc/cores/e1framer /home/oc/cores +/home/oc/cores +/home/oc/cores/e1framerdeframer /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding fas_insert.vhd + +Committed revision 2. +/home/oc/cores +/home/oc/cores/edatools /home/oc/cores +/home/oc/cores +/home/oc/cores/elevator /home/oc/cores +/home/oc/cores +/home/oc/cores/elphel_353 /home/oc/cores +/home/oc/cores +/home/oc/cores/embedded_risc /home/oc/cores +Adding (bin) Block_Diagram/sdram_controller.pdf + +Committed revision 2. +/home/oc/cores +/home/oc/cores/embed_z8 /home/oc/cores +/home/oc/cores +/home/oc/cores/epp /home/oc/cores +Adding (bin) epp.jpg + +Committed revision 1. +/home/oc/cores +/home/oc/cores/epp-interface-v /home/oc/cores +/home/oc/cores +/home/oc/cores/epp-to-wishbone /home/oc/cores +/home/oc/cores +/home/oc/cores/erp /home/oc/cores +Adding ERPTechnicalReport4.pdf + +Committed revision 1. +Adding ERPTechnicalReport5.pdf + +Committed revision 2. +Adding ERPverilogcore.txt + +Committed revision 3. +/home/oc/cores +/home/oc/cores/ethdev /home/oc/cores +/home/oc/cores +/home/oc/cores/ethernet_tri_mode /home/oc/cores +Adding (bin) ethernet_tri_mode.rel-1-0.tar.gz + +Committed revision 2. +/home/oc/cores +/home/oc/cores/ethmac10g /home/oc/cores +/home/oc/cores +/home/oc/cores/ethmacvhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/ethswitch /home/oc/cores +/home/oc/cores +/home/oc/cores/eus100lx /home/oc/cores +Adding (bin) 180px-EUS_B_N.jpg + +Committed revision 2. +Adding (bin) 180px-EUS_T_N.jpg + +Committed revision 3. +Adding (bin) EUS100LX_BD.gif + +Committed revision 4. +/home/oc/cores +/home/oc/cores/eusfs /home/oc/cores +Adding (bin) eusfs-bd.jpg + +Committed revision 1. +Adding (bin) EUSIIa_bottom_tn.jpg + +Committed revision 2. +Adding (bin) EUS_II_topa_tn.jpg + +Committed revision 3. +/home/oc/cores +/home/oc/cores/evision /home/oc/cores +/home/oc/cores +/home/oc/cores/extension_pack /home/oc/cores +/home/oc/cores +/home/oc/cores/fac2222m /home/oc/cores +Adding (bin) ADC-DAC-AMP.png + +Committed revision 2. +Adding (bin) fac2222m.png + +Committed revision 3. +/home/oc/cores +/home/oc/cores/fast-crc /home/oc/cores +Adding (bin) CRC-generator.tgz + +Committed revision 2. +Adding (bin) CRC_ie3_contest.pdf + +Committed revision 3. +Adding (bin) CRC.tgz + +Committed revision 4. +Adding Readme + +Committed revision 5. +/home/oc/cores +/home/oc/cores/fbas_encoder /home/oc/cores +Adding (bin) chroma_gen.png + +Committed revision 1. +Adding (bin) connect.png + +Committed revision 2. +Adding (bin) fbas_encoder-0.21.tar.gz + +Committed revision 3. +Adding (bin) fbas-encoder_0.31.tar.gz + +Committed revision 4. +Adding (bin) fbas-enc_scrs1.jpg + +Committed revision 5. +Adding (bin) luma_gen.png + +Committed revision 6. +Adding (bin) main.png + +Committed revision 7. +/home/oc/cores +/home/oc/cores/fcpu /home/oc/cores +/home/oc/cores +/home/oc/cores/ffr16 /home/oc/cores +Adding (bin) FFR16.jpg + +Committed revision 2. +/home/oc/cores +/home/oc/cores/fft_32 /home/oc/cores +/home/oc/cores +/home/oc/cores/fftprocessor /home/oc/cores +/home/oc/cores +/home/oc/cores/fht /home/oc/cores +/home/oc/cores +/home/oc/cores/fifouart /home/oc/cores +Adding (bin) UART_datasheet.pdf + +Committed revision 1. +/home/oc/cores +/home/oc/cores/filter /home/oc/cores +/home/oc/cores +/home/oc/cores/firewire /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/fir_filter_generator /home/oc/cores +Adding design-of-high-speed.pdf + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/flha /home/oc/cores +/home/oc/cores +/home/oc/cores/floatingcore /home/oc/cores +/home/oc/cores +/home/oc/cores/floating_point_adder_subtractor /home/oc/cores +Adding addsub.vhd + +Committed revision 1. +Adding normalize.vhd + +Committed revision 2. +Adding shift.vhd + +Committed revision 3. +/home/oc/cores +/home/oc/cores/floppyif /home/oc/cores +/home/oc/cores +/home/oc/cores/fmtransmitter /home/oc/cores +/home/oc/cores +/home/oc/cores/fpga /home/oc/cores +Adding (bin) docs.jar + +Committed revision 1. +Adding (bin) examples.jar + +Committed revision 2. +Adding (bin) Fpga.pdf + +Committed revision 3. +Adding (bin) fpga_sw.pdf + +Committed revision 4. +Adding gpl.txt + +Committed revision 5. +Adding index.shtml + +Committed revision 6. +Adding (bin) KRPAN.jar + +Committed revision 7. +Adding (bin) + +Committed revision 8. +Adding (bin) opencores.cer + +Committed revision 9. +Adding pwm12_8s.v + +Committed revision 10. +Adding (bin) sources.jar + +Committed revision 11. +Adding (bin) sshot1.gif + +Committed revision 12. +/home/oc/cores +/home/oc/cores/fpgabsp /home/oc/cores +/home/oc/cores +/home/oc/cores/fpgaconfig /home/oc/cores +Adding (bin) altera_config.png + +Committed revision 1. +Adding (bin) fpgaConfig_system_block_diag.gif + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/fpgaproto /home/oc/cores +/home/oc/cores +/home/oc/cores/fpipelines /home/oc/cores +/home/oc/cores +/home/oc/cores/fpu /home/oc/cores +Adding DEADJOE + +Committed revision 2. +Adding index.shtml + +Committed revision 3. +/home/oc/cores +/home/oc/cores/fpu100 /home/oc/cores +Adding bug_report_260407.txt + +Committed revision 2. +Adding (bin) fpu_doc.pdf + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +/home/oc/cores +/home/oc/cores/fpu32bit /home/oc/cores +/home/oc/cores +/home/oc/cores/fpuvhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/freetools /home/oc/cores +/home/oc/cores +/home/oc/cores/froop /home/oc/cores +/home/oc/cores +/home/oc/cores/fsl2serial /home/oc/cores +/home/oc/cores +/home/oc/cores/gamepads /home/oc/cores +Adding (bin) gcpad.png + +Committed revision 2. +Adding (bin) snespad.png + +Committed revision 3. +Adding (bin) snespad_wire.jpg + +Committed revision 4. +Adding (bin) thumb_gcpad.png + +Committed revision 5. +Adding (bin) thumb_snespad.png + +Committed revision 6. +Adding (bin) thumb_snespad_wire.jpg + +Committed revision 7. +/home/oc/cores +/home/oc/cores/gcpu /home/oc/cores +/home/oc/cores +/home/oc/cores/generic_fifos /home/oc/cores +/home/oc/cores +/home/oc/cores/generic_fifovhd /home/oc/cores +/home/oc/cores +/home/oc/cores/gh_vhdl_library /home/oc/cores +Adding (bin) gh_vhdl_lib_3_34.pdf + +Committed revision 1. +Adding (bin) gh_vhdl_lib_3_35.pdf + +Committed revision 2. +Adding (bin) gh_vhdl_lib_3_36.pdf + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +Adding (bin) + +Committed revision 6. +/home/oc/cores +/home/oc/cores/gig_ethernet_mac_core /home/oc/cores +/home/oc/cores +/home/oc/cores/gix96 /home/oc/cores +/home/oc/cores +/home/oc/cores/gpio /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/graphicallcd /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/graphiti /home/oc/cores +Adding (bin) blockschaltbild.png + +Committed revision 2. +Adding (bin) flowers.jpg + +Committed revision 3. +Adding (bin) graphitib.jpg + +Committed revision 4. +Adding (bin) graphiti.jpg + +Committed revision 5. +Adding (bin) testbild.jpg + +Committed revision 6. +Adding (bin) tflowers.jpg + +Committed revision 7. +Adding (bin) thumb_flowers.jpg + +Committed revision 8. +Adding (bin) thumb_graphitib.jpg + +Committed revision 9. +Adding (bin) thumb_graphiti.jpg + +Committed revision 10. +Adding (bin) thumb_testbild.jpg + +Committed revision 11. +Adding (bin) thumb_tflowers.jpg + +Committed revision 12. +/home/oc/cores +/home/oc/cores/gsc /home/oc/cores +Adding (bin) btyacc.tar.gz + +Committed revision 1. +Adding (bin) graphviz-2.8.tar.gz + +Committed revision 2. +Adding (bin) gsc-0.1.1.tar.gz + +Committed revision 3. +Adding (bin) gsc.pdf + +Committed revision 4. +Adding (bin) keystone.tar.gz + +Committed revision 5. +Adding (bin) treecc-0.3.8.tar.gz + +Committed revision 6. +/home/oc/cores +/home/oc/cores/gup /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) gup_logo_thumb.jpg + +Committed revision 2. +Adding (bin) thumb_gup_logo_thumb.jpg + +Committed revision 3. +/home/oc/cores +/home/oc/cores/gzip /home/oc/cores +/home/oc/cores +/home/oc/cores/hamming /home/oc/cores +/home/oc/cores +/home/oc/cores/hamming_gen /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/hangyu /home/oc/cores +/home/oc/cores +/home/oc/cores/hasm /home/oc/cores +/home/oc/cores +/home/oc/cores/hdb3 /home/oc/cores +/home/oc/cores +/home/oc/cores/hdbn /home/oc/cores +/home/oc/cores +/home/oc/cores/hdlc /home/oc/cores +Adding (bin) HDLC_cont.jpg + +Committed revision 2. +Adding + +Committed revision 3. +Adding (bin) hdlc_fifo.jpg + +Committed revision 4. +Adding + +Committed revision 5. +Adding hdlc_project.html + +Committed revision 6. +Adding (bin) hdlc_project.pdf + +Committed revision 7. +Adding + +Committed revision 8. +Adding (bin) HDLC_top.jpg + +Committed revision 9. +Adding + +Committed revision 10. +Adding index.shtml + +Committed revision 11. +Adding + +Committed revision 12. +/home/oc/cores +/home/oc/cores/help /home/oc/cores +Adding (bin) exp1pf.gif + +Committed revision 2. +Adding search.shtml + +Committed revision 3. +/home/oc/cores +/home/oc/cores/hicovec /home/oc/cores +/home/oc/cores +/home/oc/cores/hierarch_unit /home/oc/cores +/home/oc/cores +/home/oc/cores/hmta /home/oc/cores +/home/oc/cores +/home/oc/cores/houmway /home/oc/cores +/home/oc/cores +/home/oc/cores/hpc-16 /home/oc/cores +/home/oc/cores +/home/oc/cores/hpcmemory /home/oc/cores +/home/oc/cores +/home/oc/cores/hssdrc /home/oc/cores +/home/oc/cores +/home/oc/cores/ht_tunnel /home/oc/cores +/home/oc/cores +/home/oc/cores/hwlu /home/oc/cores +/home/oc/cores +/home/oc/cores/i2c /home/oc/cores +Adding (bin) Block.gif + +Committed revision 2. +Adding (bin) i2c_rev03.pdf + +Committed revision 3. +Adding index_orig.shtml + +Committed revision 4. +Adding index.shtml + +Committed revision 5. +/home/oc/cores +/home/oc/cores/i2clog /home/oc/cores +Adding Documentation/I2CLog.v + +Committed revision 1. +Adding front + +Committed revision 2. +Adding I2C_TrafficLogger.v + +Committed revision 3. +/home/oc/cores +/home/oc/cores/i2c_master_slave_core /home/oc/cores +/home/oc/cores +/home/oc/cores/i2c_slave /home/oc/cores +Adding iic_slave_3.v + +Committed revision 1. +/home/oc/cores +/home/oc/cores/i2c_vhdl /home/oc/cores +/home/oc/cores +/home/oc/cores/i2s /home/oc/cores +Adding dff.vhd + +Committed revision 1. +Adding ebu_2_i2s.vhd + +Committed revision 2. +/home/oc/cores +/home/oc/cores/i2s_interface /home/oc/cores +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/i2sparalell /home/oc/cores +/home/oc/cores +/home/oc/cores/ic6821 /home/oc/cores +Adding VHDL6821.vhd + +Committed revision 1. +/home/oc/cores +/home/oc/cores/icu /home/oc/cores +/home/oc/cores +/home/oc/cores/ide /home/oc/cores +/home/oc/cores +/home/oc/cores/idea /home/oc/cores +Adding (bin) block_opmode.tar.gz + +Committed revision 2. +Adding (bin) control.tar.gz + +Committed revision 3. +Adding (bin) IDEA core block.GIF + +Committed revision 4. +Adding (bin) idea_machine.tar.gz + +Committed revision 5. +Adding (bin) IDEA mechine block.GIF + +Committed revision 6. +Adding index.shtml + +Committed revision 7. +Adding (bin) keys_generate.tar.gz + +Committed revision 8. +Adding (bin) Paper_IES2001_sby.PDF + +Committed revision 9. +Adding (bin) port_inout.tar.gz + +Committed revision 10. +/home/oc/cores +/home/oc/cores/iiepci /home/oc/cores +Adding (bin) iie_pci_back.jpg + +Committed revision 2. +Adding (bin) iie_pci_diagram.jpg + +Committed revision 3. +Adding (bin) iie_pci_front.jpg + +Committed revision 4. +/home/oc/cores +/home/oc/cores/ima-adpcm /home/oc/cores +/home/oc/cores +/home/oc/cores/interface_vga80x40 /home/oc/cores +Adding (bin) FPGA_VGA_Electrical_Interface.png + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding VGA80x40_documentation.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/ipchip /home/oc/cores +/home/oc/cores +/home/oc/cores/irda /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/iso7816-3 /home/oc/cores +Adding (bin) iso7816-3.tgz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/isp /home/oc/cores +/home/oc/cores +/home/oc/cores/jop /home/oc/cores +/home/oc/cores +/home/oc/cores/jpeg /home/oc/cores +Adding (bin) DiagramaCompJPGen.png + +Committed revision 2. +Adding (bin) floresconsubsamp211.jpg + +Committed revision 3. +Adding (bin) floressinsubsamp.jpg + +Committed revision 4. +Adding (bin) imagenfrutasQ05PSP.JPG + +Committed revision 5. +Adding (bin) imagenfrutasQ15.jpg + +Committed revision 6. +Adding (bin) imagenfrutasQ31.jpg + +Committed revision 7. +Adding (bin) imagenfrutasQ50.jpg + +Committed revision 8. +Adding (bin) imagenglobosPSPQ15.jpg + +Committed revision 9. +Adding (bin) imagenglobosQ15.jpg + +Committed revision 10. +/home/oc/cores +/home/oc/cores/jpegcompression /home/oc/cores +/home/oc/cores +/home/oc/cores/jtag /home/oc/cores +Adding (bin) Boundary-Scan Architecture.pdf + +Committed revision 2. +Adding index.shtml + +Committed revision 3. +/home/oc/cores +/home/oc/cores/k68 /home/oc/cores +/home/oc/cores +/home/oc/cores/k7_viterbi_decoder /home/oc/cores +/home/oc/cores +/home/oc/cores/kad /home/oc/cores +/home/oc/cores +/home/oc/cores/kcpsm3_interrupt_handling /home/oc/cores +/home/oc/cores +/home/oc/cores/keyboardcontroller /home/oc/cores +/home/oc/cores +/home/oc/cores/keypad_scanner /home/oc/cores +/home/oc/cores +/home/oc/cores/kiss-board /home/oc/cores +/home/oc/cores +/home/oc/cores/ksystem /home/oc/cores +/home/oc/cores +/home/oc/cores/l8051 /home/oc/cores +Adding (bin) L8051.tar + +Committed revision 1. +/home/oc/cores +/home/oc/cores/lcd /home/oc/cores +Adding alliance.shtml + +Committed revision 1. +Adding counterc.shtml + +Committed revision 2. +Adding counter.shtml + +Committed revision 3. +Adding counterv.shtml + +Committed revision 4. +Adding decoderc.shtml + +Committed revision 5. +Adding decoderv.shtml + +Committed revision 6. +Adding dffresc.shtml + +Committed revision 7. +Adding dffresv.shtml + +Committed revision 8. +Adding dflipflop.shtml + +Committed revision 9. +Adding index.shtml + +Committed revision 10. +Adding index.shtml.old + +Committed revision 11. +Adding (bin) LCD.ht1.gif + +Committed revision 12. +Adding (bin) + +Committed revision 13. +Adding mcc.shtml + +Committed revision 14. +Adding mcv.shtml + +Committed revision 15. +Adding ramc.shtml + +Committed revision 16. +Adding ramv.shtml + +Committed revision 17. +Adding struct.shtml + +Committed revision 18. +Adding test.shtml + +Committed revision 19. +/home/oc/cores +/home/oc/cores/lcd1 /home/oc/cores +/home/oc/cores +/home/oc/cores/lcd_controller /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding CM920TUserGuide.pdf + +Committed revision 2. +Adding (bin) ColorTFT-LCDController.ppt + +Committed revision 3. +Adding DUI0146C_LM600.pdf + +Committed revision 4. +Adding tx18d16vm1caa.pdf + +Committed revision 5. +/home/oc/cores +/home/oc/cores/ldpc_decoder_802_3an /home/oc/cores +Adding (bin) ldpc_decoder_802_3an.tar.gz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/ldpc_encoder_802_3an /home/oc/cores +Adding (bin) ldpc_encoder_802_3an.v.gz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/lem1_9min /home/oc/cores +Adding d3_lem1_9min_hw.ucf + +Committed revision 1. +Adding Form1.cs + +Committed revision 2. +Adding lem1_9min_asm.csproj + +Committed revision 3. +Adding lem1_9min_defs.vhd + +Committed revision 4. +Adding lem1_9min_hw.vhd + +Committed revision 5. +Adding lem1_9min.vhd + +Committed revision 6. +Adding trinity_talk_041205.pdf + +Committed revision 7. +/home/oc/cores +/home/oc/cores/light8080 /home/oc/cores +/home/oc/cores +/home/oc/cores/lin-a /home/oc/cores +/home/oc/cores +/home/oc/cores/line_codes /home/oc/cores +/home/oc/cores +/home/oc/cores/linuxvcap /home/oc/cores +/home/oc/cores +/home/oc/cores/llc1394 /home/oc/cores +/home/oc/cores +/home/oc/cores/log_anal /home/oc/cores +/home/oc/cores +/home/oc/cores/lowpowerfir /home/oc/cores +Adding (bin) FIRLowPowerConsiderations.doc + +Committed revision 1. +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/lpc /home/oc/cores +/home/oc/cores +/home/oc/cores/lpu /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) Mem Driven Processor.doc + +Committed revision 2. +/home/oc/cores +/home/oc/cores/lq057q3dc02 /home/oc/cores +/home/oc/cores +/home/oc/cores/lwmips /home/oc/cores +/home/oc/cores +/home/oc/cores/lwrisc /home/oc/cores +Adding (bin) 200735153855.bmp + +Committed revision 2. +Adding (bin) 200735153855.JPG + +Committed revision 3. +Adding (bin) clairisc.JPG + +Committed revision 4. +Adding (bin) thumb_200735153855.JPG + +Committed revision 5. +Adding (bin) thumb_clairisc.JPG + +Committed revision 6. +Adding (bin) thumb_we.GIF + +Committed revision 7. +Adding (bin) we.GIF + +Committed revision 8. +/home/oc/cores +/home/oc/cores/m1_core /home/oc/cores +/home/oc/cores +/home/oc/cores/mac /home/oc/cores +/home/oc/cores +/home/oc/cores/macroblock_motion_detection /home/oc/cores +/home/oc/cores +/home/oc/cores/maf /home/oc/cores +/home/oc/cores +/home/oc/cores/mafa-pc-board /home/oc/cores +/home/oc/cores +/home/oc/cores/man2uart /home/oc/cores +Adding Man2uartopencores.txt + +Committed revision 1. +/home/oc/cores +/home/oc/cores/manchesterencoderdecoder /home/oc/cores +Adding ME2.vhd + +Committed revision 1. +/home/oc/cores +/home/oc/cores/marca /home/oc/cores +/home/oc/cores +/home/oc/cores/matrix3x3 /home/oc/cores +/home/oc/cores +/home/oc/cores/maxii-evalboard /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) MAXII-Evalboard_V1.0_a.jpg + +Committed revision 2. +Adding (bin) MAXII-Evalboard_V1.0_b.jpg + +Committed revision 3. +Adding (bin) MAXII-Evalboard_V1.0_BOM.xls + +Committed revision 4. +Adding (bin) MAXII-Evalboard_V1.0_Gerber& + +Committed revision 5. +Adding (bin) MAXII-Evalboard_V1.0.jpg + +Committed revision 6. +Adding MAXII-Evalboard_V1.0_PCB-Errata.txt + +Committed revision 7. +Adding MAXII-Evalboard_V1.0_PCB.pdf + +Committed revision 8. +Adding (bin) MAXII-Evalboard_V1.0_Placement.pdf + +Committed revision 9. +Adding (bin) + +Committed revision 10. +Adding (bin) MAXII-Evalboard_V1.0_Schem.pdf + +Committed revision 11. +/home/oc/cores +/home/oc/cores/mb-jpeg /home/oc/cores +Adding (bin) mb-jpeg_STEP2_1b.tar.bz2 + +Committed revision 2. +Adding (bin) mb-jpeg_STEP2_2b.tar.bz2 + +Committed revision 3. +Adding (bin) mb-jpeg_STEP7_2.tar.bz2 + +Committed revision 4. +/home/oc/cores +/home/oc/cores/mcbsp /home/oc/cores +/home/oc/cores +/home/oc/cores/mcpu /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) mcpu-doc.pdf + +Committed revision 2. +Adding (bin) mcpu.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/mcu8 /home/oc/cores +/home/oc/cores +/home/oc/cores/md5 /home/oc/cores +/home/oc/cores +/home/oc/cores/mdct /home/oc/cores +Adding (bin) block_diagram.jpg + +Committed revision 2. +/home/oc/cores +/home/oc/cores/membist /home/oc/cores +/home/oc/cores +/home/oc/cores/mem_ctrl /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/memorycontroller /home/oc/cores +/home/oc/cores +/home/oc/cores/memory_cores /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/memory_sizer /home/oc/cores +Adding documentation.shtml + +Committed revision 2. +Adding download.shtml + +Committed revision 3. +Adding index.shtml + +Committed revision 4. +Adding people.shtml + +Committed revision 5. +/home/oc/cores +/home/oc/cores/mfpga /home/oc/cores +Adding index.shtml + +Committed revision 1. +Adding (bin) mfpga_block.gif + +Committed revision 2. +Adding (bin) mfpga_block_new.gif + +Committed revision 3. +Adding (bin) micro_orcad.sch + +Committed revision 4. +Adding (bin) micro_protelbinary.lib + +Committed revision 5. +Adding (bin) micro_protelbinary.sch + +Committed revision 6. +Adding (bin) micro_sch.pdf + +Committed revision 7. +Adding (bin) xcv50.jpg + +Committed revision 8. +/home/oc/cores +/home/oc/cores/micore /home/oc/cores +/home/oc/cores +/home/oc/cores/microprocessor /home/oc/cores +/home/oc/cores +/home/oc/cores/milsa /home/oc/cores +/home/oc/cores +/home/oc/cores/milstd1553bbusprotocol /home/oc/cores +/home/oc/cores +/home/oc/cores/mini-acex1k /home/oc/cores +/home/oc/cores +/home/oc/cores/mini_aes /home/oc/cores +/home/oc/cores +/home/oc/cores/minimips /home/oc/cores +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/minirisc /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/mips789 /home/oc/cores +Adding (bin) cal_PI_2.GIF + +Committed revision 1. +Adding (bin) MIPS789.bmp + +Committed revision 2. +Adding (bin) pi_2200.GIF + +Committed revision 3. +Adding (bin) topview.GIF + +Committed revision 4. +/home/oc/cores +/home/oc/cores/mipss /home/oc/cores +Adding s70_32bit_to_9bit.vhd + +Committed revision 1. +Adding s70_ALU.vhd + +Committed revision 2. +Adding s70_ctrl_unit.vhd + +Committed revision 3. +Adding s70_data_mem_comp.vhd + +Committed revision 4. +Adding s70_data_mem.vhd + +Committed revision 5. +Adding s70_datapath.vhd + +Committed revision 6. +Adding s70_Ext_S_Z.vhd + +Committed revision 7. +Adding s70_inc.vhd + +Committed revision 8. +/home/oc/cores +/home/oc/cores/mmcfpgaconfig /home/oc/cores +/home/oc/cores +/home/oc/cores/moonshadow /home/oc/cores +/home/oc/cores +/home/oc/cores/most /home/oc/cores +Adding (bin) MOST_Core_Compliance_Test_Specification.pdf + +Committed revision 2. +Adding MOSTSpecification.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/most_core /home/oc/cores +/home/oc/cores +/home/oc/cores/motion_controller /home/oc/cores +/home/oc/cores +/home/oc/cores/motionestimator /home/oc/cores +/home/oc/cores +/home/oc/cores/motor /home/oc/cores +/home/oc/cores +/home/oc/cores/mp3decoder /home/oc/cores +/home/oc/cores +/home/oc/cores/mpdma /home/oc/cores +Adding (bin) BlazeCluster_v0.14.tar.bz2 + +Committed revision 2. +Adding (bin) BlazeCluster_v0.15.tar.bz2 + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +Adding (bin) + +Committed revision 6. +Adding (bin) mpdma20061020.tar.bz2 + +Committed revision 7. +Adding (bin) mpdma20061023b.tar.bz2 + +Committed revision 8. +Adding (bin) mpdma20061023c.tar.bz2 + +Committed revision 9. +Adding (bin) mpdma20061023.tar.bz2 + +Committed revision 10. +Adding (bin) SoftwareMultiprocessoronFPGA20070608.pdf + +Committed revision 11. +/home/oc/cores +/home/oc/cores/mpeg2decoder /home/oc/cores +/home/oc/cores +/home/oc/cores/mpeg4_video_coding /home/oc/cores +/home/oc/cores +/home/oc/cores/mpegencoderdecoder /home/oc/cores +/home/oc/cores +/home/oc/cores/mup /home/oc/cores +/home/oc/cores +/home/oc/cores/ncore /home/oc/cores +Adding CASM.C + +Committed revision 1. +Adding NCORE2.V + +Committed revision 2. +Adding NCORE3.V + +Committed revision 3. +Adding (bin) nCore_doc.pdf + +Committed revision 4. +Adding (bin) NCORE.tar.bz2 + +Committed revision 5. +Adding nCore.v + +Committed revision 6. +Adding SIM.C + +Committed revision 7. +/home/oc/cores +/home/oc/cores/nemo_emotion /home/oc/cores +/home/oc/cores +/home/oc/cores/neot /home/oc/cores +/home/oc/cores +/home/oc/cores/neptune-core /home/oc/cores +Adding (bin) triton-block.png + +Committed revision 1. +/home/oc/cores +/home/oc/cores/nnARM /home/oc/cores +Adding Arch118.pdf + +Committed revision 1. +Adding Architecture111.pdf + +Committed revision 2. +Adding (bin) Architecture111.pdf.old + +Committed revision 3. +Adding Architecture_jc.pdf + +Committed revision 4. +Adding BS.shtml + +Committed revision 5. +Adding default.htm + +Committed revision 6. +Adding Documentation.shtml + +Committed revision 7. +Adding Download.shtml + +Committed revision 8. +Adding GT.shtml + +Committed revision 9. +Adding index1.shtml + +Committed revision 10. +Adding index.shtml1 + +Committed revision 11. +Adding index.shtml.old + +Committed revision 12. +Adding Introduction.shtml + +Committed revision 13. +Adding News.htm + +Committed revision 14. +Adding News.shtml + +Committed revision 15. +Adding nnARM.prog + +Committed revision 16. +Adding (bin) + +Committed revision 17. +Adding (bin) + +Committed revision 18. +Adding (bin) + +Committed revision 19. +Adding (bin) + +Committed revision 20. +Adding People.htm + +Committed revision 21. +Adding People.shtml + +Committed revision 22. +Adding PR.shtml + +Committed revision 23. +Adding (bin) put.JPG + +Committed revision 24. +Adding (bin) + +Committed revision 25. +Adding (bin) + +Committed revision 26. +Adding (bin) + +Committed revision 27. +Adding (bin) + +Committed revision 28. +Adding (bin) + +Committed revision 29. +Adding (bin) + +Committed revision 30. +Adding (bin) + +Committed revision 31. +Adding (bin) + +Committed revision 32. +Adding (bin) + +Committed revision 33. +Adding (bin) + +Committed revision 34. +Adding (bin) + +Committed revision 35. +Adding (bin) + +Committed revision 36. +Adding (bin) tag3.bmp + +Committed revision 37. +Adding (bin) Testbench/setlinker.jpg +Adding Testbench/loadcon +Adding Testbench/loadcon/loadcon.shtml +Adding (bin) Testbench/loadcon/loadcon_SDT.jpg +Adding Testbench/loadcon/loadcon.txt +Adding (bin) Testbench/loadcon/loadcon.jpg +Adding (bin) Testbench/setlinker.JPG +Adding Testbench/ldrlabel +Adding Testbench/ldrlabel/ldrlabel.txt +Adding (bin) Testbench/ldrlabel/ldrlabel.jpg +Adding Testbench/ldrlabel/ldrlabel.shtml +Adding (bin) Testbench/ldrlabel/ldrlabel_SDT.jpg +Adding (bin) Testbench/add2proj.jpg +Adding (bin) Testbench/put.JPG +Adding (bin) Testbench/put.jpg +Adding Testbench/thumbsub +Adding Testbench/thumbsub/thumbsub.shtml +Adding (bin) Testbench/thumbsub/thumbsub_SDT.JPG +Adding Testbench/thumbsub/thumbsub.txt +Adding (bin) Testbench/thumbsub/thumbsub.JPG +Adding Testbench/block +Adding Testbench/block/block.shtml +Adding Testbench/block/block.txt +Adding (bin) Testbench/block/block.JPG +Adding Testbench/mul +Adding (bin) Testbench/mul/mul3.jpg +Adding Testbench/mul/mul.shtml +Adding Testbench/mul/mul.txt +Adding (bin) Testbench/mul/mul1.jpg +Adding (bin) Testbench/mul/mul2.jpg +Adding Testbench/add64 +Adding Testbench/add64/add64.txt +Adding (bin) Testbench/add64/add64.jpg +Adding Testbench/add64/add64.shtml +Adding (bin) Testbench/add64/add64_SDT.jpg +Adding Testbench/strcopy +Adding (bin) Testbench/strcopy/strcopy.jpg +Adding Testbench/strcopy/strcopy.shtml +Adding (bin) Testbench/strcopy/strcopy_SDT.jpg +Adding Testbench/Testbench.shtml +Adding Testbench/adrlabel +Adding (bin) Testbench/adrlabel/source.jpg +Adding (bin) Testbench/adrlabel/adrlable_SDT.jpg +Adding Testbench/adrlabel/adrlabel.txt +Adding (bin) Testbench/adrlabel/adrlable.jpg +Adding Testbench/adrlabel/adrlabel.shtml +Adding (bin) Testbench/thumbsub.JPG +Adding Testbench/mla +Adding Testbench/mla/mla.shtml +Adding (bin) Testbench/mla/mul3.jpg +Adding Testbench/mla/mla.txt +Adding (bin) Testbench/mla/mla1.jpg +Adding (bin) Testbench/mla/mla2.jpg +Adding (bin) Testbench/mla/mla3.jpg +Adding (bin) Testbench/mla/mul1.jpg +Adding (bin) Testbench/mla/mul2.jpg +Adding Testbench/mull +Adding Testbench/mull/mull.shtml +Adding (bin) Testbench/mull/mull_SDT.JPG +Adding Testbench/mull/mull.txt +Adding (bin) Testbench/mull/mull.JPG +Adding Testbench/jump +Adding Testbench/jump/jump.shtml +Adding (bin) Testbench/jump/jump_SDT.jpg +Adding Testbench/jump/adrlabel.txt +Adding Testbench/jump/jump.txt +Adding (bin) Testbench/jump/jump.jpg +Adding Testbench/armex +Adding Testbench/armex/armex.shtml +Adding (bin) Testbench/armex/armex_SDT.jpg +Adding Testbench/armex/armex_src.shtml +Adding Testbench/armex/Armex.txt +Adding (bin) Testbench/armex/armex.jpg +Adding (bin) Testbench/armex/armex2.jpg +Adding Testbench/ldm +Adding Testbench/ldm/ldm.shtml +Adding (bin) Testbench/ldm/ldm_SDT.JPG +Adding Testbench/ldm/ldm.txt +Adding (bin) Testbench/ldm/ldm.JPG +Adding Testbench/tblock +Adding Testbench/tblock/tblock.shtml +Adding (bin) Testbench/tblock/block.JPG +Adding Testbench/tblock/tblock.txt +Adding (bin) Testbench/tblock/tblock.JPG + +Committed revision 38. +Adding topFrame.htm + +Committed revision 39. +Adding (bin) wishlogo.jpg + +Committed revision 40. +/home/oc/cores +/home/oc/cores/nocem /home/oc/cores +/home/oc/cores +/home/oc/cores/noise_reduction /home/oc/cores +/home/oc/cores +/home/oc/cores/nonrestoringsquareroot /home/oc/cores +/home/oc/cores +/home/oc/cores/nova /home/oc/cores +/home/oc/cores +/home/oc/cores/npigrctrl /home/oc/cores +Adding (bin) demo.png + +Committed revision 2. +Adding (bin) mpmc4.rar + +Committed revision 3. +Adding npi_eng.vhd + +Committed revision 4. +/home/oc/cores +/home/oc/cores/oab1 /home/oc/cores +Adding index.htm + +Committed revision 1. +Adding (bin) title_logo.gif + +Committed revision 2. +Adding (bin) ver01.JPG + +Committed revision 3. +Adding (bin) ver02.jpg + +Committed revision 4. +/home/oc/cores +/home/oc/cores/oberon /home/oc/cores +/home/oc/cores +/home/oc/cores/ocmips /home/oc/cores +Adding (bin) fpga.gif + +Committed revision 1. +Adding (bin) opencores.gif + +Committed revision 2. +Adding (bin) sim.GIF + +Committed revision 3. +/home/oc/cores +/home/oc/cores/ocp_wb_wrapper /home/oc/cores +/home/oc/cores +/home/oc/cores/ocrp-1 /home/oc/cores +Adding (bin) block.gif + +Committed revision 1. +Adding index.shtml + +Committed revision 2. +Adding ocrp-1_bill_of_materials.txt + +Committed revision 3. +Adding (bin) ocrp-1_gerber.tar.gz + +Committed revision 4. +Adding (bin) ocrp1.jpg + +Committed revision 5. +Adding (bin) ocrp1ord.pdf + +Committed revision 6. +Adding (bin) ocrp-1_sch.pdf + +Committed revision 7. +Adding (bin) PCB1-72dpi.jpg + +Committed revision 8. +Adding (bin) PCB2-72dpi.jpg + +Committed revision 9. +Adding (bin) pic1.jpg + +Committed revision 10. +Adding (bin) pic2.jpg + +Committed revision 11. +Adding (bin) pic3.jpg + +Committed revision 12. +Adding (bin) pic4.jpg + +Committed revision 13. +Adding (bin) pic7.jpg + +Committed revision 14. +Adding xc95288xl_tq144.bsd + +Committed revision 15. +Adding xcv100_tq144.bsd + +Committed revision 16. +Adding xcv50_tq144.bsd + +Committed revision 17. +/home/oc/cores +/home/oc/cores/ofdm /home/oc/cores +/home/oc/cores +/home/oc/cores/ofdm-baseband-receiver /home/oc/cores +/home/oc/cores +/home/oc/cores/ofdm_modulator /home/oc/cores +/home/oc/cores +/home/oc/cores/oks8 /home/oc/cores +/home/oc/cores +/home/oc/cores/omega /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_i2c /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_isa /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_onewire /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_ps2_keyboard_controller /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_psram_controller /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_udp_transceiver /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_vga_char_display_nodac /home/oc/cores +/home/oc/cores +/home/oc/cores/opb_wb_wrapper /home/oc/cores +/home/oc/cores +/home/oc/cores/open_1394_intellectual_property /home/oc/cores +/home/oc/cores +/home/oc/cores/open8_urisc /home/oc/cores +/home/oc/cores +/home/oc/cores/openarm /home/oc/cores +/home/oc/cores +/home/oc/cores/opencores /home/oc/cores +Adding (bin) 27dec03_IrishTimes.pdf + +Committed revision 2. +Adding (bin) bottom.jpg + +Committed revision 3. +Adding (bin) dr_logo_b.gif + +Committed revision 4. +Adding (bin) logos/oc_logo_black.gif +Adding (bin) logos/ +Adding (bin) logos/oc_bnr1.gif +Adding (bin) logos/oc_logo_outlined.gif +Adding (bin) logos/oc_bnr2.gif +Adding (bin) logos/oc_logo.cdr +Adding (bin) logos/oc_bnr3.gif +Adding (bin) logos/oc_btn1.gif +Adding (bin) logos/eliud3.gif +Adding (bin) logos/oc_logo.pdf +Adding (bin) logos/oc_btn2.gif +Adding (bin) logos/oc_btn3.gif +Adding (bin) logos/joerg1.gif +Adding (bin) logos/joerg2.gif +Adding (bin) logos/scott1.jpg +Adding (bin) logos/joerg3.gif +Adding (bin) logos/phuzzy1.gif +Adding (bin) logos/joerg4.gif +Adding (bin) logos/phuzzy2.gif +Adding (bin) logos/paolo1.gif +Adding (bin) logos/joerg5.gif +Adding (bin) logos/paolo2.gif +Adding (bin) logos/lwei1.jpg +Adding logos/johansson +Adding (bin) logos/johansson/open_c_l.gif +Adding (bin) logos/johansson/open_c.gif +Adding (bin) logos/johansson/open_c_r.gif +Adding logos/johansson/open_c.shtml +Adding (bin) logos/johansson/blank.gif +Adding (bin) logos/johansson/open_c_ani.gif +Adding (bin) logos/jng1.gif +Adding (bin) logos/jng2.gif +Adding (bin) logos/jng3.gif +Adding (bin) logos/jng4.gif +Adding (bin) logos/jng5.gif +Adding (bin) logos/jng6.gif +Adding (bin) logos/otso1.gif +Adding (bin) logos/bobklein1.gif +Adding (bin) logos/bobklein2.gif +Adding (bin) logos/scott2.gif +Adding (bin) logos/oc_logo1.wmf +Adding (bin) logos/menezes1.gif +Adding (bin) logos/oc_logo2.wmf +Adding (bin) logos/oc_logo3.wmf +Adding logos/index.shtml +Adding (bin) logos/mlampret_01.jpg +Adding (bin) logos/azadnik.jpg +Adding (bin) logos/vogel1.gif +Adding (bin) logos/mlampret_02.jpg +Adding (bin) logos/clbutler1.gif +Adding (bin) logos/bach_01.gif +Adding (bin) logos/battenberg1.gif +Adding (bin) logos/clbutler2.gif +Adding (bin) logos/eliud1.jpg +Adding (bin) logos/bach_02.gif +Adding (bin) logos/eliud2.jpg +Adding (bin) logos/clbutler3.gif +Adding (bin) logos/clbutler4.gif +Adding (bin) logos/title_logo.gif +Adding (bin) logos/garcia_01.png +Adding logos/ +Adding (bin) logos/oc_logo_grey.gif + +Committed revision 5. +Adding (bin) mdl_logo.jpg + +Committed revision 6. +Adding (bin) ORSoC_logo.jpg + +Committed revision 7. +Adding press/press_release_9dec1999.shtml +Adding press/FG-RISCLIBRE383.doc.pdf +Adding press/drafts +Adding (bin) press/or1k_avtomatika.pdf +Adding press/pr_8jan2001.shtml +Adding (bin) press/pr_12aug2002.pdf +Adding press/pr_25feb2002.shtml + +Committed revision 8. +Adding (bin) regionalbreakdown.png + +Committed revision 9. +Adding (bin) siteranking.png + +Committed revision 10. +Adding (bin) sponsors/simwave.gif +Adding (bin) sponsors/Altera_img.jpg +Adding (bin) sponsors/synapticadlogo.gif +Adding (bin) sponsors/xesslogo.png +Adding (bin) sponsors/dr_logo_b.gif +Adding (bin) sponsors/veriloggerscreen1.gif +Adding (bin) sponsors/protellogo.gif +Adding (bin) sponsors/veriloggerscreen2.gif +Adding (bin) sponsors/b_board.gif +Adding (bin) sponsors/protel99screen1big.gif +Adding (bin) sponsors/nclaunch.gif +Adding (bin) sponsors/protel99screen2big.gif +Adding (bin) sponsors/FlexSemiLogo.gif +Adding (bin) sponsors/cadence_logo.gif +Adding (bin) sponsors/xsv300.gif +Adding (bin) sponsors/altera_logo.jpg +Adding (bin) sponsors/protel99screen1.gif +Adding (bin) sponsors/veriloggerscreen1big.gif +Adding (bin) sponsors/veriloggerscreen2big.gif +Adding (bin) sponsors/protel99screen2.gif + +Committed revision 11. +Adding (bin) thumb_dr_logo_b.gif + +Committed revision 12. +Adding (bin) Ultimodule_Logo_Blue.JPG + +Committed revision 13. +/home/oc/cores +/home/oc/cores/opencpu678085 /home/oc/cores +/home/oc/cores +/home/oc/cores/openfire /home/oc/cores +/home/oc/cores +/home/oc/cores/openfire2 /home/oc/cores +Adding (bin) + +Committed revision 2. +Adding targetselection.itb + +Committed revision 3. +/home/oc/cores +/home/oc/cores/openfire_core /home/oc/cores +/home/oc/cores +/home/oc/cores/openh263 /home/oc/cores +/home/oc/cores +/home/oc/cores/openriscdevboard /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +/home/oc/cores +/home/oc/cores/open_tcpip /home/oc/cores +/home/oc/cores +/home/oc/cores/opentech /home/oc/cores +Adding changes_1_4_0.txt + +Committed revision 1. +Adding changes_1_4_1.txt + +Committed revision 2. +Adding changes_1_5_0.txt + +Committed revision 3. +Adding changes_1_5_1.txt + +Committed revision 4. +Adding changes_1_6_0.txt + +Committed revision 5. +Adding changes_1_6_1.txt + +Committed revision 6. +Adding contents_1_4_0.txt + +Committed revision 7. +Adding contents_1_4_1.txt + +Committed revision 8. +Adding contents_1_5_0.txt + +Committed revision 9. +Adding contents_1_5_1.txt + +Committed revision 10. +Adding contents_1_6_0.txt + +Committed revision 11. +Adding contents_1_6_1.txt + +Committed revision 12. +Adding content.txt + +Committed revision 13. +Adding (bin) + +Committed revision 14. +Adding (bin) icon.gif + +Committed revision 15. +Adding (bin) icon.jpg + +Committed revision 16. +Adding (bin) icon.png + +Committed revision 17. +Adding (bin) logo_full.jpg + +Committed revision 18. +Adding (bin) OpenTech_Info.xls + +Committed revision 19. +Adding (bin) OpenTechnologies_small.gif + +Committed revision 20. +Adding (bin) + +Committed revision 21. +/home/oc/cores +/home/oc/cores/openverifla /home/oc/cores +Adding (bin) verifla_keyboard_protocol_verification_50procent.jpg + +Committed revision 2. +/home/oc/cores +/home/oc/cores/or1200gct /home/oc/cores +/home/oc/cores +/home/oc/cores/or1k-cf /home/oc/cores +/home/oc/cores +/home/oc/cores/or1k-new /home/oc/cores +/home/oc/cores +/home/oc/cores/ovcodec /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/pap /home/oc/cores +/home/oc/cores +/home/oc/cores/pavr /home/oc/cores +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +Adding (bin) + +Committed revision 6. +Adding (bin) + +Committed revision 7. +Adding todo.html + +Committed revision 8. +/home/oc/cores +/home/oc/cores/pci /home/oc/cores +Adding charact.shtml + +Committed revision 2. +Adding contacts.shtml + +Committed revision 3. +Adding current_stat.shtml + +Committed revision 4. +Adding documentation.shtml + +Committed revision 5. +Adding download.shtml + +Committed revision 6. +Adding index.shtml + +Committed revision 7. +Adding links.shtml + +Committed revision 8. +Adding (bin) PCI_HOST_architecture.jpg + +Committed revision 9. +Adding pci_parity.html + +Committed revision 10. +Adding pci_prototype.shtml + +Committed revision 11. +Adding PCIsim.shtml + +Committed revision 12. +Adding pci_snapshots.shtml + +Committed revision 13. +Adding (bin) PCI_VGA_conn.jpg + +Committed revision 14. +Adding (bin) PCI_VGA_cristal.jpg + +Committed revision 15. +Adding (bin) PCI_VGA_sch.gif + +Committed revision 16. +Adding (bin) PCI_VGA_sch.jpg + +Committed revision 17. +Adding (bin) PCI_VGA_test_brd.gif + +Committed revision 18. +Adding (bin) pcixwin.jpg + +Committed revision 19. +Adding (bin) Pic00022.jpg + +Committed revision 20. +Adding (bin) Pic00026.jpg + +Committed revision 21. +Adding (bin) Pic00027.jpg + +Committed revision 22. +Adding (bin) Pic00028.jpg + +Committed revision 23. +Adding (bin) Pic00037.jpg + +Committed revision 24. +Adding (bin) pics/Pic00026.jpg +Adding (bin) pics/Pic00027.jpg +Adding (bin) pics/Pic00028.jpg +Adding (bin) pics/Pic00037.jpg +Adding (bin) pics/Pic00022.jpg + +Committed revision 25. +Adding references.shtml + +Committed revision 26. +Adding test_app.shtml + +Committed revision 27. +Adding testbench.shtml + +Committed revision 28. +Adding test_board.shtml + +Committed revision 29. +Adding test_driver.shtml + +Committed revision 30. +Adding test_snapshots.shtml + +Committed revision 31. +Adding (bin) thumb_pcixwin.jpg + +Committed revision 32. +Adding (bin) thumb_Pic00022.jpg + +Committed revision 33. +Adding (bin) thumb_Pic00026.jpg + +Committed revision 34. +Adding (bin) thumb_Pic00027.jpg + +Committed revision 35. +Adding (bin) thumb_Pic00028.jpg + +Committed revision 36. +Adding (bin) thumb_Pic00037.jpg + +Committed revision 37. +Adding todo_list.shtml + +Committed revision 38. +/home/oc/cores +/home/oc/cores/pci32tlite_oc /home/oc/cores +/home/oc/cores +/home/oc/cores/pci-board /home/oc/cores +Adding (bin) PCI-Board.jpeg + +Committed revision 1. +Adding (bin) PCI-Board.jpg + +Committed revision 2. +Adding PCI-CARD-SCH-v1.0.pdf + +Committed revision 3. +Adding PCI-Card-v1.0.pdf + +Committed revision 4. +/home/oc/cores +/home/oc/cores/pci_controller /home/oc/cores +/home/oc/cores +/home/oc/cores/pcie_vera_tb /home/oc/cores +/home/oc/cores +/home/oc/cores/pci_express /home/oc/cores +/home/oc/cores +/home/oc/cores/pci_express_crc /home/oc/cores +/home/oc/cores +/home/oc/cores/pci_ide_controller /home/oc/cores +/home/oc/cores +/home/oc/cores/pci_mini /home/oc/cores +Adding (bin) PCI_Mini_IP_core_Datasheet2.0_oc.pdf + +Committed revision 1. +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/pcix /home/oc/cores +/home/oc/cores +/home/oc/cores/pcmcia /home/oc/cores +/home/oc/cores +/home/oc/cores/performance_counter /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/perlilog /home/oc/cores +Adding index.shtml + +Committed revision 1. +Adding old-index.shtml + +Committed revision 2. +Adding (bin) Perlilog-0.2.tar.gz + +Committed revision 3. +Adding (bin) Perlilog-0.3.tar.gz + +Committed revision 4. +Adding perlilog-guide-0.2.pdf + +Committed revision 5. +Adding perlilog-guide-0.3.pdf + +Committed revision 6. +Adding perlilog-guide.pdf + +Committed revision 7. +Adding (bin) perlilog.tar.gz + +Committed revision 8. +Adding (bin) + +Committed revision 9. +/home/oc/cores +/home/oc/cores/phoenix_controller /home/oc/cores +/home/oc/cores +/home/oc/cores/pic8259 /home/oc/cores +/home/oc/cores +/home/oc/cores/picoblaze_interrupt_controller /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/pif2wb /home/oc/cores +/home/oc/cores +/home/oc/cores/pipelined_aes /home/oc/cores +/home/oc/cores +/home/oc/cores/pipelined_dct /home/oc/cores +/home/oc/cores +/home/oc/cores/piranha /home/oc/cores +/home/oc/cores +/home/oc/cores/power_inverter /home/oc/cores +/home/oc/cores +/home/oc/cores/ppcnorthbridge /home/oc/cores +/home/oc/cores +/home/oc/cores/ppx16 /home/oc/cores +/home/oc/cores +/home/oc/cores/product_code_iterative_decoder /home/oc/cores +/home/oc/cores +/home/oc/cores/profibus_dp /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/programmabledct /home/oc/cores +/home/oc/cores +/home/oc/cores/project /home/oc/cores +Adding (bin) datapath.pdf + +Committed revision 1. +Adding (bin) Informations.doc + +Committed revision 2. +Adding (bin) memories_core_jenerator_implementations.rar + +Committed revision 3. +Adding (bin) Readme-Instructions.doc + +Committed revision 4. +Adding (bin) RegFile_SystemC_implementation.rar + +Committed revision 5. +Adding (bin) systemC_Implementation.rar + +Committed revision 6. +Adding (bin) Xilinx_project_from_files_from_SystemC_implementation.rar + +Committed revision 7. +/home/oc/cores +/home/oc/cores/ps2 /home/oc/cores +Adding documentation.shtml + +Committed revision 2. +Adding download.shtml + +Committed revision 3. +Adding index.shtml + +Committed revision 4. +Adding people.shtml + +Committed revision 5. +/home/oc/cores +/home/oc/cores/ps2core /home/oc/cores +/home/oc/cores +/home/oc/cores/ptc /home/oc/cores +Adding index.shtml + +Committed revision 2. +Adding ptc_spec.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/pyramid_unit /home/oc/cores +/home/oc/cores +/home/oc/cores/quadraturecount /home/oc/cores +/home/oc/cores +/home/oc/cores/r2000 /home/oc/cores +/home/oc/cores +/home/oc/cores/radixrsa /home/oc/cores +Adding core.shtml + +Committed revision 1. +Adding doc.shtml + +Committed revision 2. +Adding (bin) dotty.gif + +Committed revision 3. +Adding index.shtml + +Committed revision 4. +Adding (bin) montgo.jpg + +Committed revision 5. +Adding (bin) RSAAlgorithm.pdf + +Committed revision 6. +Adding (bin) title_logo.gif + +Committed revision 7. +/home/oc/cores +/home/oc/cores/raggedstone /home/oc/cores +/home/oc/cores +/home/oc/cores/rc5-72 /home/oc/cores +/home/oc/cores +/home/oc/cores/rc5_decoder /home/oc/cores +/home/oc/cores +/home/oc/cores/rfid /home/oc/cores +Adding 7Prog.pdf + +Committed revision 1. +Adding (bin) TheMultiTagTesterFinal.exe + +Committed revision 2. +/home/oc/cores +/home/oc/cores/rijndael /home/oc/cores +Adding (bin) dekrip_files/image018.gif +Adding (bin) dekrip_files/image001.wmz +Adding (bin) dekrip_files/image003.wmz +Adding (bin) dekrip_files/image011.emz +Adding (bin) dekrip_files/image013.emz +Adding (bin) dekrip_files/image005.emz +Adding (bin) dekrip_files/image015.emz +Adding (bin) dekrip_files/image007.emz +Adding (bin) dekrip_files/image017.emz +Adding (bin) dekrip_files/image009.emz +Adding (bin) dekrip_files/image019.emz +Adding (bin) dekrip_files/oledata.mso +Adding (bin) dekrip_files/image010.gif +Adding (bin) dekrip_files/image020.gif +Adding (bin) dekrip_files/image002.gif +Adding (bin) dekrip_files/image012.gif +Adding (bin) dekrip_files/image021.gif +Adding (bin) dekrip_files/image004.gif +Adding dekrip_files/filelist.xml +Adding (bin) dekrip_files/image014.gif +Adding (bin) dekrip_files/image006.gif +Adding (bin) dekrip_files/image008.gif + +Committed revision 1. +Adding dekrip.htm + +Committed revision 2. +Adding (bin) enkrip_files/image010.wmz +Adding (bin) enkrip_files/image009.gif +Adding (bin) enkrip_files/image019.gif +Adding (bin) enkrip_files/image012.wmz +Adding (bin) enkrip_files/image014.wmz +Adding (bin) enkrip_files/image006.wmz +Adding (bin) enkrip_files/image016.wmz +Adding (bin) enkrip_files/image008.wmz +Adding (bin) enkrip_files/image018.wmz +Adding (bin) enkrip_files/ +Adding (bin) enkrip_files/oledata.mso +Adding (bin) enkrip_files/image001.gif +Adding (bin) enkrip_files/image002.gif +Adding (bin) enkrip_files/image011.gif +Adding (bin) enkrip_files/image003.gif +Adding (bin) enkrip_files/image013.gif +Adding (bin) enkrip_files/image004.gif +Adding enkrip_files/filelist.xml +Adding (bin) enkrip_files/image005.gif +Adding (bin) enkrip_files/image015.gif +Adding (bin) enkrip_files/image007.gif +Adding (bin) enkrip_files/image017.gif + +Committed revision 3. +Adding enkrip.htm + +Committed revision 4. +Adding enkrip.pdf + +Committed revision 5. +/home/oc/cores +/home/oc/cores/risc16f84 /home/oc/cores +Adding risc16f84_lite.v + +Committed revision 2. +Adding risc16f84_small.v + +Committed revision 3. +Adding risc16f84.v + +Committed revision 4. +/home/oc/cores +/home/oc/cores/risc36 /home/oc/cores +/home/oc/cores +/home/oc/cores/risc5x /home/oc/cores +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +/home/oc/cores +/home/oc/cores/risc_core_i /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) RISCCore.pdf + +Committed revision 2. +Adding (bin) vhdl + +Committed revision 3. +Adding (bin) Zusammenfassung.pdf + +Committed revision 4. +/home/oc/cores +/home/oc/cores/riscmcu /home/oc/cores +/home/oc/cores +/home/oc/cores/risc_processor_with_os /home/oc/cores +/home/oc/cores +/home/oc/cores/rise /home/oc/cores +/home/oc/cores +/home/oc/cores/rng_lib /home/oc/cores +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/robot_control_library /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +/home/oc/cores +/home/oc/cores/rosetta /home/oc/cores +/home/oc/cores +/home/oc/cores/rs232_syscon /home/oc/cores +Adding (bin) + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding documentation.shtml + +Committed revision 5. +Adding download.shtml + +Committed revision 6. +Adding (bin) Image4.gif + +Committed revision 7. +Adding index.shtml + +Committed revision 8. +Adding people.shtml + +Committed revision 9. +Adding (bin) + +Committed revision 10. +Adding (bin) + +Committed revision 11. +Adding (bin) rs232_syscon1.doc + +Committed revision 12. +Adding (bin) + +Committed revision 13. +Adding rs232_syscon.htm + +Committed revision 14. +Adding rs232_syscon.pdf + +Committed revision 15. +Adding (bin) + +Committed revision 16. +Adding (bin) + +Committed revision 17. +Adding (bin) + +Committed revision 18. +Adding + +Committed revision 19. +/home/oc/cores +/home/oc/cores/rs_5_3_gf256 /home/oc/cores +Adding (bin) ReedSolomon(5,3)Codec.ppt + +Committed revision 2. +/home/oc/cores +/home/oc/cores/rsa /home/oc/cores +Adding index.shtml + +Committed revision 2. +Adding rsa + +Committed revision 3. +Adding RSA.htm + +Committed revision 4. +Adding RSA.shtml + +Committed revision 5. +/home/oc/cores +/home/oc/cores/rs_decoder_31_19_6 /home/oc/cores +/home/oc/cores +/home/oc/cores/rsencoder /home/oc/cores +Adding readme.txt + +Committed revision 1. +Adding reed_solomon.v + +Committed revision 2. +Adding rs_testbench.v + +Committed revision 3. +/home/oc/cores +/home/oc/cores/s1_core /home/oc/cores +/home/oc/cores +/home/oc/cores/sardmips /home/oc/cores +/home/oc/cores +/home/oc/cores/sasc /home/oc/cores +/home/oc/cores +/home/oc/cores/sata1a /home/oc/cores +/home/oc/cores +/home/oc/cores/sayeh_processor /home/oc/cores +/home/oc/cores +/home/oc/cores/sbd_sqrt_fp /home/oc/cores +/home/oc/cores +/home/oc/cores/sc2v /home/oc/cores +/home/oc/cores +/home/oc/cores/scarm /home/oc/cores +Adding (bin) arm1.JPG + +Committed revision 1. +Adding chinese/sysmec.htm +Adding chinese/systemc.htm + +Committed revision 2. +Adding english/scarm.htm + +Committed revision 3. +Adding (bin) images/Welco.gif + +Committed revision 4. +Adding index.shtml + +Committed revision 5. +Adding main.shtml + +Committed revision 6. +Adding (bin) + +Committed revision 7. + +Committed revision 8. +Adding (bin) + +Committed revision 9. +/home/oc/cores +/home/oc/cores/scsi_interface /home/oc/cores +/home/oc/cores +/home/oc/cores/sdram /home/oc/cores +Adding index.shtml + +Committed revision 2. +Adding index.shtml2 + +Committed revision 3. +Adding (bin) intefacing block diagram.gif + +Committed revision 4. +Adding (bin) interfacing_block_diagram.gif + +Committed revision 5. +Adding (bin) sdram_doc.pdf + +Committed revision 6. +Adding sdram.html + +Committed revision 7. +Adding (bin) sdram_ip_doc_preliminary.pdf + +Committed revision 8. +/home/oc/cores +/home/oc/cores/sdram_ctrl /home/oc/cores +/home/oc/cores +/home/oc/cores/sdr_sdram_ctrl /home/oc/cores +/home/oc/cores +/home/oc/cores/serial_div_uu /home/oc/cores +/home/oc/cores +/home/oc/cores/serpent_core /home/oc/cores +/home/oc/cores +/home/oc/cores/sfpga /home/oc/cores +Adding index.shtml + +Committed revision 1. +Adding (bin) + +Committed revision 2. +Adding (bin) OCRP-2_sch_preliminary.pdf + +Committed revision 3. +Adding (bin) sfpga_block.gif + +Committed revision 4. +/home/oc/cores +/home/oc/cores/sha1 /home/oc/cores +Adding sha1_readme_v01.txt + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/sha_core /home/oc/cores +/home/oc/cores +/home/oc/cores/simpcon /home/oc/cores +/home/oc/cores +/home/oc/cores/simplearm /home/oc/cores +/home/oc/cores +/home/oc/cores/simple-cpu /home/oc/cores +/home/oc/cores +/home/oc/cores/simple_fm_receiver /home/oc/cores +/home/oc/cores +/home/oc/cores/simple_gpio /home/oc/cores +/home/oc/cores +/home/oc/cores/simple_pic /home/oc/cores +/home/oc/cores +/home/oc/cores/simple_spi /home/oc/cores +/home/oc/cores +/home/oc/cores/simple_uart /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/single_clock_divider /home/oc/cores +/home/oc/cores +/home/oc/cores/single_port /home/oc/cores +Adding (bin) single_port.tar.gz + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/slave_vme_bridge /home/oc/cores +/home/oc/cores +/home/oc/cores/smallarm /home/oc/cores +/home/oc/cores +/home/oc/cores/smbus_if /home/oc/cores +Adding (bin) smbus_if.doc + +Committed revision 1. +/home/oc/cores +/home/oc/cores/socbuilder /home/oc/cores +/home/oc/cores +/home/oc/cores/soft_core_risc_microprocessor_design_enabling_the_port_of_an_os /home/oc/cores +/home/oc/cores +/home/oc/cores/sonet /home/oc/cores +Adding (bin) blockdia.doc + +Committed revision 1. +Adding (bin) overview.doc + +Committed revision 2. +/home/oc/cores +/home/oc/cores/spacewire /home/oc/cores +Adding (bin) Router.JPG + +Committed revision 2. +Adding (bin) SpWinterfacewithCODEC.JPG + +Committed revision 3. +/home/oc/cores +/home/oc/cores/spacewire_if /home/oc/cores +/home/oc/cores +/home/oc/cores/spates /home/oc/cores +/home/oc/cores +/home/oc/cores/spdif_interface /home/oc/cores +/home/oc/cores +/home/oc/cores/spi /home/oc/cores +/home/oc/cores +/home/oc/cores/spi_boot /home/oc/cores +/home/oc/cores +/home/oc/cores/spicc /home/oc/cores +/home/oc/cores +/home/oc/cores/spiflashcontroller /home/oc/cores +/home/oc/cores +/home/oc/cores/spimaster /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/spi_slave /home/oc/cores +/home/oc/cores +/home/oc/cores/spi-slave /home/oc/cores +/home/oc/cores +/home/oc/cores/srl_fifo /home/oc/cores +/home/oc/cores +/home/oc/cores/srtdivision /home/oc/cores +/home/oc/cores +/home/oc/cores/ss_pcm /home/oc/cores +/home/oc/cores +/home/oc/cores/ssram /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/steppermotordrive /home/oc/cores +/home/oc/cores +/home/oc/cores/sts1 /home/oc/cores +Adding spe.vhd + +Committed revision 1. +/home/oc/cores +/home/oc/cores/svmac /home/oc/cores +/home/oc/cores +/home/oc/cores/sxp /home/oc/cores +Adding (bin) sxp_block.gif + +Committed revision 2. +/home/oc/cores +/home/oc/cores/system05 /home/oc/cores +/home/oc/cores +/home/oc/cores/system09 /home/oc/cores +/home/oc/cores +/home/oc/cores/system11 /home/oc/cores +/home/oc/cores +/home/oc/cores/system68 /home/oc/cores +/home/oc/cores +/home/oc/cores/system6801 /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/systemcaes /home/oc/cores +/home/oc/cores +/home/oc/cores/systemc_cordic /home/oc/cores +/home/oc/cores +/home/oc/cores/systemcdes /home/oc/cores +/home/oc/cores +/home/oc/cores/systemcmd5 /home/oc/cores +/home/oc/cores +/home/oc/cores/systemc_rng /home/oc/cores +/home/oc/cores +/home/oc/cores/t400 /home/oc/cores +/home/oc/cores +/home/oc/cores/t48 /home/oc/cores +/home/oc/cores +/home/oc/cores/t51 /home/oc/cores +/home/oc/cores +/home/oc/cores/t65 /home/oc/cores +/home/oc/cores +/home/oc/cores/t80 /home/oc/cores +/home/oc/cores +/home/oc/cores/t8000 /home/oc/cores +/home/oc/cores +/home/oc/cores/tdm /home/oc/cores +Adding index.shtml + +Committed revision 2. +Adding (bin) tdm_core.jpg + +Committed revision 3. +Adding + +Committed revision 4. +Adding (bin) tdm_ISDN_top.jpg + +Committed revision 5. +Adding + +Committed revision 6. +Adding tdm_project.html + +Committed revision 7. +Adding (bin) tdm_project.pdf + +Committed revision 8. +Adding + +Committed revision 9. +Adding (bin) tdm_top.jpg + +Committed revision 10. +Adding + +Committed revision 11. +Adding + +Committed revision 12. +/home/oc/cores +/home/oc/cores/tdm_switch /home/oc/cores +Adding map.dat + +Committed revision 1. +Adding (bin) ModelSim_Edition.exe + +Committed revision 2. +Adding stream_0.dat + +Committed revision 3. +Adding stream_1.dat + +Committed revision 4. +Adding stream_2.dat + +Committed revision 5. +Adding stream_3.dat + +Committed revision 6. +Adding stream_4.dat + +Committed revision 7. +Adding stream_5.dat + +Committed revision 8. +Adding stream_6.dat + +Committed revision 9. +Adding stream_7.dat + +Committed revision 10. +Adding tdm_switch_b.v + +Committed revision 11. +Adding (bin) TDM_Switch_DS.pdf + +Committed revision 12. +Adding tdm_switch_top_timesim.sdf + +Committed revision 13. +Adding tdm_switch_top_timesim.v + +Committed revision 14. +Adding tdm_switch_top.v + +Committed revision 15. +Adding testbench_top.v + +Committed revision 16. +/home/oc/cores +/home/oc/cores/template /home/oc/cores +/home/oc/cores +/home/oc/cores/test /home/oc/cores +Adding (bin) apple.gif + +Committed revision 2. +Adding (bin) FLEX_w_CMYK_R_LG.jpg + +Committed revision 3. +Adding include1.ssi + +Committed revision 4. +Adding include2.ssi + +Committed revision 5. +/home/oc/cores +/home/oc/cores/test1 /home/oc/cores +/home/oc/cores +/home/oc/cores/test2 /home/oc/cores +/home/oc/cores +/home/oc/cores/test3 /home/oc/cores +/home/oc/cores +/home/oc/cores/test_project /home/oc/cores +/home/oc/cores +/home/oc/cores/test-project /home/oc/cores +/home/oc/cores +/home/oc/cores/tg68 /home/oc/cores +/home/oc/cores +/home/oc/cores/tiny64 /home/oc/cores +/home/oc/cores +/home/oc/cores/tiny8 /home/oc/cores +/home/oc/cores +/home/oc/cores/tlc2 /home/oc/cores +/home/oc/cores +/home/oc/cores/toe /home/oc/cores +/home/oc/cores +/home/oc/cores/tone_generator /home/oc/cores +/home/oc/cores +/home/oc/cores/totalcpu /home/oc/cores +/home/oc/cores +/home/oc/cores/trinitor /home/oc/cores +/home/oc/cores +/home/oc/cores/truescalar /home/oc/cores +/home/oc/cores +/home/oc/cores/ts7300_opencore /home/oc/cores +Adding (bin) 7300stclwp.jpg + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/turbocodes /home/oc/cores +Adding (bin) turbo.tar.gz + +Committed revision 1. +/home/oc/cores +/home/oc/cores/tv80 /home/oc/cores +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/twofish /home/oc/cores +/home/oc/cores +/home/oc/cores/twofish_team /home/oc/cores +Adding (bin) ciphertext.jpg + +Committed revision 1. +Adding (bin) cleartext.jpg + +Committed revision 2. +Adding (bin) key-mod.jpg + +Committed revision 3. +Adding (bin) modifiedF.jpg + +Committed revision 4. +Adding peracangan + +Committed revision 5. +Adding (bin) qper.jpg + +Committed revision 6. +Adding (bin) s-boxes.jpg + +Committed revision 7. +Adding (bin) twofish.jpg + +Committed revision 8. +Adding (bin) + +Committed revision 9. +/home/oc/cores +/home/oc/cores/ualpha /home/oc/cores +/home/oc/cores +/home/oc/cores/uart16550 /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/uart8bit /home/oc/cores +/home/oc/cores +/home/oc/cores/uart_fifo /home/oc/cores +/home/oc/cores +/home/oc/cores/uart_serial /home/oc/cores +/home/oc/cores +/home/oc/cores/ucore /home/oc/cores +Adding (bin) ucsys-0.0.1.rar + +Committed revision 1. +/home/oc/cores +/home/oc/cores/ultimate_crc /home/oc/cores +Adding (bin) + +Committed revision 2. +/home/oc/cores +/home/oc/cores/ultramegasquirt /home/oc/cores +/home/oc/cores +/home/oc/cores/ultravec /home/oc/cores +/home/oc/cores +/home/oc/cores/upcable /home/oc/cores +Adding (bin) + +Committed revision 1. +Adding OneDollarDongle.pdf + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/usb11 /home/oc/cores +/home/oc/cores +/home/oc/cores/usb1_funct /home/oc/cores +/home/oc/cores +/home/oc/cores/usb_dongle_fpga /home/oc/cores +Adding (bin) block_diagram.png + +Committed revision 2. +Adding (bin) dongle_block.png + +Committed revision 3. +Adding (bin) mini_LR_DSC_0016.jpg + +Committed revision 4. +Adding (bin) small_LR_DSC_0016.jpg + +Committed revision 5. +Adding (bin) usb_dongle.jpg + +Committed revision 6. +/home/oc/cores +/home/oc/cores/usbhost /home/oc/cores +/home/oc/cores +/home/oc/cores/usbhostslave /home/oc/cores +Adding (bin) ALDEC_logo.jpg + +Committed revision 2. +Adding (bin) + +Committed revision 3. +Adding (bin) + +Committed revision 4. +Adding (bin) + +Committed revision 5. +Adding (bin) + +Committed revision 6. +/home/oc/cores +/home/oc/cores/usb_phy /home/oc/cores +/home/oc/cores +/home/oc/cores/usucc /home/oc/cores +/home/oc/cores +/home/oc/cores/utop_lvl_1 /home/oc/cores +/home/oc/cores +/home/oc/cores/verilator /home/oc/cores +/home/oc/cores +/home/oc/cores/vgafb /home/oc/cores +/home/oc/cores +/home/oc/cores/vga_lcd /home/oc/cores +Adding (bin) block_diagram.gif + +Committed revision 2. +Adding (bin) block_diagram.jpg + +Committed revision 3. +Adding index.shtml + +Committed revision 4. +Adding vga_core.pdf + +Committed revision 5. +/home/oc/cores +/home/oc/cores/vhcg /home/oc/cores +Adding (bin) morpheus1.1release.rar + +Committed revision 1. +Adding (bin) morpheus.tar.gz + +Committed revision 2. +Adding (bin) Specification.pdf + +Committed revision 3. +/home/oc/cores +/home/oc/cores/vhdl_cpu_emulator /home/oc/cores +Adding (bin) vhdl_cpu_emulator_Beta.7z + +Committed revision 2. +/home/oc/cores +/home/oc/cores/vhdlmd5 /home/oc/cores +/home/oc/cores +/home/oc/cores/vhld_tb /home/oc/cores +/home/oc/cores +/home/oc/cores/video_starter_kit /home/oc/cores +Adding (bin) main_designoverview0.0.2.pdf + +Committed revision 1. +/home/oc/cores +/home/oc/cores/vip_regs /home/oc/cores +/home/oc/cores +/home/oc/cores/viterbi_decoder /home/oc/cores +/home/oc/cores +/home/oc/cores/viterbi_decoder_k_7_r_1_2 /home/oc/cores +/home/oc/cores +/home/oc/cores/vmebus /home/oc/cores +/home/oc/cores +/home/oc/cores/vmm /home/oc/cores +/home/oc/cores +/home/oc/cores/warp /home/oc/cores +/home/oc/cores +/home/oc/cores/wb2hpi /home/oc/cores +Adding (bin) BlockTransfer1.jpg + +Committed revision 2. +Adding (bin) BlockTransfer2.jpg + +Committed revision 3. +Adding (bin) DspFill1.jpg + +Committed revision 4. +Adding (bin) DspMemory1.jpg + +Committed revision 5. +Adding (bin) DspMemory2.jpg + +Committed revision 6. +Adding (bin) DSPMove1.jpg + +Committed revision 7. +Adding (bin) Registers.jpg + +Committed revision 8. +Adding (bin) SistemMemoryFill1.jpg + +Committed revision 9. +Adding (bin) SistemMemoryMove1.jpg + +Committed revision 10. +Adding (bin) SystemMemory1.jpg + +Committed revision 11. +Adding (bin) TestBench051.jpg + +Committed revision 12. +Adding (bin) wb2hpi_hw2.jpg + +Committed revision 13. +/home/oc/cores +/home/oc/cores/wb2npi /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_builder /home/oc/cores +Adding (bin) users_manual.pdf + +Committed revision 2. +/home/oc/cores +/home/oc/cores/wb_conbus /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_conmax /home/oc/cores +Adding (bin) conmax.jpg + +Committed revision 2. +Adding index.shtml + +Committed revision 3. +/home/oc/cores +/home/oc/cores/wbc_parallel_master /home/oc/cores +Adding (bin) wbc_parallel_master-spec_doc-r01.pdf + +Committed revision 2. +/home/oc/cores +/home/oc/cores/wb_ddr /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_dma /home/oc/cores +Adding index.shtml + +Committed revision 2. +/home/oc/cores +/home/oc/cores/wb_flash /home/oc/cores +/home/oc/cores +/home/oc/cores/wbif_68k /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_lpc /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_mcs51 /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_rtc /home/oc/cores +Adding (bin) ports.jpg + +Committed revision 1. +Adding (bin) structure.jpg + +Committed revision 2. +Adding (bin) + +Committed revision 3. +/home/oc/cores +/home/oc/cores/wb_tk /home/oc/cores +Adding index.shtml + +Committed revision 2. +Adding wb_arbiter.shtml + +Committed revision 3. +Adding wb_async_master.shtml + +Committed revision 4. +Adding wb_async_slave.shtml + +Committed revision 5. +Adding wb_bus_resizer.shtml + +Committed revision 6. +Adding wb_extensions.shtml + +Committed revision 7. +Adding wb_out_reg.shtml + +Committed revision 8. +Adding wb_ram.shtml + +Committed revision 9. +Adding wb_test.shtml + +Committed revision 10. +/home/oc/cores +/home/oc/cores/wb_vga /home/oc/cores +Adding accel.shtml + +Committed revision 2. +Adding index.shtml + +Committed revision 3. +Adding mouse.shtml + +Committed revision 4. +Adding palette.shtml + +Committed revision 5. +Adding vga_chip.shtml + +Committed revision 6. +Adding vga_core.shtml + +Committed revision 7. +Adding vga_core_v2.shtml + +Committed revision 8. +/home/oc/cores +/home/oc/cores/wb_z80 /home/oc/cores +/home/oc/cores +/home/oc/cores/wb_zbt /home/oc/cores +/home/oc/cores +/home/oc/cores/wisbone_2_ahb /home/oc/cores +/home/oc/cores +/home/oc/cores/wishbone /home/oc/cores +Adding appnote_01.pdf + +Committed revision 1. +Adding flex.pdf + +Committed revision 2. +Adding (bin) press_release_12_08_2002.pdf + +Committed revision 3. +Adding soc_bus_comparison.pdf + +Committed revision 4. +Adding wbspec_b1.pdf + +Committed revision 5. +Adding wbspec_b2.pdf + +Committed revision 6. +Adding wbspec_b3.pdf + +Committed revision 7. +/home/oc/cores +/home/oc/cores/wishbone2ahb /home/oc/cores +/home/oc/cores +/home/oc/cores/wishbone_bfm /home/oc/cores +/home/oc/cores +/home/oc/cores/wishbone_checker /home/oc/cores +/home/oc/cores +/home/oc/cores/wishbone_out_port /home/oc/cores +/home/oc/cores +/home/oc/cores/wishbone_to_ahb /home/oc/cores +/home/oc/cores +/home/oc/cores/wlanmac /home/oc/cores +/home/oc/cores +/home/oc/cores/wlan_modem /home/oc/cores +/home/oc/cores +/home/oc/cores/wpf /home/oc/cores +/home/oc/cores +/home/oc/cores/x25_protocol_interface_project /home/oc/cores +/home/oc/cores +/home/oc/cores/x86soc /home/oc/cores +/home/oc/cores +/home/oc/cores/xge_mac /home/oc/cores +/home/oc/cores +/home/oc/cores/xmatchpro /home/oc/cores +Adding (bin) + +Committed revision 1. +/home/oc/cores +/home/oc/cores/xtea /home/oc/cores +/home/oc/cores +/home/oc/cores/yacc /home/oc/cores +/home/oc/cores +/home/oc/cores/yellowstar /home/oc/cores +Adding appendix.pdf + +Committed revision 1. +Adding processor.v + +Committed revision 2. +Adding report.pdf + +Committed revision 3. +Adding (bin) yellowstar_schematics.tar.gz + +Committed revision 4. +Adding (bin) yellowstar_symbols.tar.gz + +Committed revision 5. +Adding (bin) yellow_star.tar.gz + +Committed revision 6. +Adding (bin) ys_logo.jpg + +Committed revision 7. +/home/oc/cores +/home/oc/cores/yoda /home/oc/cores +/home/oc/cores +/home/oc/cores/z80soc /home/oc/cores +Adding (bin) mP5170003.JPG + +Committed revision 2. +Adding (bin) mP5180007.JPG + +Committed revision 3. +Adding (bin) thumb_mP5170003.JPG + +Committed revision 4. +Adding (bin) thumb_mP5180007.JPG + +Committed revision 5. +/home/oc/cores +/home/oc/cores/zpu /home/oc/cores +Adding (bin) compile.PNG + +Committed revision 2. +Adding (bin) simulator2.PNG + +Committed revision 3. +Adding (bin) simulator3.PNG + +Committed revision 4. +Adding (bin) simulator.PNG + +Committed revision 5. +Adding (bin) thumb_compile.PNG + +Committed revision 6. +Adding (bin) thumb_simulator2.PNG + +Committed revision 7. +Adding (bin) thumb_simulator3.PNG + +Committed revision 8. +Adding (bin) thumb_simulator.PNG + +Committed revision 9. +/home/oc/cores +All checkins done Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (nonexistent) +++ hdlc/web_uploads/ (revision 18) @@ -0,0 +1,225 @@ +#!/bin/bash +# AUTOMATICALLY GENERATED SCRIPT +# Scans the cores directory, excludes the projects and subdirectories +# listed below, and generates a script which checks in all of the +# remaining files to the SVN repository +# This should be run and the output piped to a new file something like: +# ./ > +# and then probably the execute permission enabled on +8b10b_encdec +acxbrd +adder +ae68 +aes_128_192_256 +aes_fekete256 +all_digital_fm_receiver +alternascope +aquarius +aspida +ata +auto_baud +a_vhd_16550_uart +a_vhdl_can_controller +avr_core +baudgen +binary_to_bcd +biquad +bluespec-h264 +bluetooth +board +camellia +can +cereon +cf_cordic +cf_fft +cf_fir +cf_fp_mul +cf_interleaver +cf_ldpc +cf_rca +cf_ssp +const_encoder +cordic +cpugen +cryptosorter +dct +ddr_sdr +decoder +des +dfp +diogenes +dram +dualspartainc6713cpci +dwt2d +e123mux +e1framerdeframer +embedded_risc +epp +erp +ethernet_tri_mode +eus100lx +eusfs +fac2222m +fast-crc +fbas_encoder +fcpu +ffr16 +fht +fifouart +filter +firewire +fir_filter_generator +floating_point_adder_subtractor +fpga +fpgaconfig +fpu +fpu100 +freetools +gamepads +gh_vhdl_library +gpio +graphicallcd +graphiti +gsc +gup +hamming_gen +hdlc +help +i2c +i2clog +i2c_slave +i2s +i2s_interface +ic6821 +idea +iiepci +interface_vga80x40 +irda +iso7816-3 +jpeg +jpegcompression +jtag +keypad_scanner +l8051 +lcd +lcd_controller +ldpc_decoder_802_3an +ldpc_encoder_802_3an +lem1_9min +lowpowerfir +lpu +lwrisc +man2uart +manchesterencoderdecoder +maxii-evalboard +mb-jpeg +mcpu +mdct +mem_ctrl +memory_cores +memory_sizer +mfpga +minimips +minirisc +mips789 +mipss +most +mpdma +ncore +neptune-core +nnARM +npigrctrl +oab1 +ocmips +ocrp-1 +opencores +openfire2 +openh263 +openriscdevboard +opentech +openverifla +or1k-new +ovcodec +pavr +pci +pci-board +pci_controller +pci_mini +performance_counter +perlilog +picoblaze_interrupt_controller +piranha +profibus_dp +project +ps2 +ptc +radixrsa +raggedstone +rfid +rijndael +risc16f84 +risc5x +risc_core_i +riscmcu +rng_lib +robot_control_library +rs232_syscon +rs_5_3_gf256 +rsa +rsencoder +scarm +sdram +serial_div_uu +sfpga +sha1 +simple_uart +single_port +smbus_if +sonet +spacewire +spimaster +spi-slave +ssram +sts1 +sxp +system09 +system11 +system68 +system6801 +tdm +tdm_switch +template +test +test1 +test2 +test-project +ts7300_opencore +turbocodes +tv80 +twofish_team +uart16550 +ucore +ultimate_crc +upcable +usb_dongle_fpga +usbhost +usbhostslave +usucc +vga_lcd +vhcg +vhdl_cpu_emulator +video_starter_kit +wb2hpi +wb_builder +wb_conmax +wbc_parallel_master +wb_dma +wb_rtc +wb_tk +wb_vga +wishbone +xmatchpro +yellowstar +yoda +z80soc +zpu Index: hdlc/web_uploads/ =================================================================== --- hdlc/web_uploads/ (nonexistent) +++ hdlc/web_uploads/ (revision 18) @@ -0,0 +1,2994 @@ +#!/bin/bash +# AUTOMATICALLY GENERATED SCRIPT +# Scans the cores directory, excludes the projects and subdirectories +# listed below, and generates a script which checks in all of the +# remaining files to the SVN repository +# This should be run and the output piped to a new file something like: +# ./ > +# and then probably the execute permission enabled on +# Encapsulate the checkins inside this loop we can +# break out of in the event of a problem checking +# one of them in + +# Function to check the return value of each SVN checkin +function check_svn_return_value { if [ $? -gt 1 ]; then echo "Error during checkins - aborting script."; exit 1; fi +} +ALL_DONE="0" +while [ $ALL_DONE = 0 ]; do + pushd "100baset" + popd + pushd "1394ohci" + popd + pushd "2dcoprocessor" + popd + pushd "395_vgs" + popd + pushd "3des_vhdl" + popd + pushd "4bitprocesor" + popd + pushd "6502vhdl" + popd + pushd "68hc05" + popd + pushd "68hc08" + popd + pushd "8051_serial" + popd + pushd "8051_to_ahb_interface" + popd + pushd "8b10b_encdec" + svn import -m "Import from OC" "8b10b_encdec_v1d0.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "8b10_dec.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "8b10_enc.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "enc_8b10b_TB.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "encdec_8b10b_TB.vhd" "" + check_svn_return_value + popd + pushd "8bituartvhdl" + popd + pushd "aacencode" + popd + pushd "acxbrd" + svn import -m "Import from OC" "jopcore.pdf" "" + check_svn_return_value + popd + pushd "adaptivefilter" + popd + pushd "adaptive_lms_equalizer" + popd + pushd "adaptiveprocessor" + popd + pushd "adat_optical_feed_forward_receiver" + svn import -m "Import from OC" "ADAT_receiver.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "Adat_testbench.vhd" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_waves1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "thumb_waves2.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "waves1.jpg" "" + check_svn_return_value + svn import -m "Import from OC" "waves2.jpg" "" + check_svn_return_value + popd + pushd "adder" + svn import -m "Import from OC" "high-speed-adder-128bits-opencore.v" "" + check_svn_return_value + popd + pushd "ae18" + popd + pushd "aemb" + popd + pushd "aes" + popd + pushd "aes128" + popd + pushd "aes_128_192_256" + svn import -m "Import from OC" "aes_dec.vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "aes_enc.vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "aes_pkg.vhdl" "" + check_svn_return_value + svn import -m "Import from OC" "aes_top.pdf" "" + check_svn_return_value + svn import -m "Import from OC" "key_expansion.vhdl" "" + check_svn_return_value + popd + pushd "aes_core" + popd + pushd "aes_crypto_core" + popd + pushd "aes_fekete256" +